Merge pull request #193 from thxCode/windows_cni

Windows CNI support

.appveyor.yml

@@ -6,15 +6,16 @@ environment:
 install:
   - echo %PATH%
   - echo %GOPATH%
-  - set PATH=%GOPATH%\bin;c:\go\bin;%PATH%
   - go version
   - go env
+  - ps: $webClient = New-Object System.Net.WebClient; $InstallPath="c:" ; $webClient.DownloadFile("https://raw.githubusercontent.com/jhowardmsft/docker-tdmgcc/master/gcc.zip", "$InstallPath\gcc.zip"); Expand-Archive $InstallPath\gcc.zip -DestinationPath $InstallPath\gcc -Force; $webClient.DownloadFile("https://raw.githubusercontent.com/jhowardmsft/docker-tdmgcc/master/runtime.zip", "$InstallPath\runtime.zip"); Expand-Archive $InstallPath\runtime.zip -DestinationPath $InstallPath\gcc -Force; $webClient.DownloadFile("https://raw.githubusercontent.com/jhowardmsft/docker-tdmgcc/master/binutils.zip","$InstallPath\binutils.zip"); Expand-Archive $InstallPath\binutils.zip -DestinationPath $InstallPath\gcc -Force;
+  - set PATH=%GOPATH%\bin;c:\go\bin;c:\gcc\bin;%PATH%
 
 build: off
 
 test_script:
   - ps: |
-      go list ./... | Select-String -Pattern (Get-Content "./plugins/linux_only.txt") -NotMatch > "to_test.txt"
+      go list ./... | Select-String -Pattern (Get-Content "./plugins/windows_only.txt") > "to_test.txt"
       echo "Will test:"
       Get-Content "to_test.txt"
       foreach ($pkg in Get-Content "to_test.txt") {

.gitignore

@@ -26,5 +26,5 @@ _testmain.go
 bin/
 gopath/
 .vagrant
-
+.idea
 /release-*

.travis.yml

@@ -20,6 +20,7 @@ matrix:
   fast_finish: true
 
 install:
+  - sudo apt-get install gcc-multilib gcc-mingw-w64 -y
   - go get github.com/onsi/ginkgo/ginkgo
   - go get github.com/containernetworking/cni/cnitool
 

Godeps/Godeps.json

@@ -6,10 +6,79 @@
 		"./..."
 	],
 	"Deps": [
+		{
+			"ImportPath": "github.com/Microsoft/go-winio",
+			"Comment": "v0.4.11",
+			"Rev": "97e4973ce50b2ff5f09635a57e2b88a037aae829"
+		},
+		{
+			"ImportPath": "github.com/Microsoft/hcsshim",
+			"Comment": "v0.7.4",
+			"Rev": "e44e499d29527b244d6858772f1b9090eeaddc4e"
+		},
+		{
+			"ImportPath": "github.com/Microsoft/hcsshim/internal/guid",
+			"Comment": "v0.7.4",
+			"Rev": "e44e499d29527b244d6858772f1b9090eeaddc4e"
+		},
+		{
+			"ImportPath": "github.com/Microsoft/hcsshim/internal/hcs",
+			"Comment": "v0.7.4",
+			"Rev": "e44e499d29527b244d6858772f1b9090eeaddc4e"
+		},
+		{
+			"ImportPath": "github.com/Microsoft/hcsshim/internal/hcserror",
+			"Comment": "v0.7.4",
+			"Rev": "e44e499d29527b244d6858772f1b9090eeaddc4e"
+		},
+		{
+			"ImportPath": "github.com/Microsoft/hcsshim/internal/hns",
+			"Comment": "v0.7.4",
+			"Rev": "e44e499d29527b244d6858772f1b9090eeaddc4e"
+		},
+		{
+			"ImportPath": "github.com/Microsoft/hcsshim/internal/interop",
+			"Comment": "v0.7.4",
+			"Rev": "e44e499d29527b244d6858772f1b9090eeaddc4e"
+		},
+		{
+			"ImportPath": "github.com/Microsoft/hcsshim/internal/longpath",
+			"Comment": "v0.7.4",
+			"Rev": "e44e499d29527b244d6858772f1b9090eeaddc4e"
+		},
+		{
+			"ImportPath": "github.com/Microsoft/hcsshim/internal/mergemaps",
+			"Comment": "v0.7.4",
+			"Rev": "e44e499d29527b244d6858772f1b9090eeaddc4e"
+		},
+		{
+			"ImportPath": "github.com/Microsoft/hcsshim/internal/safefile",
+			"Comment": "v0.7.4",
+			"Rev": "e44e499d29527b244d6858772f1b9090eeaddc4e"
+		},
+		{
+			"ImportPath": "github.com/Microsoft/hcsshim/internal/schema1",
+			"Comment": "v0.7.4",
+			"Rev": "e44e499d29527b244d6858772f1b9090eeaddc4e"
+		},
+		{
+			"ImportPath": "github.com/Microsoft/hcsshim/internal/timeout",
+			"Comment": "v0.7.4",
+			"Rev": "e44e499d29527b244d6858772f1b9090eeaddc4e"
+		},
+		{
+			"ImportPath": "github.com/Microsoft/hcsshim/internal/wclayer",
+			"Comment": "v0.7.4",
+			"Rev": "e44e499d29527b244d6858772f1b9090eeaddc4e"
+		},
 		{
 			"ImportPath": "github.com/alexflint/go-filemutex",
 			"Rev": "72bdc8eae2aef913234599b837f5dda445ca9bd9"
 		},
+		{
+			"ImportPath": "github.com/buger/jsonparser",
+			"Rev": "f4dd9f5a6b441265aefc1d44872a6f8c10f42b37"
+		},
 		{
 			"ImportPath": "github.com/containernetworking/cni/libcni",
 			"Comment": "v0.7.0-alpha1",
@@ -67,10 +136,22 @@
 			"ImportPath": "github.com/d2g/dhcp4server",
 			"Rev": "1b74244053681c90de5cf1af3d6b5c93b74e3abb"
 		},
+		{
+			"ImportPath": "github.com/d2g/dhcp4server/leasepool",
+			"Rev": "1b74244053681c90de5cf1af3d6b5c93b74e3abb"
+		},
+		{
+			"ImportPath": "github.com/d2g/dhcp4server/leasepool/memorypool",
+			"Rev": "1b74244053681c90de5cf1af3d6b5c93b74e3abb"
+		},
 		{
 			"ImportPath": "github.com/j-keck/arping",
 			"Rev": "2cf9dc699c5640a7e2c81403a44127bf28033600"
 		},
+		{
+			"ImportPath": "github.com/juju/errors",
+			"Rev": "22422dad46e14561a0854ad42497a75af9b61909"
+		},
 		{
 			"ImportPath": "github.com/mattn/go-shellwords",
 			"Comment": "v1.0.3",
@@ -230,6 +311,11 @@
 			"ImportPath": "github.com/safchain/ethtool",
 			"Rev": "7ff1ba29eca231991280817541cb3903f6be15d1"
 		},
+		{
+			"ImportPath": "github.com/sirupsen/logrus",
+			"Comment": "v1.0.6",
+			"Rev": "3e01752db0189b9157070a0e1668a620f9a85da2"
+		},
 		{
 			"ImportPath": "github.com/vishvananda/netlink",
 			"Rev": "6e453822d85ef5721799774b654d4d02fed62afb"
@@ -242,6 +328,10 @@
 			"ImportPath": "github.com/vishvananda/netns",
 			"Rev": "54f0e4339ce73702a0607f49922aaa1e749b418d"
 		},
+		{
+			"ImportPath": "golang.org/x/crypto/ssh/terminal",
+			"Rev": "94eea52f7b742c7cbe0b03b22f0c4c8631ece122"
+		},
 		{
 			"ImportPath": "golang.org/x/net/bpf",
 			"Rev": "e90d6d0afc4c315a0d87a568ae68577cc15149a0"
@@ -256,7 +346,11 @@
 		},
 		{
 			"ImportPath": "golang.org/x/sys/unix",
-			"Rev": "076b546753157f758b316e59bcb51e6807c04057"
+			"Rev": "d5840adf789d732bc8b00f37b26ca956a7cc8e79"
+		},
+		{
+			"ImportPath": "golang.org/x/sys/windows",
+			"Rev": "d5840adf789d732bc8b00f37b26ca956a7cc8e79"
 		}
 	]
 }

README.md

@@ -14,7 +14,9 @@ Read [CONTRIBUTING](CONTRIBUTING.md) for build and test instructions.
 * `macvlan`: Creates a new MAC address, forwards all traffic to that to the container.
 * `ptp`: Creates a veth pair.
 * `vlan`: Allocates a vlan device.
-
+#### Windows: windows specific
+* `win-bridge`: Creates a bridge, adds the host and the container to it.
+* `win-overlay`: Creates an overlay interface to the container.
 ### IPAM: IP address allocation
 * `dhcp`: Runs a daemon on the host to make DHCP requests on behalf of the container
 * `host-local`: maintains a local database of allocated IPs

Vagrantfile

@@ -8,14 +8,11 @@ Vagrant.configure(2) do |config|
 
   config.vm.provision "shell", inline: <<-SHELL
     set -e -x -u
-
     apt-get update -y || (sleep 40 && apt-get update -y)
-    apt-get install -y git
-
+    apt-get install -y git gcc-multilib gcc-mingw-w64
     wget -qO- https://storage.googleapis.com/golang/go1.10.linux-amd64.tar.gz | tar -C /usr/local -xz
-
     echo 'export GOPATH=/go' >> /root/.bashrc
     echo 'export PATH=$PATH:/usr/local/go/bin:$GOPATH/bin' >> /root/.bashrc
     cd /go/src/github.com/containernetworking/plugins
   SHELL
-end
+end

build.sh

@@ -19,12 +19,20 @@ export GO="${GO:-go}"
 
 mkdir -p "${PWD}/bin"
 
-echo "Building plugins"
+echo "Building plugins ${GOOS}"
 PLUGINS="plugins/meta/* plugins/main/* plugins/ipam/* plugins/sample"
 for d in $PLUGINS; do
 	if [ -d "$d" ]; then
 		plugin="$(basename "$d")"
-		echo "  $plugin"
-		$GO build -o "${PWD}/bin/$plugin" "$@" "$REPO_PATH"/$d
+		if [ $plugin == "windows" ]
+		then
+			if [ "$GOARCH" == "amd64" ]
+			then
+				GOOS=windows . $d/build.sh
+			fi
+		else
+			echo "  $plugin"
+		        $GO build -o "${PWD}/bin/$plugin" "$@" "$REPO_PATH"/$d
+		fi
 	fi
 done

pkg/hns/endpoint_windows.go

@@ -0,0 +1,152 @@
+// Copyright 2017 CNI authors
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+//     http://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+
+package hns
+
+import (
+	"fmt"
+	"net"
+	"strings"
+
+	"github.com/Microsoft/hcsshim"
+	"github.com/containernetworking/cni/pkg/types/current"
+	"github.com/juju/errors"
+)
+
+const (
+	pauseContainerNetNS = "none"
+)
+
+// GetSandboxContainerID returns the sandbox ID of this pod
+func GetSandboxContainerID(containerID string, netNs string) string {
+	if len(netNs) != 0 && netNs != pauseContainerNetNS {
+		splits := strings.SplitN(netNs, ":", 2)
+		if len(splits) == 2 {
+			containerID = splits[1]
+		}
+	}
+
+	return containerID
+}
+
+// ConstructEndpointName constructs enpointId which is used to identify an endpoint from HNS
+// There is a special consideration for netNs name here, which is required for Windows Server 1709
+// containerID is the Id of the container on which the endpoint is worked on
+func ConstructEndpointName(containerID string, netNs string, networkName string) string {
+	return GetSandboxContainerID(containerID, netNs) + "_" + networkName
+}
+
+// DeprovisionEndpoint removes an endpoint from the container by sending a Detach request to HNS
+// For shared endpoint, ContainerDetach is used
+// for removing the endpoint completely, HotDetachEndpoint is used
+func DeprovisionEndpoint(epName string, netns string, containerID string) error {
+	if len(netns) == 0 {
+		return nil
+	}
+
+	hnsEndpoint, err := hcsshim.GetHNSEndpointByName(epName)
+	if err != nil {
+		return errors.Annotatef(err, "failed to find HNSEndpoint %s", epName)
+	}
+
+	if netns != pauseContainerNetNS {
+		// Shared endpoint removal. Do not remove the endpoint.
+		hnsEndpoint.ContainerDetach(containerID)
+		return nil
+	}
+
+	// Do not consider this as failure, else this would leak endpoints
+	hcsshim.HotDetachEndpoint(containerID, hnsEndpoint.Id)
+
+	// Do not return error
+	hnsEndpoint.Delete()
+
+	return nil
+}
+
+type EndpointMakerFunc func() (*hcsshim.HNSEndpoint, error)
+
+// ProvisionEndpoint provisions an endpoint to a container specified by containerID.
+// If an endpoint already exists, the endpoint is reused.
+// This call is idempotent
+func ProvisionEndpoint(epName string, expectedNetworkId string, containerID string, makeEndpoint EndpointMakerFunc) (*hcsshim.HNSEndpoint, error) {
+	// check if endpoint already exists
+	createEndpoint := true
+	hnsEndpoint, err := hcsshim.GetHNSEndpointByName(epName)
+	if hnsEndpoint != nil && hnsEndpoint.VirtualNetwork == expectedNetworkId {
+		createEndpoint = false
+	}
+
+	if createEndpoint {
+		if hnsEndpoint != nil {
+			if _, err = hnsEndpoint.Delete(); err != nil {
+				return nil, errors.Annotate(err, "failed to delete the stale HNSEndpoint")
+			}
+		}
+
+		if hnsEndpoint, err = makeEndpoint(); err != nil {
+			return nil, errors.Annotate(err, "failed to make a new HNSEndpoint")
+		}
+
+		if hnsEndpoint, err = hnsEndpoint.Create(); err != nil {
+			return nil, errors.Annotate(err, "failed to create the new HNSEndpoint")
+		}
+
+	}
+
+	// hot attach
+	if err := hcsshim.HotAttachEndpoint(containerID, hnsEndpoint.Id); err != nil {
+		if hcsshim.ErrComputeSystemDoesNotExist == err {
+			return hnsEndpoint, nil
+		}
+
+		return nil, err
+	}
+
+	return hnsEndpoint, nil
+}
+
+// ConstructResult constructs the CNI result for the endpoint
+func ConstructResult(hnsNetwork *hcsshim.HNSNetwork, hnsEndpoint *hcsshim.HNSEndpoint) (*current.Result, error) {
+	resultInterface := &current.Interface{
+		Name: hnsEndpoint.Name,
+		Mac:  hnsEndpoint.MacAddress,
+	}
+	_, ipSubnet, err := net.ParseCIDR(hnsNetwork.Subnets[0].AddressPrefix)
+	if err != nil {
+		return nil, errors.Annotatef(err, "failed to parse CIDR from %s", hnsNetwork.Subnets[0].AddressPrefix)
+	}
+
+	var ipVersion string
+	if ipv4 := hnsEndpoint.IPAddress.To4(); ipv4 != nil {
+		ipVersion = "4"
+	} else if ipv6 := hnsEndpoint.IPAddress.To16(); ipv6 != nil {
+		ipVersion = "6"
+	} else {
+		return nil, fmt.Errorf("IPAddress of HNSEndpoint %s isn't a valid ipv4 or ipv6 Address", hnsEndpoint.Name)
+	}
+
+	resultIPConfig := &current.IPConfig{
+		Version: ipVersion,
+		Address: net.IPNet{
+			IP:   hnsEndpoint.IPAddress,
+			Mask: ipSubnet.Mask},
+		Gateway: net.ParseIP(hnsEndpoint.GatewayAddress),
+	}
+	result := &current.Result{}
+	result.Interfaces = []*current.Interface{resultInterface}
+	result.IPs = []*current.IPConfig{resultIPConfig}
+
+	return result, nil
+}

pkg/hns/netconf.go

@@ -0,0 +1,152 @@
+// Copyright 2017 CNI authors
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+//     http://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+
+package hns
+
+import (
+	"encoding/json"
+	"strings"
+
+	"bytes"
+	"github.com/buger/jsonparser"
+	"github.com/containernetworking/cni/pkg/types"
+)
+
+// NetConf is the CNI spec
+type NetConf struct {
+	types.NetConf
+
+	Policies []policy `json:"policies,omitempty"`
+}
+
+type policy struct {
+	Name  string          `json:"name"`
+	Value json.RawMessage `json:"value"`
+}
+
+// MarshalPolicies converts the Endpoint policies in Policies
+// to HNS specific policies as Json raw bytes
+func (n *NetConf) MarshalPolicies() []json.RawMessage {
+	if n.Policies == nil {
+		n.Policies = make([]policy, 0)
+	}
+
+	result := make([]json.RawMessage, 0, len(n.Policies))
+	for _, p := range n.Policies {
+		if !strings.EqualFold(p.Name, "EndpointPolicy") {
+			continue
+		}
+
+		result = append(result, p.Value)
+	}
+
+	return result
+}
+
+// ApplyOutboundNatPolicy applies NAT Policy in VFP using HNS
+// Simultaneously an exception is added for the network that has to be Nat'd
+func (n *NetConf) ApplyOutboundNatPolicy(nwToNat string) {
+	if n.Policies == nil {
+		n.Policies = make([]policy, 0)
+	}
+
+	nwToNatBytes := []byte(nwToNat)
+
+	for i, p := range n.Policies {
+		if !strings.EqualFold(p.Name, "EndpointPolicy") {
+			continue
+		}
+
+		typeValue, err := jsonparser.GetUnsafeString(p.Value, "Type")
+		if err != nil || len(typeValue) == 0 {
+			continue
+		}
+
+		if !strings.EqualFold(typeValue, "OutBoundNAT") {
+			continue
+		}
+
+		exceptionListValue, dt, _, _ := jsonparser.Get(p.Value, "ExceptionList")
+		// OutBoundNAT must with ExceptionList, so don't need to judge jsonparser.NotExist
+		if dt == jsonparser.Array {
+			buf := bytes.Buffer{}
+			buf.WriteString(`{"Type": "OutBoundNAT", "ExceptionList": [`)
+
+			jsonparser.ArrayEach(exceptionListValue, func(value []byte, dataType jsonparser.ValueType, offset int, err error) {
+				if dataType == jsonparser.String && len(value) != 0 {
+					if bytes.Compare(value, nwToNatBytes) != 0 {
+						buf.WriteByte('"')
+						buf.Write(value)
+						buf.WriteByte('"')
+						buf.WriteByte(',')
+					}
+				}
+			})
+
+			buf.WriteString(`"` + nwToNat + `"]}`)
+
+			n.Policies[i] = policy{
+				Name:  "EndpointPolicy",
+				Value: buf.Bytes(),
+			}
+		} else {
+			n.Policies[i] = policy{
+				Name:  "EndpointPolicy",
+				Value: []byte(`{"Type": "OutBoundNAT", "ExceptionList": ["` + nwToNat + `"]}`),
+			}
+		}
+
+		return
+	}
+
+	// didn't find the policyArg, add it
+	n.Policies = append(n.Policies, policy{
+		Name:  "EndpointPolicy",
+		Value: []byte(`{"Type": "OutBoundNAT", "ExceptionList": ["` + nwToNat + `"]}`),
+	})
+}
+
+// ApplyDefaultPAPolicy is used to configure a endpoint PA policy in HNS
+func (n *NetConf) ApplyDefaultPAPolicy(paAddress string) {
+	if n.Policies == nil {
+		n.Policies = make([]policy, 0)
+	}
+
+	// if its already present, leave untouched
+	for i, p := range n.Policies {
+		if !strings.EqualFold(p.Name, "EndpointPolicy") {
+			continue
+		}
+
+		paValue, dt, _, _ := jsonparser.Get(p.Value, "PA")
+		if dt == jsonparser.NotExist {
+			continue
+		} else if dt == jsonparser.String && len(paValue) != 0 {
+			// found it, don't override
+			return
+		}
+
+		n.Policies[i] = policy{
+			Name:  "EndpointPolicy",
+			Value: []byte(`{"Type": "PA", "PA": "` + paAddress + `"}`),
+		}
+		return
+	}
+
+	// didn't find the policyArg, add it
+	n.Policies = append(n.Policies, policy{
+		Name:  "EndpointPolicy",
+		Value: []byte(`{"Type": "PA", "PA": "` + paAddress + `"}`),
+	})
+}

pkg/hns/netconf_suite_test.go

@@ -0,0 +1,26 @@
+// Copyright 2017 CNI authors
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+//     http://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+package hns
+
+import (
+	. "github.com/onsi/ginkgo"
+	. "github.com/onsi/gomega"
+
+	"testing"
+)
+
+func TestHns(t *testing.T) {
+	RegisterFailHandler(Fail)
+	RunSpecs(t, "HNS NetConf Suite")
+}

pkg/hns/netconf_test.go

@@ -0,0 +1,189 @@
+// Copyright 2017 CNI authors
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+//     http://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+package hns
+
+import (
+	"encoding/json"
+
+	. "github.com/onsi/ginkgo"
+	. "github.com/onsi/gomega"
+)
+
+var _ = Describe("HNS NetConf", func() {
+	Describe("ApplyOutBoundNATPolicy", func() {
+		Context("when not set by user", func() {
+			It("sets it by adding a policy", func() {
+
+				// apply it
+				n := NetConf{}
+				n.ApplyOutboundNatPolicy("192.168.0.0/16")
+
+				addlArgs := n.Policies
+				Expect(addlArgs).Should(HaveLen(1))
+
+				policy := addlArgs[0]
+				Expect(policy.Name).Should(Equal("EndpointPolicy"))
+
+				value := make(map[string]interface{})
+				json.Unmarshal(policy.Value, &value)
+
+				Expect(value).Should(HaveKey("Type"))
+				Expect(value).Should(HaveKey("ExceptionList"))
+				Expect(value["Type"]).Should(Equal("OutBoundNAT"))
+
+				exceptionList := value["ExceptionList"].([]interface{})
+				Expect(exceptionList).Should(HaveLen(1))
+				Expect(exceptionList[0].(string)).Should(Equal("192.168.0.0/16"))
+			})
+		})
+
+		Context("when set by user", func() {
+			It("appends exceptions to the existing policy", func() {
+				// first set it
+				n := NetConf{}
+				n.ApplyOutboundNatPolicy("192.168.0.0/16")
+
+				// then attempt to update it
+				n.ApplyOutboundNatPolicy("10.244.0.0/16")
+
+				// it should be unchanged!
+				addlArgs := n.Policies
+				Expect(addlArgs).Should(HaveLen(1))
+
+				policy := addlArgs[0]
+				Expect(policy.Name).Should(Equal("EndpointPolicy"))
+
+				var value map[string]interface{}
+				json.Unmarshal(policy.Value, &value)
+
+				Expect(value).Should(HaveKey("Type"))
+				Expect(value).Should(HaveKey("ExceptionList"))
+				Expect(value["Type"]).Should(Equal("OutBoundNAT"))
+
+				exceptionList := value["ExceptionList"].([]interface{})
+				Expect(exceptionList).Should(HaveLen(2))
+				Expect(exceptionList[0].(string)).Should(Equal("192.168.0.0/16"))
+				Expect(exceptionList[1].(string)).Should(Equal("10.244.0.0/16"))
+			})
+		})
+	})
+
+	Describe("ApplyDefaultPAPolicy", func() {
+		Context("when not set by user", func() {
+			It("sets it by adding a policy", func() {
+
+				n := NetConf{}
+				n.ApplyDefaultPAPolicy("192.168.0.1")
+
+				addlArgs := n.Policies
+				Expect(addlArgs).Should(HaveLen(1))
+
+				policy := addlArgs[0]
+				Expect(policy.Name).Should(Equal("EndpointPolicy"))
+
+				value := make(map[string]interface{})
+				json.Unmarshal(policy.Value, &value)
+
+				Expect(value).Should(HaveKey("Type"))
+				Expect(value["Type"]).Should(Equal("PA"))
+
+				paAddress := value["PA"].(string)
+				Expect(paAddress).Should(Equal("192.168.0.1"))
+			})
+		})
+
+		Context("when set by user", func() {
+			It("does not override", func() {
+				n := NetConf{}
+				n.ApplyDefaultPAPolicy("192.168.0.1")
+				n.ApplyDefaultPAPolicy("192.168.0.2")
+
+				addlArgs := n.Policies
+				Expect(addlArgs).Should(HaveLen(1))
+
+				policy := addlArgs[0]
+				Expect(policy.Name).Should(Equal("EndpointPolicy"))
+
+				value := make(map[string]interface{})
+				json.Unmarshal(policy.Value, &value)
+
+				Expect(value).Should(HaveKey("Type"))
+				Expect(value["Type"]).Should(Equal("PA"))
+
+				paAddress := value["PA"].(string)
+				Expect(paAddress).Should(Equal("192.168.0.1"))
+				Expect(paAddress).ShouldNot(Equal("192.168.0.2"))
+			})
+		})
+	})
+
+	Describe("MarshalPolicies", func() {
+		Context("when not set by user", func() {
+			It("sets it by adding a policy", func() {
+
+				n := NetConf{
+					Policies: []policy{
+						{
+							Name:  "EndpointPolicy",
+							Value: []byte(`{"someKey": "someValue"}`),
+						},
+						{
+							Name:  "someOtherType",
+							Value: []byte(`{"someOtherKey": "someOtherValue"}`),
+						},
+					},
+				}
+
+				result := n.MarshalPolicies()
+				Expect(len(result)).To(Equal(1))
+
+				policy := make(map[string]interface{})
+				err := json.Unmarshal(result[0], &policy)
+				Expect(err).ToNot(HaveOccurred())
+				Expect(policy).Should(HaveKey("someKey"))
+				Expect(policy["someKey"]).To(Equal("someValue"))
+			})
+		})
+
+		Context("when set by user", func() {
+			It("appends exceptions to the existing policy", func() {
+				// first set it
+				n := NetConf{}
+				n.ApplyOutboundNatPolicy("192.168.0.0/16")
+
+				// then attempt to update it
+				n.ApplyOutboundNatPolicy("10.244.0.0/16")
+
+				// it should be unchanged!
+				addlArgs := n.Policies
+				Expect(addlArgs).Should(HaveLen(1))
+
+				policy := addlArgs[0]
+				Expect(policy.Name).Should(Equal("EndpointPolicy"))
+
+				var value map[string]interface{}
+				json.Unmarshal(policy.Value, &value)
+
+				Expect(value).Should(HaveKey("Type"))
+				Expect(value).Should(HaveKey("ExceptionList"))
+				Expect(value["Type"]).Should(Equal("OutBoundNAT"))
+
+				exceptionList := value["ExceptionList"].([]interface{})
+				Expect(exceptionList).Should(HaveLen(2))
+				Expect(exceptionList[0].(string)).Should(Equal("192.168.0.0/16"))
+				Expect(exceptionList[1].(string)).Should(Equal("10.244.0.0/16"))
+			})
+		})
+	})
+})

plugins/linux_only.txt

@@ -1,11 +0,0 @@
-plugins/ipam/dhcp
-plugins/main/bridge
-plugins/main/host-device
-plugins/main/ipvlan
-plugins/main/loopback
-plugins/main/macvlan
-plugins/main/ptp
-plugins/main/vlan
-plugins/meta/portmap
-plugins/meta/tuning
-plugins/meta/bandwidth

plugins/main/windows/build.sh

@@ -0,0 +1,13 @@
+#!/usr/bin/env bash
+set -e
+
+PLUGINS=$(cat plugins/windows_only.txt)
+for d in $PLUGINS; do
+	if [ -d "$d" ]; then
+	    plugin="$(basename "$d").exe"
+
+		echo "  $plugin"
+		CXX=x86_64-w64-mingw32-g++ CC=x86_64-w64-mingw32-gcc CGO_ENABLED=1 \
+		    $GO build -o "${PWD}/bin/$plugin" "$@" "$REPO_PATH"/$d
+	fi
+done

plugins/main/windows/win-bridge/README.md

@@ -0,0 +1,25 @@
+# win-bridge plugin
+
+## Overview
+
+With win-bridge plugin, all containers (on the same host) are plugged into an L2Bridge network that has one endpoint in the host namespace.
+
+## Example configuration
+```
+{
+	"name": "mynet",
+	"type": "win-bridge",
+	"ipMasqNetwork": "10.244.0.0/16",
+	"ipam": {
+		"type": "host-local",
+		"subnet": "10.10.0.0/16"
+	}
+}
+```
+
+## Network configuration reference
+
+* `name` (string, required): the name of the network.
+* `type` (string, required): "win-bridge".
+* `ipMasqNetwork` (string, optional): setup NAT if not empty.
+* `ipam` (dictionary, required): IPAM configuration to be used for this network.

plugins/main/windows/win-bridge/sample.conf

@@ -0,0 +1,44 @@
+{
+    "name":"cbr0",
+    "type":"flannel",
+    "delegate":{
+        "type":"win-bridge",
+        "dns":{
+            "nameservers":[
+                "11.0.0.10"
+            ],
+            "search":[
+                "svc.cluster.local"
+            ]
+        },
+        "policies":[
+            {
+                "name":"EndpointPolicy",
+                "value":{
+                    "Type":"OutBoundNAT",
+                    "ExceptionList":[
+                        "192.168.0.0/16",
+                        "11.0.0.0/8",
+                        "10.137.196.0/23"
+                    ]
+                }
+            },
+            {
+                "name":"EndpointPolicy",
+                "value":{
+                    "Type":"ROUTE",
+                    "DestinationPrefix":"11.0.0.0/8",
+                    "NeedEncap":true
+                }
+            },
+            {
+                "name":"EndpointPolicy",
+                "value":{
+                    "Type":"ROUTE",
+                    "DestinationPrefix":"10.137.198.27/32",
+                    "NeedEncap":true
+                }
+            }
+        ]
+    }
+}

plugins/main/windows/win-bridge/win-bridge_windows.go

@@ -0,0 +1,151 @@
+// Copyright 2017 CNI authors
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+//     http://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+
+package main
+
+import (
+	"encoding/json"
+	"fmt"
+	"runtime"
+	"strings"
+
+	"github.com/juju/errors"
+
+	"github.com/Microsoft/hcsshim"
+	"github.com/containernetworking/cni/pkg/skel"
+	"github.com/containernetworking/cni/pkg/types"
+	"github.com/containernetworking/cni/pkg/types/current"
+	"github.com/containernetworking/cni/pkg/version"
+	"github.com/containernetworking/plugins/pkg/hns"
+	"github.com/containernetworking/plugins/pkg/ipam"
+)
+
+type NetConf struct {
+	hns.NetConf
+
+	IPMasqNetwork string `json:"ipMasqNetwork,omitempty"`
+}
+
+func init() {
+	// this ensures that main runs only on main thread (thread group leader).
+	// since namespace ops (unshare, setns) are done for a single thread, we
+	// must ensure that the goroutine does not jump from OS thread to thread
+	runtime.LockOSThread()
+}
+
+func loadNetConf(bytes []byte) (*NetConf, string, error) {
+	n := &NetConf{}
+	if err := json.Unmarshal(bytes, n); err != nil {
+		return nil, "", fmt.Errorf("failed to load netconf: %v", err)
+	}
+	return n, n.CNIVersion, nil
+}
+
+func cmdAdd(args *skel.CmdArgs) error {
+	n, cniVersion, err := loadNetConf(args.StdinData)
+	if err != nil {
+		return errors.Annotate(err, "error while loadNetConf")
+	}
+
+	networkName := n.Name
+	hnsNetwork, err := hcsshim.GetHNSNetworkByName(networkName)
+	if err != nil {
+		return errors.Annotatef(err, "error while GETHNSNewtorkByName(%s)", networkName)
+	}
+
+	if hnsNetwork == nil {
+		return fmt.Errorf("network %v not found", networkName)
+	}
+
+	if !strings.EqualFold(hnsNetwork.Type, "L2Bridge") {
+		return fmt.Errorf("network %v is of an unexpected type: %v", networkName, hnsNetwork.Type)
+	}
+
+	epName := hns.ConstructEndpointName(args.ContainerID, args.Netns, n.Name)
+
+	hnsEndpoint, err := hns.ProvisionEndpoint(epName, hnsNetwork.Id, args.ContainerID, func() (*hcsshim.HNSEndpoint, error) {
+		// run the IPAM plugin and get back the config to apply
+		r, err := ipam.ExecAdd(n.IPAM.Type, args.StdinData)
+		if err != nil {
+			return nil, errors.Annotatef(err, "error while ipam.ExecAdd")
+		}
+
+		// Convert whatever the IPAM result was into the current Result type
+		result, err := current.NewResultFromResult(r)
+		if err != nil {
+			return nil, errors.Annotatef(err, "error while NewResultFromResult")
+		}
+
+		if len(result.IPs) == 0 {
+			return nil, errors.New("IPAM plugin return is missing IP config")
+		}
+
+		// Calculate gateway for bridge network (needs to be x.2)
+		gw := result.IPs[0].Address.IP.Mask(result.IPs[0].Address.Mask)
+		gw[len(gw)-1] += 2
+
+		// NAT based on the the configured cluster network
+		if len(n.IPMasqNetwork) != 0 {
+			n.ApplyOutboundNatPolicy(n.IPMasqNetwork)
+		}
+
+		result.DNS = n.DNS
+
+		hnsEndpoint := &hcsshim.HNSEndpoint{
+			Name:           epName,
+			VirtualNetwork: hnsNetwork.Id,
+			DNSServerList:  strings.Join(result.DNS.Nameservers, ","),
+			DNSSuffix:      strings.Join(result.DNS.Search, ","),
+			GatewayAddress: gw.String(),
+			IPAddress:      result.IPs[0].Address.IP,
+			Policies:       n.MarshalPolicies(),
+		}
+
+		return hnsEndpoint, nil
+	})
+	if err != nil {
+		return errors.Annotatef(err, "error while ProvisionEndpoint(%v,%v,%v)", epName, hnsNetwork.Id, args.ContainerID)
+	}
+
+	result, err := hns.ConstructResult(hnsNetwork, hnsEndpoint)
+	if err != nil {
+		return errors.Annotatef(err, "error while constructResult")
+	}
+
+	return types.PrintResult(result, cniVersion)
+}
+
+func cmdDel(args *skel.CmdArgs) error {
+	n, _, err := loadNetConf(args.StdinData)
+	if err != nil {
+		return err
+	}
+
+	if err := ipam.ExecDel(n.IPAM.Type, args.StdinData); err != nil {
+		return err
+	}
+
+	epName := hns.ConstructEndpointName(args.ContainerID, args.Netns, n.Name)
+
+	return hns.DeprovisionEndpoint(epName, args.Netns, args.ContainerID)
+}
+
+func cmdGet(_ *skel.CmdArgs) error {
+	// TODO: implement
+	return fmt.Errorf("not implemented")
+}
+
+func main() {
+	skel.PluginMain(cmdAdd, cmdGet, cmdDel, version.All, "TODO")
+}

plugins/main/windows/win-overlay/README.md

@@ -0,0 +1,27 @@
+# win-overlay plugin
+
+## Overview
+
+With win-overlay plugin, all containers (on the same host) are plugged into an Overlay network based on VXLAN encapsulation. 
+
+## Example configuration
+```
+{
+	"name": "mynet",
+	"type": "win-overlay",
+	"ipMasq": true,
+	"endpointMacPrefix": "0E-2A",
+	"ipam": {
+		"type": "host-local",
+		"subnet": "10.10.0.0/16"
+	}
+}
+```
+
+## Network configuration reference
+
+* `name` (string, required): the name of the network.
+* `type` (string, required): "win-overlay".
+* `ipMasq` (bool, optional): the inverse of `$FLANNEL_IPMASQ`, setup NAT for the hnsNetwork subnet.
+* `endpointMacPrefix` (string, optional): set to the MAC prefix configured for Flannel  
+* `ipam` (dictionary, required): IPAM configuration to be used for this network.

plugins/main/windows/win-overlay/sample.conf

@@ -0,0 +1,36 @@
+{
+    "cniVersion":"0.2.0",
+    "name":"vxlan0",
+    "type":"flannel",
+    "delegate":{
+        "type":"win-overlay",
+        "dns":{
+            "nameservers":[
+                "11.0.0.10"
+            ],
+            "search":[
+                "svc.cluster.local"
+            ]
+        },
+        "policies":[
+            {
+                "name":"EndpointPolicy",
+                "value":{
+                    "Type":"OutBoundNAT",
+                    "ExceptionList":[
+                        "192.168.0.0/16",
+                        "11.0.0.0/8"
+                    ]
+                }
+            },
+            {
+                "name":"EndpointPolicy",
+                "value":{
+                    "Type":"ROUTE",
+                    "DestinationPrefix":"11.0.0.0/8",
+                    "NeedEncap":true
+                }
+            }
+        ]
+    }
+}

plugins/main/windows/win-overlay/win-overlay_windows.go

@@ -0,0 +1,166 @@
+// Copyright 2017 CNI authors
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+//     http://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+
+package main
+
+import (
+	"encoding/json"
+	"fmt"
+	"runtime"
+	"strings"
+
+	"github.com/juju/errors"
+
+	"github.com/Microsoft/hcsshim"
+	"github.com/containernetworking/cni/pkg/skel"
+	"github.com/containernetworking/cni/pkg/types"
+	"github.com/containernetworking/cni/pkg/types/current"
+	"github.com/containernetworking/cni/pkg/version"
+	"github.com/containernetworking/plugins/pkg/hns"
+	"github.com/containernetworking/plugins/pkg/ipam"
+)
+
+type NetConf struct {
+	hns.NetConf
+
+	IPMasq            bool   `json:"ipMasq"`
+	EndpointMacPrefix string `json:"endpointMacPrefix,omitempty"`
+}
+
+func init() {
+	// this ensures that main runs only on main thread (thread group leader).
+	// since namespace ops (unshare, setns) are done for a single thread, we
+	// must ensure that the goroutine does not jump from OS thread to thread
+	runtime.LockOSThread()
+}
+
+func loadNetConf(bytes []byte) (*NetConf, string, error) {
+	n := &NetConf{}
+	if err := json.Unmarshal(bytes, n); err != nil {
+		return nil, "", fmt.Errorf("failed to load netconf: %v", err)
+	}
+	return n, n.CNIVersion, nil
+}
+
+func cmdAdd(args *skel.CmdArgs) error {
+	n, cniVersion, err := loadNetConf(args.StdinData)
+	if err != nil {
+		return errors.Annotate(err, "error while loadNetConf")
+	}
+
+	if len(n.EndpointMacPrefix) != 0 {
+		if len(n.EndpointMacPrefix) != 5 || n.EndpointMacPrefix[2] != '-' {
+			return fmt.Errorf("endpointMacPrefix [%v] is invalid, value must be of the format xx-xx", n.EndpointMacPrefix)
+		}
+	} else {
+		n.EndpointMacPrefix = "0E-2A"
+	}
+
+	networkName := n.Name
+	hnsNetwork, err := hcsshim.GetHNSNetworkByName(networkName)
+	if err != nil {
+		return errors.Annotatef(err, "error while GETHNSNewtorkByName(%s)", networkName)
+	}
+
+	if hnsNetwork == nil {
+		return fmt.Errorf("network %v not found", networkName)
+	}
+
+	if !strings.EqualFold(hnsNetwork.Type, "Overlay") {
+		return fmt.Errorf("network %v is of an unexpected type: %v", networkName, hnsNetwork.Type)
+	}
+
+	epName := hns.ConstructEndpointName(args.ContainerID, args.Netns, n.Name)
+
+	hnsEndpoint, err := hns.ProvisionEndpoint(epName, hnsNetwork.Id, args.ContainerID, func() (*hcsshim.HNSEndpoint, error) {
+		// run the IPAM plugin and get back the config to apply
+		r, err := ipam.ExecAdd(n.IPAM.Type, args.StdinData)
+		if err != nil {
+			return nil, errors.Annotatef(err, "error while ipam.ExecAdd")
+		}
+
+		// Convert whatever the IPAM result was into the current Result type
+		result, err := current.NewResultFromResult(r)
+		if err != nil {
+			return nil, errors.Annotatef(err, "error while NewResultFromResult")
+		}
+
+		if len(result.IPs) == 0 {
+			return nil, errors.New("IPAM plugin return is missing IP config")
+		}
+
+		ipAddr := result.IPs[0].Address.IP.To4()
+		if ipAddr == nil {
+			return nil, errors.New("win-overlay doesn't support IPv6 now")
+		}
+
+		// conjure a MAC based on the IP for Overlay
+		macAddr := fmt.Sprintf("%v-%02x-%02x-%02x-%02x", n.EndpointMacPrefix, ipAddr[0], ipAddr[1], ipAddr[2], ipAddr[3])
+		// use the HNS network gateway
+		gw := hnsNetwork.Subnets[0].GatewayAddress
+		n.ApplyDefaultPAPolicy(hnsNetwork.ManagementIP)
+		if n.IPMasq {
+			n.ApplyOutboundNatPolicy(hnsNetwork.Subnets[0].AddressPrefix)
+		}
+
+		result.DNS = n.DNS
+
+		hnsEndpoint := &hcsshim.HNSEndpoint{
+			Name:           epName,
+			VirtualNetwork: hnsNetwork.Id,
+			DNSServerList:  strings.Join(result.DNS.Nameservers, ","),
+			DNSSuffix:      strings.Join(result.DNS.Search, ","),
+			GatewayAddress: gw,
+			IPAddress:      ipAddr,
+			MacAddress:     macAddr,
+			Policies:       n.MarshalPolicies(),
+		}
+
+		return hnsEndpoint, nil
+	})
+	if err != nil {
+		return errors.Annotatef(err, "error while ProvisionEndpoint(%v,%v,%v)", epName, hnsNetwork.Id, args.ContainerID)
+	}
+
+	result, err := hns.ConstructResult(hnsNetwork, hnsEndpoint)
+	if err != nil {
+		return errors.Annotatef(err, "error while constructResult")
+	}
+
+	return types.PrintResult(result, cniVersion)
+}
+
+func cmdDel(args *skel.CmdArgs) error {
+	n, _, err := loadNetConf(args.StdinData)
+	if err != nil {
+		return err
+	}
+
+	if err := ipam.ExecDel(n.IPAM.Type, args.StdinData); err != nil {
+		return err
+	}
+
+	epName := hns.ConstructEndpointName(args.ContainerID, args.Netns, n.Name)
+
+	return hns.DeprovisionEndpoint(epName, args.Netns, args.ContainerID)
+}
+
+func cmdGet(_ *skel.CmdArgs) error {
+	// TODO: implement
+	return fmt.Errorf("not implemented")
+}
+
+func main() {
+	skel.PluginMain(cmdAdd, cmdGet, cmdDel, version.All, "TODO")
+}

plugins/meta/flannel/README.md

@@ -86,3 +86,50 @@ flannel plugin will set the following fields in the delegated plugin configurati
 * `mtu`: `$FLANNEL_MTU`
 
 Additionally, for the bridge plugin, `isGateway` will be set to `true`, if not present.
+
+## Windows Support (Experimental)
+This plugin supports delegating to the windows CNI plugins (overlay.exe, l2bridge.exe) to work in conjunction with [Flannel on Windows](https://github.com/coreos/flannel/issues/833). 
+Flannel sets up an [HNS Network](https://docs.microsoft.com/en-us/virtualization/windowscontainers/manage-containers/container-networking) in L2Bridge mode for host-gw and in Overlay mode for vxlan. 
+
+The following fields must be set in the delegated plugin configuration:
+* `name` (string, required): the name of the network (must match the name in Flannel config / name of the HNS network)
+* `type` (string, optional): set to `win-l2bridge` by default. Can be set to `win-overlay` or other custom windows CNI
+* `ipMasq`: the inverse of `$FLANNEL_IPMASQ`
+* `endpointMacPrefix` (string, optional): required for `win-overlay` mode, set to the MAC prefix configured for Flannel  
+* `clusterNetworkPrefix` (string, optional): required for `win-l2bridge` mode, setup NAT if `ipMasq` is set to true
+
+For `win-l2bridge`, the Flannel CNI plugin will set:
+* `ipam`: "host-local" type will be used with "subnet" set to `$FLANNEL_SUBNET` and gateway as the .2 address in `$FLANNEL_NETWORK`
+
+For `win-overlay`, the Flannel CNI plugin will set:
+* `ipam`: "host-local" type will be used with "subnet" set to `$FLANNEL_SUBNET` and gateway as the .1 address in `$FLANNEL_NETWORK`
+
+If IPMASQ is true, the Flannel CNI plugin will setup an OutBoundNAT policy and add FLANNEL_SUBNET to any existing exclusions.
+
+All other delegate config e.g. other HNS endpoint policies in AdditionalArgs will be passed to WINCNI as-is.    
+
+Example VXLAN Flannel CNI config
+```
+{
+	"name": "mynet",
+	"type": "flannel",
+	"delegate": {
+		"type": "win-overlay",
+		"endpointMacPrefix": "0E-2A"
+	}
+}
+```
+
+For this example, Flannel CNI would generate the following config to delegate to the windows CNI when FLANNEL_NETWORK=10.244.0.0/16, FLANNEL_SUBNET=10.244.1.0/24 and IPMASQ=true
+```
+{
+	"name": "mynet",
+	"type": "win-overlay",
+	"endpointMacPrefix": "0E-2A",
+	"ipMasq": true,
+	"ipam": {
+		"subnet": "10.244.1.0/24",
+		"type": "host-local"
+	}
+}
+```

plugins/meta/flannel/flannel.go

@@ -42,6 +42,7 @@ const (
 
 type NetConf struct {
 	types.NetConf
+
 	SubnetFile string                 `json:"subnetFile"`
 	DataDir    string                 `json:"dataDir"`
 	Delegate   map[string]interface{} `json:"delegate"`
@@ -202,43 +203,7 @@ func cmdAdd(args *skel.CmdArgs) error {
 		}
 	}
 
-	n.Delegate["name"] = n.Name
-
-	if !hasKey(n.Delegate, "type") {
-		n.Delegate["type"] = "bridge"
-	}
-
-	if !hasKey(n.Delegate, "ipMasq") {
-		// if flannel is not doing ipmasq, we should
-		ipmasq := !*fenv.ipmasq
-		n.Delegate["ipMasq"] = ipmasq
-	}
-
-	if !hasKey(n.Delegate, "mtu") {
-		mtu := fenv.mtu
-		n.Delegate["mtu"] = mtu
-	}
-
-	if n.Delegate["type"].(string) == "bridge" {
-		if !hasKey(n.Delegate, "isGateway") {
-			n.Delegate["isGateway"] = true
-		}
-	}
-	if n.CNIVersion != "" {
-		n.Delegate["cniVersion"] = n.CNIVersion
-	}
-
-	n.Delegate["ipam"] = map[string]interface{}{
-		"type":   "host-local",
-		"subnet": fenv.sn.String(),
-		"routes": []types.Route{
-			types.Route{
-				Dst: *fenv.nw,
-			},
-		},
-	}
-
-	return delegateAdd(args.ContainerID, n.DataDir, n.Delegate)
+	return doCmdAdd(args, n, fenv)
 }
 
 func cmdDel(args *skel.CmdArgs) error {
@@ -247,25 +212,10 @@ func cmdDel(args *skel.CmdArgs) error {
 		return err
 	}
 
-	netconfBytes, err := consumeScratchNetConf(args.ContainerID, nc.DataDir)
-	if err != nil {
-		if os.IsNotExist(err) {
-			// Per spec should ignore error if resources are missing / already removed
-			return nil
-		}
-		return err
-	}
-
-	n := &types.NetConf{}
-	if err = json.Unmarshal(netconfBytes, n); err != nil {
-		return fmt.Errorf("failed to parse netconf: %v", err)
-	}
-
-	return invoke.DelegateDel(n.Type, netconfBytes, nil)
+	return doCmdDel(args, nc)
 }
 
 func main() {
-	// TODO: implement plugin version
 	skel.PluginMain(cmdAdd, cmdGet, cmdDel, version.All, "TODO")
 }
 

plugins/meta/flannel/flannel_linux.go

@@ -0,0 +1,86 @@
+// Copyright 2018 CNI authors
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+//     http://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+
+// This is a "meta-plugin". It reads in its own netconf, combines it with
+// the data from flannel generated subnet file and then invokes a plugin
+// like bridge or ipvlan to do the real work.
+
+package main
+
+import (
+	"encoding/json"
+	"fmt"
+	"github.com/containernetworking/cni/pkg/invoke"
+	"github.com/containernetworking/cni/pkg/skel"
+	"github.com/containernetworking/cni/pkg/types"
+	"os"
+)
+
+func doCmdAdd(args *skel.CmdArgs, n *NetConf, fenv *subnetEnv) error {
+	n.Delegate["name"] = n.Name
+
+	if !hasKey(n.Delegate, "type") {
+		n.Delegate["type"] = "bridge"
+	}
+
+	if !hasKey(n.Delegate, "ipMasq") {
+		// if flannel is not doing ipmasq, we should
+		ipmasq := !*fenv.ipmasq
+		n.Delegate["ipMasq"] = ipmasq
+	}
+
+	if !hasKey(n.Delegate, "mtu") {
+		mtu := fenv.mtu
+		n.Delegate["mtu"] = mtu
+	}
+
+	if n.Delegate["type"].(string) == "bridge" {
+		if !hasKey(n.Delegate, "isGateway") {
+			n.Delegate["isGateway"] = true
+		}
+	}
+	if n.CNIVersion != "" {
+		n.Delegate["cniVersion"] = n.CNIVersion
+	}
+
+	n.Delegate["ipam"] = map[string]interface{}{
+		"type":   "host-local",
+		"subnet": fenv.sn.String(),
+		"routes": []types.Route{
+			{
+				Dst: *fenv.nw,
+			},
+		},
+	}
+
+	return delegateAdd(args.ContainerID, n.DataDir, n.Delegate)
+}
+
+func doCmdDel(args *skel.CmdArgs, n *NetConf) error {
+	netconfBytes, err := consumeScratchNetConf(args.ContainerID, n.DataDir)
+	if err != nil {
+		if os.IsNotExist(err) {
+			// Per spec should ignore error if resources are missing / already removed
+			return nil
+		}
+		return err
+	}
+
+	nc := &types.NetConf{}
+	if err = json.Unmarshal(netconfBytes, nc); err != nil {
+		return fmt.Errorf("failed to parse netconf: %v", err)
+	}
+
+	return invoke.DelegateDel(nc.Type, netconfBytes, nil)
+}

plugins/meta/flannel/flannel_windows.go

@@ -0,0 +1,73 @@
+// Copyright 2018 CNI authors
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+//     http://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+
+// This is a "meta-plugin". It reads in its own netconf, combines it with
+// the data from flannel generated subnet file and then invokes a plugin
+// like bridge or ipvlan to do the real work.
+
+package main
+
+import (
+	"encoding/json"
+	"fmt"
+	"github.com/containernetworking/cni/pkg/invoke"
+	"github.com/containernetworking/cni/pkg/skel"
+	"github.com/containernetworking/cni/pkg/types"
+	"github.com/containernetworking/cni/pkg/types/020"
+	"github.com/containernetworking/plugins/pkg/hns"
+	"os"
+)
+
+func doCmdAdd(args *skel.CmdArgs, n *NetConf, fenv *subnetEnv) error {
+	n.Delegate["name"] = n.Name
+
+	if !hasKey(n.Delegate, "type") {
+		n.Delegate["type"] = "win-bridge"
+	}
+
+	// if flannel needs ipmasq - get the plugin to configure it
+	// (this is the opposite of how linux works - on linux the flannel daemon configure ipmasq)
+	n.Delegate["ipMasq"] = *fenv.ipmasq
+	n.Delegate["ipMasqNetwork"] = fenv.nw.String()
+
+	n.Delegate["cniVersion"] = types020.ImplementedSpecVersion
+	if len(n.CNIVersion) != 0 {
+		n.Delegate["cniVersion"] = n.CNIVersion
+	}
+
+	n.Delegate["ipam"] = map[string]interface{}{
+		"type":   "host-local",
+		"subnet": fenv.sn.String(),
+	}
+
+	return delegateAdd(hns.GetSandboxContainerID(args.ContainerID, args.Netns), n.DataDir, n.Delegate)
+}
+
+func doCmdDel(args *skel.CmdArgs, n *NetConf) error {
+	netconfBytes, err := consumeScratchNetConf(hns.GetSandboxContainerID(args.ContainerID, args.Netns), n.DataDir)
+	if err != nil {
+		if os.IsNotExist(err) {
+			// Per spec should ignore error if resources are missing / already removed
+			return nil
+		}
+		return err
+	}
+
+	nc := &types.NetConf{}
+	if err = json.Unmarshal(netconfBytes, nc); err != nil {
+		return fmt.Errorf("failed to parse netconf: %v", err)
+	}
+
+	return invoke.DelegateDel(nc.Type, netconfBytes, nil)
+}

plugins/windows_only.txt

@@ -0,0 +1,4 @@
+plugins/ipam/host-local
+plugins/main/windows/win-bridge
+plugins/main/windows/win-overlay
+plugins/meta/flannel

vendor/github.com/Microsoft/go-winio/.gitignore

@@ -0,0 +1 @@
+*.exe

vendor/github.com/Microsoft/go-winio/LICENSE

@@ -0,0 +1,22 @@
+The MIT License (MIT)
+
+Copyright (c) 2015 Microsoft
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all
+copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
+SOFTWARE.
+

vendor/github.com/Microsoft/go-winio/README.md

@@ -0,0 +1,22 @@
+# go-winio
+
+This repository contains utilities for efficiently performing Win32 IO operations in
+Go. Currently, this is focused on accessing named pipes and other file handles, and
+for using named pipes as a net transport.
+
+This code relies on IO completion ports to avoid blocking IO on system threads, allowing Go
+to reuse the thread to schedule another goroutine. This limits support to Windows Vista and
+newer operating systems. This is similar to the implementation of network sockets in Go's net
+package.
+
+Please see the LICENSE file for licensing information.
+
+This project has adopted the [Microsoft Open Source Code of
+Conduct](https://opensource.microsoft.com/codeofconduct/). For more information
+see the [Code of Conduct
+FAQ](https://opensource.microsoft.com/codeofconduct/faq/) or contact
+[opencode@microsoft.com](mailto:opencode@microsoft.com) with any additional
+questions or comments.
+
+Thanks to natefinch for the inspiration for this library. See https://github.com/natefinch/npipe
+for another named pipe implementation.

vendor/github.com/Microsoft/go-winio/backup.go

@@ -0,0 +1,280 @@
+// +build windows
+
+package winio
+
+import (
+	"encoding/binary"
+	"errors"
+	"fmt"
+	"io"
+	"io/ioutil"
+	"os"
+	"runtime"
+	"syscall"
+	"unicode/utf16"
+)
+
+//sys backupRead(h syscall.Handle, b []byte, bytesRead *uint32, abort bool, processSecurity bool, context *uintptr) (err error) = BackupRead
+//sys backupWrite(h syscall.Handle, b []byte, bytesWritten *uint32, abort bool, processSecurity bool, context *uintptr) (err error) = BackupWrite
+
+const (
+	BackupData = uint32(iota + 1)
+	BackupEaData
+	BackupSecurity
+	BackupAlternateData
+	BackupLink
+	BackupPropertyData
+	BackupObjectId
+	BackupReparseData
+	BackupSparseBlock
+	BackupTxfsData
+)
+
+const (
+	StreamSparseAttributes = uint32(8)
+)
+
+const (
+	WRITE_DAC              = 0x40000
+	WRITE_OWNER            = 0x80000
+	ACCESS_SYSTEM_SECURITY = 0x1000000
+)
+
+// BackupHeader represents a backup stream of a file.
+type BackupHeader struct {
+	Id         uint32 // The backup stream ID
+	Attributes uint32 // Stream attributes
+	Size       int64  // The size of the stream in bytes
+	Name       string // The name of the stream (for BackupAlternateData only).
+	Offset     int64  // The offset of the stream in the file (for BackupSparseBlock only).
+}
+
+type win32StreamId struct {
+	StreamId   uint32
+	Attributes uint32
+	Size       uint64
+	NameSize   uint32
+}
+
+// BackupStreamReader reads from a stream produced by the BackupRead Win32 API and produces a series
+// of BackupHeader values.
+type BackupStreamReader struct {
+	r         io.Reader
+	bytesLeft int64
+}
+
+// NewBackupStreamReader produces a BackupStreamReader from any io.Reader.
+func NewBackupStreamReader(r io.Reader) *BackupStreamReader {
+	return &BackupStreamReader{r, 0}
+}
+
+// Next returns the next backup stream and prepares for calls to Read(). It skips the remainder of the current stream if
+// it was not completely read.
+func (r *BackupStreamReader) Next() (*BackupHeader, error) {
+	if r.bytesLeft > 0 {
+		if s, ok := r.r.(io.Seeker); ok {
+			// Make sure Seek on io.SeekCurrent sometimes succeeds
+			// before trying the actual seek.
+			if _, err := s.Seek(0, io.SeekCurrent); err == nil {
+				if _, err = s.Seek(r.bytesLeft, io.SeekCurrent); err != nil {
+					return nil, err
+				}
+				r.bytesLeft = 0
+			}
+		}
+		if _, err := io.Copy(ioutil.Discard, r); err != nil {
+			return nil, err
+		}
+	}
+	var wsi win32StreamId
+	if err := binary.Read(r.r, binary.LittleEndian, &wsi); err != nil {
+		return nil, err
+	}
+	hdr := &BackupHeader{
+		Id:         wsi.StreamId,
+		Attributes: wsi.Attributes,
+		Size:       int64(wsi.Size),
+	}
+	if wsi.NameSize != 0 {
+		name := make([]uint16, int(wsi.NameSize/2))
+		if err := binary.Read(r.r, binary.LittleEndian, name); err != nil {
+			return nil, err
+		}
+		hdr.Name = syscall.UTF16ToString(name)
+	}
+	if wsi.StreamId == BackupSparseBlock {
+		if err := binary.Read(r.r, binary.LittleEndian, &hdr.Offset); err != nil {
+			return nil, err
+		}
+		hdr.Size -= 8
+	}
+	r.bytesLeft = hdr.Size
+	return hdr, nil
+}
+
+// Read reads from the current backup stream.
+func (r *BackupStreamReader) Read(b []byte) (int, error) {
+	if r.bytesLeft == 0 {
+		return 0, io.EOF
+	}
+	if int64(len(b)) > r.bytesLeft {
+		b = b[:r.bytesLeft]
+	}
+	n, err := r.r.Read(b)
+	r.bytesLeft -= int64(n)
+	if err == io.EOF {
+		err = io.ErrUnexpectedEOF
+	} else if r.bytesLeft == 0 && err == nil {
+		err = io.EOF
+	}
+	return n, err
+}
+
+// BackupStreamWriter writes a stream compatible with the BackupWrite Win32 API.
+type BackupStreamWriter struct {
+	w         io.Writer
+	bytesLeft int64
+}
+
+// NewBackupStreamWriter produces a BackupStreamWriter on top of an io.Writer.
+func NewBackupStreamWriter(w io.Writer) *BackupStreamWriter {
+	return &BackupStreamWriter{w, 0}
+}
+
+// WriteHeader writes the next backup stream header and prepares for calls to Write().
+func (w *BackupStreamWriter) WriteHeader(hdr *BackupHeader) error {
+	if w.bytesLeft != 0 {
+		return fmt.Errorf("missing %d bytes", w.bytesLeft)
+	}
+	name := utf16.Encode([]rune(hdr.Name))
+	wsi := win32StreamId{
+		StreamId:   hdr.Id,
+		Attributes: hdr.Attributes,
+		Size:       uint64(hdr.Size),
+		NameSize:   uint32(len(name) * 2),
+	}
+	if hdr.Id == BackupSparseBlock {
+		// Include space for the int64 block offset
+		wsi.Size += 8
+	}
+	if err := binary.Write(w.w, binary.LittleEndian, &wsi); err != nil {
+		return err
+	}
+	if len(name) != 0 {
+		if err := binary.Write(w.w, binary.LittleEndian, name); err != nil {
+			return err
+		}
+	}
+	if hdr.Id == BackupSparseBlock {
+		if err := binary.Write(w.w, binary.LittleEndian, hdr.Offset); err != nil {
+			return err
+		}
+	}
+	w.bytesLeft = hdr.Size
+	return nil
+}
+
+// Write writes to the current backup stream.
+func (w *BackupStreamWriter) Write(b []byte) (int, error) {
+	if w.bytesLeft < int64(len(b)) {
+		return 0, fmt.Errorf("too many bytes by %d", int64(len(b))-w.bytesLeft)
+	}
+	n, err := w.w.Write(b)
+	w.bytesLeft -= int64(n)
+	return n, err
+}
+
+// BackupFileReader provides an io.ReadCloser interface on top of the BackupRead Win32 API.
+type BackupFileReader struct {
+	f               *os.File
+	includeSecurity bool
+	ctx             uintptr
+}
+
+// NewBackupFileReader returns a new BackupFileReader from a file handle. If includeSecurity is true,
+// Read will attempt to read the security descriptor of the file.
+func NewBackupFileReader(f *os.File, includeSecurity bool) *BackupFileReader {
+	r := &BackupFileReader{f, includeSecurity, 0}
+	return r
+}
+
+// Read reads a backup stream from the file by calling the Win32 API BackupRead().
+func (r *BackupFileReader) Read(b []byte) (int, error) {
+	var bytesRead uint32
+	err := backupRead(syscall.Handle(r.f.Fd()), b, &bytesRead, false, r.includeSecurity, &r.ctx)
+	if err != nil {
+		return 0, &os.PathError{"BackupRead", r.f.Name(), err}
+	}
+	runtime.KeepAlive(r.f)
+	if bytesRead == 0 {
+		return 0, io.EOF
+	}
+	return int(bytesRead), nil
+}
+
+// Close frees Win32 resources associated with the BackupFileReader. It does not close
+// the underlying file.
+func (r *BackupFileReader) Close() error {
+	if r.ctx != 0 {
+		backupRead(syscall.Handle(r.f.Fd()), nil, nil, true, false, &r.ctx)
+		runtime.KeepAlive(r.f)
+		r.ctx = 0
+	}
+	return nil
+}
+
+// BackupFileWriter provides an io.WriteCloser interface on top of the BackupWrite Win32 API.
+type BackupFileWriter struct {
+	f               *os.File
+	includeSecurity bool
+	ctx             uintptr
+}
+
+// NewBackupFileWriter returns a new BackupFileWriter from a file handle. If includeSecurity is true,
+// Write() will attempt to restore the security descriptor from the stream.
+func NewBackupFileWriter(f *os.File, includeSecurity bool) *BackupFileWriter {
+	w := &BackupFileWriter{f, includeSecurity, 0}
+	return w
+}
+
+// Write restores a portion of the file using the provided backup stream.
+func (w *BackupFileWriter) Write(b []byte) (int, error) {
+	var bytesWritten uint32
+	err := backupWrite(syscall.Handle(w.f.Fd()), b, &bytesWritten, false, w.includeSecurity, &w.ctx)
+	if err != nil {
+		return 0, &os.PathError{"BackupWrite", w.f.Name(), err}
+	}
+	runtime.KeepAlive(w.f)
+	if int(bytesWritten) != len(b) {
+		return int(bytesWritten), errors.New("not all bytes could be written")
+	}
+	return len(b), nil
+}
+
+// Close frees Win32 resources associated with the BackupFileWriter. It does not
+// close the underlying file.
+func (w *BackupFileWriter) Close() error {
+	if w.ctx != 0 {
+		backupWrite(syscall.Handle(w.f.Fd()), nil, nil, true, false, &w.ctx)
+		runtime.KeepAlive(w.f)
+		w.ctx = 0
+	}
+	return nil
+}
+
+// OpenForBackup opens a file or directory, potentially skipping access checks if the backup
+// or restore privileges have been acquired.
+//
+// If the file opened was a directory, it cannot be used with Readdir().
+func OpenForBackup(path string, access uint32, share uint32, createmode uint32) (*os.File, error) {
+	winPath, err := syscall.UTF16FromString(path)
+	if err != nil {
+		return nil, err
+	}
+	h, err := syscall.CreateFile(&winPath[0], access, share, nil, createmode, syscall.FILE_FLAG_BACKUP_SEMANTICS|syscall.FILE_FLAG_OPEN_REPARSE_POINT, 0)
+	if err != nil {
+		err = &os.PathError{Op: "open", Path: path, Err: err}
+		return nil, err
+	}
+	return os.NewFile(uintptr(h), path), nil
+}

vendor/github.com/Microsoft/go-winio/ea.go

@@ -0,0 +1,137 @@
+package winio
+
+import (
+	"bytes"
+	"encoding/binary"
+	"errors"
+)
+
+type fileFullEaInformation struct {
+	NextEntryOffset uint32
+	Flags           uint8
+	NameLength      uint8
+	ValueLength     uint16
+}
+
+var (
+	fileFullEaInformationSize = binary.Size(&fileFullEaInformation{})
+
+	errInvalidEaBuffer = errors.New("invalid extended attribute buffer")
+	errEaNameTooLarge  = errors.New("extended attribute name too large")
+	errEaValueTooLarge = errors.New("extended attribute value too large")
+)
+
+// ExtendedAttribute represents a single Windows EA.
+type ExtendedAttribute struct {
+	Name  string
+	Value []byte
+	Flags uint8
+}
+
+func parseEa(b []byte) (ea ExtendedAttribute, nb []byte, err error) {
+	var info fileFullEaInformation
+	err = binary.Read(bytes.NewReader(b), binary.LittleEndian, &info)
+	if err != nil {
+		err = errInvalidEaBuffer
+		return
+	}
+
+	nameOffset := fileFullEaInformationSize
+	nameLen := int(info.NameLength)
+	valueOffset := nameOffset + int(info.NameLength) + 1
+	valueLen := int(info.ValueLength)
+	nextOffset := int(info.NextEntryOffset)
+	if valueLen+valueOffset > len(b) || nextOffset < 0 || nextOffset > len(b) {
+		err = errInvalidEaBuffer
+		return
+	}
+
+	ea.Name = string(b[nameOffset : nameOffset+nameLen])
+	ea.Value = b[valueOffset : valueOffset+valueLen]
+	ea.Flags = info.Flags
+	if info.NextEntryOffset != 0 {
+		nb = b[info.NextEntryOffset:]
+	}
+	return
+}
+
+// DecodeExtendedAttributes decodes a list of EAs from a FILE_FULL_EA_INFORMATION
+// buffer retrieved from BackupRead, ZwQueryEaFile, etc.
+func DecodeExtendedAttributes(b []byte) (eas []ExtendedAttribute, err error) {
+	for len(b) != 0 {
+		ea, nb, err := parseEa(b)
+		if err != nil {
+			return nil, err
+		}
+
+		eas = append(eas, ea)
+		b = nb
+	}
+	return
+}
+
+func writeEa(buf *bytes.Buffer, ea *ExtendedAttribute, last bool) error {
+	if int(uint8(len(ea.Name))) != len(ea.Name) {
+		return errEaNameTooLarge
+	}
+	if int(uint16(len(ea.Value))) != len(ea.Value) {
+		return errEaValueTooLarge
+	}
+	entrySize := uint32(fileFullEaInformationSize + len(ea.Name) + 1 + len(ea.Value))
+	withPadding := (entrySize + 3) &^ 3
+	nextOffset := uint32(0)
+	if !last {
+		nextOffset = withPadding
+	}
+	info := fileFullEaInformation{
+		NextEntryOffset: nextOffset,
+		Flags:           ea.Flags,
+		NameLength:      uint8(len(ea.Name)),
+		ValueLength:     uint16(len(ea.Value)),
+	}
+
+	err := binary.Write(buf, binary.LittleEndian, &info)
+	if err != nil {
+		return err
+	}
+
+	_, err = buf.Write([]byte(ea.Name))
+	if err != nil {
+		return err
+	}
+
+	err = buf.WriteByte(0)
+	if err != nil {
+		return err
+	}
+
+	_, err = buf.Write(ea.Value)
+	if err != nil {
+		return err
+	}
+
+	_, err = buf.Write([]byte{0, 0, 0}[0 : withPadding-entrySize])
+	if err != nil {
+		return err
+	}
+
+	return nil
+}
+
+// EncodeExtendedAttributes encodes a list of EAs into a FILE_FULL_EA_INFORMATION
+// buffer for use with BackupWrite, ZwSetEaFile, etc.
+func EncodeExtendedAttributes(eas []ExtendedAttribute) ([]byte, error) {
+	var buf bytes.Buffer
+	for i := range eas {
+		last := false
+		if i == len(eas)-1 {
+			last = true
+		}
+
+		err := writeEa(&buf, &eas[i], last)
+		if err != nil {
+			return nil, err
+		}
+	}
+	return buf.Bytes(), nil
+}

vendor/github.com/Microsoft/go-winio/file.go

@@ -0,0 +1,307 @@
+// +build windows
+
+package winio
+
+import (
+	"errors"
+	"io"
+	"runtime"
+	"sync"
+	"sync/atomic"
+	"syscall"
+	"time"
+)
+
+//sys cancelIoEx(file syscall.Handle, o *syscall.Overlapped) (err error) = CancelIoEx
+//sys createIoCompletionPort(file syscall.Handle, port syscall.Handle, key uintptr, threadCount uint32) (newport syscall.Handle, err error) = CreateIoCompletionPort
+//sys getQueuedCompletionStatus(port syscall.Handle, bytes *uint32, key *uintptr, o **ioOperation, timeout uint32) (err error) = GetQueuedCompletionStatus
+//sys setFileCompletionNotificationModes(h syscall.Handle, flags uint8) (err error) = SetFileCompletionNotificationModes
+
+type atomicBool int32
+
+func (b *atomicBool) isSet() bool { return atomic.LoadInt32((*int32)(b)) != 0 }
+func (b *atomicBool) setFalse()   { atomic.StoreInt32((*int32)(b), 0) }
+func (b *atomicBool) setTrue()    { atomic.StoreInt32((*int32)(b), 1) }
+func (b *atomicBool) swap(new bool) bool {
+	var newInt int32
+	if new {
+		newInt = 1
+	}
+	return atomic.SwapInt32((*int32)(b), newInt) == 1
+}
+
+const (
+	cFILE_SKIP_COMPLETION_PORT_ON_SUCCESS = 1
+	cFILE_SKIP_SET_EVENT_ON_HANDLE        = 2
+)
+
+var (
+	ErrFileClosed = errors.New("file has already been closed")
+	ErrTimeout    = &timeoutError{}
+)
+
+type timeoutError struct{}
+
+func (e *timeoutError) Error() string   { return "i/o timeout" }
+func (e *timeoutError) Timeout() bool   { return true }
+func (e *timeoutError) Temporary() bool { return true }
+
+type timeoutChan chan struct{}
+
+var ioInitOnce sync.Once
+var ioCompletionPort syscall.Handle
+
+// ioResult contains the result of an asynchronous IO operation
+type ioResult struct {
+	bytes uint32
+	err   error
+}
+
+// ioOperation represents an outstanding asynchronous Win32 IO
+type ioOperation struct {
+	o  syscall.Overlapped
+	ch chan ioResult
+}
+
+func initIo() {
+	h, err := createIoCompletionPort(syscall.InvalidHandle, 0, 0, 0xffffffff)
+	if err != nil {
+		panic(err)
+	}
+	ioCompletionPort = h
+	go ioCompletionProcessor(h)
+}
+
+// win32File implements Reader, Writer, and Closer on a Win32 handle without blocking in a syscall.
+// It takes ownership of this handle and will close it if it is garbage collected.
+type win32File struct {
+	handle        syscall.Handle
+	wg            sync.WaitGroup
+	wgLock        sync.RWMutex
+	closing       atomicBool
+	readDeadline  deadlineHandler
+	writeDeadline deadlineHandler
+}
+
+type deadlineHandler struct {
+	setLock     sync.Mutex
+	channel     timeoutChan
+	channelLock sync.RWMutex
+	timer       *time.Timer
+	timedout    atomicBool
+}
+
+// makeWin32File makes a new win32File from an existing file handle
+func makeWin32File(h syscall.Handle) (*win32File, error) {
+	f := &win32File{handle: h}
+	ioInitOnce.Do(initIo)
+	_, err := createIoCompletionPort(h, ioCompletionPort, 0, 0xffffffff)
+	if err != nil {
+		return nil, err
+	}
+	err = setFileCompletionNotificationModes(h, cFILE_SKIP_COMPLETION_PORT_ON_SUCCESS|cFILE_SKIP_SET_EVENT_ON_HANDLE)
+	if err != nil {
+		return nil, err
+	}
+	f.readDeadline.channel = make(timeoutChan)
+	f.writeDeadline.channel = make(timeoutChan)
+	return f, nil
+}
+
+func MakeOpenFile(h syscall.Handle) (io.ReadWriteCloser, error) {
+	return makeWin32File(h)
+}
+
+// closeHandle closes the resources associated with a Win32 handle
+func (f *win32File) closeHandle() {
+	f.wgLock.Lock()
+	// Atomically set that we are closing, releasing the resources only once.
+	if !f.closing.swap(true) {
+		f.wgLock.Unlock()
+		// cancel all IO and wait for it to complete
+		cancelIoEx(f.handle, nil)
+		f.wg.Wait()
+		// at this point, no new IO can start
+		syscall.Close(f.handle)
+		f.handle = 0
+	} else {
+		f.wgLock.Unlock()
+	}
+}
+
+// Close closes a win32File.
+func (f *win32File) Close() error {
+	f.closeHandle()
+	return nil
+}
+
+// prepareIo prepares for a new IO operation.
+// The caller must call f.wg.Done() when the IO is finished, prior to Close() returning.
+func (f *win32File) prepareIo() (*ioOperation, error) {
+	f.wgLock.RLock()
+	if f.closing.isSet() {
+		f.wgLock.RUnlock()
+		return nil, ErrFileClosed
+	}
+	f.wg.Add(1)
+	f.wgLock.RUnlock()
+	c := &ioOperation{}
+	c.ch = make(chan ioResult)
+	return c, nil
+}
+
+// ioCompletionProcessor processes completed async IOs forever
+func ioCompletionProcessor(h syscall.Handle) {
+	for {
+		var bytes uint32
+		var key uintptr
+		var op *ioOperation
+		err := getQueuedCompletionStatus(h, &bytes, &key, &op, syscall.INFINITE)
+		if op == nil {
+			panic(err)
+		}
+		op.ch <- ioResult{bytes, err}
+	}
+}
+
+// asyncIo processes the return value from ReadFile or WriteFile, blocking until
+// the operation has actually completed.
+func (f *win32File) asyncIo(c *ioOperation, d *deadlineHandler, bytes uint32, err error) (int, error) {
+	if err != syscall.ERROR_IO_PENDING {
+		return int(bytes), err
+	}
+
+	if f.closing.isSet() {
+		cancelIoEx(f.handle, &c.o)
+	}
+
+	var timeout timeoutChan
+	if d != nil {
+		d.channelLock.Lock()
+		timeout = d.channel
+		d.channelLock.Unlock()
+	}
+
+	var r ioResult
+	select {
+	case r = <-c.ch:
+		err = r.err
+		if err == syscall.ERROR_OPERATION_ABORTED {
+			if f.closing.isSet() {
+				err = ErrFileClosed
+			}
+		}
+	case <-timeout:
+		cancelIoEx(f.handle, &c.o)
+		r = <-c.ch
+		err = r.err
+		if err == syscall.ERROR_OPERATION_ABORTED {
+			err = ErrTimeout
+		}
+	}
+
+	// runtime.KeepAlive is needed, as c is passed via native
+	// code to ioCompletionProcessor, c must remain alive
+	// until the channel read is complete.
+	runtime.KeepAlive(c)
+	return int(r.bytes), err
+}
+
+// Read reads from a file handle.
+func (f *win32File) Read(b []byte) (int, error) {
+	c, err := f.prepareIo()
+	if err != nil {
+		return 0, err
+	}
+	defer f.wg.Done()
+
+	if f.readDeadline.timedout.isSet() {
+		return 0, ErrTimeout
+	}
+
+	var bytes uint32
+	err = syscall.ReadFile(f.handle, b, &bytes, &c.o)
+	n, err := f.asyncIo(c, &f.readDeadline, bytes, err)
+	runtime.KeepAlive(b)
+
+	// Handle EOF conditions.
+	if err == nil && n == 0 && len(b) != 0 {
+		return 0, io.EOF
+	} else if err == syscall.ERROR_BROKEN_PIPE {
+		return 0, io.EOF
+	} else {
+		return n, err
+	}
+}
+
+// Write writes to a file handle.
+func (f *win32File) Write(b []byte) (int, error) {
+	c, err := f.prepareIo()
+	if err != nil {
+		return 0, err
+	}
+	defer f.wg.Done()
+
+	if f.writeDeadline.timedout.isSet() {
+		return 0, ErrTimeout
+	}
+
+	var bytes uint32
+	err = syscall.WriteFile(f.handle, b, &bytes, &c.o)
+	n, err := f.asyncIo(c, &f.writeDeadline, bytes, err)
+	runtime.KeepAlive(b)
+	return n, err
+}
+
+func (f *win32File) SetReadDeadline(deadline time.Time) error {
+	return f.readDeadline.set(deadline)
+}
+
+func (f *win32File) SetWriteDeadline(deadline time.Time) error {
+	return f.writeDeadline.set(deadline)
+}
+
+func (f *win32File) Flush() error {
+	return syscall.FlushFileBuffers(f.handle)
+}
+
+func (d *deadlineHandler) set(deadline time.Time) error {
+	d.setLock.Lock()
+	defer d.setLock.Unlock()
+
+	if d.timer != nil {
+		if !d.timer.Stop() {
+			<-d.channel
+		}
+		d.timer = nil
+	}
+	d.timedout.setFalse()
+
+	select {
+	case <-d.channel:
+		d.channelLock.Lock()
+		d.channel = make(chan struct{})
+		d.channelLock.Unlock()
+	default:
+	}
+
+	if deadline.IsZero() {
+		return nil
+	}
+
+	timeoutIO := func() {
+		d.timedout.setTrue()
+		close(d.channel)
+	}
+
+	now := time.Now()
+	duration := deadline.Sub(now)
+	if deadline.After(now) {
+		// Deadline is in the future, set a timer to wait
+		d.timer = time.AfterFunc(duration, timeoutIO)
+	} else {
+		// Deadline is in the past. Cancel all pending IO now.
+		timeoutIO()
+	}
+	return nil
+}

vendor/github.com/Microsoft/go-winio/fileinfo.go

@@ -0,0 +1,61 @@
+// +build windows
+
+package winio
+
+import (
+	"os"
+	"runtime"
+	"syscall"
+	"unsafe"
+)
+
+//sys getFileInformationByHandleEx(h syscall.Handle, class uint32, buffer *byte, size uint32) (err error) = GetFileInformationByHandleEx
+//sys setFileInformationByHandle(h syscall.Handle, class uint32, buffer *byte, size uint32) (err error) = SetFileInformationByHandle
+
+const (
+	fileBasicInfo = 0
+	fileIDInfo    = 0x12
+)
+
+// FileBasicInfo contains file access time and file attributes information.
+type FileBasicInfo struct {
+	CreationTime, LastAccessTime, LastWriteTime, ChangeTime syscall.Filetime
+	FileAttributes                                          uint32
+	pad                                                     uint32 // padding
+}
+
+// GetFileBasicInfo retrieves times and attributes for a file.
+func GetFileBasicInfo(f *os.File) (*FileBasicInfo, error) {
+	bi := &FileBasicInfo{}
+	if err := getFileInformationByHandleEx(syscall.Handle(f.Fd()), fileBasicInfo, (*byte)(unsafe.Pointer(bi)), uint32(unsafe.Sizeof(*bi))); err != nil {
+		return nil, &os.PathError{Op: "GetFileInformationByHandleEx", Path: f.Name(), Err: err}
+	}
+	runtime.KeepAlive(f)
+	return bi, nil
+}
+
+// SetFileBasicInfo sets times and attributes for a file.
+func SetFileBasicInfo(f *os.File, bi *FileBasicInfo) error {
+	if err := setFileInformationByHandle(syscall.Handle(f.Fd()), fileBasicInfo, (*byte)(unsafe.Pointer(bi)), uint32(unsafe.Sizeof(*bi))); err != nil {
+		return &os.PathError{Op: "SetFileInformationByHandle", Path: f.Name(), Err: err}
+	}
+	runtime.KeepAlive(f)
+	return nil
+}
+
+// FileIDInfo contains the volume serial number and file ID for a file. This pair should be
+// unique on a system.
+type FileIDInfo struct {
+	VolumeSerialNumber uint64
+	FileID             [16]byte
+}
+
+// GetFileID retrieves the unique (volume, file ID) pair for a file.
+func GetFileID(f *os.File) (*FileIDInfo, error) {
+	fileID := &FileIDInfo{}
+	if err := getFileInformationByHandleEx(syscall.Handle(f.Fd()), fileIDInfo, (*byte)(unsafe.Pointer(fileID)), uint32(unsafe.Sizeof(*fileID))); err != nil {
+		return nil, &os.PathError{Op: "GetFileInformationByHandleEx", Path: f.Name(), Err: err}
+	}
+	runtime.KeepAlive(f)
+	return fileID, nil
+}

vendor/github.com/Microsoft/go-winio/pipe.go

@@ -0,0 +1,421 @@
+// +build windows
+
+package winio
+
+import (
+	"errors"
+	"io"
+	"net"
+	"os"
+	"syscall"
+	"time"
+	"unsafe"
+)
+
+//sys connectNamedPipe(pipe syscall.Handle, o *syscall.Overlapped) (err error) = ConnectNamedPipe
+//sys createNamedPipe(name string, flags uint32, pipeMode uint32, maxInstances uint32, outSize uint32, inSize uint32, defaultTimeout uint32, sa *syscall.SecurityAttributes) (handle syscall.Handle, err error)  [failretval==syscall.InvalidHandle] = CreateNamedPipeW
+//sys createFile(name string, access uint32, mode uint32, sa *syscall.SecurityAttributes, createmode uint32, attrs uint32, templatefile syscall.Handle) (handle syscall.Handle, err error) [failretval==syscall.InvalidHandle] = CreateFileW
+//sys getNamedPipeInfo(pipe syscall.Handle, flags *uint32, outSize *uint32, inSize *uint32, maxInstances *uint32) (err error) = GetNamedPipeInfo
+//sys getNamedPipeHandleState(pipe syscall.Handle, state *uint32, curInstances *uint32, maxCollectionCount *uint32, collectDataTimeout *uint32, userName *uint16, maxUserNameSize uint32) (err error) = GetNamedPipeHandleStateW
+//sys localAlloc(uFlags uint32, length uint32) (ptr uintptr) = LocalAlloc
+
+const (
+	cERROR_PIPE_BUSY      = syscall.Errno(231)
+	cERROR_NO_DATA        = syscall.Errno(232)
+	cERROR_PIPE_CONNECTED = syscall.Errno(535)
+	cERROR_SEM_TIMEOUT    = syscall.Errno(121)
+
+	cPIPE_ACCESS_DUPLEX            = 0x3
+	cFILE_FLAG_FIRST_PIPE_INSTANCE = 0x80000
+	cSECURITY_SQOS_PRESENT         = 0x100000
+	cSECURITY_ANONYMOUS            = 0
+
+	cPIPE_REJECT_REMOTE_CLIENTS = 0x8
+
+	cPIPE_UNLIMITED_INSTANCES = 255
+
+	cNMPWAIT_USE_DEFAULT_WAIT = 0
+	cNMPWAIT_NOWAIT           = 1
+
+	cPIPE_TYPE_MESSAGE = 4
+
+	cPIPE_READMODE_MESSAGE = 2
+)
+
+var (
+	// ErrPipeListenerClosed is returned for pipe operations on listeners that have been closed.
+	// This error should match net.errClosing since docker takes a dependency on its text.
+	ErrPipeListenerClosed = errors.New("use of closed network connection")
+
+	errPipeWriteClosed = errors.New("pipe has been closed for write")
+)
+
+type win32Pipe struct {
+	*win32File
+	path string
+}
+
+type win32MessageBytePipe struct {
+	win32Pipe
+	writeClosed bool
+	readEOF     bool
+}
+
+type pipeAddress string
+
+func (f *win32Pipe) LocalAddr() net.Addr {
+	return pipeAddress(f.path)
+}
+
+func (f *win32Pipe) RemoteAddr() net.Addr {
+	return pipeAddress(f.path)
+}
+
+func (f *win32Pipe) SetDeadline(t time.Time) error {
+	f.SetReadDeadline(t)
+	f.SetWriteDeadline(t)
+	return nil
+}
+
+// CloseWrite closes the write side of a message pipe in byte mode.
+func (f *win32MessageBytePipe) CloseWrite() error {
+	if f.writeClosed {
+		return errPipeWriteClosed
+	}
+	err := f.win32File.Flush()
+	if err != nil {
+		return err
+	}
+	_, err = f.win32File.Write(nil)
+	if err != nil {
+		return err
+	}
+	f.writeClosed = true
+	return nil
+}
+
+// Write writes bytes to a message pipe in byte mode. Zero-byte writes are ignored, since
+// they are used to implement CloseWrite().
+func (f *win32MessageBytePipe) Write(b []byte) (int, error) {
+	if f.writeClosed {
+		return 0, errPipeWriteClosed
+	}
+	if len(b) == 0 {
+		return 0, nil
+	}
+	return f.win32File.Write(b)
+}
+
+// Read reads bytes from a message pipe in byte mode. A read of a zero-byte message on a message
+// mode pipe will return io.EOF, as will all subsequent reads.
+func (f *win32MessageBytePipe) Read(b []byte) (int, error) {
+	if f.readEOF {
+		return 0, io.EOF
+	}
+	n, err := f.win32File.Read(b)
+	if err == io.EOF {
+		// If this was the result of a zero-byte read, then
+		// it is possible that the read was due to a zero-size
+		// message. Since we are simulating CloseWrite with a
+		// zero-byte message, ensure that all future Read() calls
+		// also return EOF.
+		f.readEOF = true
+	} else if err == syscall.ERROR_MORE_DATA {
+		// ERROR_MORE_DATA indicates that the pipe's read mode is message mode
+		// and the message still has more bytes. Treat this as a success, since
+		// this package presents all named pipes as byte streams.
+		err = nil
+	}
+	return n, err
+}
+
+func (s pipeAddress) Network() string {
+	return "pipe"
+}
+
+func (s pipeAddress) String() string {
+	return string(s)
+}
+
+// DialPipe connects to a named pipe by path, timing out if the connection
+// takes longer than the specified duration. If timeout is nil, then we use
+// a default timeout of 5 seconds.  (We do not use WaitNamedPipe.)
+func DialPipe(path string, timeout *time.Duration) (net.Conn, error) {
+	var absTimeout time.Time
+	if timeout != nil {
+		absTimeout = time.Now().Add(*timeout)
+	} else {
+		absTimeout = time.Now().Add(time.Second * 2)
+	}
+	var err error
+	var h syscall.Handle
+	for {
+		h, err = createFile(path, syscall.GENERIC_READ|syscall.GENERIC_WRITE, 0, nil, syscall.OPEN_EXISTING, syscall.FILE_FLAG_OVERLAPPED|cSECURITY_SQOS_PRESENT|cSECURITY_ANONYMOUS, 0)
+		if err != cERROR_PIPE_BUSY {
+			break
+		}
+		if time.Now().After(absTimeout) {
+			return nil, ErrTimeout
+		}
+
+		// Wait 10 msec and try again. This is a rather simplistic
+		// view, as we always try each 10 milliseconds.
+		time.Sleep(time.Millisecond * 10)
+	}
+	if err != nil {
+		return nil, &os.PathError{Op: "open", Path: path, Err: err}
+	}
+
+	var flags uint32
+	err = getNamedPipeInfo(h, &flags, nil, nil, nil)
+	if err != nil {
+		return nil, err
+	}
+
+	f, err := makeWin32File(h)
+	if err != nil {
+		syscall.Close(h)
+		return nil, err
+	}
+
+	// If the pipe is in message mode, return a message byte pipe, which
+	// supports CloseWrite().
+	if flags&cPIPE_TYPE_MESSAGE != 0 {
+		return &win32MessageBytePipe{
+			win32Pipe: win32Pipe{win32File: f, path: path},
+		}, nil
+	}
+	return &win32Pipe{win32File: f, path: path}, nil
+}
+
+type acceptResponse struct {
+	f   *win32File
+	err error
+}
+
+type win32PipeListener struct {
+	firstHandle        syscall.Handle
+	path               string
+	securityDescriptor []byte
+	config             PipeConfig
+	acceptCh           chan (chan acceptResponse)
+	closeCh            chan int
+	doneCh             chan int
+}
+
+func makeServerPipeHandle(path string, securityDescriptor []byte, c *PipeConfig, first bool) (syscall.Handle, error) {
+	var flags uint32 = cPIPE_ACCESS_DUPLEX | syscall.FILE_FLAG_OVERLAPPED
+	if first {
+		flags |= cFILE_FLAG_FIRST_PIPE_INSTANCE
+	}
+
+	var mode uint32 = cPIPE_REJECT_REMOTE_CLIENTS
+	if c.MessageMode {
+		mode |= cPIPE_TYPE_MESSAGE
+	}
+
+	sa := &syscall.SecurityAttributes{}
+	sa.Length = uint32(unsafe.Sizeof(*sa))
+	if securityDescriptor != nil {
+		len := uint32(len(securityDescriptor))
+		sa.SecurityDescriptor = localAlloc(0, len)
+		defer localFree(sa.SecurityDescriptor)
+		copy((*[0xffff]byte)(unsafe.Pointer(sa.SecurityDescriptor))[:], securityDescriptor)
+	}
+	h, err := createNamedPipe(path, flags, mode, cPIPE_UNLIMITED_INSTANCES, uint32(c.OutputBufferSize), uint32(c.InputBufferSize), 0, sa)
+	if err != nil {
+		return 0, &os.PathError{Op: "open", Path: path, Err: err}
+	}
+	return h, nil
+}
+
+func (l *win32PipeListener) makeServerPipe() (*win32File, error) {
+	h, err := makeServerPipeHandle(l.path, l.securityDescriptor, &l.config, false)
+	if err != nil {
+		return nil, err
+	}
+	f, err := makeWin32File(h)
+	if err != nil {
+		syscall.Close(h)
+		return nil, err
+	}
+	return f, nil
+}
+
+func (l *win32PipeListener) makeConnectedServerPipe() (*win32File, error) {
+	p, err := l.makeServerPipe()
+	if err != nil {
+		return nil, err
+	}
+
+	// Wait for the client to connect.
+	ch := make(chan error)
+	go func(p *win32File) {
+		ch <- connectPipe(p)
+	}(p)
+
+	select {
+	case err = <-ch:
+		if err != nil {
+			p.Close()
+			p = nil
+		}
+	case <-l.closeCh:
+		// Abort the connect request by closing the handle.
+		p.Close()
+		p = nil
+		err = <-ch
+		if err == nil || err == ErrFileClosed {
+			err = ErrPipeListenerClosed
+		}
+	}
+	return p, err
+}
+
+func (l *win32PipeListener) listenerRoutine() {
+	closed := false
+	for !closed {
+		select {
+		case <-l.closeCh:
+			closed = true
+		case responseCh := <-l.acceptCh:
+			var (
+				p   *win32File
+				err error
+			)
+			for {
+				p, err = l.makeConnectedServerPipe()
+				// If the connection was immediately closed by the client, try
+				// again.
+				if err != cERROR_NO_DATA {
+					break
+				}
+			}
+			responseCh <- acceptResponse{p, err}
+			closed = err == ErrPipeListenerClosed
+		}
+	}
+	syscall.Close(l.firstHandle)
+	l.firstHandle = 0
+	// Notify Close() and Accept() callers that the handle has been closed.
+	close(l.doneCh)
+}
+
+// PipeConfig contain configuration for the pipe listener.
+type PipeConfig struct {
+	// SecurityDescriptor contains a Windows security descriptor in SDDL format.
+	SecurityDescriptor string
+
+	// MessageMode determines whether the pipe is in byte or message mode. In either
+	// case the pipe is read in byte mode by default. The only practical difference in
+	// this implementation is that CloseWrite() is only supported for message mode pipes;
+	// CloseWrite() is implemented as a zero-byte write, but zero-byte writes are only
+	// transferred to the reader (and returned as io.EOF in this implementation)
+	// when the pipe is in message mode.
+	MessageMode bool
+
+	// InputBufferSize specifies the size the input buffer, in bytes.
+	InputBufferSize int32
+
+	// OutputBufferSize specifies the size the input buffer, in bytes.
+	OutputBufferSize int32
+}
+
+// ListenPipe creates a listener on a Windows named pipe path, e.g. \\.\pipe\mypipe.
+// The pipe must not already exist.
+func ListenPipe(path string, c *PipeConfig) (net.Listener, error) {
+	var (
+		sd  []byte
+		err error
+	)
+	if c == nil {
+		c = &PipeConfig{}
+	}
+	if c.SecurityDescriptor != "" {
+		sd, err = SddlToSecurityDescriptor(c.SecurityDescriptor)
+		if err != nil {
+			return nil, err
+		}
+	}
+	h, err := makeServerPipeHandle(path, sd, c, true)
+	if err != nil {
+		return nil, err
+	}
+	// Create a client handle and connect it.  This results in the pipe
+	// instance always existing, so that clients see ERROR_PIPE_BUSY
+	// rather than ERROR_FILE_NOT_FOUND.  This ties the first instance
+	// up so that no other instances can be used.  This would have been
+	// cleaner if the Win32 API matched CreateFile with ConnectNamedPipe
+	// instead of CreateNamedPipe.  (Apparently created named pipes are
+	// considered to be in listening state regardless of whether any
+	// active calls to ConnectNamedPipe are outstanding.)
+	h2, err := createFile(path, 0, 0, nil, syscall.OPEN_EXISTING, cSECURITY_SQOS_PRESENT|cSECURITY_ANONYMOUS, 0)
+	if err != nil {
+		syscall.Close(h)
+		return nil, err
+	}
+	// Close the client handle. The server side of the instance will
+	// still be busy, leading to ERROR_PIPE_BUSY instead of
+	// ERROR_NOT_FOUND, as long as we don't close the server handle,
+	// or disconnect the client with DisconnectNamedPipe.
+	syscall.Close(h2)
+	l := &win32PipeListener{
+		firstHandle:        h,
+		path:               path,
+		securityDescriptor: sd,
+		config:             *c,
+		acceptCh:           make(chan (chan acceptResponse)),
+		closeCh:            make(chan int),
+		doneCh:             make(chan int),
+	}
+	go l.listenerRoutine()
+	return l, nil
+}
+
+func connectPipe(p *win32File) error {
+	c, err := p.prepareIo()
+	if err != nil {
+		return err
+	}
+	defer p.wg.Done()
+
+	err = connectNamedPipe(p.handle, &c.o)
+	_, err = p.asyncIo(c, nil, 0, err)
+	if err != nil && err != cERROR_PIPE_CONNECTED {
+		return err
+	}
+	return nil
+}
+
+func (l *win32PipeListener) Accept() (net.Conn, error) {
+	ch := make(chan acceptResponse)
+	select {
+	case l.acceptCh <- ch:
+		response := <-ch
+		err := response.err
+		if err != nil {
+			return nil, err
+		}
+		if l.config.MessageMode {
+			return &win32MessageBytePipe{
+				win32Pipe: win32Pipe{win32File: response.f, path: l.path},
+			}, nil
+		}
+		return &win32Pipe{win32File: response.f, path: l.path}, nil
+	case <-l.doneCh:
+		return nil, ErrPipeListenerClosed
+	}
+}
+
+func (l *win32PipeListener) Close() error {
+	select {
+	case l.closeCh <- 1:
+		<-l.doneCh
+	case <-l.doneCh:
+	}
+	return nil
+}
+
+func (l *win32PipeListener) Addr() net.Addr {
+	return pipeAddress(l.path)
+}

vendor/github.com/Microsoft/go-winio/privilege.go

@@ -0,0 +1,202 @@
+// +build windows
+
+package winio
+
+import (
+	"bytes"
+	"encoding/binary"
+	"fmt"
+	"runtime"
+	"sync"
+	"syscall"
+	"unicode/utf16"
+
+	"golang.org/x/sys/windows"
+)
+
+//sys adjustTokenPrivileges(token windows.Token, releaseAll bool, input *byte, outputSize uint32, output *byte, requiredSize *uint32) (success bool, err error) [true] = advapi32.AdjustTokenPrivileges
+//sys impersonateSelf(level uint32) (err error) = advapi32.ImpersonateSelf
+//sys revertToSelf() (err error) = advapi32.RevertToSelf
+//sys openThreadToken(thread syscall.Handle, accessMask uint32, openAsSelf bool, token *windows.Token) (err error) = advapi32.OpenThreadToken
+//sys getCurrentThread() (h syscall.Handle) = GetCurrentThread
+//sys lookupPrivilegeValue(systemName string, name string, luid *uint64) (err error) = advapi32.LookupPrivilegeValueW
+//sys lookupPrivilegeName(systemName string, luid *uint64, buffer *uint16, size *uint32) (err error) = advapi32.LookupPrivilegeNameW
+//sys lookupPrivilegeDisplayName(systemName string, name *uint16, buffer *uint16, size *uint32, languageId *uint32) (err error) = advapi32.LookupPrivilegeDisplayNameW
+
+const (
+	SE_PRIVILEGE_ENABLED = 2
+
+	ERROR_NOT_ALL_ASSIGNED syscall.Errno = 1300
+
+	SeBackupPrivilege  = "SeBackupPrivilege"
+	SeRestorePrivilege = "SeRestorePrivilege"
+)
+
+const (
+	securityAnonymous = iota
+	securityIdentification
+	securityImpersonation
+	securityDelegation
+)
+
+var (
+	privNames     = make(map[string]uint64)
+	privNameMutex sync.Mutex
+)
+
+// PrivilegeError represents an error enabling privileges.
+type PrivilegeError struct {
+	privileges []uint64
+}
+
+func (e *PrivilegeError) Error() string {
+	s := ""
+	if len(e.privileges) > 1 {
+		s = "Could not enable privileges "
+	} else {
+		s = "Could not enable privilege "
+	}
+	for i, p := range e.privileges {
+		if i != 0 {
+			s += ", "
+		}
+		s += `"`
+		s += getPrivilegeName(p)
+		s += `"`
+	}
+	return s
+}
+
+// RunWithPrivilege enables a single privilege for a function call.
+func RunWithPrivilege(name string, fn func() error) error {
+	return RunWithPrivileges([]string{name}, fn)
+}
+
+// RunWithPrivileges enables privileges for a function call.
+func RunWithPrivileges(names []string, fn func() error) error {
+	privileges, err := mapPrivileges(names)
+	if err != nil {
+		return err
+	}
+	runtime.LockOSThread()
+	defer runtime.UnlockOSThread()
+	token, err := newThreadToken()
+	if err != nil {
+		return err
+	}
+	defer releaseThreadToken(token)
+	err = adjustPrivileges(token, privileges, SE_PRIVILEGE_ENABLED)
+	if err != nil {
+		return err
+	}
+	return fn()
+}
+
+func mapPrivileges(names []string) ([]uint64, error) {
+	var privileges []uint64
+	privNameMutex.Lock()
+	defer privNameMutex.Unlock()
+	for _, name := range names {
+		p, ok := privNames[name]
+		if !ok {
+			err := lookupPrivilegeValue("", name, &p)
+			if err != nil {
+				return nil, err
+			}
+			privNames[name] = p
+		}
+		privileges = append(privileges, p)
+	}
+	return privileges, nil
+}
+
+// EnableProcessPrivileges enables privileges globally for the process.
+func EnableProcessPrivileges(names []string) error {
+	return enableDisableProcessPrivilege(names, SE_PRIVILEGE_ENABLED)
+}
+
+// DisableProcessPrivileges disables privileges globally for the process.
+func DisableProcessPrivileges(names []string) error {
+	return enableDisableProcessPrivilege(names, 0)
+}
+
+func enableDisableProcessPrivilege(names []string, action uint32) error {
+	privileges, err := mapPrivileges(names)
+	if err != nil {
+		return err
+	}
+
+	p, _ := windows.GetCurrentProcess()
+	var token windows.Token
+	err = windows.OpenProcessToken(p, windows.TOKEN_ADJUST_PRIVILEGES|windows.TOKEN_QUERY, &token)
+	if err != nil {
+		return err
+	}
+
+	defer token.Close()
+	return adjustPrivileges(token, privileges, action)
+}
+
+func adjustPrivileges(token windows.Token, privileges []uint64, action uint32) error {
+	var b bytes.Buffer
+	binary.Write(&b, binary.LittleEndian, uint32(len(privileges)))
+	for _, p := range privileges {
+		binary.Write(&b, binary.LittleEndian, p)
+		binary.Write(&b, binary.LittleEndian, action)
+	}
+	prevState := make([]byte, b.Len())
+	reqSize := uint32(0)
+	success, err := adjustTokenPrivileges(token, false, &b.Bytes()[0], uint32(len(prevState)), &prevState[0], &reqSize)
+	if !success {
+		return err
+	}
+	if err == ERROR_NOT_ALL_ASSIGNED {
+		return &PrivilegeError{privileges}
+	}
+	return nil
+}
+
+func getPrivilegeName(luid uint64) string {
+	var nameBuffer [256]uint16
+	bufSize := uint32(len(nameBuffer))
+	err := lookupPrivilegeName("", &luid, &nameBuffer[0], &bufSize)
+	if err != nil {
+		return fmt.Sprintf("<unknown privilege %d>", luid)
+	}
+
+	var displayNameBuffer [256]uint16
+	displayBufSize := uint32(len(displayNameBuffer))
+	var langID uint32
+	err = lookupPrivilegeDisplayName("", &nameBuffer[0], &displayNameBuffer[0], &displayBufSize, &langID)
+	if err != nil {
+		return fmt.Sprintf("<unknown privilege %s>", string(utf16.Decode(nameBuffer[:bufSize])))
+	}
+
+	return string(utf16.Decode(displayNameBuffer[:displayBufSize]))
+}
+
+func newThreadToken() (windows.Token, error) {
+	err := impersonateSelf(securityImpersonation)
+	if err != nil {
+		return 0, err
+	}
+
+	var token windows.Token
+	err = openThreadToken(getCurrentThread(), syscall.TOKEN_ADJUST_PRIVILEGES|syscall.TOKEN_QUERY, false, &token)
+	if err != nil {
+		rerr := revertToSelf()
+		if rerr != nil {
+			panic(rerr)
+		}
+		return 0, err
+	}
+	return token, nil
+}
+
+func releaseThreadToken(h windows.Token) {
+	err := revertToSelf()
+	if err != nil {
+		panic(err)
+	}
+	h.Close()
+}

vendor/github.com/Microsoft/go-winio/reparse.go

@@ -0,0 +1,128 @@
+package winio
+
+import (
+	"bytes"
+	"encoding/binary"
+	"fmt"
+	"strings"
+	"unicode/utf16"
+	"unsafe"
+)
+
+const (
+	reparseTagMountPoint = 0xA0000003
+	reparseTagSymlink    = 0xA000000C
+)
+
+type reparseDataBuffer struct {
+	ReparseTag           uint32
+	ReparseDataLength    uint16
+	Reserved             uint16
+	SubstituteNameOffset uint16
+	SubstituteNameLength uint16
+	PrintNameOffset      uint16
+	PrintNameLength      uint16
+}
+
+// ReparsePoint describes a Win32 symlink or mount point.
+type ReparsePoint struct {
+	Target       string
+	IsMountPoint bool
+}
+
+// UnsupportedReparsePointError is returned when trying to decode a non-symlink or
+// mount point reparse point.
+type UnsupportedReparsePointError struct {
+	Tag uint32
+}
+
+func (e *UnsupportedReparsePointError) Error() string {
+	return fmt.Sprintf("unsupported reparse point %x", e.Tag)
+}
+
+// DecodeReparsePoint decodes a Win32 REPARSE_DATA_BUFFER structure containing either a symlink
+// or a mount point.
+func DecodeReparsePoint(b []byte) (*ReparsePoint, error) {
+	tag := binary.LittleEndian.Uint32(b[0:4])
+	return DecodeReparsePointData(tag, b[8:])
+}
+
+func DecodeReparsePointData(tag uint32, b []byte) (*ReparsePoint, error) {
+	isMountPoint := false
+	switch tag {
+	case reparseTagMountPoint:
+		isMountPoint = true
+	case reparseTagSymlink:
+	default:
+		return nil, &UnsupportedReparsePointError{tag}
+	}
+	nameOffset := 8 + binary.LittleEndian.Uint16(b[4:6])
+	if !isMountPoint {
+		nameOffset += 4
+	}
+	nameLength := binary.LittleEndian.Uint16(b[6:8])
+	name := make([]uint16, nameLength/2)
+	err := binary.Read(bytes.NewReader(b[nameOffset:nameOffset+nameLength]), binary.LittleEndian, &name)
+	if err != nil {
+		return nil, err
+	}
+	return &ReparsePoint{string(utf16.Decode(name)), isMountPoint}, nil
+}
+
+func isDriveLetter(c byte) bool {
+	return (c >= 'a' && c <= 'z') || (c >= 'A' && c <= 'Z')
+}
+
+// EncodeReparsePoint encodes a Win32 REPARSE_DATA_BUFFER structure describing a symlink or
+// mount point.
+func EncodeReparsePoint(rp *ReparsePoint) []byte {
+	// Generate an NT path and determine if this is a relative path.
+	var ntTarget string
+	relative := false
+	if strings.HasPrefix(rp.Target, `\\?\`) {
+		ntTarget = `\??\` + rp.Target[4:]
+	} else if strings.HasPrefix(rp.Target, `\\`) {
+		ntTarget = `\??\UNC\` + rp.Target[2:]
+	} else if len(rp.Target) >= 2 && isDriveLetter(rp.Target[0]) && rp.Target[1] == ':' {
+		ntTarget = `\??\` + rp.Target
+	} else {
+		ntTarget = rp.Target
+		relative = true
+	}
+
+	// The paths must be NUL-terminated even though they are counted strings.
+	target16 := utf16.Encode([]rune(rp.Target + "\x00"))
+	ntTarget16 := utf16.Encode([]rune(ntTarget + "\x00"))
+
+	size := int(unsafe.Sizeof(reparseDataBuffer{})) - 8
+	size += len(ntTarget16)*2 + len(target16)*2
+
+	tag := uint32(reparseTagMountPoint)
+	if !rp.IsMountPoint {
+		tag = reparseTagSymlink
+		size += 4 // Add room for symlink flags
+	}
+
+	data := reparseDataBuffer{
+		ReparseTag:           tag,
+		ReparseDataLength:    uint16(size),
+		SubstituteNameOffset: 0,
+		SubstituteNameLength: uint16((len(ntTarget16) - 1) * 2),
+		PrintNameOffset:      uint16(len(ntTarget16) * 2),
+		PrintNameLength:      uint16((len(target16) - 1) * 2),
+	}
+
+	var b bytes.Buffer
+	binary.Write(&b, binary.LittleEndian, &data)
+	if !rp.IsMountPoint {
+		flags := uint32(0)
+		if relative {
+			flags |= 1
+		}
+		binary.Write(&b, binary.LittleEndian, flags)
+	}
+
+	binary.Write(&b, binary.LittleEndian, ntTarget16)
+	binary.Write(&b, binary.LittleEndian, target16)
+	return b.Bytes()
+}

vendor/github.com/Microsoft/go-winio/sd.go

@@ -0,0 +1,98 @@
+// +build windows
+
+package winio
+
+import (
+	"syscall"
+	"unsafe"
+)
+
+//sys lookupAccountName(systemName *uint16, accountName string, sid *byte, sidSize *uint32, refDomain *uint16, refDomainSize *uint32, sidNameUse *uint32) (err error) = advapi32.LookupAccountNameW
+//sys convertSidToStringSid(sid *byte, str **uint16) (err error) = advapi32.ConvertSidToStringSidW
+//sys convertStringSecurityDescriptorToSecurityDescriptor(str string, revision uint32, sd *uintptr, size *uint32) (err error) = advapi32.ConvertStringSecurityDescriptorToSecurityDescriptorW
+//sys convertSecurityDescriptorToStringSecurityDescriptor(sd *byte, revision uint32, secInfo uint32, sddl **uint16, sddlSize *uint32) (err error) = advapi32.ConvertSecurityDescriptorToStringSecurityDescriptorW
+//sys localFree(mem uintptr) = LocalFree
+//sys getSecurityDescriptorLength(sd uintptr) (len uint32) = advapi32.GetSecurityDescriptorLength
+
+const (
+	cERROR_NONE_MAPPED = syscall.Errno(1332)
+)
+
+type AccountLookupError struct {
+	Name string
+	Err  error
+}
+
+func (e *AccountLookupError) Error() string {
+	if e.Name == "" {
+		return "lookup account: empty account name specified"
+	}
+	var s string
+	switch e.Err {
+	case cERROR_NONE_MAPPED:
+		s = "not found"
+	default:
+		s = e.Err.Error()
+	}
+	return "lookup account " + e.Name + ": " + s
+}
+
+type SddlConversionError struct {
+	Sddl string
+	Err  error
+}
+
+func (e *SddlConversionError) Error() string {
+	return "convert " + e.Sddl + ": " + e.Err.Error()
+}
+
+// LookupSidByName looks up the SID of an account by name
+func LookupSidByName(name string) (sid string, err error) {
+	if name == "" {
+		return "", &AccountLookupError{name, cERROR_NONE_MAPPED}
+	}
+
+	var sidSize, sidNameUse, refDomainSize uint32
+	err = lookupAccountName(nil, name, nil, &sidSize, nil, &refDomainSize, &sidNameUse)
+	if err != nil && err != syscall.ERROR_INSUFFICIENT_BUFFER {
+		return "", &AccountLookupError{name, err}
+	}
+	sidBuffer := make([]byte, sidSize)
+	refDomainBuffer := make([]uint16, refDomainSize)
+	err = lookupAccountName(nil, name, &sidBuffer[0], &sidSize, &refDomainBuffer[0], &refDomainSize, &sidNameUse)
+	if err != nil {
+		return "", &AccountLookupError{name, err}
+	}
+	var strBuffer *uint16
+	err = convertSidToStringSid(&sidBuffer[0], &strBuffer)
+	if err != nil {
+		return "", &AccountLookupError{name, err}
+	}
+	sid = syscall.UTF16ToString((*[0xffff]uint16)(unsafe.Pointer(strBuffer))[:])
+	localFree(uintptr(unsafe.Pointer(strBuffer)))
+	return sid, nil
+}
+
+func SddlToSecurityDescriptor(sddl string) ([]byte, error) {
+	var sdBuffer uintptr
+	err := convertStringSecurityDescriptorToSecurityDescriptor(sddl, 1, &sdBuffer, nil)
+	if err != nil {
+		return nil, &SddlConversionError{sddl, err}
+	}
+	defer localFree(sdBuffer)
+	sd := make([]byte, getSecurityDescriptorLength(sdBuffer))
+	copy(sd, (*[0xffff]byte)(unsafe.Pointer(sdBuffer))[:len(sd)])
+	return sd, nil
+}
+
+func SecurityDescriptorToSddl(sd []byte) (string, error) {
+	var sddl *uint16
+	// The returned string length seems to including an aribtrary number of terminating NULs.
+	// Don't use it.
+	err := convertSecurityDescriptorToStringSecurityDescriptor(&sd[0], 1, 0xff, &sddl, nil)
+	if err != nil {
+		return "", err
+	}
+	defer localFree(uintptr(unsafe.Pointer(sddl)))
+	return syscall.UTF16ToString((*[0xffff]uint16)(unsafe.Pointer(sddl))[:]), nil
+}

vendor/github.com/Microsoft/go-winio/syscall.go

@@ -0,0 +1,3 @@
+package winio
+
+//go:generate go run $GOROOT/src/syscall/mksyscall_windows.go -output zsyscall_windows.go file.go pipe.go sd.go fileinfo.go privilege.go backup.go

vendor/github.com/Microsoft/go-winio/zsyscall_windows.go

@@ -0,0 +1,520 @@
+// MACHINE GENERATED BY 'go generate' COMMAND; DO NOT EDIT
+
+package winio
+
+import (
+	"syscall"
+	"unsafe"
+
+	"golang.org/x/sys/windows"
+)
+
+var _ unsafe.Pointer
+
+// Do the interface allocations only once for common
+// Errno values.
+const (
+	errnoERROR_IO_PENDING = 997
+)
+
+var (
+	errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING)
+)
+
+// errnoErr returns common boxed Errno values, to prevent
+// allocations at runtime.
+func errnoErr(e syscall.Errno) error {
+	switch e {
+	case 0:
+		return nil
+	case errnoERROR_IO_PENDING:
+		return errERROR_IO_PENDING
+	}
+	// TODO: add more here, after collecting data on the common
+	// error values see on Windows. (perhaps when running
+	// all.bat?)
+	return e
+}
+
+var (
+	modkernel32 = windows.NewLazySystemDLL("kernel32.dll")
+	modadvapi32 = windows.NewLazySystemDLL("advapi32.dll")
+
+	procCancelIoEx                                           = modkernel32.NewProc("CancelIoEx")
+	procCreateIoCompletionPort                               = modkernel32.NewProc("CreateIoCompletionPort")
+	procGetQueuedCompletionStatus                            = modkernel32.NewProc("GetQueuedCompletionStatus")
+	procSetFileCompletionNotificationModes                   = modkernel32.NewProc("SetFileCompletionNotificationModes")
+	procConnectNamedPipe                                     = modkernel32.NewProc("ConnectNamedPipe")
+	procCreateNamedPipeW                                     = modkernel32.NewProc("CreateNamedPipeW")
+	procCreateFileW                                          = modkernel32.NewProc("CreateFileW")
+	procWaitNamedPipeW                                       = modkernel32.NewProc("WaitNamedPipeW")
+	procGetNamedPipeInfo                                     = modkernel32.NewProc("GetNamedPipeInfo")
+	procGetNamedPipeHandleStateW                             = modkernel32.NewProc("GetNamedPipeHandleStateW")
+	procLocalAlloc                                           = modkernel32.NewProc("LocalAlloc")
+	procLookupAccountNameW                                   = modadvapi32.NewProc("LookupAccountNameW")
+	procConvertSidToStringSidW                               = modadvapi32.NewProc("ConvertSidToStringSidW")
+	procConvertStringSecurityDescriptorToSecurityDescriptorW = modadvapi32.NewProc("ConvertStringSecurityDescriptorToSecurityDescriptorW")
+	procConvertSecurityDescriptorToStringSecurityDescriptorW = modadvapi32.NewProc("ConvertSecurityDescriptorToStringSecurityDescriptorW")
+	procLocalFree                                            = modkernel32.NewProc("LocalFree")
+	procGetSecurityDescriptorLength                          = modadvapi32.NewProc("GetSecurityDescriptorLength")
+	procGetFileInformationByHandleEx                         = modkernel32.NewProc("GetFileInformationByHandleEx")
+	procSetFileInformationByHandle                           = modkernel32.NewProc("SetFileInformationByHandle")
+	procAdjustTokenPrivileges                                = modadvapi32.NewProc("AdjustTokenPrivileges")
+	procImpersonateSelf                                      = modadvapi32.NewProc("ImpersonateSelf")
+	procRevertToSelf                                         = modadvapi32.NewProc("RevertToSelf")
+	procOpenThreadToken                                      = modadvapi32.NewProc("OpenThreadToken")
+	procGetCurrentThread                                     = modkernel32.NewProc("GetCurrentThread")
+	procLookupPrivilegeValueW                                = modadvapi32.NewProc("LookupPrivilegeValueW")
+	procLookupPrivilegeNameW                                 = modadvapi32.NewProc("LookupPrivilegeNameW")
+	procLookupPrivilegeDisplayNameW                          = modadvapi32.NewProc("LookupPrivilegeDisplayNameW")
+	procBackupRead                                           = modkernel32.NewProc("BackupRead")
+	procBackupWrite                                          = modkernel32.NewProc("BackupWrite")
+)
+
+func cancelIoEx(file syscall.Handle, o *syscall.Overlapped) (err error) {
+	r1, _, e1 := syscall.Syscall(procCancelIoEx.Addr(), 2, uintptr(file), uintptr(unsafe.Pointer(o)), 0)
+	if r1 == 0 {
+		if e1 != 0 {
+			err = errnoErr(e1)
+		} else {
+			err = syscall.EINVAL
+		}
+	}
+	return
+}
+
+func createIoCompletionPort(file syscall.Handle, port syscall.Handle, key uintptr, threadCount uint32) (newport syscall.Handle, err error) {
+	r0, _, e1 := syscall.Syscall6(procCreateIoCompletionPort.Addr(), 4, uintptr(file), uintptr(port), uintptr(key), uintptr(threadCount), 0, 0)
+	newport = syscall.Handle(r0)
+	if newport == 0 {
+		if e1 != 0 {
+			err = errnoErr(e1)
+		} else {
+			err = syscall.EINVAL
+		}
+	}
+	return
+}
+
+func getQueuedCompletionStatus(port syscall.Handle, bytes *uint32, key *uintptr, o **ioOperation, timeout uint32) (err error) {
+	r1, _, e1 := syscall.Syscall6(procGetQueuedCompletionStatus.Addr(), 5, uintptr(port), uintptr(unsafe.Pointer(bytes)), uintptr(unsafe.Pointer(key)), uintptr(unsafe.Pointer(o)), uintptr(timeout), 0)
+	if r1 == 0 {
+		if e1 != 0 {
+			err = errnoErr(e1)
+		} else {
+			err = syscall.EINVAL
+		}
+	}
+	return
+}
+
+func setFileCompletionNotificationModes(h syscall.Handle, flags uint8) (err error) {
+	r1, _, e1 := syscall.Syscall(procSetFileCompletionNotificationModes.Addr(), 2, uintptr(h), uintptr(flags), 0)
+	if r1 == 0 {
+		if e1 != 0 {
+			err = errnoErr(e1)
+		} else {
+			err = syscall.EINVAL
+		}
+	}
+	return
+}
+
+func connectNamedPipe(pipe syscall.Handle, o *syscall.Overlapped) (err error) {
+	r1, _, e1 := syscall.Syscall(procConnectNamedPipe.Addr(), 2, uintptr(pipe), uintptr(unsafe.Pointer(o)), 0)
+	if r1 == 0 {
+		if e1 != 0 {
+			err = errnoErr(e1)
+		} else {
+			err = syscall.EINVAL
+		}
+	}
+	return
+}
+
+func createNamedPipe(name string, flags uint32, pipeMode uint32, maxInstances uint32, outSize uint32, inSize uint32, defaultTimeout uint32, sa *syscall.SecurityAttributes) (handle syscall.Handle, err error) {
+	var _p0 *uint16
+	_p0, err = syscall.UTF16PtrFromString(name)
+	if err != nil {
+		return
+	}
+	return _createNamedPipe(_p0, flags, pipeMode, maxInstances, outSize, inSize, defaultTimeout, sa)
+}
+
+func _createNamedPipe(name *uint16, flags uint32, pipeMode uint32, maxInstances uint32, outSize uint32, inSize uint32, defaultTimeout uint32, sa *syscall.SecurityAttributes) (handle syscall.Handle, err error) {
+	r0, _, e1 := syscall.Syscall9(procCreateNamedPipeW.Addr(), 8, uintptr(unsafe.Pointer(name)), uintptr(flags), uintptr(pipeMode), uintptr(maxInstances), uintptr(outSize), uintptr(inSize), uintptr(defaultTimeout), uintptr(unsafe.Pointer(sa)), 0)
+	handle = syscall.Handle(r0)
+	if handle == syscall.InvalidHandle {
+		if e1 != 0 {
+			err = errnoErr(e1)
+		} else {
+			err = syscall.EINVAL
+		}
+	}
+	return
+}
+
+func createFile(name string, access uint32, mode uint32, sa *syscall.SecurityAttributes, createmode uint32, attrs uint32, templatefile syscall.Handle) (handle syscall.Handle, err error) {
+	var _p0 *uint16
+	_p0, err = syscall.UTF16PtrFromString(name)
+	if err != nil {
+		return
+	}
+	return _createFile(_p0, access, mode, sa, createmode, attrs, templatefile)
+}
+
+func _createFile(name *uint16, access uint32, mode uint32, sa *syscall.SecurityAttributes, createmode uint32, attrs uint32, templatefile syscall.Handle) (handle syscall.Handle, err error) {
+	r0, _, e1 := syscall.Syscall9(procCreateFileW.Addr(), 7, uintptr(unsafe.Pointer(name)), uintptr(access), uintptr(mode), uintptr(unsafe.Pointer(sa)), uintptr(createmode), uintptr(attrs), uintptr(templatefile), 0, 0)
+	handle = syscall.Handle(r0)
+	if handle == syscall.InvalidHandle {
+		if e1 != 0 {
+			err = errnoErr(e1)
+		} else {
+			err = syscall.EINVAL
+		}
+	}
+	return
+}
+
+func waitNamedPipe(name string, timeout uint32) (err error) {
+	var _p0 *uint16
+	_p0, err = syscall.UTF16PtrFromString(name)
+	if err != nil {
+		return
+	}
+	return _waitNamedPipe(_p0, timeout)
+}
+
+func _waitNamedPipe(name *uint16, timeout uint32) (err error) {
+	r1, _, e1 := syscall.Syscall(procWaitNamedPipeW.Addr(), 2, uintptr(unsafe.Pointer(name)), uintptr(timeout), 0)
+	if r1 == 0 {
+		if e1 != 0 {
+			err = errnoErr(e1)
+		} else {
+			err = syscall.EINVAL
+		}
+	}
+	return
+}
+
+func getNamedPipeInfo(pipe syscall.Handle, flags *uint32, outSize *uint32, inSize *uint32, maxInstances *uint32) (err error) {
+	r1, _, e1 := syscall.Syscall6(procGetNamedPipeInfo.Addr(), 5, uintptr(pipe), uintptr(unsafe.Pointer(flags)), uintptr(unsafe.Pointer(outSize)), uintptr(unsafe.Pointer(inSize)), uintptr(unsafe.Pointer(maxInstances)), 0)
+	if r1 == 0 {
+		if e1 != 0 {
+			err = errnoErr(e1)
+		} else {
+			err = syscall.EINVAL
+		}
+	}
+	return
+}
+
+func getNamedPipeHandleState(pipe syscall.Handle, state *uint32, curInstances *uint32, maxCollectionCount *uint32, collectDataTimeout *uint32, userName *uint16, maxUserNameSize uint32) (err error) {
+	r1, _, e1 := syscall.Syscall9(procGetNamedPipeHandleStateW.Addr(), 7, uintptr(pipe), uintptr(unsafe.Pointer(state)), uintptr(unsafe.Pointer(curInstances)), uintptr(unsafe.Pointer(maxCollectionCount)), uintptr(unsafe.Pointer(collectDataTimeout)), uintptr(unsafe.Pointer(userName)), uintptr(maxUserNameSize), 0, 0)
+	if r1 == 0 {
+		if e1 != 0 {
+			err = errnoErr(e1)
+		} else {
+			err = syscall.EINVAL
+		}
+	}
+	return
+}
+
+func localAlloc(uFlags uint32, length uint32) (ptr uintptr) {
+	r0, _, _ := syscall.Syscall(procLocalAlloc.Addr(), 2, uintptr(uFlags), uintptr(length), 0)
+	ptr = uintptr(r0)
+	return
+}
+
+func lookupAccountName(systemName *uint16, accountName string, sid *byte, sidSize *uint32, refDomain *uint16, refDomainSize *uint32, sidNameUse *uint32) (err error) {
+	var _p0 *uint16
+	_p0, err = syscall.UTF16PtrFromString(accountName)
+	if err != nil {
+		return
+	}
+	return _lookupAccountName(systemName, _p0, sid, sidSize, refDomain, refDomainSize, sidNameUse)
+}
+
+func _lookupAccountName(systemName *uint16, accountName *uint16, sid *byte, sidSize *uint32, refDomain *uint16, refDomainSize *uint32, sidNameUse *uint32) (err error) {
+	r1, _, e1 := syscall.Syscall9(procLookupAccountNameW.Addr(), 7, uintptr(unsafe.Pointer(systemName)), uintptr(unsafe.Pointer(accountName)), uintptr(unsafe.Pointer(sid)), uintptr(unsafe.Pointer(sidSize)), uintptr(unsafe.Pointer(refDomain)), uintptr(unsafe.Pointer(refDomainSize)), uintptr(unsafe.Pointer(sidNameUse)), 0, 0)
+	if r1 == 0 {
+		if e1 != 0 {
+			err = errnoErr(e1)
+		} else {
+			err = syscall.EINVAL
+		}
+	}
+	return
+}
+
+func convertSidToStringSid(sid *byte, str **uint16) (err error) {
+	r1, _, e1 := syscall.Syscall(procConvertSidToStringSidW.Addr(), 2, uintptr(unsafe.Pointer(sid)), uintptr(unsafe.Pointer(str)), 0)
+	if r1 == 0 {
+		if e1 != 0 {
+			err = errnoErr(e1)
+		} else {
+			err = syscall.EINVAL
+		}
+	}
+	return
+}
+
+func convertStringSecurityDescriptorToSecurityDescriptor(str string, revision uint32, sd *uintptr, size *uint32) (err error) {
+	var _p0 *uint16
+	_p0, err = syscall.UTF16PtrFromString(str)
+	if err != nil {
+		return
+	}
+	return _convertStringSecurityDescriptorToSecurityDescriptor(_p0, revision, sd, size)
+}
+
+func _convertStringSecurityDescriptorToSecurityDescriptor(str *uint16, revision uint32, sd *uintptr, size *uint32) (err error) {
+	r1, _, e1 := syscall.Syscall6(procConvertStringSecurityDescriptorToSecurityDescriptorW.Addr(), 4, uintptr(unsafe.Pointer(str)), uintptr(revision), uintptr(unsafe.Pointer(sd)), uintptr(unsafe.Pointer(size)), 0, 0)
+	if r1 == 0 {
+		if e1 != 0 {
+			err = errnoErr(e1)
+		} else {
+			err = syscall.EINVAL
+		}
+	}
+	return
+}
+
+func convertSecurityDescriptorToStringSecurityDescriptor(sd *byte, revision uint32, secInfo uint32, sddl **uint16, sddlSize *uint32) (err error) {
+	r1, _, e1 := syscall.Syscall6(procConvertSecurityDescriptorToStringSecurityDescriptorW.Addr(), 5, uintptr(unsafe.Pointer(sd)), uintptr(revision), uintptr(secInfo), uintptr(unsafe.Pointer(sddl)), uintptr(unsafe.Pointer(sddlSize)), 0)
+	if r1 == 0 {
+		if e1 != 0 {
+			err = errnoErr(e1)
+		} else {
+			err = syscall.EINVAL
+		}
+	}
+	return
+}
+
+func localFree(mem uintptr) {
+	syscall.Syscall(procLocalFree.Addr(), 1, uintptr(mem), 0, 0)
+	return
+}
+
+func getSecurityDescriptorLength(sd uintptr) (len uint32) {
+	r0, _, _ := syscall.Syscall(procGetSecurityDescriptorLength.Addr(), 1, uintptr(sd), 0, 0)
+	len = uint32(r0)
+	return
+}
+
+func getFileInformationByHandleEx(h syscall.Handle, class uint32, buffer *byte, size uint32) (err error) {
+	r1, _, e1 := syscall.Syscall6(procGetFileInformationByHandleEx.Addr(), 4, uintptr(h), uintptr(class), uintptr(unsafe.Pointer(buffer)), uintptr(size), 0, 0)
+	if r1 == 0 {
+		if e1 != 0 {
+			err = errnoErr(e1)
+		} else {
+			err = syscall.EINVAL
+		}
+	}
+	return
+}
+
+func setFileInformationByHandle(h syscall.Handle, class uint32, buffer *byte, size uint32) (err error) {
+	r1, _, e1 := syscall.Syscall6(procSetFileInformationByHandle.Addr(), 4, uintptr(h), uintptr(class), uintptr(unsafe.Pointer(buffer)), uintptr(size), 0, 0)
+	if r1 == 0 {
+		if e1 != 0 {
+			err = errnoErr(e1)
+		} else {
+			err = syscall.EINVAL
+		}
+	}
+	return
+}
+
+func adjustTokenPrivileges(token windows.Token, releaseAll bool, input *byte, outputSize uint32, output *byte, requiredSize *uint32) (success bool, err error) {
+	var _p0 uint32
+	if releaseAll {
+		_p0 = 1
+	} else {
+		_p0 = 0
+	}
+	r0, _, e1 := syscall.Syscall6(procAdjustTokenPrivileges.Addr(), 6, uintptr(token), uintptr(_p0), uintptr(unsafe.Pointer(input)), uintptr(outputSize), uintptr(unsafe.Pointer(output)), uintptr(unsafe.Pointer(requiredSize)))
+	success = r0 != 0
+	if true {
+		if e1 != 0 {
+			err = errnoErr(e1)
+		} else {
+			err = syscall.EINVAL
+		}
+	}
+	return
+}
+
+func impersonateSelf(level uint32) (err error) {
+	r1, _, e1 := syscall.Syscall(procImpersonateSelf.Addr(), 1, uintptr(level), 0, 0)
+	if r1 == 0 {
+		if e1 != 0 {
+			err = errnoErr(e1)
+		} else {
+			err = syscall.EINVAL
+		}
+	}
+	return
+}
+
+func revertToSelf() (err error) {
+	r1, _, e1 := syscall.Syscall(procRevertToSelf.Addr(), 0, 0, 0, 0)
+	if r1 == 0 {
+		if e1 != 0 {
+			err = errnoErr(e1)
+		} else {
+			err = syscall.EINVAL
+		}
+	}
+	return
+}
+
+func openThreadToken(thread syscall.Handle, accessMask uint32, openAsSelf bool, token *windows.Token) (err error) {
+	var _p0 uint32
+	if openAsSelf {
+		_p0 = 1
+	} else {
+		_p0 = 0
+	}
+	r1, _, e1 := syscall.Syscall6(procOpenThreadToken.Addr(), 4, uintptr(thread), uintptr(accessMask), uintptr(_p0), uintptr(unsafe.Pointer(token)), 0, 0)
+	if r1 == 0 {
+		if e1 != 0 {
+			err = errnoErr(e1)
+		} else {
+			err = syscall.EINVAL
+		}
+	}
+	return
+}
+
+func getCurrentThread() (h syscall.Handle) {
+	r0, _, _ := syscall.Syscall(procGetCurrentThread.Addr(), 0, 0, 0, 0)
+	h = syscall.Handle(r0)
+	return
+}
+
+func lookupPrivilegeValue(systemName string, name string, luid *uint64) (err error) {
+	var _p0 *uint16
+	_p0, err = syscall.UTF16PtrFromString(systemName)
+	if err != nil {
+		return
+	}
+	var _p1 *uint16
+	_p1, err = syscall.UTF16PtrFromString(name)
+	if err != nil {
+		return
+	}
+	return _lookupPrivilegeValue(_p0, _p1, luid)
+}
+
+func _lookupPrivilegeValue(systemName *uint16, name *uint16, luid *uint64) (err error) {
+	r1, _, e1 := syscall.Syscall(procLookupPrivilegeValueW.Addr(), 3, uintptr(unsafe.Pointer(systemName)), uintptr(unsafe.Pointer(name)), uintptr(unsafe.Pointer(luid)))
+	if r1 == 0 {
+		if e1 != 0 {
+			err = errnoErr(e1)
+		} else {
+			err = syscall.EINVAL
+		}
+	}
+	return
+}
+
+func lookupPrivilegeName(systemName string, luid *uint64, buffer *uint16, size *uint32) (err error) {
+	var _p0 *uint16
+	_p0, err = syscall.UTF16PtrFromString(systemName)
+	if err != nil {
+		return
+	}
+	return _lookupPrivilegeName(_p0, luid, buffer, size)
+}
+
+func _lookupPrivilegeName(systemName *uint16, luid *uint64, buffer *uint16, size *uint32) (err error) {
+	r1, _, e1 := syscall.Syscall6(procLookupPrivilegeNameW.Addr(), 4, uintptr(unsafe.Pointer(systemName)), uintptr(unsafe.Pointer(luid)), uintptr(unsafe.Pointer(buffer)), uintptr(unsafe.Pointer(size)), 0, 0)
+	if r1 == 0 {
+		if e1 != 0 {
+			err = errnoErr(e1)
+		} else {
+			err = syscall.EINVAL
+		}
+	}
+	return
+}
+
+func lookupPrivilegeDisplayName(systemName string, name *uint16, buffer *uint16, size *uint32, languageId *uint32) (err error) {
+	var _p0 *uint16
+	_p0, err = syscall.UTF16PtrFromString(systemName)
+	if err != nil {
+		return
+	}
+	return _lookupPrivilegeDisplayName(_p0, name, buffer, size, languageId)
+}
+
+func _lookupPrivilegeDisplayName(systemName *uint16, name *uint16, buffer *uint16, size *uint32, languageId *uint32) (err error) {
+	r1, _, e1 := syscall.Syscall6(procLookupPrivilegeDisplayNameW.Addr(), 5, uintptr(unsafe.Pointer(systemName)), uintptr(unsafe.Pointer(name)), uintptr(unsafe.Pointer(buffer)), uintptr(unsafe.Pointer(size)), uintptr(unsafe.Pointer(languageId)), 0)
+	if r1 == 0 {
+		if e1 != 0 {
+			err = errnoErr(e1)
+		} else {
+			err = syscall.EINVAL
+		}
+	}
+	return
+}
+
+func backupRead(h syscall.Handle, b []byte, bytesRead *uint32, abort bool, processSecurity bool, context *uintptr) (err error) {
+	var _p0 *byte
+	if len(b) > 0 {
+		_p0 = &b[0]
+	}
+	var _p1 uint32
+	if abort {
+		_p1 = 1
+	} else {
+		_p1 = 0
+	}
+	var _p2 uint32
+	if processSecurity {
+		_p2 = 1
+	} else {
+		_p2 = 0
+	}
+	r1, _, e1 := syscall.Syscall9(procBackupRead.Addr(), 7, uintptr(h), uintptr(unsafe.Pointer(_p0)), uintptr(len(b)), uintptr(unsafe.Pointer(bytesRead)), uintptr(_p1), uintptr(_p2), uintptr(unsafe.Pointer(context)), 0, 0)
+	if r1 == 0 {
+		if e1 != 0 {
+			err = errnoErr(e1)
+		} else {
+			err = syscall.EINVAL
+		}
+	}
+	return
+}
+
+func backupWrite(h syscall.Handle, b []byte, bytesWritten *uint32, abort bool, processSecurity bool, context *uintptr) (err error) {
+	var _p0 *byte
+	if len(b) > 0 {
+		_p0 = &b[0]
+	}
+	var _p1 uint32
+	if abort {
+		_p1 = 1
+	} else {
+		_p1 = 0
+	}
+	var _p2 uint32
+	if processSecurity {
+		_p2 = 1
+	} else {
+		_p2 = 0
+	}
+	r1, _, e1 := syscall.Syscall9(procBackupWrite.Addr(), 7, uintptr(h), uintptr(unsafe.Pointer(_p0)), uintptr(len(b)), uintptr(unsafe.Pointer(bytesWritten)), uintptr(_p1), uintptr(_p2), uintptr(unsafe.Pointer(context)), 0, 0)
+	if r1 == 0 {
+		if e1 != 0 {
+			err = errnoErr(e1)
+		} else {
+			err = syscall.EINVAL
+		}
+	}
+	return
+}

vendor/github.com/Microsoft/hcsshim/.gitignore

@@ -0,0 +1 @@
+*.exe

vendor/github.com/Microsoft/hcsshim/LICENSE

@@ -0,0 +1,21 @@
+The MIT License (MIT)
+
+Copyright (c) 2015 Microsoft
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all
+copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
+SOFTWARE.

vendor/github.com/Microsoft/hcsshim/README.md

@@ -0,0 +1,41 @@
+# hcsshim
+
+[![Build status](https://ci.appveyor.com/api/projects/status/nbcw28mnkqml0loa/branch/master?svg=true)](https://ci.appveyor.com/project/WindowsVirtualization/hcsshim/branch/master)
+
+This package contains the Golang interface for using the Windows [Host Compute Service](https://blogs.technet.microsoft.com/virtualization/2017/01/27/introducing-the-host-compute-service-hcs/) (HCS) to launch and manage [Windows Containers](https://docs.microsoft.com/en-us/virtualization/windowscontainers/about/). It also contains other helpers and functions for managing Windows Containers such as the Golang interface for the Host Network Service (HNS).
+
+It is primarily used in the [Moby Project](https://github.com/moby/moby), but it can be freely used by other projects as well.
+
+## Contributing
+
+This project welcomes contributions and suggestions.  Most contributions require you to agree to a
+Contributor License Agreement (CLA) declaring that you have the right to, and actually do, grant us
+the rights to use your contribution. For details, visit https://cla.microsoft.com.
+
+When you submit a pull request, a CLA-bot will automatically determine whether you need to provide
+a CLA and decorate the PR appropriately (e.g., label, comment). Simply follow the instructions
+provided by the bot. You will only need to do this once across all repos using our CLA.
+
+This project has adopted the [Microsoft Open Source Code of Conduct](https://opensource.microsoft.com/codeofconduct/).
+For more information see the [Code of Conduct FAQ](https://opensource.microsoft.com/codeofconduct/faq/) or
+contact [opencode@microsoft.com](mailto:opencode@microsoft.com) with any additional questions or comments.
+
+## Dependencies
+
+This project requires Golang 1.9 or newer to build.
+
+For system requirements to run this project, see the Microsoft docs on [Windows Container requirements](https://docs.microsoft.com/en-us/virtualization/windowscontainers/deploy-containers/system-requirements).
+
+## Reporting Security Issues
+
+Security issues and bugs should be reported privately, via email, to the Microsoft Security
+Response Center (MSRC) at [secure@microsoft.com](mailto:secure@microsoft.com). You should
+receive a response within 24 hours. If for some reason you do not, please follow up via
+email to ensure we received your original message. Further information, including the
+[MSRC PGP](https://technet.microsoft.com/en-us/security/dn606155) key, can be found in
+the [Security TechCenter](https://technet.microsoft.com/en-us/security/default).
+
+For additional details, see [Report a Computer Security Vulnerability](https://technet.microsoft.com/en-us/security/ff852094.aspx) on Technet
+
+---------------
+Copyright (c) 2018 Microsoft Corp.  All rights reserved.

vendor/github.com/Microsoft/hcsshim/appveyor.yml

@@ -0,0 +1,19 @@
+version: 0.1.{build}
+
+image: Visual Studio 2017
+
+clone_folder: c:\gopath\src\github.com\Microsoft\hcsshim
+
+environment:
+  GOPATH: c:\gopath
+  PATH: C:\mingw-w64\x86_64-7.2.0-posix-seh-rt_v5-rev1\mingw64\bin;%PATH%
+
+build_script:
+  - go get -v -t ./...
+  - go build ./cmd/wclayer
+  - go build ./cmd/runhcs
+  - go test -v ./... -tags admin
+
+artifacts:
+  - path: 'wclayer.exe'
+  - path: 'runhcs.exe'

vendor/github.com/Microsoft/hcsshim/container.go

@@ -0,0 +1,192 @@
+package hcsshim
+
+import (
+	"fmt"
+	"os"
+	"time"
+
+	"github.com/Microsoft/hcsshim/internal/hcs"
+	"github.com/Microsoft/hcsshim/internal/mergemaps"
+	"github.com/Microsoft/hcsshim/internal/schema1"
+)
+
+// ContainerProperties holds the properties for a container and the processes running in that container
+type ContainerProperties = schema1.ContainerProperties
+
+// MemoryStats holds the memory statistics for a container
+type MemoryStats = schema1.MemoryStats
+
+// ProcessorStats holds the processor statistics for a container
+type ProcessorStats = schema1.ProcessorStats
+
+// StorageStats holds the storage statistics for a container
+type StorageStats = schema1.StorageStats
+
+// NetworkStats holds the network statistics for a container
+type NetworkStats = schema1.NetworkStats
+
+// Statistics is the structure returned by a statistics call on a container
+type Statistics = schema1.Statistics
+
+// ProcessList is the structure of an item returned by a ProcessList call on a container
+type ProcessListItem = schema1.ProcessListItem
+
+// MappedVirtualDiskController is the structure of an item returned by a MappedVirtualDiskList call on a container
+type MappedVirtualDiskController = schema1.MappedVirtualDiskController
+
+// Type of Request Support in ModifySystem
+type RequestType = schema1.RequestType
+
+// Type of Resource Support in ModifySystem
+type ResourceType = schema1.ResourceType
+
+// RequestType const
+const (
+	Add     = schema1.Add
+	Remove  = schema1.Remove
+	Network = schema1.Network
+)
+
+// ResourceModificationRequestResponse is the structure used to send request to the container to modify the system
+// Supported resource types are Network and Request Types are Add/Remove
+type ResourceModificationRequestResponse = schema1.ResourceModificationRequestResponse
+
+type container struct {
+	system *hcs.System
+}
+
+// createComputeSystemAdditionalJSON is read from the environment at initialisation
+// time. It allows an environment variable to define additional JSON which
+// is merged in the CreateComputeSystem call to HCS.
+var createContainerAdditionalJSON []byte
+
+func init() {
+	createContainerAdditionalJSON = ([]byte)(os.Getenv("HCSSHIM_CREATECONTAINER_ADDITIONALJSON"))
+}
+
+// CreateContainer creates a new container with the given configuration but does not start it.
+func CreateContainer(id string, c *ContainerConfig) (Container, error) {
+	fullConfig, err := mergemaps.MergeJSON(c, createContainerAdditionalJSON)
+	if err != nil {
+		return nil, fmt.Errorf("failed to merge additional JSON '%s': %s", createContainerAdditionalJSON, err)
+	}
+
+	system, err := hcs.CreateComputeSystem(id, fullConfig)
+	if err != nil {
+		return nil, err
+	}
+	return &container{system}, err
+}
+
+// OpenContainer opens an existing container by ID.
+func OpenContainer(id string) (Container, error) {
+	system, err := hcs.OpenComputeSystem(id)
+	if err != nil {
+		return nil, err
+	}
+	return &container{system}, err
+}
+
+// GetContainers gets a list of the containers on the system that match the query
+func GetContainers(q ComputeSystemQuery) ([]ContainerProperties, error) {
+	return hcs.GetComputeSystems(q)
+}
+
+// Start synchronously starts the container.
+func (container *container) Start() error {
+	return convertSystemError(container.system.Start(), container)
+}
+
+// Shutdown requests a container shutdown, but it may not actually be shutdown until Wait() succeeds.
+func (container *container) Shutdown() error {
+	return convertSystemError(container.system.Shutdown(), container)
+}
+
+// Terminate requests a container terminate, but it may not actually be terminated until Wait() succeeds.
+func (container *container) Terminate() error {
+	return convertSystemError(container.system.Terminate(), container)
+}
+
+// Waits synchronously waits for the container to shutdown or terminate.
+func (container *container) Wait() error {
+	return convertSystemError(container.system.Wait(), container)
+}
+
+// WaitTimeout synchronously waits for the container to terminate or the duration to elapse. It
+// returns false if timeout occurs.
+func (container *container) WaitTimeout(t time.Duration) error {
+	return convertSystemError(container.system.WaitTimeout(t), container)
+}
+
+// Pause pauses the execution of a container.
+func (container *container) Pause() error {
+	return convertSystemError(container.system.Pause(), container)
+}
+
+// Resume resumes the execution of a container.
+func (container *container) Resume() error {
+	return convertSystemError(container.system.Resume(), container)
+}
+
+// HasPendingUpdates returns true if the container has updates pending to install
+func (container *container) HasPendingUpdates() (bool, error) {
+	return false, nil
+}
+
+// Statistics returns statistics for the container. This is a legacy v1 call
+func (container *container) Statistics() (Statistics, error) {
+	properties, err := container.system.Properties(schema1.PropertyTypeStatistics)
+	if err != nil {
+		return Statistics{}, convertSystemError(err, container)
+	}
+
+	return properties.Statistics, nil
+}
+
+// ProcessList returns an array of ProcessListItems for the container. This is a legacy v1 call
+func (container *container) ProcessList() ([]ProcessListItem, error) {
+	properties, err := container.system.Properties(schema1.PropertyTypeProcessList)
+	if err != nil {
+		return nil, convertSystemError(err, container)
+	}
+
+	return properties.ProcessList, nil
+}
+
+// This is a legacy v1 call
+func (container *container) MappedVirtualDisks() (map[int]MappedVirtualDiskController, error) {
+	properties, err := container.system.Properties(schema1.PropertyTypeMappedVirtualDisk)
+	if err != nil {
+		return nil, convertSystemError(err, container)
+	}
+
+	return properties.MappedVirtualDiskControllers, nil
+}
+
+// CreateProcess launches a new process within the container.
+func (container *container) CreateProcess(c *ProcessConfig) (Process, error) {
+	p, err := container.system.CreateProcess(c)
+	if err != nil {
+		return nil, convertSystemError(err, container)
+	}
+	return &process{p}, nil
+}
+
+// OpenProcess gets an interface to an existing process within the container.
+func (container *container) OpenProcess(pid int) (Process, error) {
+	p, err := container.system.OpenProcess(pid)
+	if err != nil {
+		return nil, convertSystemError(err, container)
+	}
+	return &process{p}, nil
+}
+
+// Close cleans up any state associated with the container but does not terminate or wait for it.
+func (container *container) Close() error {
+	return convertSystemError(container.system.Close(), container)
+}
+
+// Modify the System
+func (container *container) Modify(config *ResourceModificationRequestResponse) error {
+	return convertSystemError(container.system.Modify(config), container)
+}

vendor/github.com/Microsoft/hcsshim/errors.go

@@ -0,0 +1,257 @@
+package hcsshim
+
+import (
+	"fmt"
+	"syscall"
+
+	"github.com/Microsoft/hcsshim/internal/hns"
+
+	"github.com/Microsoft/hcsshim/internal/hcs"
+	"github.com/Microsoft/hcsshim/internal/hcserror"
+)
+
+var (
+	// ErrComputeSystemDoesNotExist is an error encountered when the container being operated on no longer exists = hcs.exist
+	ErrComputeSystemDoesNotExist = hcs.ErrComputeSystemDoesNotExist
+
+	// ErrElementNotFound is an error encountered when the object being referenced does not exist
+	ErrElementNotFound = hcs.ErrElementNotFound
+
+	// ErrElementNotFound is an error encountered when the object being referenced does not exist
+	ErrNotSupported = hcs.ErrNotSupported
+
+	// ErrInvalidData is an error encountered when the request being sent to hcs is invalid/unsupported
+	// decimal -2147024883 / hex 0x8007000d
+	ErrInvalidData = hcs.ErrInvalidData
+
+	// ErrHandleClose is an error encountered when the handle generating the notification being waited on has been closed
+	ErrHandleClose = hcs.ErrHandleClose
+
+	// ErrAlreadyClosed is an error encountered when using a handle that has been closed by the Close method
+	ErrAlreadyClosed = hcs.ErrAlreadyClosed
+
+	// ErrInvalidNotificationType is an error encountered when an invalid notification type is used
+	ErrInvalidNotificationType = hcs.ErrInvalidNotificationType
+
+	// ErrInvalidProcessState is an error encountered when the process is not in a valid state for the requested operation
+	ErrInvalidProcessState = hcs.ErrInvalidProcessState
+
+	// ErrTimeout is an error encountered when waiting on a notification times out
+	ErrTimeout = hcs.ErrTimeout
+
+	// ErrUnexpectedContainerExit is the error encountered when a container exits while waiting for
+	// a different expected notification
+	ErrUnexpectedContainerExit = hcs.ErrUnexpectedContainerExit
+
+	// ErrUnexpectedProcessAbort is the error encountered when communication with the compute service
+	// is lost while waiting for a notification
+	ErrUnexpectedProcessAbort = hcs.ErrUnexpectedProcessAbort
+
+	// ErrUnexpectedValue is an error encountered when hcs returns an invalid value
+	ErrUnexpectedValue = hcs.ErrUnexpectedValue
+
+	// ErrVmcomputeAlreadyStopped is an error encountered when a shutdown or terminate request is made on a stopped container
+	ErrVmcomputeAlreadyStopped = hcs.ErrVmcomputeAlreadyStopped
+
+	// ErrVmcomputeOperationPending is an error encountered when the operation is being completed asynchronously
+	ErrVmcomputeOperationPending = hcs.ErrVmcomputeOperationPending
+
+	// ErrVmcomputeOperationInvalidState is an error encountered when the compute system is not in a valid state for the requested operation
+	ErrVmcomputeOperationInvalidState = hcs.ErrVmcomputeOperationInvalidState
+
+	// ErrProcNotFound is an error encountered when the the process cannot be found
+	ErrProcNotFound = hcs.ErrProcNotFound
+
+	// ErrVmcomputeOperationAccessIsDenied is an error which can be encountered when enumerating compute systems in RS1/RS2
+	// builds when the underlying silo might be in the process of terminating. HCS was fixed in RS3.
+	ErrVmcomputeOperationAccessIsDenied = hcs.ErrVmcomputeOperationAccessIsDenied
+
+	// ErrVmcomputeInvalidJSON is an error encountered when the compute system does not support/understand the messages sent by management
+	ErrVmcomputeInvalidJSON = hcs.ErrVmcomputeInvalidJSON
+
+	// ErrVmcomputeUnknownMessage is an error encountered guest compute system doesn't support the message
+	ErrVmcomputeUnknownMessage = hcs.ErrVmcomputeUnknownMessage
+
+	// ErrNotSupported is an error encountered when hcs doesn't support the request
+	ErrPlatformNotSupported = hcs.ErrPlatformNotSupported
+)
+
+type EndpointNotFoundError = hns.EndpointNotFoundError
+type NetworkNotFoundError = hns.NetworkNotFoundError
+
+// ProcessError is an error encountered in HCS during an operation on a Process object
+type ProcessError struct {
+	Process   *process
+	Operation string
+	ExtraInfo string
+	Err       error
+	Events    []hcs.ErrorEvent
+}
+
+// ContainerError is an error encountered in HCS during an operation on a Container object
+type ContainerError struct {
+	Container *container
+	Operation string
+	ExtraInfo string
+	Err       error
+	Events    []hcs.ErrorEvent
+}
+
+func (e *ContainerError) Error() string {
+	if e == nil {
+		return "<nil>"
+	}
+
+	if e.Container == nil {
+		return "unexpected nil container for error: " + e.Err.Error()
+	}
+
+	s := "container " + e.Container.system.ID()
+
+	if e.Operation != "" {
+		s += " encountered an error during " + e.Operation
+	}
+
+	switch e.Err.(type) {
+	case nil:
+		break
+	case syscall.Errno:
+		s += fmt.Sprintf(": failure in a Windows system call: %s (0x%x)", e.Err, hcserror.Win32FromError(e.Err))
+	default:
+		s += fmt.Sprintf(": %s", e.Err.Error())
+	}
+
+	for _, ev := range e.Events {
+		s += "\n" + ev.String()
+	}
+
+	if e.ExtraInfo != "" {
+		s += " extra info: " + e.ExtraInfo
+	}
+
+	return s
+}
+
+func makeContainerError(container *container, operation string, extraInfo string, err error) error {
+	// Don't double wrap errors
+	if _, ok := err.(*ContainerError); ok {
+		return err
+	}
+	containerError := &ContainerError{Container: container, Operation: operation, ExtraInfo: extraInfo, Err: err}
+	return containerError
+}
+
+func (e *ProcessError) Error() string {
+	if e == nil {
+		return "<nil>"
+	}
+
+	if e.Process == nil {
+		return "Unexpected nil process for error: " + e.Err.Error()
+	}
+
+	s := fmt.Sprintf("process %d in container %s", e.Process.p.Pid(), e.Process.p.SystemID())
+	if e.Operation != "" {
+		s += " encountered an error during " + e.Operation
+	}
+
+	switch e.Err.(type) {
+	case nil:
+		break
+	case syscall.Errno:
+		s += fmt.Sprintf(": failure in a Windows system call: %s (0x%x)", e.Err, hcserror.Win32FromError(e.Err))
+	default:
+		s += fmt.Sprintf(": %s", e.Err.Error())
+	}
+
+	for _, ev := range e.Events {
+		s += "\n" + ev.String()
+	}
+
+	return s
+}
+
+func makeProcessError(process *process, operation string, extraInfo string, err error) error {
+	// Don't double wrap errors
+	if _, ok := err.(*ProcessError); ok {
+		return err
+	}
+	processError := &ProcessError{Process: process, Operation: operation, ExtraInfo: extraInfo, Err: err}
+	return processError
+}
+
+// IsNotExist checks if an error is caused by the Container or Process not existing.
+// Note: Currently, ErrElementNotFound can mean that a Process has either
+// already exited, or does not exist. Both IsAlreadyStopped and IsNotExist
+// will currently return true when the error is ErrElementNotFound or ErrProcNotFound.
+func IsNotExist(err error) bool {
+	if _, ok := err.(EndpointNotFoundError); ok {
+		return true
+	}
+	if _, ok := err.(NetworkNotFoundError); ok {
+		return true
+	}
+	return hcs.IsNotExist(getInnerError(err))
+}
+
+// IsAlreadyClosed checks if an error is caused by the Container or Process having been
+// already closed by a call to the Close() method.
+func IsAlreadyClosed(err error) bool {
+	return hcs.IsAlreadyClosed(getInnerError(err))
+}
+
+// IsPending returns a boolean indicating whether the error is that
+// the requested operation is being completed in the background.
+func IsPending(err error) bool {
+	return hcs.IsPending(getInnerError(err))
+}
+
+// IsTimeout returns a boolean indicating whether the error is caused by
+// a timeout waiting for the operation to complete.
+func IsTimeout(err error) bool {
+	return hcs.IsTimeout(getInnerError(err))
+}
+
+// IsAlreadyStopped returns a boolean indicating whether the error is caused by
+// a Container or Process being already stopped.
+// Note: Currently, ErrElementNotFound can mean that a Process has either
+// already exited, or does not exist. Both IsAlreadyStopped and IsNotExist
+// will currently return true when the error is ErrElementNotFound or ErrProcNotFound.
+func IsAlreadyStopped(err error) bool {
+	return hcs.IsAlreadyStopped(getInnerError(err))
+}
+
+// IsNotSupported returns a boolean indicating whether the error is caused by
+// unsupported platform requests
+// Note: Currently Unsupported platform requests can be mean either
+// ErrVmcomputeInvalidJSON, ErrInvalidData, ErrNotSupported or ErrVmcomputeUnknownMessage
+// is thrown from the Platform
+func IsNotSupported(err error) bool {
+	return hcs.IsNotSupported(getInnerError(err))
+}
+
+func getInnerError(err error) error {
+	switch pe := err.(type) {
+	case nil:
+		return nil
+	case *ContainerError:
+		err = pe.Err
+	case *ProcessError:
+		err = pe.Err
+	}
+	return err
+}
+
+func convertSystemError(err error, c *container) error {
+	if serr, ok := err.(*hcs.SystemError); ok {
+		return &ContainerError{Container: c, Operation: serr.Op, ExtraInfo: serr.Extra, Err: serr.Err, Events: serr.Events}
+	}
+	return err
+}
+
+func convertProcessError(err error, p *process) error {
+	if perr, ok := err.(*hcs.ProcessError); ok {
+		return &ProcessError{Process: p, Operation: perr.Op, Err: perr.Err, Events: perr.Events}
+	}
+	return err
+}

vendor/github.com/Microsoft/hcsshim/functional_tests.ps1

@@ -0,0 +1,12 @@
+# Requirements so far:
+# dockerd running
+#  - image microsoft/nanoserver (matching host base image)  docker load -i c:\baseimages\nanoserver.tar
+#  - image alpine (linux) docker pull --platform=linux alpine
+
+
+# TODO: Add this a parameter for debugging. ie "functional-tests -debug=$true"
+#$env:HCSSHIM_FUNCTIONAL_TESTS_DEBUG="yes please"
+
+#pushd uvm
+go test -v -tags "functional uvmcreate uvmscratch uvmscsi uvmvpmem uvmvsmb uvmp9" ./...
+#popd

vendor/github.com/Microsoft/hcsshim/hcsshim.go

@@ -0,0 +1,28 @@
+// Shim for the Host Compute Service (HCS) to manage Windows Server
+// containers and Hyper-V containers.
+
+package hcsshim
+
+import (
+	"syscall"
+
+	"github.com/Microsoft/hcsshim/internal/hcserror"
+)
+
+//go:generate go run mksyscall_windows.go -output zsyscall_windows.go hcsshim.go
+
+//sys SetCurrentThreadCompartmentId(compartmentId uint32) (hr error) = iphlpapi.SetCurrentThreadCompartmentId
+
+const (
+	// Specific user-visible exit codes
+	WaitErrExecFailed = 32767
+
+	ERROR_GEN_FAILURE          = hcserror.ERROR_GEN_FAILURE
+	ERROR_SHUTDOWN_IN_PROGRESS = syscall.Errno(1115)
+	WSAEINVAL                  = syscall.Errno(10022)
+
+	// Timeout on wait calls
+	TimeoutInfinite = 0xFFFFFFFF
+)
+
+type HcsError = hcserror.HcsError

vendor/github.com/Microsoft/hcsshim/hnsendpoint.go

@@ -0,0 +1,91 @@
+package hcsshim
+
+import (
+	"github.com/Microsoft/hcsshim/internal/hns"
+)
+
+// HNSEndpoint represents a network endpoint in HNS
+type HNSEndpoint = hns.HNSEndpoint
+
+//SystemType represents the type of the system on which actions are done
+type SystemType string
+
+// SystemType const
+const (
+	ContainerType      SystemType = "Container"
+	VirtualMachineType SystemType = "VirtualMachine"
+	HostType           SystemType = "Host"
+)
+
+// EndpointAttachDetachRequest is the structure used to send request to the container to modify the system
+// Supported resource types are Network and Request Types are Add/Remove
+type EndpointAttachDetachRequest = hns.EndpointAttachDetachRequest
+
+// EndpointResquestResponse is object to get the endpoint request response
+type EndpointResquestResponse = hns.EndpointResquestResponse
+
+// HNSEndpointRequest makes a HNS call to modify/query a network endpoint
+func HNSEndpointRequest(method, path, request string) (*HNSEndpoint, error) {
+	return hns.HNSEndpointRequest(method, path, request)
+}
+
+// HNSListEndpointRequest makes a HNS call to query the list of available endpoints
+func HNSListEndpointRequest() ([]HNSEndpoint, error) {
+	return hns.HNSListEndpointRequest()
+}
+
+// HotAttachEndpoint makes a HCS Call to attach the endpoint to the container
+func HotAttachEndpoint(containerID string, endpointID string) error {
+	return modifyNetworkEndpoint(containerID, endpointID, Add)
+}
+
+// HotDetachEndpoint makes a HCS Call to detach the endpoint from the container
+func HotDetachEndpoint(containerID string, endpointID string) error {
+	return modifyNetworkEndpoint(containerID, endpointID, Remove)
+}
+
+// ModifyContainer corresponding to the container id, by sending a request
+func modifyContainer(id string, request *ResourceModificationRequestResponse) error {
+	container, err := OpenContainer(id)
+	if err != nil {
+		if IsNotExist(err) {
+			return ErrComputeSystemDoesNotExist
+		}
+		return getInnerError(err)
+	}
+	defer container.Close()
+	err = container.Modify(request)
+	if err != nil {
+		if IsNotSupported(err) {
+			return ErrPlatformNotSupported
+		}
+		return getInnerError(err)
+	}
+
+	return nil
+}
+
+func modifyNetworkEndpoint(containerID string, endpointID string, request RequestType) error {
+	requestMessage := &ResourceModificationRequestResponse{
+		Resource: Network,
+		Request:  request,
+		Data:     endpointID,
+	}
+	err := modifyContainer(containerID, requestMessage)
+
+	if err != nil {
+		return err
+	}
+
+	return nil
+}
+
+// GetHNSEndpointByID get the Endpoint by ID
+func GetHNSEndpointByID(endpointID string) (*HNSEndpoint, error) {
+	return hns.GetHNSEndpointByID(endpointID)
+}
+
+// GetHNSEndpointByName gets the endpoint filtered by Name
+func GetHNSEndpointByName(endpointName string) (*HNSEndpoint, error) {
+	return hns.GetHNSEndpointByName(endpointName)
+}

vendor/github.com/Microsoft/hcsshim/hnsglobals.go

@@ -0,0 +1,16 @@
+package hcsshim
+
+import (
+	"github.com/Microsoft/hcsshim/internal/hns"
+)
+
+type HNSGlobals = hns.HNSGlobals
+type HNSVersion = hns.HNSVersion
+
+var (
+	HNSVersion1803 = hns.HNSVersion1803
+)
+
+func GetHNSGlobals() (*HNSGlobals, error) {
+	return hns.GetHNSGlobals()
+}

vendor/github.com/Microsoft/hcsshim/hnsnetwork.go

@@ -0,0 +1,36 @@
+package hcsshim
+
+import (
+	"github.com/Microsoft/hcsshim/internal/hns"
+)
+
+// Subnet is assoicated with a network and represents a list
+// of subnets available to the network
+type Subnet = hns.Subnet
+
+// MacPool is assoicated with a network and represents a list
+// of macaddresses available to the network
+type MacPool = hns.MacPool
+
+// HNSNetwork represents a network in HNS
+type HNSNetwork = hns.HNSNetwork
+
+// HNSNetworkRequest makes a call into HNS to update/query a single network
+func HNSNetworkRequest(method, path, request string) (*HNSNetwork, error) {
+	return hns.HNSNetworkRequest(method, path, request)
+}
+
+// HNSListNetworkRequest makes a HNS call to query the list of available networks
+func HNSListNetworkRequest(method, path, request string) ([]HNSNetwork, error) {
+	return hns.HNSListNetworkRequest(method, path, request)
+}
+
+// GetHNSNetworkByID
+func GetHNSNetworkByID(networkID string) (*HNSNetwork, error) {
+	return hns.GetHNSNetworkByID(networkID)
+}
+
+// GetHNSNetworkName filtered by Name
+func GetHNSNetworkByName(networkName string) (*HNSNetwork, error) {
+	return hns.GetHNSNetworkByName(networkName)
+}

vendor/github.com/Microsoft/hcsshim/hnspolicy.go

@@ -0,0 +1,57 @@
+package hcsshim
+
+import (
+	"github.com/Microsoft/hcsshim/internal/hns"
+)
+
+// Type of Request Support in ModifySystem
+type PolicyType = hns.PolicyType
+
+// RequestType const
+const (
+	Nat                  = hns.Nat
+	ACL                  = hns.ACL
+	PA                   = hns.PA
+	VLAN                 = hns.VLAN
+	VSID                 = hns.VSID
+	VNet                 = hns.VNet
+	L2Driver             = hns.L2Driver
+	Isolation            = hns.Isolation
+	QOS                  = hns.QOS
+	OutboundNat          = hns.OutboundNat
+	ExternalLoadBalancer = hns.ExternalLoadBalancer
+	Route                = hns.Route
+)
+
+type NatPolicy = hns.NatPolicy
+
+type QosPolicy = hns.QosPolicy
+
+type IsolationPolicy = hns.IsolationPolicy
+
+type VlanPolicy = hns.VlanPolicy
+
+type VsidPolicy = hns.VsidPolicy
+
+type PaPolicy = hns.PaPolicy
+
+type OutboundNatPolicy = hns.OutboundNatPolicy
+
+type ActionType = hns.ActionType
+type DirectionType = hns.DirectionType
+type RuleType = hns.RuleType
+
+const (
+	Allow = hns.Allow
+	Block = hns.Block
+
+	In  = hns.In
+	Out = hns.Out
+
+	Host   = hns.Host
+	Switch = hns.Switch
+)
+
+type ACLPolicy = hns.ACLPolicy
+
+type Policy = hns.Policy

vendor/github.com/Microsoft/hcsshim/hnspolicylist.go

@@ -0,0 +1,47 @@
+package hcsshim
+
+import (
+	"github.com/Microsoft/hcsshim/internal/hns"
+)
+
+// RoutePolicy is a structure defining schema for Route based Policy
+type RoutePolicy = hns.RoutePolicy
+
+// ELBPolicy is a structure defining schema for ELB LoadBalancing based Policy
+type ELBPolicy = hns.ELBPolicy
+
+// LBPolicy is a structure defining schema for LoadBalancing based Policy
+type LBPolicy = hns.LBPolicy
+
+// PolicyList is a structure defining schema for Policy list request
+type PolicyList = hns.PolicyList
+
+// HNSPolicyListRequest makes a call into HNS to update/query a single network
+func HNSPolicyListRequest(method, path, request string) (*PolicyList, error) {
+	return hns.HNSPolicyListRequest(method, path, request)
+}
+
+// HNSListPolicyListRequest gets all the policy list
+func HNSListPolicyListRequest() ([]PolicyList, error) {
+	return hns.HNSListPolicyListRequest()
+}
+
+// PolicyListRequest makes a HNS call to modify/query a network policy list
+func PolicyListRequest(method, path, request string) (*PolicyList, error) {
+	return hns.PolicyListRequest(method, path, request)
+}
+
+// GetPolicyListByID get the policy list by ID
+func GetPolicyListByID(policyListID string) (*PolicyList, error) {
+	return hns.GetPolicyListByID(policyListID)
+}
+
+// AddLoadBalancer policy list for the specified endpoints
+func AddLoadBalancer(endpoints []HNSEndpoint, isILB bool, sourceVIP, vip string, protocol uint16, internalPort uint16, externalPort uint16) (*PolicyList, error) {
+	return hns.AddLoadBalancer(endpoints, isILB, sourceVIP, vip, protocol, internalPort, externalPort)
+}
+
+// AddRoute adds route policy list for the specified endpoints
+func AddRoute(endpoints []HNSEndpoint, destinationPrefix string, nextHop string, encapEnabled bool) (*PolicyList, error) {
+	return hns.AddRoute(endpoints, destinationPrefix, nextHop, encapEnabled)
+}

vendor/github.com/Microsoft/hcsshim/hnssupport.go

@@ -0,0 +1,13 @@
+package hcsshim
+
+import (
+	"github.com/Microsoft/hcsshim/internal/hns"
+)
+
+type HNSSupportedFeatures = hns.HNSSupportedFeatures
+
+type HNSAclFeatures = hns.HNSAclFeatures
+
+func GetHNSSupportedFeatures() HNSSupportedFeatures {
+	return hns.GetHNSSupportedFeatures()
+}

vendor/github.com/Microsoft/hcsshim/interface.go

@@ -0,0 +1,109 @@
+package hcsshim
+
+import (
+	"io"
+	"time"
+
+	"github.com/Microsoft/hcsshim/internal/schema1"
+)
+
+// ProcessConfig is used as both the input of Container.CreateProcess
+// and to convert the parameters to JSON for passing onto the HCS
+type ProcessConfig = schema1.ProcessConfig
+
+type Layer = schema1.Layer
+type MappedDir = schema1.MappedDir
+type MappedPipe = schema1.MappedPipe
+type HvRuntime = schema1.HvRuntime
+type MappedVirtualDisk = schema1.MappedVirtualDisk
+
+// ContainerConfig is used as both the input of CreateContainer
+// and to convert the parameters to JSON for passing onto the HCS
+type ContainerConfig = schema1.ContainerConfig
+
+type ComputeSystemQuery = schema1.ComputeSystemQuery
+
+// Container represents a created (but not necessarily running) container.
+type Container interface {
+	// Start synchronously starts the container.
+	Start() error
+
+	// Shutdown requests a container shutdown, but it may not actually be shutdown until Wait() succeeds.
+	Shutdown() error
+
+	// Terminate requests a container terminate, but it may not actually be terminated until Wait() succeeds.
+	Terminate() error
+
+	// Waits synchronously waits for the container to shutdown or terminate.
+	Wait() error
+
+	// WaitTimeout synchronously waits for the container to terminate or the duration to elapse. It
+	// returns false if timeout occurs.
+	WaitTimeout(time.Duration) error
+
+	// Pause pauses the execution of a container.
+	Pause() error
+
+	// Resume resumes the execution of a container.
+	Resume() error
+
+	// HasPendingUpdates returns true if the container has updates pending to install.
+	HasPendingUpdates() (bool, error)
+
+	// Statistics returns statistics for a container.
+	Statistics() (Statistics, error)
+
+	// ProcessList returns details for the processes in a container.
+	ProcessList() ([]ProcessListItem, error)
+
+	// MappedVirtualDisks returns virtual disks mapped to a utility VM, indexed by controller
+	MappedVirtualDisks() (map[int]MappedVirtualDiskController, error)
+
+	// CreateProcess launches a new process within the container.
+	CreateProcess(c *ProcessConfig) (Process, error)
+
+	// OpenProcess gets an interface to an existing process within the container.
+	OpenProcess(pid int) (Process, error)
+
+	// Close cleans up any state associated with the container but does not terminate or wait for it.
+	Close() error
+
+	// Modify the System
+	Modify(config *ResourceModificationRequestResponse) error
+}
+
+// Process represents a running or exited process.
+type Process interface {
+	// Pid returns the process ID of the process within the container.
+	Pid() int
+
+	// Kill signals the process to terminate but does not wait for it to finish terminating.
+	Kill() error
+
+	// Wait waits for the process to exit.
+	Wait() error
+
+	// WaitTimeout waits for the process to exit or the duration to elapse. It returns
+	// false if timeout occurs.
+	WaitTimeout(time.Duration) error
+
+	// ExitCode returns the exit code of the process. The process must have
+	// already terminated.
+	ExitCode() (int, error)
+
+	// ResizeConsole resizes the console of the process.
+	ResizeConsole(width, height uint16) error
+
+	// Stdio returns the stdin, stdout, and stderr pipes, respectively. Closing
+	// these pipes does not close the underlying pipes; it should be possible to
+	// call this multiple times to get multiple interfaces.
+	Stdio() (io.WriteCloser, io.ReadCloser, io.ReadCloser, error)
+
+	// CloseStdin closes the write side of the stdin pipe so that the process is
+	// notified on the read side that there is no more data in stdin.
+	CloseStdin() error
+
+	// Close cleans up any state associated with the process but does not kill
+	// or wait on it.
+	Close() error
+}

vendor/github.com/Microsoft/hcsshim/internal/guid/guid.go

@@ -0,0 +1,69 @@
+package guid
+
+import (
+	"crypto/rand"
+	"encoding/json"
+	"fmt"
+	"io"
+	"strconv"
+	"strings"
+)
+
+var _ = (json.Marshaler)(&GUID{})
+var _ = (json.Unmarshaler)(&GUID{})
+
+type GUID [16]byte
+
+func New() GUID {
+	g := GUID{}
+	_, err := io.ReadFull(rand.Reader, g[:])
+	if err != nil {
+		panic(err)
+	}
+	return g
+}
+
+func (g GUID) String() string {
+	return fmt.Sprintf("%02x%02x%02x%02x-%02x%02x-%02x%02x-%02x-%02x", g[3], g[2], g[1], g[0], g[5], g[4], g[7], g[6], g[8:10], g[10:])
+}
+
+func FromString(s string) GUID {
+	if len(s) != 36 {
+		panic(fmt.Sprintf("invalid GUID length: %d", len(s)))
+	}
+	if s[8] != '-' || s[13] != '-' || s[18] != '-' || s[23] != '-' {
+		panic("invalid GUID format")
+	}
+	indexOrder := [16]int{
+		0, 2, 4, 6,
+		9, 11,
+		14, 16,
+		19, 21,
+		24, 26, 28, 30, 32, 34,
+	}
+	byteOrder := [16]int{
+		3, 2, 1, 0,
+		5, 4,
+		7, 6,
+		8, 9,
+		10, 11, 12, 13, 14, 15,
+	}
+	var g GUID
+	for i, x := range indexOrder {
+		b, err := strconv.ParseInt(s[x:x+2], 16, 16)
+		if err != nil {
+			panic(err)
+		}
+		g[byteOrder[i]] = byte(b)
+	}
+	return g
+}
+
+func (g GUID) MarshalJSON() ([]byte, error) {
+	return json.Marshal(g.String())
+}
+
+func (g *GUID) UnmarshalJSON(data []byte) error {
+	*g = FromString(strings.Trim(string(data), "\""))
+	return nil
+}

vendor/github.com/Microsoft/hcsshim/internal/hcs/callback.go

@@ -0,0 +1,81 @@
+package hcs
+
+import (
+	"sync"
+	"syscall"
+
+	"github.com/Microsoft/hcsshim/internal/interop"
+)
+
+var (
+	nextCallback    uintptr
+	callbackMap     = map[uintptr]*notifcationWatcherContext{}
+	callbackMapLock = sync.RWMutex{}
+
+	notificationWatcherCallback = syscall.NewCallback(notificationWatcher)
+
+	// Notifications for HCS_SYSTEM handles
+	hcsNotificationSystemExited          hcsNotification = 0x00000001
+	hcsNotificationSystemCreateCompleted hcsNotification = 0x00000002
+	hcsNotificationSystemStartCompleted  hcsNotification = 0x00000003
+	hcsNotificationSystemPauseCompleted  hcsNotification = 0x00000004
+	hcsNotificationSystemResumeCompleted hcsNotification = 0x00000005
+
+	// Notifications for HCS_PROCESS handles
+	hcsNotificationProcessExited hcsNotification = 0x00010000
+
+	// Common notifications
+	hcsNotificationInvalid           hcsNotification = 0x00000000
+	hcsNotificationServiceDisconnect hcsNotification = 0x01000000
+)
+
+type hcsNotification uint32
+type notificationChannel chan error
+
+type notifcationWatcherContext struct {
+	channels notificationChannels
+	handle   hcsCallback
+}
+
+type notificationChannels map[hcsNotification]notificationChannel
+
+func newChannels() notificationChannels {
+	channels := make(notificationChannels)
+
+	channels[hcsNotificationSystemExited] = make(notificationChannel, 1)
+	channels[hcsNotificationSystemCreateCompleted] = make(notificationChannel, 1)
+	channels[hcsNotificationSystemStartCompleted] = make(notificationChannel, 1)
+	channels[hcsNotificationSystemPauseCompleted] = make(notificationChannel, 1)
+	channels[hcsNotificationSystemResumeCompleted] = make(notificationChannel, 1)
+	channels[hcsNotificationProcessExited] = make(notificationChannel, 1)
+	channels[hcsNotificationServiceDisconnect] = make(notificationChannel, 1)
+	return channels
+}
+func closeChannels(channels notificationChannels) {
+	close(channels[hcsNotificationSystemExited])
+	close(channels[hcsNotificationSystemCreateCompleted])
+	close(channels[hcsNotificationSystemStartCompleted])
+	close(channels[hcsNotificationSystemPauseCompleted])
+	close(channels[hcsNotificationSystemResumeCompleted])
+	close(channels[hcsNotificationProcessExited])
+	close(channels[hcsNotificationServiceDisconnect])
+}
+
+func notificationWatcher(notificationType hcsNotification, callbackNumber uintptr, notificationStatus uintptr, notificationData *uint16) uintptr {
+	var result error
+	if int32(notificationStatus) < 0 {
+		result = interop.Win32FromHresult(notificationStatus)
+	}
+
+	callbackMapLock.RLock()
+	context := callbackMap[callbackNumber]
+	callbackMapLock.RUnlock()
+
+	if context == nil {
+		return 0
+	}
+
+	context.channels[notificationType] <- result
+
+	return 0
+}

vendor/github.com/Microsoft/hcsshim/internal/hcs/cgo.go

@@ -0,0 +1,7 @@
+package hcs
+
+import "C"
+
+// This import is needed to make the library compile as CGO because HCSSHIM
+// only works with CGO due to callbacks from HCS comming back from a C thread
+// which is not supported without CGO. See https://github.com/golang/go/issues/10973

vendor/github.com/Microsoft/hcsshim/internal/hcs/errors.go

@@ -0,0 +1,279 @@
+package hcs
+
+import (
+	"encoding/json"
+	"errors"
+	"fmt"
+	"syscall"
+
+	"github.com/Microsoft/hcsshim/internal/interop"
+	"github.com/sirupsen/logrus"
+)
+
+var (
+	// ErrComputeSystemDoesNotExist is an error encountered when the container being operated on no longer exists
+	ErrComputeSystemDoesNotExist = syscall.Errno(0xc037010e)
+
+	// ErrElementNotFound is an error encountered when the object being referenced does not exist
+	ErrElementNotFound = syscall.Errno(0x490)
+
+	// ErrElementNotFound is an error encountered when the object being referenced does not exist
+	ErrNotSupported = syscall.Errno(0x32)
+
+	// ErrInvalidData is an error encountered when the request being sent to hcs is invalid/unsupported
+	// decimal -2147024883 / hex 0x8007000d
+	ErrInvalidData = syscall.Errno(0xd)
+
+	// ErrHandleClose is an error encountered when the handle generating the notification being waited on has been closed
+	ErrHandleClose = errors.New("hcsshim: the handle generating this notification has been closed")
+
+	// ErrAlreadyClosed is an error encountered when using a handle that has been closed by the Close method
+	ErrAlreadyClosed = errors.New("hcsshim: the handle has already been closed")
+
+	// ErrInvalidNotificationType is an error encountered when an invalid notification type is used
+	ErrInvalidNotificationType = errors.New("hcsshim: invalid notification type")
+
+	// ErrInvalidProcessState is an error encountered when the process is not in a valid state for the requested operation
+	ErrInvalidProcessState = errors.New("the process is in an invalid state for the attempted operation")
+
+	// ErrTimeout is an error encountered when waiting on a notification times out
+	ErrTimeout = errors.New("hcsshim: timeout waiting for notification")
+
+	// ErrUnexpectedContainerExit is the error encountered when a container exits while waiting for
+	// a different expected notification
+	ErrUnexpectedContainerExit = errors.New("unexpected container exit")
+
+	// ErrUnexpectedProcessAbort is the error encountered when communication with the compute service
+	// is lost while waiting for a notification
+	ErrUnexpectedProcessAbort = errors.New("lost communication with compute service")
+
+	// ErrUnexpectedValue is an error encountered when hcs returns an invalid value
+	ErrUnexpectedValue = errors.New("unexpected value returned from hcs")
+
+	// ErrVmcomputeAlreadyStopped is an error encountered when a shutdown or terminate request is made on a stopped container
+	ErrVmcomputeAlreadyStopped = syscall.Errno(0xc0370110)
+
+	// ErrVmcomputeOperationPending is an error encountered when the operation is being completed asynchronously
+	ErrVmcomputeOperationPending = syscall.Errno(0xC0370103)
+
+	// ErrVmcomputeOperationInvalidState is an error encountered when the compute system is not in a valid state for the requested operation
+	ErrVmcomputeOperationInvalidState = syscall.Errno(0xc0370105)
+
+	// ErrProcNotFound is an error encountered when the the process cannot be found
+	ErrProcNotFound = syscall.Errno(0x7f)
+
+	// ErrVmcomputeOperationAccessIsDenied is an error which can be encountered when enumerating compute systems in RS1/RS2
+	// builds when the underlying silo might be in the process of terminating. HCS was fixed in RS3.
+	ErrVmcomputeOperationAccessIsDenied = syscall.Errno(0x5)
+
+	// ErrVmcomputeInvalidJSON is an error encountered when the compute system does not support/understand the messages sent by management
+	ErrVmcomputeInvalidJSON = syscall.Errno(0xc037010d)
+
+	// ErrVmcomputeUnknownMessage is an error encountered guest compute system doesn't support the message
+	ErrVmcomputeUnknownMessage = syscall.Errno(0xc037010b)
+
+	// ErrNotSupported is an error encountered when hcs doesn't support the request
+	ErrPlatformNotSupported = errors.New("unsupported platform request")
+)
+
+type ErrorEvent struct {
+	Message    string `json:"Message,omitempty"`    // Fully formated error message
+	StackTrace string `json:"StackTrace,omitempty"` // Stack trace in string form
+	Provider   string `json:"Provider,omitempty"`
+	EventID    uint16 `json:"EventId,omitempty"`
+	Flags      uint32 `json:"Flags,omitempty"`
+	Source     string `json:"Source,omitempty"`
+	//Data       []EventData `json:"Data,omitempty"`  // Omit this as HCS doesn't encode this well. It's more confusing to include. It is however logged in debug mode (see processHcsResult function)
+}
+
+type hcsResult struct {
+	Error        int32
+	ErrorMessage string
+	ErrorEvents  []ErrorEvent `json:"ErrorEvents,omitempty"`
+}
+
+func (ev *ErrorEvent) String() string {
+	evs := "[Event Detail: " + ev.Message
+	if ev.StackTrace != "" {
+		evs += " Stack Trace: " + ev.StackTrace
+	}
+	if ev.Provider != "" {
+		evs += " Provider: " + ev.Provider
+	}
+	if ev.EventID != 0 {
+		evs = fmt.Sprintf("%s EventID: %d", evs, ev.EventID)
+	}
+	if ev.Flags != 0 {
+		evs = fmt.Sprintf("%s flags: %d", evs, ev.Flags)
+	}
+	if ev.Source != "" {
+		evs += " Source: " + ev.Source
+	}
+	evs += "]"
+	return evs
+}
+
+func processHcsResult(resultp *uint16) []ErrorEvent {
+	if resultp != nil {
+		resultj := interop.ConvertAndFreeCoTaskMemString(resultp)
+		logrus.Debugf("Result: %s", resultj)
+		result := &hcsResult{}
+		if err := json.Unmarshal([]byte(resultj), result); err != nil {
+			logrus.Warnf("Could not unmarshal HCS result %s: %s", resultj, err)
+			return nil
+		}
+		return result.ErrorEvents
+	}
+	return nil
+}
+
+type HcsError struct {
+	Op     string
+	Err    error
+	Events []ErrorEvent
+}
+
+func (e *HcsError) Error() string {
+	s := e.Op + ": " + e.Err.Error()
+	for _, ev := range e.Events {
+		s += "\n" + ev.String()
+	}
+	return s
+}
+
+// ProcessError is an error encountered in HCS during an operation on a Process object
+type ProcessError struct {
+	SystemID string
+	Pid      int
+	Op       string
+	Err      error
+	Events   []ErrorEvent
+}
+
+// SystemError is an error encountered in HCS during an operation on a Container object
+type SystemError struct {
+	ID     string
+	Op     string
+	Err    error
+	Extra  string
+	Events []ErrorEvent
+}
+
+func (e *SystemError) Error() string {
+	s := e.Op + " " + e.ID + ": " + e.Err.Error()
+	for _, ev := range e.Events {
+		s += "\n" + ev.String()
+	}
+	if e.Extra != "" {
+		s += "\n(extra info: " + e.Extra + ")"
+	}
+	return s
+}
+
+func makeSystemError(system *System, op string, extra string, err error, events []ErrorEvent) error {
+	// Don't double wrap errors
+	if _, ok := err.(*SystemError); ok {
+		return err
+	}
+	return &SystemError{
+		ID:     system.ID(),
+		Op:     op,
+		Extra:  extra,
+		Err:    err,
+		Events: events,
+	}
+}
+
+func (e *ProcessError) Error() string {
+	s := fmt.Sprintf("%s %s:%d: %s", e.Op, e.SystemID, e.Pid, e.Err.Error())
+	for _, ev := range e.Events {
+		s += "\n" + ev.String()
+	}
+	return s
+}
+
+func makeProcessError(process *Process, op string, err error, events []ErrorEvent) error {
+	// Don't double wrap errors
+	if _, ok := err.(*ProcessError); ok {
+		return err
+	}
+	return &ProcessError{
+		Pid:      process.Pid(),
+		SystemID: process.SystemID(),
+		Op:       op,
+		Err:      err,
+		Events:   events,
+	}
+}
+
+// IsNotExist checks if an error is caused by the Container or Process not existing.
+// Note: Currently, ErrElementNotFound can mean that a Process has either
+// already exited, or does not exist. Both IsAlreadyStopped and IsNotExist
+// will currently return true when the error is ErrElementNotFound or ErrProcNotFound.
+func IsNotExist(err error) bool {
+	err = getInnerError(err)
+	return err == ErrComputeSystemDoesNotExist ||
+		err == ErrElementNotFound ||
+		err == ErrProcNotFound
+}
+
+// IsAlreadyClosed checks if an error is caused by the Container or Process having been
+// already closed by a call to the Close() method.
+func IsAlreadyClosed(err error) bool {
+	err = getInnerError(err)
+	return err == ErrAlreadyClosed
+}
+
+// IsPending returns a boolean indicating whether the error is that
+// the requested operation is being completed in the background.
+func IsPending(err error) bool {
+	err = getInnerError(err)
+	return err == ErrVmcomputeOperationPending
+}
+
+// IsTimeout returns a boolean indicating whether the error is caused by
+// a timeout waiting for the operation to complete.
+func IsTimeout(err error) bool {
+	err = getInnerError(err)
+	return err == ErrTimeout
+}
+
+// IsAlreadyStopped returns a boolean indicating whether the error is caused by
+// a Container or Process being already stopped.
+// Note: Currently, ErrElementNotFound can mean that a Process has either
+// already exited, or does not exist. Both IsAlreadyStopped and IsNotExist
+// will currently return true when the error is ErrElementNotFound or ErrProcNotFound.
+func IsAlreadyStopped(err error) bool {
+	err = getInnerError(err)
+	return err == ErrVmcomputeAlreadyStopped ||
+		err == ErrElementNotFound ||
+		err == ErrProcNotFound
+}
+
+// IsNotSupported returns a boolean indicating whether the error is caused by
+// unsupported platform requests
+// Note: Currently Unsupported platform requests can be mean either
+// ErrVmcomputeInvalidJSON, ErrInvalidData, ErrNotSupported or ErrVmcomputeUnknownMessage
+// is thrown from the Platform
+func IsNotSupported(err error) bool {
+	err = getInnerError(err)
+	// If Platform doesn't recognize or support the request sent, below errors are seen
+	return err == ErrVmcomputeInvalidJSON ||
+		err == ErrInvalidData ||
+		err == ErrNotSupported ||
+		err == ErrVmcomputeUnknownMessage
+}
+
+func getInnerError(err error) error {
+	switch pe := err.(type) {
+	case nil:
+		return nil
+	case *HcsError:
+		err = pe.Err
+	case *SystemError:
+		err = pe.Err
+	case *ProcessError:
+		err = pe.Err
+	}
+	return err
+}

vendor/github.com/Microsoft/hcsshim/internal/hcs/hcs.go

@@ -0,0 +1,47 @@
+// Shim for the Host Compute Service (HCS) to manage Windows Server
+// containers and Hyper-V containers.
+
+package hcs
+
+import (
+	"syscall"
+)
+
+//go:generate go run ../../mksyscall_windows.go -output zsyscall_windows.go hcs.go
+
+//sys hcsEnumerateComputeSystems(query string, computeSystems **uint16, result **uint16) (hr error) = vmcompute.HcsEnumerateComputeSystems?
+//sys hcsCreateComputeSystem(id string, configuration string, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) = vmcompute.HcsCreateComputeSystem?
+//sys hcsOpenComputeSystem(id string, computeSystem *hcsSystem, result **uint16) (hr error) = vmcompute.HcsOpenComputeSystem?
+//sys hcsCloseComputeSystem(computeSystem hcsSystem) (hr error) = vmcompute.HcsCloseComputeSystem?
+//sys hcsStartComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsStartComputeSystem?
+//sys hcsShutdownComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsShutdownComputeSystem?
+//sys hcsTerminateComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsTerminateComputeSystem?
+//sys hcsPauseComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsPauseComputeSystem?
+//sys hcsResumeComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsResumeComputeSystem?
+//sys hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) = vmcompute.HcsGetComputeSystemProperties?
+//sys hcsModifyComputeSystem(computeSystem hcsSystem, configuration string, result **uint16) (hr error) = vmcompute.HcsModifyComputeSystem?
+//sys hcsRegisterComputeSystemCallback(computeSystem hcsSystem, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) = vmcompute.HcsRegisterComputeSystemCallback?
+//sys hcsUnregisterComputeSystemCallback(callbackHandle hcsCallback) (hr error) = vmcompute.HcsUnregisterComputeSystemCallback?
+
+//sys hcsCreateProcess(computeSystem hcsSystem, processParameters string, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) = vmcompute.HcsCreateProcess?
+//sys hcsOpenProcess(computeSystem hcsSystem, pid uint32, process *hcsProcess, result **uint16) (hr error) = vmcompute.HcsOpenProcess?
+//sys hcsCloseProcess(process hcsProcess) (hr error) = vmcompute.HcsCloseProcess?
+//sys hcsTerminateProcess(process hcsProcess, result **uint16) (hr error) = vmcompute.HcsTerminateProcess?
+//sys hcsGetProcessInfo(process hcsProcess, processInformation *hcsProcessInformation, result **uint16) (hr error) = vmcompute.HcsGetProcessInfo?
+//sys hcsGetProcessProperties(process hcsProcess, processProperties **uint16, result **uint16) (hr error) = vmcompute.HcsGetProcessProperties?
+//sys hcsModifyProcess(process hcsProcess, settings string, result **uint16) (hr error) = vmcompute.HcsModifyProcess?
+//sys hcsGetServiceProperties(propertyQuery string, properties **uint16, result **uint16) (hr error) = vmcompute.HcsGetServiceProperties?
+//sys hcsRegisterProcessCallback(process hcsProcess, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) = vmcompute.HcsRegisterProcessCallback?
+//sys hcsUnregisterProcessCallback(callbackHandle hcsCallback) (hr error) = vmcompute.HcsUnregisterProcessCallback?
+
+type hcsSystem syscall.Handle
+type hcsProcess syscall.Handle
+type hcsCallback syscall.Handle
+
+type hcsProcessInformation struct {
+	ProcessId uint32
+	Reserved  uint32
+	StdInput  syscall.Handle
+	StdOutput syscall.Handle
+	StdError  syscall.Handle
+}

vendor/github.com/Microsoft/hcsshim/internal/hcs/process.go

@@ -0,0 +1,393 @@
+package hcs
+
+import (
+	"encoding/json"
+	"fmt"
+	"io"
+	"sync"
+	"syscall"
+	"time"
+
+	"github.com/Microsoft/hcsshim/internal/interop"
+	"github.com/sirupsen/logrus"
+)
+
+// ContainerError is an error encountered in HCS
+type Process struct {
+	handleLock     sync.RWMutex
+	handle         hcsProcess
+	processID      int
+	system         *System
+	cachedPipes    *cachedPipes
+	callbackNumber uintptr
+}
+
+type cachedPipes struct {
+	stdIn  syscall.Handle
+	stdOut syscall.Handle
+	stdErr syscall.Handle
+}
+
+type processModifyRequest struct {
+	Operation   string
+	ConsoleSize *consoleSize `json:",omitempty"`
+	CloseHandle *closeHandle `json:",omitempty"`
+}
+
+type consoleSize struct {
+	Height uint16
+	Width  uint16
+}
+
+type closeHandle struct {
+	Handle string
+}
+
+type ProcessStatus struct {
+	ProcessID      uint32
+	Exited         bool
+	ExitCode       uint32
+	LastWaitResult int32
+}
+
+const (
+	stdIn  string = "StdIn"
+	stdOut string = "StdOut"
+	stdErr string = "StdErr"
+)
+
+const (
+	modifyConsoleSize string = "ConsoleSize"
+	modifyCloseHandle string = "CloseHandle"
+)
+
+// Pid returns the process ID of the process within the container.
+func (process *Process) Pid() int {
+	return process.processID
+}
+
+// SystemID returns the ID of the process's compute system.
+func (process *Process) SystemID() string {
+	return process.system.ID()
+}
+
+// Kill signals the process to terminate but does not wait for it to finish terminating.
+func (process *Process) Kill() error {
+	process.handleLock.RLock()
+	defer process.handleLock.RUnlock()
+	operation := "Kill"
+	title := "hcsshim::Process::" + operation
+	logrus.Debugf(title+" processid=%d", process.processID)
+
+	if process.handle == 0 {
+		return makeProcessError(process, operation, ErrAlreadyClosed, nil)
+	}
+
+	var resultp *uint16
+	completed := false
+	go syscallWatcher(fmt.Sprintf("TerminateProcess %s: %d", process.SystemID(), process.Pid()), &completed)
+	err := hcsTerminateProcess(process.handle, &resultp)
+	completed = true
+	events := processHcsResult(resultp)
+	if err != nil {
+		return makeProcessError(process, operation, err, events)
+	}
+
+	logrus.Debugf(title+" succeeded processid=%d", process.processID)
+	return nil
+}
+
+// Wait waits for the process to exit.
+func (process *Process) Wait() error {
+	operation := "Wait"
+	title := "hcsshim::Process::" + operation
+	logrus.Debugf(title+" processid=%d", process.processID)
+
+	err := waitForNotification(process.callbackNumber, hcsNotificationProcessExited, nil)
+	if err != nil {
+		return makeProcessError(process, operation, err, nil)
+	}
+
+	logrus.Debugf(title+" succeeded processid=%d", process.processID)
+	return nil
+}
+
+// WaitTimeout waits for the process to exit or the duration to elapse. It returns
+// false if timeout occurs.
+func (process *Process) WaitTimeout(timeout time.Duration) error {
+	operation := "WaitTimeout"
+	title := "hcsshim::Process::" + operation
+	logrus.Debugf(title+" processid=%d", process.processID)
+
+	err := waitForNotification(process.callbackNumber, hcsNotificationProcessExited, &timeout)
+	if err != nil {
+		return makeProcessError(process, operation, err, nil)
+	}
+
+	logrus.Debugf(title+" succeeded processid=%d", process.processID)
+	return nil
+}
+
+// ResizeConsole resizes the console of the process.
+func (process *Process) ResizeConsole(width, height uint16) error {
+	process.handleLock.RLock()
+	defer process.handleLock.RUnlock()
+	operation := "ResizeConsole"
+	title := "hcsshim::Process::" + operation
+	logrus.Debugf(title+" processid=%d", process.processID)
+
+	if process.handle == 0 {
+		return makeProcessError(process, operation, ErrAlreadyClosed, nil)
+	}
+
+	modifyRequest := processModifyRequest{
+		Operation: modifyConsoleSize,
+		ConsoleSize: &consoleSize{
+			Height: height,
+			Width:  width,
+		},
+	}
+
+	modifyRequestb, err := json.Marshal(modifyRequest)
+	if err != nil {
+		return err
+	}
+
+	modifyRequestStr := string(modifyRequestb)
+
+	var resultp *uint16
+	err = hcsModifyProcess(process.handle, modifyRequestStr, &resultp)
+	events := processHcsResult(resultp)
+	if err != nil {
+		return makeProcessError(process, operation, err, events)
+	}
+
+	logrus.Debugf(title+" succeeded processid=%d", process.processID)
+	return nil
+}
+
+func (process *Process) Properties() (*ProcessStatus, error) {
+	process.handleLock.RLock()
+	defer process.handleLock.RUnlock()
+	operation := "Properties"
+	title := "hcsshim::Process::" + operation
+	logrus.Debugf(title+" processid=%d", process.processID)
+
+	if process.handle == 0 {
+		return nil, makeProcessError(process, operation, ErrAlreadyClosed, nil)
+	}
+
+	var (
+		resultp     *uint16
+		propertiesp *uint16
+	)
+	completed := false
+	go syscallWatcher(fmt.Sprintf("GetProcessProperties %s: %d", process.SystemID(), process.Pid()), &completed)
+	err := hcsGetProcessProperties(process.handle, &propertiesp, &resultp)
+	completed = true
+	events := processHcsResult(resultp)
+	if err != nil {
+		return nil, makeProcessError(process, operation, err, events)
+	}
+
+	if propertiesp == nil {
+		return nil, ErrUnexpectedValue
+	}
+	propertiesRaw := interop.ConvertAndFreeCoTaskMemBytes(propertiesp)
+
+	properties := &ProcessStatus{}
+	if err := json.Unmarshal(propertiesRaw, properties); err != nil {
+		return nil, makeProcessError(process, operation, err, nil)
+	}
+
+	logrus.Debugf(title+" succeeded processid=%d, properties=%s", process.processID, propertiesRaw)
+	return properties, nil
+}
+
+// ExitCode returns the exit code of the process. The process must have
+// already terminated.
+func (process *Process) ExitCode() (int, error) {
+	operation := "ExitCode"
+	properties, err := process.Properties()
+	if err != nil {
+		return 0, makeProcessError(process, operation, err, nil)
+	}
+
+	if properties.Exited == false {
+		return 0, makeProcessError(process, operation, ErrInvalidProcessState, nil)
+	}
+
+	if properties.LastWaitResult != 0 {
+		return 0, makeProcessError(process, operation, syscall.Errno(properties.LastWaitResult), nil)
+	}
+
+	return int(properties.ExitCode), nil
+}
+
+// Stdio returns the stdin, stdout, and stderr pipes, respectively. Closing
+// these pipes does not close the underlying pipes; it should be possible to
+// call this multiple times to get multiple interfaces.
+func (process *Process) Stdio() (io.WriteCloser, io.ReadCloser, io.ReadCloser, error) {
+	process.handleLock.RLock()
+	defer process.handleLock.RUnlock()
+	operation := "Stdio"
+	title := "hcsshim::Process::" + operation
+	logrus.Debugf(title+" processid=%d", process.processID)
+
+	if process.handle == 0 {
+		return nil, nil, nil, makeProcessError(process, operation, ErrAlreadyClosed, nil)
+	}
+
+	var stdIn, stdOut, stdErr syscall.Handle
+
+	if process.cachedPipes == nil {
+		var (
+			processInfo hcsProcessInformation
+			resultp     *uint16
+		)
+		err := hcsGetProcessInfo(process.handle, &processInfo, &resultp)
+		events := processHcsResult(resultp)
+		if err != nil {
+			return nil, nil, nil, makeProcessError(process, operation, err, events)
+		}
+
+		stdIn, stdOut, stdErr = processInfo.StdInput, processInfo.StdOutput, processInfo.StdError
+	} else {
+		// Use cached pipes
+		stdIn, stdOut, stdErr = process.cachedPipes.stdIn, process.cachedPipes.stdOut, process.cachedPipes.stdErr
+
+		// Invalidate the cache
+		process.cachedPipes = nil
+	}
+
+	pipes, err := makeOpenFiles([]syscall.Handle{stdIn, stdOut, stdErr})
+	if err != nil {
+		return nil, nil, nil, makeProcessError(process, operation, err, nil)
+	}
+
+	logrus.Debugf(title+" succeeded processid=%d", process.processID)
+	return pipes[0], pipes[1], pipes[2], nil
+}
+
+// CloseStdin closes the write side of the stdin pipe so that the process is
+// notified on the read side that there is no more data in stdin.
+func (process *Process) CloseStdin() error {
+	process.handleLock.RLock()
+	defer process.handleLock.RUnlock()
+	operation := "CloseStdin"
+	title := "hcsshim::Process::" + operation
+	logrus.Debugf(title+" processid=%d", process.processID)
+
+	if process.handle == 0 {
+		return makeProcessError(process, operation, ErrAlreadyClosed, nil)
+	}
+
+	modifyRequest := processModifyRequest{
+		Operation: modifyCloseHandle,
+		CloseHandle: &closeHandle{
+			Handle: stdIn,
+		},
+	}
+
+	modifyRequestb, err := json.Marshal(modifyRequest)
+	if err != nil {
+		return err
+	}
+
+	modifyRequestStr := string(modifyRequestb)
+
+	var resultp *uint16
+	err = hcsModifyProcess(process.handle, modifyRequestStr, &resultp)
+	events := processHcsResult(resultp)
+	if err != nil {
+		return makeProcessError(process, operation, err, events)
+	}
+
+	logrus.Debugf(title+" succeeded processid=%d", process.processID)
+	return nil
+}
+
+// Close cleans up any state associated with the process but does not kill
+// or wait on it.
+func (process *Process) Close() error {
+	process.handleLock.Lock()
+	defer process.handleLock.Unlock()
+	operation := "Close"
+	title := "hcsshim::Process::" + operation
+	logrus.Debugf(title+" processid=%d", process.processID)
+
+	// Don't double free this
+	if process.handle == 0 {
+		return nil
+	}
+
+	if err := process.unregisterCallback(); err != nil {
+		return makeProcessError(process, operation, err, nil)
+	}
+
+	if err := hcsCloseProcess(process.handle); err != nil {
+		return makeProcessError(process, operation, err, nil)
+	}
+
+	process.handle = 0
+
+	logrus.Debugf(title+" succeeded processid=%d", process.processID)
+	return nil
+}
+
+func (process *Process) registerCallback() error {
+	context := &notifcationWatcherContext{
+		channels: newChannels(),
+	}
+
+	callbackMapLock.Lock()
+	callbackNumber := nextCallback
+	nextCallback++
+	callbackMap[callbackNumber] = context
+	callbackMapLock.Unlock()
+
+	var callbackHandle hcsCallback
+	err := hcsRegisterProcessCallback(process.handle, notificationWatcherCallback, callbackNumber, &callbackHandle)
+	if err != nil {
+		return err
+	}
+	context.handle = callbackHandle
+	process.callbackNumber = callbackNumber
+
+	return nil
+}
+
+func (process *Process) unregisterCallback() error {
+	callbackNumber := process.callbackNumber
+
+	callbackMapLock.RLock()
+	context := callbackMap[callbackNumber]
+	callbackMapLock.RUnlock()
+
+	if context == nil {
+		return nil
+	}
+
+	handle := context.handle
+
+	if handle == 0 {
+		return nil
+	}
+
+	// hcsUnregisterProcessCallback has its own syncronization
+	// to wait for all callbacks to complete. We must NOT hold the callbackMapLock.
+	err := hcsUnregisterProcessCallback(handle)
+	if err != nil {
+		return err
+	}
+
+	closeChannels(context.channels)
+
+	callbackMapLock.Lock()
+	callbackMap[callbackNumber] = nil
+	callbackMapLock.Unlock()
+
+	handle = 0
+
+	return nil
+}

vendor/github.com/Microsoft/hcsshim/internal/hcs/system.go

@@ -0,0 +1,585 @@
+package hcs
+
+import (
+	"encoding/json"
+	"fmt"
+	"os"
+	"strconv"
+	"sync"
+	"syscall"
+	"time"
+
+	"github.com/Microsoft/hcsshim/internal/interop"
+	"github.com/Microsoft/hcsshim/internal/schema1"
+	"github.com/Microsoft/hcsshim/internal/timeout"
+	"github.com/sirupsen/logrus"
+)
+
+// currentContainerStarts is used to limit the number of concurrent container
+// starts.
+var currentContainerStarts containerStarts
+
+type containerStarts struct {
+	maxParallel int
+	inProgress  int
+	sync.Mutex
+}
+
+func init() {
+	mpsS := os.Getenv("HCSSHIM_MAX_PARALLEL_START")
+	if len(mpsS) > 0 {
+		mpsI, err := strconv.Atoi(mpsS)
+		if err != nil || mpsI < 0 {
+			return
+		}
+		currentContainerStarts.maxParallel = mpsI
+	}
+}
+
+type System struct {
+	handleLock     sync.RWMutex
+	handle         hcsSystem
+	id             string
+	callbackNumber uintptr
+}
+
+// CreateComputeSystem creates a new compute system with the given configuration but does not start it.
+func CreateComputeSystem(id string, hcsDocumentInterface interface{}) (*System, error) {
+	operation := "CreateComputeSystem"
+	title := "hcsshim::" + operation
+
+	computeSystem := &System{
+		id: id,
+	}
+
+	hcsDocumentB, err := json.Marshal(hcsDocumentInterface)
+	if err != nil {
+		return nil, err
+	}
+
+	hcsDocument := string(hcsDocumentB)
+	logrus.Debugf(title+" ID=%s config=%s", id, hcsDocument)
+
+	var (
+		resultp  *uint16
+		identity syscall.Handle
+	)
+	completed := false
+	go syscallWatcher(fmt.Sprintf("CreateCompleteSystem %s: %s", id, hcsDocument), &completed)
+	createError := hcsCreateComputeSystem(id, hcsDocument, identity, &computeSystem.handle, &resultp)
+	completed = true
+
+	if createError == nil || IsPending(createError) {
+		if err := computeSystem.registerCallback(); err != nil {
+			// Terminate the compute system if it still exists. We're okay to
+			// ignore a failure here.
+			computeSystem.Terminate()
+			return nil, makeSystemError(computeSystem, operation, "", err, nil)
+		}
+	}
+
+	events, err := processAsyncHcsResult(createError, resultp, computeSystem.callbackNumber, hcsNotificationSystemCreateCompleted, &timeout.SystemCreate)
+	if err != nil {
+		if err == ErrTimeout {
+			// Terminate the compute system if it still exists. We're okay to
+			// ignore a failure here.
+			computeSystem.Terminate()
+		}
+		return nil, makeSystemError(computeSystem, operation, hcsDocument, err, events)
+	}
+
+	logrus.Debugf(title+" succeeded id=%s handle=%d", id, computeSystem.handle)
+	return computeSystem, nil
+}
+
+// OpenComputeSystem opens an existing compute system by ID.
+func OpenComputeSystem(id string) (*System, error) {
+	operation := "OpenComputeSystem"
+	title := "hcsshim::" + operation
+	logrus.Debugf(title+" ID=%s", id)
+
+	computeSystem := &System{
+		id: id,
+	}
+
+	var (
+		handle  hcsSystem
+		resultp *uint16
+	)
+	err := hcsOpenComputeSystem(id, &handle, &resultp)
+	events := processHcsResult(resultp)
+	if err != nil {
+		return nil, makeSystemError(computeSystem, operation, "", err, events)
+	}
+
+	computeSystem.handle = handle
+
+	if err := computeSystem.registerCallback(); err != nil {
+		return nil, makeSystemError(computeSystem, operation, "", err, nil)
+	}
+
+	logrus.Debugf(title+" succeeded id=%s handle=%d", id, handle)
+	return computeSystem, nil
+}
+
+// GetComputeSystems gets a list of the compute systems on the system that match the query
+func GetComputeSystems(q schema1.ComputeSystemQuery) ([]schema1.ContainerProperties, error) {
+	operation := "GetComputeSystems"
+	title := "hcsshim::" + operation
+
+	queryb, err := json.Marshal(q)
+	if err != nil {
+		return nil, err
+	}
+
+	query := string(queryb)
+	logrus.Debugf(title+" query=%s", query)
+
+	var (
+		resultp         *uint16
+		computeSystemsp *uint16
+	)
+	completed := false
+	go syscallWatcher(fmt.Sprintf("GetComputeSystems %s:", query), &completed)
+	err = hcsEnumerateComputeSystems(query, &computeSystemsp, &resultp)
+	completed = true
+	events := processHcsResult(resultp)
+	if err != nil {
+		return nil, &HcsError{Op: operation, Err: err, Events: events}
+	}
+
+	if computeSystemsp == nil {
+		return nil, ErrUnexpectedValue
+	}
+	computeSystemsRaw := interop.ConvertAndFreeCoTaskMemBytes(computeSystemsp)
+	computeSystems := []schema1.ContainerProperties{}
+	if err := json.Unmarshal(computeSystemsRaw, &computeSystems); err != nil {
+		return nil, err
+	}
+
+	logrus.Debugf(title + " succeeded")
+	return computeSystems, nil
+}
+
+// Start synchronously starts the computeSystem.
+func (computeSystem *System) Start() error {
+	computeSystem.handleLock.RLock()
+	defer computeSystem.handleLock.RUnlock()
+	title := "hcsshim::ComputeSystem::Start ID=" + computeSystem.ID()
+	logrus.Debugf(title)
+
+	if computeSystem.handle == 0 {
+		return makeSystemError(computeSystem, "Start", "", ErrAlreadyClosed, nil)
+	}
+
+	// This is a very simple backoff-retry loop to limit the number
+	// of parallel container starts if environment variable
+	// HCSSHIM_MAX_PARALLEL_START is set to a positive integer.
+	// It should generally only be used as a workaround to various
+	// platform issues that exist between RS1 and RS4 as of Aug 2018
+	if currentContainerStarts.maxParallel > 0 {
+		for {
+			currentContainerStarts.Lock()
+			if currentContainerStarts.inProgress < currentContainerStarts.maxParallel {
+				currentContainerStarts.inProgress++
+				currentContainerStarts.Unlock()
+				break
+			}
+			if currentContainerStarts.inProgress == currentContainerStarts.maxParallel {
+				currentContainerStarts.Unlock()
+				time.Sleep(100 * time.Millisecond)
+			}
+		}
+		// Make sure we decrement the count when we are done.
+		defer func() {
+			currentContainerStarts.Lock()
+			currentContainerStarts.inProgress--
+			currentContainerStarts.Unlock()
+		}()
+	}
+
+	var resultp *uint16
+	completed := false
+	go syscallWatcher(fmt.Sprintf("StartComputeSystem %s:", computeSystem.ID()), &completed)
+	err := hcsStartComputeSystem(computeSystem.handle, "", &resultp)
+	completed = true
+	events, err := processAsyncHcsResult(err, resultp, computeSystem.callbackNumber, hcsNotificationSystemStartCompleted, &timeout.SystemStart)
+	if err != nil {
+		return makeSystemError(computeSystem, "Start", "", err, events)
+	}
+
+	logrus.Debugf(title + " succeeded")
+	return nil
+}
+
+// ID returns the compute system's identifier.
+func (computeSystem *System) ID() string {
+	return computeSystem.id
+}
+
+// Shutdown requests a compute system shutdown, if IsPending() on the error returned is true,
+// it may not actually be shut down until Wait() succeeds.
+func (computeSystem *System) Shutdown() error {
+	computeSystem.handleLock.RLock()
+	defer computeSystem.handleLock.RUnlock()
+	title := "hcsshim::ComputeSystem::Shutdown"
+	logrus.Debugf(title)
+	if computeSystem.handle == 0 {
+		return makeSystemError(computeSystem, "Shutdown", "", ErrAlreadyClosed, nil)
+	}
+
+	var resultp *uint16
+	completed := false
+	go syscallWatcher(fmt.Sprintf("ShutdownComputeSystem %s:", computeSystem.ID()), &completed)
+	err := hcsShutdownComputeSystem(computeSystem.handle, "", &resultp)
+	completed = true
+	events := processHcsResult(resultp)
+	if err != nil {
+		return makeSystemError(computeSystem, "Shutdown", "", err, events)
+	}
+
+	logrus.Debugf(title + " succeeded")
+	return nil
+}
+
+// Terminate requests a compute system terminate, if IsPending() on the error returned is true,
+// it may not actually be shut down until Wait() succeeds.
+func (computeSystem *System) Terminate() error {
+	computeSystem.handleLock.RLock()
+	defer computeSystem.handleLock.RUnlock()
+	title := "hcsshim::ComputeSystem::Terminate ID=" + computeSystem.ID()
+	logrus.Debugf(title)
+
+	if computeSystem.handle == 0 {
+		return makeSystemError(computeSystem, "Terminate", "", ErrAlreadyClosed, nil)
+	}
+
+	var resultp *uint16
+	completed := false
+	go syscallWatcher(fmt.Sprintf("TerminateComputeSystem %s:", computeSystem.ID()), &completed)
+	err := hcsTerminateComputeSystem(computeSystem.handle, "", &resultp)
+	completed = true
+	events := processHcsResult(resultp)
+	if err != nil {
+		return makeSystemError(computeSystem, "Terminate", "", err, events)
+	}
+
+	logrus.Debugf(title + " succeeded")
+	return nil
+}
+
+// Wait synchronously waits for the compute system to shutdown or terminate.
+func (computeSystem *System) Wait() error {
+	title := "hcsshim::ComputeSystem::Wait ID=" + computeSystem.ID()
+	logrus.Debugf(title)
+
+	err := waitForNotification(computeSystem.callbackNumber, hcsNotificationSystemExited, nil)
+	if err != nil {
+		return makeSystemError(computeSystem, "Wait", "", err, nil)
+	}
+
+	logrus.Debugf(title + " succeeded")
+	return nil
+}
+
+// WaitTimeout synchronously waits for the compute system to terminate or the duration to elapse.
+// If the timeout expires, IsTimeout(err) == true
+func (computeSystem *System) WaitTimeout(timeout time.Duration) error {
+	title := "hcsshim::ComputeSystem::WaitTimeout ID=" + computeSystem.ID()
+	logrus.Debugf(title)
+
+	err := waitForNotification(computeSystem.callbackNumber, hcsNotificationSystemExited, &timeout)
+	if err != nil {
+		return makeSystemError(computeSystem, "WaitTimeout", "", err, nil)
+	}
+
+	logrus.Debugf(title + " succeeded")
+	return nil
+}
+
+func (computeSystem *System) Properties(types ...schema1.PropertyType) (*schema1.ContainerProperties, error) {
+	computeSystem.handleLock.RLock()
+	defer computeSystem.handleLock.RUnlock()
+
+	queryj, err := json.Marshal(schema1.PropertyQuery{types})
+	if err != nil {
+		return nil, makeSystemError(computeSystem, "Properties", "", err, nil)
+	}
+
+	var resultp, propertiesp *uint16
+	completed := false
+	go syscallWatcher(fmt.Sprintf("GetComputeSystemProperties %s:", computeSystem.ID()), &completed)
+	err = hcsGetComputeSystemProperties(computeSystem.handle, string(queryj), &propertiesp, &resultp)
+	completed = true
+	events := processHcsResult(resultp)
+	if err != nil {
+		return nil, makeSystemError(computeSystem, "Properties", "", err, events)
+	}
+
+	if propertiesp == nil {
+		return nil, ErrUnexpectedValue
+	}
+	propertiesRaw := interop.ConvertAndFreeCoTaskMemBytes(propertiesp)
+	properties := &schema1.ContainerProperties{}
+	if err := json.Unmarshal(propertiesRaw, properties); err != nil {
+		return nil, makeSystemError(computeSystem, "Properties", "", err, nil)
+	}
+	return properties, nil
+}
+
+// Pause pauses the execution of the computeSystem. This feature is not enabled in TP5.
+func (computeSystem *System) Pause() error {
+	computeSystem.handleLock.RLock()
+	defer computeSystem.handleLock.RUnlock()
+	title := "hcsshim::ComputeSystem::Pause ID=" + computeSystem.ID()
+	logrus.Debugf(title)
+
+	if computeSystem.handle == 0 {
+		return makeSystemError(computeSystem, "Pause", "", ErrAlreadyClosed, nil)
+	}
+
+	var resultp *uint16
+	completed := false
+	go syscallWatcher(fmt.Sprintf("PauseComputeSystem %s:", computeSystem.ID()), &completed)
+	err := hcsPauseComputeSystem(computeSystem.handle, "", &resultp)
+	completed = true
+	events, err := processAsyncHcsResult(err, resultp, computeSystem.callbackNumber, hcsNotificationSystemPauseCompleted, &timeout.SystemPause)
+	if err != nil {
+		return makeSystemError(computeSystem, "Pause", "", err, events)
+	}
+
+	logrus.Debugf(title + " succeeded")
+	return nil
+}
+
+// Resume resumes the execution of the computeSystem. This feature is not enabled in TP5.
+func (computeSystem *System) Resume() error {
+	computeSystem.handleLock.RLock()
+	defer computeSystem.handleLock.RUnlock()
+	title := "hcsshim::ComputeSystem::Resume ID=" + computeSystem.ID()
+	logrus.Debugf(title)
+
+	if computeSystem.handle == 0 {
+		return makeSystemError(computeSystem, "Resume", "", ErrAlreadyClosed, nil)
+	}
+
+	var resultp *uint16
+	completed := false
+	go syscallWatcher(fmt.Sprintf("ResumeComputeSystem %s:", computeSystem.ID()), &completed)
+	err := hcsResumeComputeSystem(computeSystem.handle, "", &resultp)
+	completed = true
+	events, err := processAsyncHcsResult(err, resultp, computeSystem.callbackNumber, hcsNotificationSystemResumeCompleted, &timeout.SystemResume)
+	if err != nil {
+		return makeSystemError(computeSystem, "Resume", "", err, events)
+	}
+
+	logrus.Debugf(title + " succeeded")
+	return nil
+}
+
+// CreateProcess launches a new process within the computeSystem.
+func (computeSystem *System) CreateProcess(c interface{}) (*Process, error) {
+	computeSystem.handleLock.RLock()
+	defer computeSystem.handleLock.RUnlock()
+	title := "hcsshim::ComputeSystem::CreateProcess ID=" + computeSystem.ID()
+	var (
+		processInfo   hcsProcessInformation
+		processHandle hcsProcess
+		resultp       *uint16
+	)
+
+	if computeSystem.handle == 0 {
+		return nil, makeSystemError(computeSystem, "CreateProcess", "", ErrAlreadyClosed, nil)
+	}
+
+	configurationb, err := json.Marshal(c)
+	if err != nil {
+		return nil, makeSystemError(computeSystem, "CreateProcess", "", err, nil)
+	}
+
+	configuration := string(configurationb)
+	logrus.Debugf(title+" config=%s", configuration)
+
+	completed := false
+	go syscallWatcher(fmt.Sprintf("CreateProcess %s: %s", computeSystem.ID(), configuration), &completed)
+	err = hcsCreateProcess(computeSystem.handle, configuration, &processInfo, &processHandle, &resultp)
+	completed = true
+	events := processHcsResult(resultp)
+	if err != nil {
+		return nil, makeSystemError(computeSystem, "CreateProcess", configuration, err, events)
+	}
+
+	process := &Process{
+		handle:    processHandle,
+		processID: int(processInfo.ProcessId),
+		system:    computeSystem,
+		cachedPipes: &cachedPipes{
+			stdIn:  processInfo.StdInput,
+			stdOut: processInfo.StdOutput,
+			stdErr: processInfo.StdError,
+		},
+	}
+
+	if err := process.registerCallback(); err != nil {
+		return nil, makeSystemError(computeSystem, "CreateProcess", "", err, nil)
+	}
+
+	logrus.Debugf(title+" succeeded processid=%d", process.processID)
+	return process, nil
+}
+
+// OpenProcess gets an interface to an existing process within the computeSystem.
+func (computeSystem *System) OpenProcess(pid int) (*Process, error) {
+	computeSystem.handleLock.RLock()
+	defer computeSystem.handleLock.RUnlock()
+	title := "hcsshim::ComputeSystem::OpenProcess ID=" + computeSystem.ID()
+	logrus.Debugf(title+" processid=%d", pid)
+	var (
+		processHandle hcsProcess
+		resultp       *uint16
+	)
+
+	if computeSystem.handle == 0 {
+		return nil, makeSystemError(computeSystem, "OpenProcess", "", ErrAlreadyClosed, nil)
+	}
+
+	completed := false
+	go syscallWatcher(fmt.Sprintf("OpenProcess %s: %d", computeSystem.ID(), pid), &completed)
+	err := hcsOpenProcess(computeSystem.handle, uint32(pid), &processHandle, &resultp)
+	completed = true
+	events := processHcsResult(resultp)
+	if err != nil {
+		return nil, makeSystemError(computeSystem, "OpenProcess", "", err, events)
+	}
+
+	process := &Process{
+		handle:    processHandle,
+		processID: pid,
+		system:    computeSystem,
+	}
+
+	if err := process.registerCallback(); err != nil {
+		return nil, makeSystemError(computeSystem, "OpenProcess", "", err, nil)
+	}
+
+	logrus.Debugf(title+" succeeded processid=%s", process.processID)
+	return process, nil
+}
+
+// Close cleans up any state associated with the compute system but does not terminate or wait for it.
+func (computeSystem *System) Close() error {
+	computeSystem.handleLock.Lock()
+	defer computeSystem.handleLock.Unlock()
+	title := "hcsshim::ComputeSystem::Close ID=" + computeSystem.ID()
+	logrus.Debugf(title)
+
+	// Don't double free this
+	if computeSystem.handle == 0 {
+		return nil
+	}
+
+	if err := computeSystem.unregisterCallback(); err != nil {
+		return makeSystemError(computeSystem, "Close", "", err, nil)
+	}
+
+	completed := false
+	go syscallWatcher(fmt.Sprintf("CloseComputeSystem %s:", computeSystem.ID()), &completed)
+	err := hcsCloseComputeSystem(computeSystem.handle)
+	completed = true
+	if err != nil {
+		return makeSystemError(computeSystem, "Close", "", err, nil)
+	}
+
+	computeSystem.handle = 0
+
+	logrus.Debugf(title + " succeeded")
+	return nil
+}
+
+func (computeSystem *System) registerCallback() error {
+	context := &notifcationWatcherContext{
+		channels: newChannels(),
+	}
+
+	callbackMapLock.Lock()
+	callbackNumber := nextCallback
+	nextCallback++
+	callbackMap[callbackNumber] = context
+	callbackMapLock.Unlock()
+
+	var callbackHandle hcsCallback
+	err := hcsRegisterComputeSystemCallback(computeSystem.handle, notificationWatcherCallback, callbackNumber, &callbackHandle)
+	if err != nil {
+		return err
+	}
+	context.handle = callbackHandle
+	computeSystem.callbackNumber = callbackNumber
+
+	return nil
+}
+
+func (computeSystem *System) unregisterCallback() error {
+	callbackNumber := computeSystem.callbackNumber
+
+	callbackMapLock.RLock()
+	context := callbackMap[callbackNumber]
+	callbackMapLock.RUnlock()
+
+	if context == nil {
+		return nil
+	}
+
+	handle := context.handle
+
+	if handle == 0 {
+		return nil
+	}
+
+	// hcsUnregisterComputeSystemCallback has its own syncronization
+	// to wait for all callbacks to complete. We must NOT hold the callbackMapLock.
+	err := hcsUnregisterComputeSystemCallback(handle)
+	if err != nil {
+		return err
+	}
+
+	closeChannels(context.channels)
+
+	callbackMapLock.Lock()
+	callbackMap[callbackNumber] = nil
+	callbackMapLock.Unlock()
+
+	handle = 0
+
+	return nil
+}
+
+// Modifies the System by sending a request to HCS
+func (computeSystem *System) Modify(config interface{}) error {
+	computeSystem.handleLock.RLock()
+	defer computeSystem.handleLock.RUnlock()
+	title := "hcsshim::Modify ID=" + computeSystem.id
+
+	if computeSystem.handle == 0 {
+		return makeSystemError(computeSystem, "Modify", "", ErrAlreadyClosed, nil)
+	}
+
+	requestJSON, err := json.Marshal(config)
+	if err != nil {
+		return err
+	}
+
+	requestString := string(requestJSON)
+	logrus.Debugf(title + " " + requestString)
+
+	var resultp *uint16
+	completed := false
+	go syscallWatcher(fmt.Sprintf("ModifyComputeSystem %s: %s", computeSystem.ID(), requestString), &completed)
+	err = hcsModifyComputeSystem(computeSystem.handle, requestString, &resultp)
+	completed = true
+	events := processHcsResult(resultp)
+	if err != nil {
+		return makeSystemError(computeSystem, "Modify", requestString, err, events)
+	}
+	logrus.Debugf(title + " succeeded ")
+	return nil
+}

vendor/github.com/Microsoft/hcsshim/internal/hcs/utils.go

@@ -0,0 +1,33 @@
+package hcs
+
+import (
+	"io"
+	"syscall"
+
+	"github.com/Microsoft/go-winio"
+)
+
+// makeOpenFiles calls winio.MakeOpenFile for each handle in a slice but closes all the handles
+// if there is an error.
+func makeOpenFiles(hs []syscall.Handle) (_ []io.ReadWriteCloser, err error) {
+	fs := make([]io.ReadWriteCloser, len(hs))
+	for i, h := range hs {
+		if h != syscall.Handle(0) {
+			if err == nil {
+				fs[i], err = winio.MakeOpenFile(h)
+			}
+			if err != nil {
+				syscall.Close(h)
+			}
+		}
+	}
+	if err != nil {
+		for _, f := range fs {
+			if f != nil {
+				f.Close()
+			}
+		}
+		return nil, err
+	}
+	return fs, nil
+}

vendor/github.com/Microsoft/hcsshim/internal/hcs/waithelper.go

@@ -0,0 +1,63 @@
+package hcs
+
+import (
+	"time"
+
+	"github.com/sirupsen/logrus"
+)
+
+func processAsyncHcsResult(err error, resultp *uint16, callbackNumber uintptr, expectedNotification hcsNotification, timeout *time.Duration) ([]ErrorEvent, error) {
+	events := processHcsResult(resultp)
+	if IsPending(err) {
+		return nil, waitForNotification(callbackNumber, expectedNotification, timeout)
+	}
+
+	return events, err
+}
+
+func waitForNotification(callbackNumber uintptr, expectedNotification hcsNotification, timeout *time.Duration) error {
+	callbackMapLock.RLock()
+	channels := callbackMap[callbackNumber].channels
+	callbackMapLock.RUnlock()
+
+	expectedChannel := channels[expectedNotification]
+	if expectedChannel == nil {
+		logrus.Errorf("unknown notification type in waitForNotification %x", expectedNotification)
+		return ErrInvalidNotificationType
+	}
+
+	var c <-chan time.Time
+	if timeout != nil {
+		timer := time.NewTimer(*timeout)
+		c = timer.C
+		defer timer.Stop()
+	}
+
+	select {
+	case err, ok := <-expectedChannel:
+		if !ok {
+			return ErrHandleClose
+		}
+		return err
+	case err, ok := <-channels[hcsNotificationSystemExited]:
+		if !ok {
+			return ErrHandleClose
+		}
+		// If the expected notification is hcsNotificationSystemExited which of the two selects
+		// chosen is random. Return the raw error if hcsNotificationSystemExited is expected
+		if channels[hcsNotificationSystemExited] == expectedChannel {
+			return err
+		}
+		return ErrUnexpectedContainerExit
+	case _, ok := <-channels[hcsNotificationServiceDisconnect]:
+		if !ok {
+			return ErrHandleClose
+		}
+		// hcsNotificationServiceDisconnect should never be an expected notification
+		// it does not need the same handling as hcsNotificationSystemExited
+		return ErrUnexpectedProcessAbort
+	case <-c:
+		return ErrTimeout
+	}
+	return nil
+}

vendor/github.com/Microsoft/hcsshim/internal/hcs/watcher.go

@@ -0,0 +1,30 @@
+package hcs
+
+import (
+	"time"
+
+	"github.com/Microsoft/hcsshim/internal/timeout"
+	"github.com/sirupsen/logrus"
+)
+
+// syscallWatcher is used as a very simple goroutine around calls into
+// the platform. In some cases, we have seen HCS APIs not returning due to
+// various bugs, and the goroutine making the syscall ends up not returning,
+// prior to its async callback. By spinning up a syscallWatcher, it allows
+// us to at least log a warning if a syscall doesn't complete in a reasonable
+// amount of time.
+//
+// Usage is:
+//
+// completed := false
+// go syscallWatcher("some description", &completed)
+// <syscall>
+// completed = true
+//
+func syscallWatcher(description string, syscallCompleted *bool) {
+	time.Sleep(timeout.SyscallWatcher)
+	if *syscallCompleted {
+		return
+	}
+	logrus.Warnf("%s: Did not complete within %s. This may indicate a platform issue. If it appears to be making no forward progress, obtain the stacks and see is there is a syscall stuck in the platform API for a significant length of time.", description, timeout.SyscallWatcher)
+}

vendor/github.com/Microsoft/hcsshim/internal/hcs/zsyscall_windows.go

@@ -0,0 +1,441 @@
+// MACHINE GENERATED BY 'go generate' COMMAND; DO NOT EDIT
+
+package hcs
+
+import (
+	"syscall"
+	"unsafe"
+
+	"github.com/Microsoft/hcsshim/internal/interop"
+	"golang.org/x/sys/windows"
+)
+
+var _ unsafe.Pointer
+
+// Do the interface allocations only once for common
+// Errno values.
+const (
+	errnoERROR_IO_PENDING = 997
+)
+
+var (
+	errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING)
+)
+
+// errnoErr returns common boxed Errno values, to prevent
+// allocations at runtime.
+func errnoErr(e syscall.Errno) error {
+	switch e {
+	case 0:
+		return nil
+	case errnoERROR_IO_PENDING:
+		return errERROR_IO_PENDING
+	}
+	// TODO: add more here, after collecting data on the common
+	// error values see on Windows. (perhaps when running
+	// all.bat?)
+	return e
+}
+
+var (
+	modvmcompute = windows.NewLazySystemDLL("vmcompute.dll")
+
+	procHcsEnumerateComputeSystems         = modvmcompute.NewProc("HcsEnumerateComputeSystems")
+	procHcsCreateComputeSystem             = modvmcompute.NewProc("HcsCreateComputeSystem")
+	procHcsOpenComputeSystem               = modvmcompute.NewProc("HcsOpenComputeSystem")
+	procHcsCloseComputeSystem              = modvmcompute.NewProc("HcsCloseComputeSystem")
+	procHcsStartComputeSystem              = modvmcompute.NewProc("HcsStartComputeSystem")
+	procHcsShutdownComputeSystem           = modvmcompute.NewProc("HcsShutdownComputeSystem")
+	procHcsTerminateComputeSystem          = modvmcompute.NewProc("HcsTerminateComputeSystem")
+	procHcsPauseComputeSystem              = modvmcompute.NewProc("HcsPauseComputeSystem")
+	procHcsResumeComputeSystem             = modvmcompute.NewProc("HcsResumeComputeSystem")
+	procHcsGetComputeSystemProperties      = modvmcompute.NewProc("HcsGetComputeSystemProperties")
+	procHcsModifyComputeSystem             = modvmcompute.NewProc("HcsModifyComputeSystem")
+	procHcsRegisterComputeSystemCallback   = modvmcompute.NewProc("HcsRegisterComputeSystemCallback")
+	procHcsUnregisterComputeSystemCallback = modvmcompute.NewProc("HcsUnregisterComputeSystemCallback")
+	procHcsCreateProcess                   = modvmcompute.NewProc("HcsCreateProcess")
+	procHcsOpenProcess                     = modvmcompute.NewProc("HcsOpenProcess")
+	procHcsCloseProcess                    = modvmcompute.NewProc("HcsCloseProcess")
+	procHcsTerminateProcess                = modvmcompute.NewProc("HcsTerminateProcess")
+	procHcsGetProcessInfo                  = modvmcompute.NewProc("HcsGetProcessInfo")
+	procHcsGetProcessProperties            = modvmcompute.NewProc("HcsGetProcessProperties")
+	procHcsModifyProcess                   = modvmcompute.NewProc("HcsModifyProcess")
+	procHcsGetServiceProperties            = modvmcompute.NewProc("HcsGetServiceProperties")
+	procHcsRegisterProcessCallback         = modvmcompute.NewProc("HcsRegisterProcessCallback")
+	procHcsUnregisterProcessCallback       = modvmcompute.NewProc("HcsUnregisterProcessCallback")
+)
+
+func hcsEnumerateComputeSystems(query string, computeSystems **uint16, result **uint16) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(query)
+	if hr != nil {
+		return
+	}
+	return _hcsEnumerateComputeSystems(_p0, computeSystems, result)
+}
+
+func _hcsEnumerateComputeSystems(query *uint16, computeSystems **uint16, result **uint16) (hr error) {
+	if hr = procHcsEnumerateComputeSystems.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsEnumerateComputeSystems.Addr(), 3, uintptr(unsafe.Pointer(query)), uintptr(unsafe.Pointer(computeSystems)), uintptr(unsafe.Pointer(result)))
+	if int32(r0) < 0 {
+		hr = interop.Win32FromHresult(r0)
+	}
+	return
+}
+
+func hcsCreateComputeSystem(id string, configuration string, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(id)
+	if hr != nil {
+		return
+	}
+	var _p1 *uint16
+	_p1, hr = syscall.UTF16PtrFromString(configuration)
+	if hr != nil {
+		return
+	}
+	return _hcsCreateComputeSystem(_p0, _p1, identity, computeSystem, result)
+}
+
+func _hcsCreateComputeSystem(id *uint16, configuration *uint16, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) {
+	if hr = procHcsCreateComputeSystem.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall6(procHcsCreateComputeSystem.Addr(), 5, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(configuration)), uintptr(identity), uintptr(unsafe.Pointer(computeSystem)), uintptr(unsafe.Pointer(result)), 0)
+	if int32(r0) < 0 {
+		hr = interop.Win32FromHresult(r0)
+	}
+	return
+}
+
+func hcsOpenComputeSystem(id string, computeSystem *hcsSystem, result **uint16) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(id)
+	if hr != nil {
+		return
+	}
+	return _hcsOpenComputeSystem(_p0, computeSystem, result)
+}
+
+func _hcsOpenComputeSystem(id *uint16, computeSystem *hcsSystem, result **uint16) (hr error) {
+	if hr = procHcsOpenComputeSystem.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsOpenComputeSystem.Addr(), 3, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(computeSystem)), uintptr(unsafe.Pointer(result)))
+	if int32(r0) < 0 {
+		hr = interop.Win32FromHresult(r0)
+	}
+	return
+}
+
+func hcsCloseComputeSystem(computeSystem hcsSystem) (hr error) {
+	if hr = procHcsCloseComputeSystem.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsCloseComputeSystem.Addr(), 1, uintptr(computeSystem), 0, 0)
+	if int32(r0) < 0 {
+		hr = interop.Win32FromHresult(r0)
+	}
+	return
+}
+
+func hcsStartComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(options)
+	if hr != nil {
+		return
+	}
+	return _hcsStartComputeSystem(computeSystem, _p0, result)
+}
+
+func _hcsStartComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) {
+	if hr = procHcsStartComputeSystem.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsStartComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result)))
+	if int32(r0) < 0 {
+		hr = interop.Win32FromHresult(r0)
+	}
+	return
+}
+
+func hcsShutdownComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(options)
+	if hr != nil {
+		return
+	}
+	return _hcsShutdownComputeSystem(computeSystem, _p0, result)
+}
+
+func _hcsShutdownComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) {
+	if hr = procHcsShutdownComputeSystem.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsShutdownComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result)))
+	if int32(r0) < 0 {
+		hr = interop.Win32FromHresult(r0)
+	}
+	return
+}
+
+func hcsTerminateComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(options)
+	if hr != nil {
+		return
+	}
+	return _hcsTerminateComputeSystem(computeSystem, _p0, result)
+}
+
+func _hcsTerminateComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) {
+	if hr = procHcsTerminateComputeSystem.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsTerminateComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result)))
+	if int32(r0) < 0 {
+		hr = interop.Win32FromHresult(r0)
+	}
+	return
+}
+
+func hcsPauseComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(options)
+	if hr != nil {
+		return
+	}
+	return _hcsPauseComputeSystem(computeSystem, _p0, result)
+}
+
+func _hcsPauseComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) {
+	if hr = procHcsPauseComputeSystem.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsPauseComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result)))
+	if int32(r0) < 0 {
+		hr = interop.Win32FromHresult(r0)
+	}
+	return
+}
+
+func hcsResumeComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(options)
+	if hr != nil {
+		return
+	}
+	return _hcsResumeComputeSystem(computeSystem, _p0, result)
+}
+
+func _hcsResumeComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) {
+	if hr = procHcsResumeComputeSystem.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsResumeComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result)))
+	if int32(r0) < 0 {
+		hr = interop.Win32FromHresult(r0)
+	}
+	return
+}
+
+func hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(propertyQuery)
+	if hr != nil {
+		return
+	}
+	return _hcsGetComputeSystemProperties(computeSystem, _p0, properties, result)
+}
+
+func _hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery *uint16, properties **uint16, result **uint16) (hr error) {
+	if hr = procHcsGetComputeSystemProperties.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall6(procHcsGetComputeSystemProperties.Addr(), 4, uintptr(computeSystem), uintptr(unsafe.Pointer(propertyQuery)), uintptr(unsafe.Pointer(properties)), uintptr(unsafe.Pointer(result)), 0, 0)
+	if int32(r0) < 0 {
+		hr = interop.Win32FromHresult(r0)
+	}
+	return
+}
+
+func hcsModifyComputeSystem(computeSystem hcsSystem, configuration string, result **uint16) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(configuration)
+	if hr != nil {
+		return
+	}
+	return _hcsModifyComputeSystem(computeSystem, _p0, result)
+}
+
+func _hcsModifyComputeSystem(computeSystem hcsSystem, configuration *uint16, result **uint16) (hr error) {
+	if hr = procHcsModifyComputeSystem.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsModifyComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(configuration)), uintptr(unsafe.Pointer(result)))
+	if int32(r0) < 0 {
+		hr = interop.Win32FromHresult(r0)
+	}
+	return
+}
+
+func hcsRegisterComputeSystemCallback(computeSystem hcsSystem, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) {
+	if hr = procHcsRegisterComputeSystemCallback.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall6(procHcsRegisterComputeSystemCallback.Addr(), 4, uintptr(computeSystem), uintptr(callback), uintptr(context), uintptr(unsafe.Pointer(callbackHandle)), 0, 0)
+	if int32(r0) < 0 {
+		hr = interop.Win32FromHresult(r0)
+	}
+	return
+}
+
+func hcsUnregisterComputeSystemCallback(callbackHandle hcsCallback) (hr error) {
+	if hr = procHcsUnregisterComputeSystemCallback.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsUnregisterComputeSystemCallback.Addr(), 1, uintptr(callbackHandle), 0, 0)
+	if int32(r0) < 0 {
+		hr = interop.Win32FromHresult(r0)
+	}
+	return
+}
+
+func hcsCreateProcess(computeSystem hcsSystem, processParameters string, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(processParameters)
+	if hr != nil {
+		return
+	}
+	return _hcsCreateProcess(computeSystem, _p0, processInformation, process, result)
+}
+
+func _hcsCreateProcess(computeSystem hcsSystem, processParameters *uint16, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) {
+	if hr = procHcsCreateProcess.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall6(procHcsCreateProcess.Addr(), 5, uintptr(computeSystem), uintptr(unsafe.Pointer(processParameters)), uintptr(unsafe.Pointer(processInformation)), uintptr(unsafe.Pointer(process)), uintptr(unsafe.Pointer(result)), 0)
+	if int32(r0) < 0 {
+		hr = interop.Win32FromHresult(r0)
+	}
+	return
+}
+
+func hcsOpenProcess(computeSystem hcsSystem, pid uint32, process *hcsProcess, result **uint16) (hr error) {
+	if hr = procHcsOpenProcess.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall6(procHcsOpenProcess.Addr(), 4, uintptr(computeSystem), uintptr(pid), uintptr(unsafe.Pointer(process)), uintptr(unsafe.Pointer(result)), 0, 0)
+	if int32(r0) < 0 {
+		hr = interop.Win32FromHresult(r0)
+	}
+	return
+}
+
+func hcsCloseProcess(process hcsProcess) (hr error) {
+	if hr = procHcsCloseProcess.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsCloseProcess.Addr(), 1, uintptr(process), 0, 0)
+	if int32(r0) < 0 {
+		hr = interop.Win32FromHresult(r0)
+	}
+	return
+}
+
+func hcsTerminateProcess(process hcsProcess, result **uint16) (hr error) {
+	if hr = procHcsTerminateProcess.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsTerminateProcess.Addr(), 2, uintptr(process), uintptr(unsafe.Pointer(result)), 0)
+	if int32(r0) < 0 {
+		hr = interop.Win32FromHresult(r0)
+	}
+	return
+}
+
+func hcsGetProcessInfo(process hcsProcess, processInformation *hcsProcessInformation, result **uint16) (hr error) {
+	if hr = procHcsGetProcessInfo.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsGetProcessInfo.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(processInformation)), uintptr(unsafe.Pointer(result)))
+	if int32(r0) < 0 {
+		hr = interop.Win32FromHresult(r0)
+	}
+	return
+}
+
+func hcsGetProcessProperties(process hcsProcess, processProperties **uint16, result **uint16) (hr error) {
+	if hr = procHcsGetProcessProperties.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsGetProcessProperties.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(processProperties)), uintptr(unsafe.Pointer(result)))
+	if int32(r0) < 0 {
+		hr = interop.Win32FromHresult(r0)
+	}
+	return
+}
+
+func hcsModifyProcess(process hcsProcess, settings string, result **uint16) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(settings)
+	if hr != nil {
+		return
+	}
+	return _hcsModifyProcess(process, _p0, result)
+}
+
+func _hcsModifyProcess(process hcsProcess, settings *uint16, result **uint16) (hr error) {
+	if hr = procHcsModifyProcess.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsModifyProcess.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(settings)), uintptr(unsafe.Pointer(result)))
+	if int32(r0) < 0 {
+		hr = interop.Win32FromHresult(r0)
+	}
+	return
+}
+
+func hcsGetServiceProperties(propertyQuery string, properties **uint16, result **uint16) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(propertyQuery)
+	if hr != nil {
+		return
+	}
+	return _hcsGetServiceProperties(_p0, properties, result)
+}
+
+func _hcsGetServiceProperties(propertyQuery *uint16, properties **uint16, result **uint16) (hr error) {
+	if hr = procHcsGetServiceProperties.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsGetServiceProperties.Addr(), 3, uintptr(unsafe.Pointer(propertyQuery)), uintptr(unsafe.Pointer(properties)), uintptr(unsafe.Pointer(result)))
+	if int32(r0) < 0 {
+		hr = interop.Win32FromHresult(r0)
+	}
+	return
+}
+
+func hcsRegisterProcessCallback(process hcsProcess, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) {
+	if hr = procHcsRegisterProcessCallback.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall6(procHcsRegisterProcessCallback.Addr(), 4, uintptr(process), uintptr(callback), uintptr(context), uintptr(unsafe.Pointer(callbackHandle)), 0, 0)
+	if int32(r0) < 0 {
+		hr = interop.Win32FromHresult(r0)
+	}
+	return
+}
+
+func hcsUnregisterProcessCallback(callbackHandle hcsCallback) (hr error) {
+	if hr = procHcsUnregisterProcessCallback.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsUnregisterProcessCallback.Addr(), 1, uintptr(callbackHandle), 0, 0)
+	if int32(r0) < 0 {
+		hr = interop.Win32FromHresult(r0)
+	}
+	return
+}

vendor/github.com/Microsoft/hcsshim/internal/hcserror/hcserror.go

@@ -0,0 +1,51 @@
+package hcserror
+
+import (
+	"fmt"
+	"syscall"
+)
+
+const ERROR_GEN_FAILURE = syscall.Errno(31)
+
+type HcsError struct {
+	title string
+	rest  string
+	Err   error
+}
+
+func (e *HcsError) Error() string {
+	s := e.title
+	if len(s) > 0 && s[len(s)-1] != ' ' {
+		s += " "
+	}
+	s += fmt.Sprintf("failed in Win32: %s (0x%x)", e.Err, Win32FromError(e.Err))
+	if e.rest != "" {
+		if e.rest[0] != ' ' {
+			s += " "
+		}
+		s += e.rest
+	}
+	return s
+}
+
+func New(err error, title, rest string) error {
+	// Pass through DLL errors directly since they do not originate from HCS.
+	if _, ok := err.(*syscall.DLLError); ok {
+		return err
+	}
+	return &HcsError{title, rest, err}
+}
+
+func Errorf(err error, title, format string, a ...interface{}) error {
+	return New(err, title, fmt.Sprintf(format, a...))
+}
+
+func Win32FromError(err error) uint32 {
+	if herr, ok := err.(*HcsError); ok {
+		return Win32FromError(herr.Err)
+	}
+	if code, ok := err.(syscall.Errno); ok {
+		return uint32(code)
+	}
+	return uint32(ERROR_GEN_FAILURE)
+}

vendor/github.com/Microsoft/hcsshim/internal/hns/hns.go

@@ -0,0 +1,23 @@
+package hns
+
+import "fmt"
+
+//go:generate go run ../../mksyscall_windows.go -output zsyscall_windows.go hns.go
+
+//sys _hnsCall(method string, path string, object string, response **uint16) (hr error) = vmcompute.HNSCall?
+
+type EndpointNotFoundError struct {
+	EndpointName string
+}
+
+func (e EndpointNotFoundError) Error() string {
+	return fmt.Sprintf("Endpoint %s not found", e.EndpointName)
+}
+
+type NetworkNotFoundError struct {
+	NetworkName string
+}
+
+func (e NetworkNotFoundError) Error() string {
+	return fmt.Sprintf("Network %s not found", e.NetworkName)
+}

vendor/github.com/Microsoft/hcsshim/internal/hns/hnsendpoint.go

@@ -0,0 +1,260 @@
+package hns
+
+import (
+	"encoding/json"
+	"net"
+
+	"github.com/sirupsen/logrus"
+)
+
+// HNSEndpoint represents a network endpoint in HNS
+type HNSEndpoint struct {
+	Id                 string            `json:"ID,omitempty"`
+	Name               string            `json:",omitempty"`
+	VirtualNetwork     string            `json:",omitempty"`
+	VirtualNetworkName string            `json:",omitempty"`
+	Policies           []json.RawMessage `json:",omitempty"`
+	MacAddress         string            `json:",omitempty"`
+	IPAddress          net.IP            `json:",omitempty"`
+	DNSSuffix          string            `json:",omitempty"`
+	DNSServerList      string            `json:",omitempty"`
+	GatewayAddress     string            `json:",omitempty"`
+	EnableInternalDNS  bool              `json:",omitempty"`
+	DisableICC         bool              `json:",omitempty"`
+	PrefixLength       uint8             `json:",omitempty"`
+	IsRemoteEndpoint   bool              `json:",omitempty"`
+	Namespace          *Namespace        `json:",omitempty"`
+}
+
+//SystemType represents the type of the system on which actions are done
+type SystemType string
+
+// SystemType const
+const (
+	ContainerType      SystemType = "Container"
+	VirtualMachineType SystemType = "VirtualMachine"
+	HostType           SystemType = "Host"
+)
+
+// EndpointAttachDetachRequest is the structure used to send request to the container to modify the system
+// Supported resource types are Network and Request Types are Add/Remove
+type EndpointAttachDetachRequest struct {
+	ContainerID    string     `json:"ContainerId,omitempty"`
+	SystemType     SystemType `json:"SystemType"`
+	CompartmentID  uint16     `json:"CompartmentId,omitempty"`
+	VirtualNICName string     `json:"VirtualNicName,omitempty"`
+}
+
+// EndpointResquestResponse is object to get the endpoint request response
+type EndpointResquestResponse struct {
+	Success bool
+	Error   string
+}
+
+// HNSEndpointRequest makes a HNS call to modify/query a network endpoint
+func HNSEndpointRequest(method, path, request string) (*HNSEndpoint, error) {
+	endpoint := &HNSEndpoint{}
+	err := hnsCall(method, "/endpoints/"+path, request, &endpoint)
+	if err != nil {
+		return nil, err
+	}
+
+	return endpoint, nil
+}
+
+// HNSListEndpointRequest makes a HNS call to query the list of available endpoints
+func HNSListEndpointRequest() ([]HNSEndpoint, error) {
+	var endpoint []HNSEndpoint
+	err := hnsCall("GET", "/endpoints/", "", &endpoint)
+	if err != nil {
+		return nil, err
+	}
+
+	return endpoint, nil
+}
+
+// GetHNSEndpointByID get the Endpoint by ID
+func GetHNSEndpointByID(endpointID string) (*HNSEndpoint, error) {
+	return HNSEndpointRequest("GET", endpointID, "")
+}
+
+// GetHNSEndpointByName gets the endpoint filtered by Name
+func GetHNSEndpointByName(endpointName string) (*HNSEndpoint, error) {
+	hnsResponse, err := HNSListEndpointRequest()
+	if err != nil {
+		return nil, err
+	}
+	for _, hnsEndpoint := range hnsResponse {
+		if hnsEndpoint.Name == endpointName {
+			return &hnsEndpoint, nil
+		}
+	}
+	return nil, EndpointNotFoundError{EndpointName: endpointName}
+}
+
+// Create Endpoint by sending EndpointRequest to HNS. TODO: Create a separate HNS interface to place all these methods
+func (endpoint *HNSEndpoint) Create() (*HNSEndpoint, error) {
+	operation := "Create"
+	title := "hcsshim::HNSEndpoint::" + operation
+	logrus.Debugf(title+" id=%s", endpoint.Id)
+
+	jsonString, err := json.Marshal(endpoint)
+	if err != nil {
+		return nil, err
+	}
+	return HNSEndpointRequest("POST", "", string(jsonString))
+}
+
+// Delete Endpoint by sending EndpointRequest to HNS
+func (endpoint *HNSEndpoint) Delete() (*HNSEndpoint, error) {
+	operation := "Delete"
+	title := "hcsshim::HNSEndpoint::" + operation
+	logrus.Debugf(title+" id=%s", endpoint.Id)
+
+	return HNSEndpointRequest("DELETE", endpoint.Id, "")
+}
+
+// Update Endpoint
+func (endpoint *HNSEndpoint) Update() (*HNSEndpoint, error) {
+	operation := "Update"
+	title := "hcsshim::HNSEndpoint::" + operation
+	logrus.Debugf(title+" id=%s", endpoint.Id)
+	jsonString, err := json.Marshal(endpoint)
+	if err != nil {
+		return nil, err
+	}
+	err = hnsCall("POST", "/endpoints/"+endpoint.Id, string(jsonString), &endpoint)
+
+	return endpoint, err
+}
+
+// ApplyACLPolicy applies a set of ACL Policies on the Endpoint
+func (endpoint *HNSEndpoint) ApplyACLPolicy(policies ...*ACLPolicy) error {
+	operation := "ApplyACLPolicy"
+	title := "hcsshim::HNSEndpoint::" + operation
+	logrus.Debugf(title+" id=%s", endpoint.Id)
+
+	for _, policy := range policies {
+		if policy == nil {
+			continue
+		}
+		jsonString, err := json.Marshal(policy)
+		if err != nil {
+			return err
+		}
+		endpoint.Policies = append(endpoint.Policies, jsonString)
+	}
+
+	_, err := endpoint.Update()
+	return err
+}
+
+// ContainerAttach attaches an endpoint to container
+func (endpoint *HNSEndpoint) ContainerAttach(containerID string, compartmentID uint16) error {
+	operation := "ContainerAttach"
+	title := "hcsshim::HNSEndpoint::" + operation
+	logrus.Debugf(title+" id=%s", endpoint.Id)
+
+	requestMessage := &EndpointAttachDetachRequest{
+		ContainerID:   containerID,
+		CompartmentID: compartmentID,
+		SystemType:    ContainerType,
+	}
+	response := &EndpointResquestResponse{}
+	jsonString, err := json.Marshal(requestMessage)
+	if err != nil {
+		return err
+	}
+	return hnsCall("POST", "/endpoints/"+endpoint.Id+"/attach", string(jsonString), &response)
+}
+
+// ContainerDetach detaches an endpoint from container
+func (endpoint *HNSEndpoint) ContainerDetach(containerID string) error {
+	operation := "ContainerDetach"
+	title := "hcsshim::HNSEndpoint::" + operation
+	logrus.Debugf(title+" id=%s", endpoint.Id)
+
+	requestMessage := &EndpointAttachDetachRequest{
+		ContainerID: containerID,
+		SystemType:  ContainerType,
+	}
+	response := &EndpointResquestResponse{}
+
+	jsonString, err := json.Marshal(requestMessage)
+	if err != nil {
+		return err
+	}
+	return hnsCall("POST", "/endpoints/"+endpoint.Id+"/detach", string(jsonString), &response)
+}
+
+// HostAttach attaches a nic on the host
+func (endpoint *HNSEndpoint) HostAttach(compartmentID uint16) error {
+	operation := "HostAttach"
+	title := "hcsshim::HNSEndpoint::" + operation
+	logrus.Debugf(title+" id=%s", endpoint.Id)
+	requestMessage := &EndpointAttachDetachRequest{
+		CompartmentID: compartmentID,
+		SystemType:    HostType,
+	}
+	response := &EndpointResquestResponse{}
+
+	jsonString, err := json.Marshal(requestMessage)
+	if err != nil {
+		return err
+	}
+	return hnsCall("POST", "/endpoints/"+endpoint.Id+"/attach", string(jsonString), &response)
+
+}
+
+// HostDetach detaches a nic on the host
+func (endpoint *HNSEndpoint) HostDetach() error {
+	operation := "HostDetach"
+	title := "hcsshim::HNSEndpoint::" + operation
+	logrus.Debugf(title+" id=%s", endpoint.Id)
+	requestMessage := &EndpointAttachDetachRequest{
+		SystemType: HostType,
+	}
+	response := &EndpointResquestResponse{}
+
+	jsonString, err := json.Marshal(requestMessage)
+	if err != nil {
+		return err
+	}
+	return hnsCall("POST", "/endpoints/"+endpoint.Id+"/detach", string(jsonString), &response)
+}
+
+// VirtualMachineNICAttach attaches a endpoint to a virtual machine
+func (endpoint *HNSEndpoint) VirtualMachineNICAttach(virtualMachineNICName string) error {
+	operation := "VirtualMachineNicAttach"
+	title := "hcsshim::HNSEndpoint::" + operation
+	logrus.Debugf(title+" id=%s", endpoint.Id)
+	requestMessage := &EndpointAttachDetachRequest{
+		VirtualNICName: virtualMachineNICName,
+		SystemType:     VirtualMachineType,
+	}
+	response := &EndpointResquestResponse{}
+
+	jsonString, err := json.Marshal(requestMessage)
+	if err != nil {
+		return err
+	}
+	return hnsCall("POST", "/endpoints/"+endpoint.Id+"/attach", string(jsonString), &response)
+}
+
+// VirtualMachineNICDetach detaches a endpoint  from a virtual machine
+func (endpoint *HNSEndpoint) VirtualMachineNICDetach() error {
+	operation := "VirtualMachineNicDetach"
+	title := "hcsshim::HNSEndpoint::" + operation
+	logrus.Debugf(title+" id=%s", endpoint.Id)
+
+	requestMessage := &EndpointAttachDetachRequest{
+		SystemType: VirtualMachineType,
+	}
+	response := &EndpointResquestResponse{}
+
+	jsonString, err := json.Marshal(requestMessage)
+	if err != nil {
+		return err
+	}
+	return hnsCall("POST", "/endpoints/"+endpoint.Id+"/detach", string(jsonString), &response)
+}

vendor/github.com/Microsoft/hcsshim/internal/hns/hnsfuncs.go

@@ -0,0 +1,42 @@
+package hns
+
+import (
+	"encoding/json"
+	"fmt"
+
+	"github.com/Microsoft/hcsshim/internal/hcserror"
+	"github.com/Microsoft/hcsshim/internal/interop"
+	"github.com/sirupsen/logrus"
+)
+
+func hnsCall(method, path, request string, returnResponse interface{}) error {
+	var responseBuffer *uint16
+	logrus.Debugf("[%s]=>[%s] Request : %s", method, path, request)
+
+	err := _hnsCall(method, path, request, &responseBuffer)
+	if err != nil {
+		return hcserror.New(err, "hnsCall ", "")
+	}
+	response := interop.ConvertAndFreeCoTaskMemString(responseBuffer)
+
+	hnsresponse := &hnsResponse{}
+	if err = json.Unmarshal([]byte(response), &hnsresponse); err != nil {
+		return err
+	}
+
+	if !hnsresponse.Success {
+		return fmt.Errorf("HNS failed with error : %s", hnsresponse.Error)
+	}
+
+	if len(hnsresponse.Output) == 0 {
+		return nil
+	}
+
+	logrus.Debugf("Network Response : %s", hnsresponse.Output)
+	err = json.Unmarshal(hnsresponse.Output, returnResponse)
+	if err != nil {
+		return err
+	}
+
+	return nil
+}

vendor/github.com/Microsoft/hcsshim/internal/hns/hnsglobals.go

@@ -0,0 +1,28 @@
+package hns
+
+type HNSGlobals struct {
+	Version HNSVersion `json:"Version"`
+}
+
+type HNSVersion struct {
+	Major int `json:"Major"`
+	Minor int `json:"Minor"`
+}
+
+var (
+	HNSVersion1803 = HNSVersion{Major: 7, Minor: 2}
+)
+
+func GetHNSGlobals() (*HNSGlobals, error) {
+	var version HNSVersion
+	err := hnsCall("GET", "/globals/version", "", &version)
+	if err != nil {
+		return nil, err
+	}
+
+	globals := &HNSGlobals{
+		Version: version,
+	}
+
+	return globals, nil
+}

vendor/github.com/Microsoft/hcsshim/internal/hns/hnsnetwork.go

@@ -0,0 +1,141 @@
+package hns
+
+import (
+	"encoding/json"
+	"net"
+
+	"github.com/sirupsen/logrus"
+)
+
+// Subnet is assoicated with a network and represents a list
+// of subnets available to the network
+type Subnet struct {
+	AddressPrefix  string            `json:",omitempty"`
+	GatewayAddress string            `json:",omitempty"`
+	Policies       []json.RawMessage `json:",omitempty"`
+}
+
+// MacPool is assoicated with a network and represents a list
+// of macaddresses available to the network
+type MacPool struct {
+	StartMacAddress string `json:",omitempty"`
+	EndMacAddress   string `json:",omitempty"`
+}
+
+// HNSNetwork represents a network in HNS
+type HNSNetwork struct {
+	Id                   string            `json:"ID,omitempty"`
+	Name                 string            `json:",omitempty"`
+	Type                 string            `json:",omitempty"`
+	NetworkAdapterName   string            `json:",omitempty"`
+	SourceMac            string            `json:",omitempty"`
+	Policies             []json.RawMessage `json:",omitempty"`
+	MacPools             []MacPool         `json:",omitempty"`
+	Subnets              []Subnet          `json:",omitempty"`
+	DNSSuffix            string            `json:",omitempty"`
+	DNSServerList        string            `json:",omitempty"`
+	DNSServerCompartment uint32            `json:",omitempty"`
+	ManagementIP         string            `json:",omitempty"`
+	AutomaticDNS         bool              `json:",omitempty"`
+}
+
+type hnsNetworkResponse struct {
+	Success bool
+	Error   string
+	Output  HNSNetwork
+}
+
+type hnsResponse struct {
+	Success bool
+	Error   string
+	Output  json.RawMessage
+}
+
+// HNSNetworkRequest makes a call into HNS to update/query a single network
+func HNSNetworkRequest(method, path, request string) (*HNSNetwork, error) {
+	var network HNSNetwork
+	err := hnsCall(method, "/networks/"+path, request, &network)
+	if err != nil {
+		return nil, err
+	}
+
+	return &network, nil
+}
+
+// HNSListNetworkRequest makes a HNS call to query the list of available networks
+func HNSListNetworkRequest(method, path, request string) ([]HNSNetwork, error) {
+	var network []HNSNetwork
+	err := hnsCall(method, "/networks/"+path, request, &network)
+	if err != nil {
+		return nil, err
+	}
+
+	return network, nil
+}
+
+// GetHNSNetworkByID
+func GetHNSNetworkByID(networkID string) (*HNSNetwork, error) {
+	return HNSNetworkRequest("GET", networkID, "")
+}
+
+// GetHNSNetworkName filtered by Name
+func GetHNSNetworkByName(networkName string) (*HNSNetwork, error) {
+	hsnnetworks, err := HNSListNetworkRequest("GET", "", "")
+	if err != nil {
+		return nil, err
+	}
+	for _, hnsnetwork := range hsnnetworks {
+		if hnsnetwork.Name == networkName {
+			return &hnsnetwork, nil
+		}
+	}
+	return nil, NetworkNotFoundError{NetworkName: networkName}
+}
+
+// Create Network by sending NetworkRequest to HNS.
+func (network *HNSNetwork) Create() (*HNSNetwork, error) {
+	operation := "Create"
+	title := "hcsshim::HNSNetwork::" + operation
+	logrus.Debugf(title+" id=%s", network.Id)
+
+	jsonString, err := json.Marshal(network)
+	if err != nil {
+		return nil, err
+	}
+	return HNSNetworkRequest("POST", "", string(jsonString))
+}
+
+// Delete Network by sending NetworkRequest to HNS
+func (network *HNSNetwork) Delete() (*HNSNetwork, error) {
+	operation := "Delete"
+	title := "hcsshim::HNSNetwork::" + operation
+	logrus.Debugf(title+" id=%s", network.Id)
+
+	return HNSNetworkRequest("DELETE", network.Id, "")
+}
+
+// Creates an endpoint on the Network.
+func (network *HNSNetwork) NewEndpoint(ipAddress net.IP, macAddress net.HardwareAddr) *HNSEndpoint {
+	return &HNSEndpoint{
+		VirtualNetwork: network.Id,
+		IPAddress:      ipAddress,
+		MacAddress:     string(macAddress),
+	}
+}
+
+func (network *HNSNetwork) CreateEndpoint(endpoint *HNSEndpoint) (*HNSEndpoint, error) {
+	operation := "CreateEndpoint"
+	title := "hcsshim::HNSNetwork::" + operation
+	logrus.Debugf(title+" id=%s, endpointId=%s", network.Id, endpoint.Id)
+
+	endpoint.VirtualNetwork = network.Id
+	return endpoint.Create()
+}
+
+func (network *HNSNetwork) CreateRemoteEndpoint(endpoint *HNSEndpoint) (*HNSEndpoint, error) {
+	operation := "CreateRemoteEndpoint"
+	title := "hcsshim::HNSNetwork::" + operation
+	logrus.Debugf(title+" id=%s", network.Id)
+	endpoint.IsRemoteEndpoint = true
+	return network.CreateEndpoint(endpoint)
+}

vendor/github.com/Microsoft/hcsshim/internal/hns/hnspolicy.go

@@ -0,0 +1,98 @@
+package hns
+
+// Type of Request Support in ModifySystem
+type PolicyType string
+
+// RequestType const
+const (
+	Nat                  PolicyType = "NAT"
+	ACL                  PolicyType = "ACL"
+	PA                   PolicyType = "PA"
+	VLAN                 PolicyType = "VLAN"
+	VSID                 PolicyType = "VSID"
+	VNet                 PolicyType = "VNET"
+	L2Driver             PolicyType = "L2Driver"
+	Isolation            PolicyType = "Isolation"
+	QOS                  PolicyType = "QOS"
+	OutboundNat          PolicyType = "OutBoundNAT"
+	ExternalLoadBalancer PolicyType = "ELB"
+	Route                PolicyType = "ROUTE"
+)
+
+type NatPolicy struct {
+	Type         PolicyType `json:"Type"`
+	Protocol     string
+	InternalPort uint16
+	ExternalPort uint16
+}
+
+type QosPolicy struct {
+	Type                            PolicyType `json:"Type"`
+	MaximumOutgoingBandwidthInBytes uint64
+}
+
+type IsolationPolicy struct {
+	Type               PolicyType `json:"Type"`
+	VLAN               uint
+	VSID               uint
+	InDefaultIsolation bool
+}
+
+type VlanPolicy struct {
+	Type PolicyType `json:"Type"`
+	VLAN uint
+}
+
+type VsidPolicy struct {
+	Type PolicyType `json:"Type"`
+	VSID uint
+}
+
+type PaPolicy struct {
+	Type PolicyType `json:"Type"`
+	PA   string     `json:"PA"`
+}
+
+type OutboundNatPolicy struct {
+	Policy
+	VIP        string   `json:"VIP,omitempty"`
+	Exceptions []string `json:"ExceptionList,omitempty"`
+}
+
+type ActionType string
+type DirectionType string
+type RuleType string
+
+const (
+	Allow ActionType = "Allow"
+	Block ActionType = "Block"
+
+	In  DirectionType = "In"
+	Out DirectionType = "Out"
+
+	Host   RuleType = "Host"
+	Switch RuleType = "Switch"
+)
+
+type ACLPolicy struct {
+	Type            PolicyType `json:"Type"`
+	Id              string     `json:"Id,omitempty"`
+	Protocol        uint16
+	Protocols       string `json:"Protocols,omitempty"`
+	InternalPort    uint16
+	Action          ActionType
+	Direction       DirectionType
+	LocalAddresses  string
+	RemoteAddresses string
+	LocalPorts      string `json:"LocalPorts,omitempty"`
+	LocalPort       uint16
+	RemotePorts     string `json:"RemotePorts,omitempty"`
+	RemotePort      uint16
+	RuleType        RuleType `json:"RuleType,omitempty"`
+	Priority        uint16
+	ServiceName     string
+}
+
+type Policy struct {
+	Type PolicyType `json:"Type"`
+}

vendor/github.com/Microsoft/hcsshim/internal/hns/hnspolicylist.go

@@ -0,0 +1,200 @@
+package hns
+
+import (
+	"encoding/json"
+
+	"github.com/sirupsen/logrus"
+)
+
+// RoutePolicy is a structure defining schema for Route based Policy
+type RoutePolicy struct {
+	Policy
+	DestinationPrefix string `json:"DestinationPrefix,omitempty"`
+	NextHop           string `json:"NextHop,omitempty"`
+	EncapEnabled      bool   `json:"NeedEncap,omitempty"`
+}
+
+// ELBPolicy is a structure defining schema for ELB LoadBalancing based Policy
+type ELBPolicy struct {
+	LBPolicy
+	SourceVIP string   `json:"SourceVIP,omitempty"`
+	VIPs      []string `json:"VIPs,omitempty"`
+	ILB       bool     `json:"ILB,omitempty"`
+}
+
+// LBPolicy is a structure defining schema for LoadBalancing based Policy
+type LBPolicy struct {
+	Policy
+	Protocol     uint16 `json:"Protocol,omitempty"`
+	InternalPort uint16
+	ExternalPort uint16
+}
+
+// PolicyList is a structure defining schema for Policy list request
+type PolicyList struct {
+	ID                 string            `json:"ID,omitempty"`
+	EndpointReferences []string          `json:"References,omitempty"`
+	Policies           []json.RawMessage `json:"Policies,omitempty"`
+}
+
+// HNSPolicyListRequest makes a call into HNS to update/query a single network
+func HNSPolicyListRequest(method, path, request string) (*PolicyList, error) {
+	var policy PolicyList
+	err := hnsCall(method, "/policylists/"+path, request, &policy)
+	if err != nil {
+		return nil, err
+	}
+
+	return &policy, nil
+}
+
+// HNSListPolicyListRequest gets all the policy list
+func HNSListPolicyListRequest() ([]PolicyList, error) {
+	var plist []PolicyList
+	err := hnsCall("GET", "/policylists/", "", &plist)
+	if err != nil {
+		return nil, err
+	}
+
+	return plist, nil
+}
+
+// PolicyListRequest makes a HNS call to modify/query a network policy list
+func PolicyListRequest(method, path, request string) (*PolicyList, error) {
+	policylist := &PolicyList{}
+	err := hnsCall(method, "/policylists/"+path, request, &policylist)
+	if err != nil {
+		return nil, err
+	}
+
+	return policylist, nil
+}
+
+// GetPolicyListByID get the policy list by ID
+func GetPolicyListByID(policyListID string) (*PolicyList, error) {
+	return PolicyListRequest("GET", policyListID, "")
+}
+
+// Create PolicyList by sending PolicyListRequest to HNS.
+func (policylist *PolicyList) Create() (*PolicyList, error) {
+	operation := "Create"
+	title := "hcsshim::PolicyList::" + operation
+	logrus.Debugf(title+" id=%s", policylist.ID)
+	jsonString, err := json.Marshal(policylist)
+	if err != nil {
+		return nil, err
+	}
+	return PolicyListRequest("POST", "", string(jsonString))
+}
+
+// Delete deletes PolicyList
+func (policylist *PolicyList) Delete() (*PolicyList, error) {
+	operation := "Delete"
+	title := "hcsshim::PolicyList::" + operation
+	logrus.Debugf(title+" id=%s", policylist.ID)
+
+	return PolicyListRequest("DELETE", policylist.ID, "")
+}
+
+// AddEndpoint add an endpoint to a Policy List
+func (policylist *PolicyList) AddEndpoint(endpoint *HNSEndpoint) (*PolicyList, error) {
+	operation := "AddEndpoint"
+	title := "hcsshim::PolicyList::" + operation
+	logrus.Debugf(title+" id=%s, endpointId:%s", policylist.ID, endpoint.Id)
+
+	_, err := policylist.Delete()
+	if err != nil {
+		return nil, err
+	}
+
+	// Add Endpoint to the Existing List
+	policylist.EndpointReferences = append(policylist.EndpointReferences, "/endpoints/"+endpoint.Id)
+
+	return policylist.Create()
+}
+
+// RemoveEndpoint removes an endpoint from the Policy List
+func (policylist *PolicyList) RemoveEndpoint(endpoint *HNSEndpoint) (*PolicyList, error) {
+	operation := "RemoveEndpoint"
+	title := "hcsshim::PolicyList::" + operation
+	logrus.Debugf(title+" id=%s, endpointId:%s", policylist.ID, endpoint.Id)
+
+	_, err := policylist.Delete()
+	if err != nil {
+		return nil, err
+	}
+
+	elementToRemove := "/endpoints/" + endpoint.Id
+
+	var references []string
+
+	for _, endpointReference := range policylist.EndpointReferences {
+		if endpointReference == elementToRemove {
+			continue
+		}
+		references = append(references, endpointReference)
+	}
+	policylist.EndpointReferences = references
+	return policylist.Create()
+}
+
+// AddLoadBalancer policy list for the specified endpoints
+func AddLoadBalancer(endpoints []HNSEndpoint, isILB bool, sourceVIP, vip string, protocol uint16, internalPort uint16, externalPort uint16) (*PolicyList, error) {
+	operation := "AddLoadBalancer"
+	title := "hcsshim::PolicyList::" + operation
+	logrus.Debugf(title+" endpointId=%v, isILB=%v, sourceVIP=%s, vip=%s, protocol=%v, internalPort=%v, externalPort=%v", endpoints, isILB, sourceVIP, vip, protocol, internalPort, externalPort)
+
+	policylist := &PolicyList{}
+
+	elbPolicy := &ELBPolicy{
+		SourceVIP: sourceVIP,
+		ILB:       isILB,
+	}
+
+	if len(vip) > 0 {
+		elbPolicy.VIPs = []string{vip}
+	}
+	elbPolicy.Type = ExternalLoadBalancer
+	elbPolicy.Protocol = protocol
+	elbPolicy.InternalPort = internalPort
+	elbPolicy.ExternalPort = externalPort
+
+	for _, endpoint := range endpoints {
+		policylist.EndpointReferences = append(policylist.EndpointReferences, "/endpoints/"+endpoint.Id)
+	}
+
+	jsonString, err := json.Marshal(elbPolicy)
+	if err != nil {
+		return nil, err
+	}
+	policylist.Policies = append(policylist.Policies, jsonString)
+	return policylist.Create()
+}
+
+// AddRoute adds route policy list for the specified endpoints
+func AddRoute(endpoints []HNSEndpoint, destinationPrefix string, nextHop string, encapEnabled bool) (*PolicyList, error) {
+	operation := "AddRoute"
+	title := "hcsshim::PolicyList::" + operation
+	logrus.Debugf(title+" destinationPrefix:%s", destinationPrefix)
+
+	policylist := &PolicyList{}
+
+	rPolicy := &RoutePolicy{
+		DestinationPrefix: destinationPrefix,
+		NextHop:           nextHop,
+		EncapEnabled:      encapEnabled,
+	}
+	rPolicy.Type = Route
+
+	for _, endpoint := range endpoints {
+		policylist.EndpointReferences = append(policylist.EndpointReferences, "/endpoints/"+endpoint.Id)
+	}
+
+	jsonString, err := json.Marshal(rPolicy)
+	if err != nil {
+		return nil, err
+	}
+
+	policylist.Policies = append(policylist.Policies, jsonString)
+	return policylist.Create()
+}

vendor/github.com/Microsoft/hcsshim/internal/hns/hnssupport.go

@@ -0,0 +1,49 @@
+package hns
+
+import (
+	"github.com/sirupsen/logrus"
+)
+
+type HNSSupportedFeatures struct {
+	Acl HNSAclFeatures `json:"ACL"`
+}
+
+type HNSAclFeatures struct {
+	AclAddressLists       bool `json:"AclAddressLists"`
+	AclNoHostRulePriority bool `json:"AclHostRulePriority"`
+	AclPortRanges         bool `json:"AclPortRanges"`
+	AclRuleId             bool `json:"AclRuleId"`
+}
+
+func GetHNSSupportedFeatures() HNSSupportedFeatures {
+	var hnsFeatures HNSSupportedFeatures
+
+	globals, err := GetHNSGlobals()
+	if err != nil {
+		// Expected on pre-1803 builds, all features will be false/unsupported
+		logrus.Debugf("Unable to obtain HNS globals: %s", err)
+		return hnsFeatures
+	}
+
+	hnsFeatures.Acl = HNSAclFeatures{
+		AclAddressLists:       isHNSFeatureSupported(globals.Version, HNSVersion1803),
+		AclNoHostRulePriority: isHNSFeatureSupported(globals.Version, HNSVersion1803),
+		AclPortRanges:         isHNSFeatureSupported(globals.Version, HNSVersion1803),
+		AclRuleId:             isHNSFeatureSupported(globals.Version, HNSVersion1803),
+	}
+
+	return hnsFeatures
+}
+
+func isHNSFeatureSupported(currentVersion HNSVersion, minVersionSupported HNSVersion) bool {
+	if currentVersion.Major < minVersionSupported.Major {
+		return false
+	}
+	if currentVersion.Major > minVersionSupported.Major {
+		return true
+	}
+	if currentVersion.Minor < minVersionSupported.Minor {
+		return false
+	}
+	return true
+}

vendor/github.com/Microsoft/hcsshim/internal/hns/namespace.go

@@ -0,0 +1,110 @@
+package hns
+
+import (
+	"encoding/json"
+	"fmt"
+	"os"
+	"path"
+	"strings"
+)
+
+type namespaceRequest struct {
+	IsDefault bool `json:",omitempty"`
+}
+
+type namespaceEndpointRequest struct {
+	ID string `json:"Id"`
+}
+
+type NamespaceResource struct {
+	Type string
+	Data json.RawMessage
+}
+
+type namespaceResourceRequest struct {
+	Type string
+	Data interface{}
+}
+
+type Namespace struct {
+	ID           string
+	IsDefault    bool                `json:",omitempty"`
+	ResourceList []NamespaceResource `json:",omitempty"`
+}
+
+func issueNamespaceRequest(id *string, method, subpath string, request interface{}) (*Namespace, error) {
+	var err error
+	hnspath := "/namespaces/"
+	if id != nil {
+		hnspath = path.Join(hnspath, *id)
+	}
+	if subpath != "" {
+		hnspath = path.Join(hnspath, subpath)
+	}
+	var reqJSON []byte
+	if request != nil {
+		if reqJSON, err = json.Marshal(request); err != nil {
+			return nil, err
+		}
+	}
+	var ns Namespace
+	err = hnsCall(method, hnspath, string(reqJSON), &ns)
+	if err != nil {
+		if strings.Contains(err.Error(), "Element not found.") {
+			return nil, os.ErrNotExist
+		}
+		return nil, fmt.Errorf("%s %s: %s", method, hnspath, err)
+	}
+	return &ns, err
+}
+
+func CreateNamespace() (string, error) {
+	req := namespaceRequest{}
+	ns, err := issueNamespaceRequest(nil, "POST", "", &req)
+	if err != nil {
+		return "", err
+	}
+	return ns.ID, nil
+}
+
+func RemoveNamespace(id string) error {
+	_, err := issueNamespaceRequest(&id, "DELETE", "", nil)
+	return err
+}
+
+func GetNamespaceEndpoints(id string) ([]string, error) {
+	ns, err := issueNamespaceRequest(&id, "GET", "", nil)
+	if err != nil {
+		return nil, err
+	}
+	var endpoints []string
+	for _, rsrc := range ns.ResourceList {
+		if rsrc.Type == "Endpoint" {
+			var endpoint namespaceEndpointRequest
+			err = json.Unmarshal(rsrc.Data, &endpoint)
+			if err != nil {
+				return nil, fmt.Errorf("unmarshal endpoint: %s", err)
+			}
+			endpoints = append(endpoints, endpoint.ID)
+		}
+	}
+	return endpoints, nil
+}
+
+func AddNamespaceEndpoint(id string, endpointID string) error {
+	resource := namespaceResourceRequest{
+		Type: "Endpoint",
+		Data: namespaceEndpointRequest{endpointID},
+	}
+	_, err := issueNamespaceRequest(&id, "POST", "addresource", &resource)
+	return err
+}
+
+func RemoveNamespaceEndpoint(id string, endpointID string) error {
+	resource := namespaceResourceRequest{
+		Type: "Endpoint",
+		Data: namespaceEndpointRequest{endpointID},
+	}
+	_, err := issueNamespaceRequest(&id, "POST", "removeresource", &resource)
+	return err
+}

vendor/github.com/Microsoft/hcsshim/internal/hns/zsyscall_windows.go

@@ -0,0 +1,74 @@
+// MACHINE GENERATED BY 'go generate' COMMAND; DO NOT EDIT
+
+package hns
+
+import (
+	"syscall"
+	"unsafe"
+
+	"github.com/Microsoft/hcsshim/internal/interop"
+	"golang.org/x/sys/windows"
+)
+
+var _ unsafe.Pointer
+
+// Do the interface allocations only once for common
+// Errno values.
+const (
+	errnoERROR_IO_PENDING = 997
+)
+
+var (
+	errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING)
+)
+
+// errnoErr returns common boxed Errno values, to prevent
+// allocations at runtime.
+func errnoErr(e syscall.Errno) error {
+	switch e {
+	case 0:
+		return nil
+	case errnoERROR_IO_PENDING:
+		return errERROR_IO_PENDING
+	}
+	// TODO: add more here, after collecting data on the common
+	// error values see on Windows. (perhaps when running
+	// all.bat?)
+	return e
+}
+
+var (
+	modvmcompute = windows.NewLazySystemDLL("vmcompute.dll")
+
+	procHNSCall = modvmcompute.NewProc("HNSCall")
+)
+
+func _hnsCall(method string, path string, object string, response **uint16) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(method)
+	if hr != nil {
+		return
+	}
+	var _p1 *uint16
+	_p1, hr = syscall.UTF16PtrFromString(path)
+	if hr != nil {
+		return
+	}
+	var _p2 *uint16
+	_p2, hr = syscall.UTF16PtrFromString(object)
+	if hr != nil {
+		return
+	}
+	return __hnsCall(_p0, _p1, _p2, response)
+}
+
+func __hnsCall(method *uint16, path *uint16, object *uint16, response **uint16) (hr error) {
+	if hr = procHNSCall.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall6(procHNSCall.Addr(), 4, uintptr(unsafe.Pointer(method)), uintptr(unsafe.Pointer(path)), uintptr(unsafe.Pointer(object)), uintptr(unsafe.Pointer(response)), 0, 0)
+	if int32(r0) < 0 {
+		hr = interop.Win32FromHresult(r0)
+	}
+	return
+}

vendor/github.com/Microsoft/hcsshim/internal/interop/interop.go

@@ -0,0 +1,27 @@
+package interop
+
+import (
+	"syscall"
+	"unsafe"
+)
+
+//go:generate go run $GOROOT/src/syscall/mksyscall_windows.go -output zsyscall_windows.go interop.go
+
+//sys coTaskMemFree(buffer unsafe.Pointer) = ole32.CoTaskMemFree
+
+func ConvertAndFreeCoTaskMemString(buffer *uint16) string {
+	str := syscall.UTF16ToString((*[1 << 29]uint16)(unsafe.Pointer(buffer))[:])
+	coTaskMemFree(unsafe.Pointer(buffer))
+	return str
+}
+
+func ConvertAndFreeCoTaskMemBytes(buffer *uint16) []byte {
+	return []byte(ConvertAndFreeCoTaskMemString(buffer))
+}
+
+func Win32FromHresult(hr uintptr) syscall.Errno {
+	if hr&0x1fff0000 == 0x00070000 {
+		return syscall.Errno(hr & 0xffff)
+	}
+	return syscall.Errno(hr)
+}

vendor/github.com/Microsoft/hcsshim/internal/interop/zsyscall_windows.go

@@ -0,0 +1,48 @@
+// Code generated by 'go generate'; DO NOT EDIT.
+
+package interop
+
+import (
+	"syscall"
+	"unsafe"
+
+	"golang.org/x/sys/windows"
+)
+
+var _ unsafe.Pointer
+
+// Do the interface allocations only once for common
+// Errno values.
+const (
+	errnoERROR_IO_PENDING = 997
+)
+
+var (
+	errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING)
+)
+
+// errnoErr returns common boxed Errno values, to prevent
+// allocations at runtime.
+func errnoErr(e syscall.Errno) error {
+	switch e {
+	case 0:
+		return nil
+	case errnoERROR_IO_PENDING:
+		return errERROR_IO_PENDING
+	}
+	// TODO: add more here, after collecting data on the common
+	// error values see on Windows. (perhaps when running
+	// all.bat?)
+	return e
+}
+
+var (
+	modole32 = windows.NewLazySystemDLL("ole32.dll")
+
+	procCoTaskMemFree = modole32.NewProc("CoTaskMemFree")
+)
+
+func coTaskMemFree(buffer unsafe.Pointer) {
+	syscall.Syscall(procCoTaskMemFree.Addr(), 1, uintptr(buffer), 0, 0)
+	return
+}

vendor/github.com/Microsoft/hcsshim/internal/longpath/longpath.go

@@ -0,0 +1,24 @@
+package longpath
+
+import (
+	"path/filepath"
+	"strings"
+)
+
+// LongAbs makes a path absolute and returns it in NT long path form.
+func LongAbs(path string) (string, error) {
+	if strings.HasPrefix(path, `\\?\`) || strings.HasPrefix(path, `\\.\`) {
+		return path, nil
+	}
+	if !filepath.IsAbs(path) {
+		absPath, err := filepath.Abs(path)
+		if err != nil {
+			return "", err
+		}
+		path = absPath
+	}
+	if strings.HasPrefix(path, `\\`) {
+		return `\\?\UNC\` + path[2:], nil
+	}
+	return `\\?\` + path, nil
+}

vendor/github.com/Microsoft/hcsshim/internal/mergemaps/merge.go

@@ -0,0 +1,52 @@
+package mergemaps
+
+import "encoding/json"
+
+// Merge recursively merges map `fromMap` into map `ToMap`. Any pre-existing values
+// in ToMap are overwritten. Values in fromMap are added to ToMap.
+// From http://stackoverflow.com/questions/40491438/merging-two-json-strings-in-golang
+func Merge(fromMap, ToMap interface{}) interface{} {
+	switch fromMap := fromMap.(type) {
+	case map[string]interface{}:
+		ToMap, ok := ToMap.(map[string]interface{})
+		if !ok {
+			return fromMap
+		}
+		for keyToMap, valueToMap := range ToMap {
+			if valueFromMap, ok := fromMap[keyToMap]; ok {
+				fromMap[keyToMap] = Merge(valueFromMap, valueToMap)
+			} else {
+				fromMap[keyToMap] = valueToMap
+			}
+		}
+	case nil:
+		// merge(nil, map[string]interface{...}) -> map[string]interface{...}
+		ToMap, ok := ToMap.(map[string]interface{})
+		if ok {
+			return ToMap
+		}
+	}
+	return fromMap
+}
+
+// MergeJSON merges the contents of a JSON string into an object representation,
+// returning a new object suitable for translating to JSON.
+func MergeJSON(object interface{}, additionalJSON []byte) (interface{}, error) {
+	if len(additionalJSON) == 0 {
+		return object, nil
+	}
+	objectJSON, err := json.Marshal(object)
+	if err != nil {
+		return nil, err
+	}
+	var objectMap, newMap map[string]interface{}
+	err = json.Unmarshal(objectJSON, &objectMap)
+	if err != nil {
+		return nil, err
+	}
+	err = json.Unmarshal(additionalJSON, &newMap)
+	if err != nil {
+		return nil, err
+	}
+	return Merge(newMap, objectMap), nil
+}

vendor/github.com/Microsoft/hcsshim/internal/safefile/safeopen.go

@@ -0,0 +1,431 @@
+package safefile
+
+import (
+	"errors"
+	"io"
+	"os"
+	"path/filepath"
+	"strings"
+	"syscall"
+	"unicode/utf16"
+	"unsafe"
+
+	"github.com/Microsoft/hcsshim/internal/longpath"
+
+	winio "github.com/Microsoft/go-winio"
+)
+
+//go:generate go run $GOROOT\src\syscall\mksyscall_windows.go -output zsyscall_windows.go safeopen.go
+
+//sys ntCreateFile(handle *uintptr, accessMask uint32, oa *objectAttributes, iosb *ioStatusBlock, allocationSize *uint64, fileAttributes uint32, shareAccess uint32, createDisposition uint32, createOptions uint32, eaBuffer *byte, eaLength uint32) (status uint32) = ntdll.NtCreateFile
+//sys ntSetInformationFile(handle uintptr, iosb *ioStatusBlock, information uintptr, length uint32, class uint32) (status uint32) = ntdll.NtSetInformationFile
+//sys rtlNtStatusToDosError(status uint32) (winerr error) = ntdll.RtlNtStatusToDosErrorNoTeb
+//sys localAlloc(flags uint32, size int) (ptr uintptr) = kernel32.LocalAlloc
+//sys localFree(ptr uintptr) = kernel32.LocalFree
+
+type ioStatusBlock struct {
+	Status, Information uintptr
+}
+
+type objectAttributes struct {
+	Length             uintptr
+	RootDirectory      uintptr
+	ObjectName         uintptr
+	Attributes         uintptr
+	SecurityDescriptor uintptr
+	SecurityQoS        uintptr
+}
+
+type unicodeString struct {
+	Length        uint16
+	MaximumLength uint16
+	Buffer        uintptr
+}
+
+type fileLinkInformation struct {
+	ReplaceIfExists bool
+	RootDirectory   uintptr
+	FileNameLength  uint32
+	FileName        [1]uint16
+}
+
+type fileDispositionInformationEx struct {
+	Flags uintptr
+}
+
+const (
+	_FileLinkInformation          = 11
+	_FileDispositionInformationEx = 64
+
+	FILE_READ_ATTRIBUTES  = 0x0080
+	FILE_WRITE_ATTRIBUTES = 0x0100
+	DELETE                = 0x10000
+
+	FILE_OPEN   = 1
+	FILE_CREATE = 2
+
+	FILE_DIRECTORY_FILE          = 0x00000001
+	FILE_SYNCHRONOUS_IO_NONALERT = 0x00000020
+	FILE_DELETE_ON_CLOSE         = 0x00001000
+	FILE_OPEN_FOR_BACKUP_INTENT  = 0x00004000
+	FILE_OPEN_REPARSE_POINT      = 0x00200000
+
+	FILE_DISPOSITION_DELETE = 0x00000001
+
+	_OBJ_DONT_REPARSE = 0x1000
+
+	_STATUS_REPARSE_POINT_ENCOUNTERED = 0xC000050B
+)
+
+func OpenRoot(path string) (*os.File, error) {
+	longpath, err := longpath.LongAbs(path)
+	if err != nil {
+		return nil, err
+	}
+	return winio.OpenForBackup(longpath, syscall.GENERIC_READ, syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE, syscall.OPEN_EXISTING)
+}
+
+func ntRelativePath(path string) ([]uint16, error) {
+	path = filepath.Clean(path)
+	if strings.Contains(":", path) {
+		// Since alternate data streams must follow the file they
+		// are attached to, finding one here (out of order) is invalid.
+		return nil, errors.New("path contains invalid character `:`")
+	}
+	fspath := filepath.FromSlash(path)
+	if len(fspath) > 0 && fspath[0] == '\\' {
+		return nil, errors.New("expected relative path")
+	}
+
+	path16 := utf16.Encode(([]rune)(fspath))
+	if len(path16) > 32767 {
+		return nil, syscall.ENAMETOOLONG
+	}
+
+	return path16, nil
+}
+
+// openRelativeInternal opens a relative path from the given root, failing if
+// any of the intermediate path components are reparse points.
+func openRelativeInternal(path string, root *os.File, accessMask uint32, shareFlags uint32, createDisposition uint32, flags uint32) (*os.File, error) {
+	var (
+		h    uintptr
+		iosb ioStatusBlock
+		oa   objectAttributes
+	)
+
+	path16, err := ntRelativePath(path)
+	if err != nil {
+		return nil, err
+	}
+
+	if root == nil || root.Fd() == 0 {
+		return nil, errors.New("missing root directory")
+	}
+
+	upathBuffer := localAlloc(0, int(unsafe.Sizeof(unicodeString{}))+len(path16)*2)
+	defer localFree(upathBuffer)
+
+	upath := (*unicodeString)(unsafe.Pointer(upathBuffer))
+	upath.Length = uint16(len(path16) * 2)
+	upath.MaximumLength = upath.Length
+	upath.Buffer = upathBuffer + unsafe.Sizeof(*upath)
+	copy((*[32768]uint16)(unsafe.Pointer(upath.Buffer))[:], path16)
+
+	oa.Length = unsafe.Sizeof(oa)
+	oa.ObjectName = upathBuffer
+	oa.RootDirectory = uintptr(root.Fd())
+	oa.Attributes = _OBJ_DONT_REPARSE
+	status := ntCreateFile(
+		&h,
+		accessMask|syscall.SYNCHRONIZE,
+		&oa,
+		&iosb,
+		nil,
+		0,
+		shareFlags,
+		createDisposition,
+		FILE_OPEN_FOR_BACKUP_INTENT|FILE_SYNCHRONOUS_IO_NONALERT|flags,
+		nil,
+		0,
+	)
+	if status != 0 {
+		return nil, rtlNtStatusToDosError(status)
+	}
+
+	fullPath, err := longpath.LongAbs(filepath.Join(root.Name(), path))
+	if err != nil {
+		syscall.Close(syscall.Handle(h))
+		return nil, err
+	}
+
+	return os.NewFile(h, fullPath), nil
+}
+
+// OpenRelative opens a relative path from the given root, failing if
+// any of the intermediate path components are reparse points.
+func OpenRelative(path string, root *os.File, accessMask uint32, shareFlags uint32, createDisposition uint32, flags uint32) (*os.File, error) {
+	f, err := openRelativeInternal(path, root, accessMask, shareFlags, createDisposition, flags)
+	if err != nil {
+		err = &os.PathError{Op: "open", Path: filepath.Join(root.Name(), path), Err: err}
+	}
+	return f, err
+}
+
+// LinkRelative creates a hard link from oldname to newname (relative to oldroot
+// and newroot), failing if any of the intermediate path components are reparse
+// points.
+func LinkRelative(oldname string, oldroot *os.File, newname string, newroot *os.File) error {
+	// Open the old file.
+	oldf, err := openRelativeInternal(
+		oldname,
+		oldroot,
+		syscall.FILE_WRITE_ATTRIBUTES,
+		syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE,
+		FILE_OPEN,
+		0,
+	)
+	if err != nil {
+		return &os.LinkError{Op: "link", Old: filepath.Join(oldroot.Name(), oldname), New: filepath.Join(newroot.Name(), newname), Err: err}
+	}
+	defer oldf.Close()
+
+	// Open the parent of the new file.
+	var parent *os.File
+	parentPath := filepath.Dir(newname)
+	if parentPath != "." {
+		parent, err = openRelativeInternal(
+			parentPath,
+			newroot,
+			syscall.GENERIC_READ,
+			syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE,
+			FILE_OPEN,
+			FILE_DIRECTORY_FILE)
+		if err != nil {
+			return &os.LinkError{Op: "link", Old: oldf.Name(), New: filepath.Join(newroot.Name(), newname), Err: err}
+		}
+		defer parent.Close()
+
+		fi, err := winio.GetFileBasicInfo(parent)
+		if err != nil {
+			return err
+		}
+		if (fi.FileAttributes & syscall.FILE_ATTRIBUTE_REPARSE_POINT) != 0 {
+			return &os.LinkError{Op: "link", Old: oldf.Name(), New: filepath.Join(newroot.Name(), newname), Err: rtlNtStatusToDosError(_STATUS_REPARSE_POINT_ENCOUNTERED)}
+		}
+
+	} else {
+		parent = newroot
+	}
+
+	// Issue an NT call to create the link. This will be safe because NT will
+	// not open any more directories to create the link, so it cannot walk any
+	// more reparse points.
+	newbase := filepath.Base(newname)
+	newbase16, err := ntRelativePath(newbase)
+	if err != nil {
+		return err
+	}
+
+	size := int(unsafe.Offsetof(fileLinkInformation{}.FileName)) + len(newbase16)*2
+	linkinfoBuffer := localAlloc(0, size)
+	defer localFree(linkinfoBuffer)
+	linkinfo := (*fileLinkInformation)(unsafe.Pointer(linkinfoBuffer))
+	linkinfo.RootDirectory = parent.Fd()
+	linkinfo.FileNameLength = uint32(len(newbase16) * 2)
+	copy((*[32768]uint16)(unsafe.Pointer(&linkinfo.FileName[0]))[:], newbase16)
+
+	var iosb ioStatusBlock
+	status := ntSetInformationFile(
+		oldf.Fd(),
+		&iosb,
+		linkinfoBuffer,
+		uint32(size),
+		_FileLinkInformation,
+	)
+	if status != 0 {
+		return &os.LinkError{Op: "link", Old: oldf.Name(), New: filepath.Join(parent.Name(), newbase), Err: rtlNtStatusToDosError(status)}
+	}
+
+	return nil
+}
+
+// deleteOnClose marks a file to be deleted when the handle is closed.
+func deleteOnClose(f *os.File) error {
+	disposition := fileDispositionInformationEx{Flags: FILE_DISPOSITION_DELETE}
+	var iosb ioStatusBlock
+	status := ntSetInformationFile(
+		f.Fd(),
+		&iosb,
+		uintptr(unsafe.Pointer(&disposition)),
+		uint32(unsafe.Sizeof(disposition)),
+		_FileDispositionInformationEx,
+	)
+	if status != 0 {
+		return rtlNtStatusToDosError(status)
+	}
+	return nil
+}
+
+// clearReadOnly clears the readonly attribute on a file.
+func clearReadOnly(f *os.File) error {
+	bi, err := winio.GetFileBasicInfo(f)
+	if err != nil {
+		return err
+	}
+	if bi.FileAttributes&syscall.FILE_ATTRIBUTE_READONLY == 0 {
+		return nil
+	}
+	sbi := winio.FileBasicInfo{
+		FileAttributes: bi.FileAttributes &^ syscall.FILE_ATTRIBUTE_READONLY,
+	}
+	if sbi.FileAttributes == 0 {
+		sbi.FileAttributes = syscall.FILE_ATTRIBUTE_NORMAL
+	}
+	return winio.SetFileBasicInfo(f, &sbi)
+}
+
+// RemoveRelative removes a file or directory relative to a root, failing if any
+// intermediate path components are reparse points.
+func RemoveRelative(path string, root *os.File) error {
+	f, err := openRelativeInternal(
+		path,
+		root,
+		FILE_READ_ATTRIBUTES|FILE_WRITE_ATTRIBUTES|DELETE,
+		syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE,
+		FILE_OPEN,
+		FILE_OPEN_REPARSE_POINT)
+	if err == nil {
+		defer f.Close()
+		err = deleteOnClose(f)
+		if err == syscall.ERROR_ACCESS_DENIED {
+			// Maybe the file is marked readonly. Clear the bit and retry.
+			clearReadOnly(f)
+			err = deleteOnClose(f)
+		}
+	}
+	if err != nil {
+		return &os.PathError{Op: "remove", Path: filepath.Join(root.Name(), path), Err: err}
+	}
+	return nil
+}
+
+// RemoveAllRelative removes a directory tree relative to a root, failing if any
+// intermediate path components are reparse points.
+func RemoveAllRelative(path string, root *os.File) error {
+	fi, err := LstatRelative(path, root)
+	if err != nil {
+		if os.IsNotExist(err) {
+			return nil
+		}
+		return err
+	}
+	fileAttributes := fi.Sys().(*syscall.Win32FileAttributeData).FileAttributes
+	if fileAttributes&syscall.FILE_ATTRIBUTE_DIRECTORY == 0 || fileAttributes&syscall.FILE_ATTRIBUTE_REPARSE_POINT != 0 {
+		// If this is a reparse point, it can't have children. Simple remove will do.
+		err := RemoveRelative(path, root)
+		if err == nil || os.IsNotExist(err) {
+			return nil
+		}
+		return err
+	}
+
+	// It is necessary to use os.Open as Readdirnames does not work with
+	// OpenRelative. This is safe because the above lstatrelative fails
+	// if the target is outside the root, and we know this is not a
+	// symlink from the above FILE_ATTRIBUTE_REPARSE_POINT check.
+	fd, err := os.Open(filepath.Join(root.Name(), path))
+	if err != nil {
+		if os.IsNotExist(err) {
+			// Race. It was deleted between the Lstat and Open.
+			// Return nil per RemoveAll's docs.
+			return nil
+		}
+		return err
+	}
+
+	// Remove contents & return first error.
+	for {
+		names, err1 := fd.Readdirnames(100)
+		for _, name := range names {
+			err1 := RemoveAllRelative(path+string(os.PathSeparator)+name, root)
+			if err == nil {
+				err = err1
+			}
+		}
+		if err1 == io.EOF {
+			break
+		}
+		// If Readdirnames returned an error, use it.
+		if err == nil {
+			err = err1
+		}
+		if len(names) == 0 {
+			break
+		}
+	}
+	fd.Close()
+
+	// Remove directory.
+	err1 := RemoveRelative(path, root)
+	if err1 == nil || os.IsNotExist(err1) {
+		return nil
+	}
+	if err == nil {
+		err = err1
+	}
+	return err
+}
+
+// MkdirRelative creates a directory relative to a root, failing if any
+// intermediate path components are reparse points.
+func MkdirRelative(path string, root *os.File) error {
+	f, err := openRelativeInternal(
+		path,
+		root,
+		0,
+		syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE,
+		FILE_CREATE,
+		FILE_DIRECTORY_FILE)
+	if err == nil {
+		f.Close()
+	} else {
+		err = &os.PathError{Op: "mkdir", Path: filepath.Join(root.Name(), path), Err: err}
+	}
+	return err
+}
+
+// LstatRelative performs a stat operation on a file relative to a root, failing
+// if any intermediate path components are reparse points.
+func LstatRelative(path string, root *os.File) (os.FileInfo, error) {
+	f, err := openRelativeInternal(
+		path,
+		root,
+		FILE_READ_ATTRIBUTES,
+		syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE,
+		FILE_OPEN,
+		FILE_OPEN_REPARSE_POINT)
+	if err != nil {
+		return nil, &os.PathError{Op: "stat", Path: filepath.Join(root.Name(), path), Err: err}
+	}
+	defer f.Close()
+	return f.Stat()
+}
+
+// EnsureNotReparsePointRelative validates that a given file (relative to a
+// root) and all intermediate path components are not a reparse points.
+func EnsureNotReparsePointRelative(path string, root *os.File) error {
+	// Perform an open with OBJ_DONT_REPARSE but without specifying FILE_OPEN_REPARSE_POINT.
+	f, err := OpenRelative(
+		path,
+		root,
+		0,
+		syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE,
+		FILE_OPEN,
+		0)
+	if err != nil {
+		return err
+	}
+	f.Close()
+	return nil
+}

vendor/github.com/Microsoft/hcsshim/internal/safefile/zsyscall_windows.go

@@ -0,0 +1,79 @@
+// Code generated by 'go generate'; DO NOT EDIT.
+
+package safefile
+
+import (
+	"syscall"
+	"unsafe"
+
+	"golang.org/x/sys/windows"
+)
+
+var _ unsafe.Pointer
+
+// Do the interface allocations only once for common
+// Errno values.
+const (
+	errnoERROR_IO_PENDING = 997
+)
+
+var (
+	errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING)
+)
+
+// errnoErr returns common boxed Errno values, to prevent
+// allocations at runtime.
+func errnoErr(e syscall.Errno) error {
+	switch e {
+	case 0:
+		return nil
+	case errnoERROR_IO_PENDING:
+		return errERROR_IO_PENDING
+	}
+	// TODO: add more here, after collecting data on the common
+	// error values see on Windows. (perhaps when running
+	// all.bat?)
+	return e
+}
+
+var (
+	modntdll    = windows.NewLazySystemDLL("ntdll.dll")
+	modkernel32 = windows.NewLazySystemDLL("kernel32.dll")
+
+	procNtCreateFile               = modntdll.NewProc("NtCreateFile")
+	procNtSetInformationFile       = modntdll.NewProc("NtSetInformationFile")
+	procRtlNtStatusToDosErrorNoTeb = modntdll.NewProc("RtlNtStatusToDosErrorNoTeb")
+	procLocalAlloc                 = modkernel32.NewProc("LocalAlloc")
+	procLocalFree                  = modkernel32.NewProc("LocalFree")
+)
+
+func ntCreateFile(handle *uintptr, accessMask uint32, oa *objectAttributes, iosb *ioStatusBlock, allocationSize *uint64, fileAttributes uint32, shareAccess uint32, createDisposition uint32, createOptions uint32, eaBuffer *byte, eaLength uint32) (status uint32) {
+	r0, _, _ := syscall.Syscall12(procNtCreateFile.Addr(), 11, uintptr(unsafe.Pointer(handle)), uintptr(accessMask), uintptr(unsafe.Pointer(oa)), uintptr(unsafe.Pointer(iosb)), uintptr(unsafe.Pointer(allocationSize)), uintptr(fileAttributes), uintptr(shareAccess), uintptr(createDisposition), uintptr(createOptions), uintptr(unsafe.Pointer(eaBuffer)), uintptr(eaLength), 0)
+	status = uint32(r0)
+	return
+}
+
+func ntSetInformationFile(handle uintptr, iosb *ioStatusBlock, information uintptr, length uint32, class uint32) (status uint32) {
+	r0, _, _ := syscall.Syscall6(procNtSetInformationFile.Addr(), 5, uintptr(handle), uintptr(unsafe.Pointer(iosb)), uintptr(information), uintptr(length), uintptr(class), 0)
+	status = uint32(r0)
+	return
+}
+
+func rtlNtStatusToDosError(status uint32) (winerr error) {
+	r0, _, _ := syscall.Syscall(procRtlNtStatusToDosErrorNoTeb.Addr(), 1, uintptr(status), 0, 0)
+	if r0 != 0 {
+		winerr = syscall.Errno(r0)
+	}
+	return
+}
+
+func localAlloc(flags uint32, size int) (ptr uintptr) {
+	r0, _, _ := syscall.Syscall(procLocalAlloc.Addr(), 2, uintptr(flags), uintptr(size), 0)
+	ptr = uintptr(r0)
+	return
+}
+
+func localFree(ptr uintptr) {
+	syscall.Syscall(procLocalFree.Addr(), 1, uintptr(ptr), 0, 0)
+	return
+}

vendor/github.com/Microsoft/hcsshim/internal/schema1/schema1.go

@@ -0,0 +1,228 @@
+package schema1
+
+import (
+	"encoding/json"
+	"time"
+)
+
+// ProcessConfig is used as both the input of Container.CreateProcess
+// and to convert the parameters to JSON for passing onto the HCS
+type ProcessConfig struct {
+	ApplicationName   string            `json:",omitempty"`
+	CommandLine       string            `json:",omitempty"`
+	CommandArgs       []string          `json:",omitempty"` // Used by Linux Containers on Windows
+	User              string            `json:",omitempty"`
+	WorkingDirectory  string            `json:",omitempty"`
+	Environment       map[string]string `json:",omitempty"`
+	EmulateConsole    bool              `json:",omitempty"`
+	CreateStdInPipe   bool              `json:",omitempty"`
+	CreateStdOutPipe  bool              `json:",omitempty"`
+	CreateStdErrPipe  bool              `json:",omitempty"`
+	ConsoleSize       [2]uint           `json:",omitempty"`
+	CreateInUtilityVm bool              `json:",omitempty"` // Used by Linux Containers on Windows
+	OCISpecification  *json.RawMessage  `json:",omitempty"` // Used by Linux Containers on Windows
+}
+
+type Layer struct {
+	ID   string
+	Path string
+}
+
+type MappedDir struct {
+	HostPath          string
+	ContainerPath     string
+	ReadOnly          bool
+	BandwidthMaximum  uint64
+	IOPSMaximum       uint64
+	CreateInUtilityVM bool
+	// LinuxMetadata - Support added in 1803/RS4+.
+	LinuxMetadata bool `json:",omitempty"`
+}
+
+type MappedPipe struct {
+	HostPath          string
+	ContainerPipeName string
+}
+
+type HvRuntime struct {
+	ImagePath           string `json:",omitempty"`
+	SkipTemplate        bool   `json:",omitempty"`
+	LinuxInitrdFile     string `json:",omitempty"` // File under ImagePath on host containing an initrd image for starting a Linux utility VM
+	LinuxKernelFile     string `json:",omitempty"` // File under ImagePath on host containing a kernel for starting a Linux utility VM
+	LinuxBootParameters string `json:",omitempty"` // Additional boot parameters for starting a Linux Utility VM in initrd mode
+	BootSource          string `json:",omitempty"` // "Vhd" for Linux Utility VM booting from VHD
+	WritableBootSource  bool   `json:",omitempty"` // Linux Utility VM booting from VHD
+}
+
+type MappedVirtualDisk struct {
+	HostPath          string `json:",omitempty"` // Path to VHD on the host
+	ContainerPath     string // Platform-specific mount point path in the container
+	CreateInUtilityVM bool   `json:",omitempty"`
+	ReadOnly          bool   `json:",omitempty"`
+	Cache             string `json:",omitempty"` // "" (Unspecified); "Disabled"; "Enabled"; "Private"; "PrivateAllowSharing"
+	AttachOnly        bool   `json:",omitempty:`
+}
+
+// AssignedDevice represents a device that has been directly assigned to a container
+//
+// NOTE: Support added in RS5
+type AssignedDevice struct {
+	//  InterfaceClassGUID of the device to assign to container.
+	InterfaceClassGUID string `json:"InterfaceClassGuid,omitempty"`
+}
+
+// ContainerConfig is used as both the input of CreateContainer
+// and to convert the parameters to JSON for passing onto the HCS
+type ContainerConfig struct {
+	SystemType                  string              // HCS requires this to be hard-coded to "Container"
+	Name                        string              // Name of the container. We use the docker ID.
+	Owner                       string              `json:",omitempty"` // The management platform that created this container
+	VolumePath                  string              `json:",omitempty"` // Windows volume path for scratch space. Used by Windows Server Containers only. Format \\?\\Volume{GUID}
+	IgnoreFlushesDuringBoot     bool                `json:",omitempty"` // Optimization hint for container startup in Windows
+	LayerFolderPath             string              `json:",omitempty"` // Where the layer folders are located. Used by Windows Server Containers only. Format  %root%\windowsfilter\containerID
+	Layers                      []Layer             // List of storage layers. Required for Windows Server and Hyper-V Containers. Format ID=GUID;Path=%root%\windowsfilter\layerID
+	Credentials                 string              `json:",omitempty"` // Credentials information
+	ProcessorCount              uint32              `json:",omitempty"` // Number of processors to assign to the container.
+	ProcessorWeight             uint64              `json:",omitempty"` // CPU shares (relative weight to other containers with cpu shares). Range is from 1 to 10000. A value of 0 results in default shares.
+	ProcessorMaximum            int64               `json:",omitempty"` // Specifies the portion of processor cycles that this container can use as a percentage times 100. Range is from 1 to 10000. A value of 0 results in no limit.
+	StorageIOPSMaximum          uint64              `json:",omitempty"` // Maximum Storage IOPS
+	StorageBandwidthMaximum     uint64              `json:",omitempty"` // Maximum Storage Bandwidth in bytes per second
+	StorageSandboxSize          uint64              `json:",omitempty"` // Size in bytes that the container system drive should be expanded to if smaller
+	MemoryMaximumInMB           int64               `json:",omitempty"` // Maximum memory available to the container in Megabytes
+	HostName                    string              `json:",omitempty"` // Hostname
+	MappedDirectories           []MappedDir         `json:",omitempty"` // List of mapped directories (volumes/mounts)
+	MappedPipes                 []MappedPipe        `json:",omitempty"` // List of mapped Windows named pipes
+	HvPartition                 bool                // True if it a Hyper-V Container
+	NetworkSharedContainerName  string              `json:",omitempty"` // Name (ID) of the container that we will share the network stack with.
+	EndpointList                []string            `json:",omitempty"` // List of networking endpoints to be attached to container
+	HvRuntime                   *HvRuntime          `json:",omitempty"` // Hyper-V container settings. Used by Hyper-V containers only. Format ImagePath=%root%\BaseLayerID\UtilityVM
+	Servicing                   bool                `json:",omitempty"` // True if this container is for servicing
+	AllowUnqualifiedDNSQuery    bool                `json:",omitempty"` // True to allow unqualified DNS name resolution
+	DNSSearchList               string              `json:",omitempty"` // Comma seperated list of DNS suffixes to use for name resolution
+	ContainerType               string              `json:",omitempty"` // "Linux" for Linux containers on Windows. Omitted otherwise.
+	TerminateOnLastHandleClosed bool                `json:",omitempty"` // Should HCS terminate the container once all handles have been closed
+	MappedVirtualDisks          []MappedVirtualDisk `json:",omitempty"` // Array of virtual disks to mount at start
+	AssignedDevices             []AssignedDevice    `json:",omitempty"` // Array of devices to assign. NOTE: Support added in RS5
+}
+
+type ComputeSystemQuery struct {
+	IDs    []string `json:"Ids,omitempty"`
+	Types  []string `json:",omitempty"`
+	Names  []string `json:",omitempty"`
+	Owners []string `json:",omitempty"`
+}
+
+type PropertyType string
+
+const (
+	PropertyTypeStatistics        PropertyType = "Statistics"
+	PropertyTypeProcessList                    = "ProcessList"
+	PropertyTypeMappedVirtualDisk              = "MappedVirtualDisk"
+)
+
+type PropertyQuery struct {
+	PropertyTypes []PropertyType `json:",omitempty"`
+}
+
+// ContainerProperties holds the properties for a container and the processes running in that container
+type ContainerProperties struct {
+	ID                           string `json:"Id"`
+	State                        string
+	Name                         string
+	SystemType                   string
+	Owner                        string
+	SiloGUID                     string                              `json:"SiloGuid,omitempty"`
+	RuntimeID                    string                              `json:"RuntimeId,omitempty"`
+	IsRuntimeTemplate            bool                                `json:",omitempty"`
+	RuntimeImagePath             string                              `json:",omitempty"`
+	Stopped                      bool                                `json:",omitempty"`
+	ExitType                     string                              `json:",omitempty"`
+	AreUpdatesPending            bool                                `json:",omitempty"`
+	ObRoot                       string                              `json:",omitempty"`
+	Statistics                   Statistics                          `json:",omitempty"`
+	ProcessList                  []ProcessListItem                   `json:",omitempty"`
+	MappedVirtualDiskControllers map[int]MappedVirtualDiskController `json:",omitempty"`
+}
+
+// MemoryStats holds the memory statistics for a container
+type MemoryStats struct {
+	UsageCommitBytes            uint64 `json:"MemoryUsageCommitBytes,omitempty"`
+	UsageCommitPeakBytes        uint64 `json:"MemoryUsageCommitPeakBytes,omitempty"`
+	UsagePrivateWorkingSetBytes uint64 `json:"MemoryUsagePrivateWorkingSetBytes,omitempty"`
+}
+
+// ProcessorStats holds the processor statistics for a container
+type ProcessorStats struct {
+	TotalRuntime100ns  uint64 `json:",omitempty"`
+	RuntimeUser100ns   uint64 `json:",omitempty"`
+	RuntimeKernel100ns uint64 `json:",omitempty"`
+}
+
+// StorageStats holds the storage statistics for a container
+type StorageStats struct {
+	ReadCountNormalized  uint64 `json:",omitempty"`
+	ReadSizeBytes        uint64 `json:",omitempty"`
+	WriteCountNormalized uint64 `json:",omitempty"`
+	WriteSizeBytes       uint64 `json:",omitempty"`
+}
+
+// NetworkStats holds the network statistics for a container
+type NetworkStats struct {
+	BytesReceived          uint64 `json:",omitempty"`
+	BytesSent              uint64 `json:",omitempty"`
+	PacketsReceived        uint64 `json:",omitempty"`
+	PacketsSent            uint64 `json:",omitempty"`
+	DroppedPacketsIncoming uint64 `json:",omitempty"`
+	DroppedPacketsOutgoing uint64 `json:",omitempty"`
+	EndpointId             string `json:",omitempty"`
+	InstanceId             string `json:",omitempty"`
+}
+
+// Statistics is the structure returned by a statistics call on a container
+type Statistics struct {
+	Timestamp          time.Time      `json:",omitempty"`
+	ContainerStartTime time.Time      `json:",omitempty"`
+	Uptime100ns        uint64         `json:",omitempty"`
+	Memory             MemoryStats    `json:",omitempty"`
+	Processor          ProcessorStats `json:",omitempty"`
+	Storage            StorageStats   `json:",omitempty"`
+	Network            []NetworkStats `json:",omitempty"`
+}
+
+// ProcessList is the structure of an item returned by a ProcessList call on a container
+type ProcessListItem struct {
+	CreateTimestamp              time.Time `json:",omitempty"`
+	ImageName                    string    `json:",omitempty"`
+	KernelTime100ns              uint64    `json:",omitempty"`
+	MemoryCommitBytes            uint64    `json:",omitempty"`
+	MemoryWorkingSetPrivateBytes uint64    `json:",omitempty"`
+	MemoryWorkingSetSharedBytes  uint64    `json:",omitempty"`
+	ProcessId                    uint32    `json:",omitempty"`
+	UserTime100ns                uint64    `json:",omitempty"`
+}
+
+// MappedVirtualDiskController is the structure of an item returned by a MappedVirtualDiskList call on a container
+type MappedVirtualDiskController struct {
+	MappedVirtualDisks map[int]MappedVirtualDisk `json:",omitempty"`
+}
+
+// Type of Request Support in ModifySystem
+type RequestType string
+
+// Type of Resource Support in ModifySystem
+type ResourceType string
+
+// RequestType const
+const (
+	Add     RequestType  = "Add"
+	Remove  RequestType  = "Remove"
+	Network ResourceType = "Network"
+)
+
+// ResourceModificationRequestResponse is the structure used to send request to the container to modify the system
+// Supported resource types are Network and Request Types are Add/Remove
+type ResourceModificationRequestResponse struct {
+	Resource ResourceType `json:"ResourceType"`
+	Data     interface{}  `json:"Settings"`
+	Request  RequestType  `json:"RequestType,omitempty"`
+}

vendor/github.com/Microsoft/hcsshim/internal/timeout/timeout.go

@@ -0,0 +1,70 @@
+package timeout
+
+import (
+	"os"
+	"strconv"
+	"time"
+)
+
+var (
+	// defaultTimeout is the timeout for most operations that is not overridden.
+	defaultTimeout = 4 * time.Minute
+
+	// defaultTimeoutTestdRetry is the retry loop timeout for testd to respond
+	// for a disk to come online in LCOW.
+	defaultTimeoutTestdRetry = 5 * time.Second
+)
+
+// External variables for HCSShim consumers to use.
+var (
+	// SystemCreate is the timeout for creating a compute system
+	SystemCreate time.Duration = defaultTimeout
+
+	// SystemStart is the timeout for starting a compute system
+	SystemStart time.Duration = defaultTimeout
+
+	// SystemPause is the timeout for pausing a compute system
+	SystemPause time.Duration = defaultTimeout
+
+	// SystemResume is the timeout for resuming a compute system
+	SystemResume time.Duration = defaultTimeout
+
+	// SyscallWatcher is the timeout before warning of a potential stuck platform syscall.
+	SyscallWatcher time.Duration = defaultTimeout
+
+	// Tar2VHD is the timeout for the tar2vhd operation to complete
+	Tar2VHD time.Duration = defaultTimeout
+
+	// ExternalCommandToStart is the timeout for external commands to start
+	ExternalCommandToStart = defaultTimeout
+
+	// ExternalCommandToComplete is the timeout for external commands to complete.
+	// Generally this means copying data from their stdio pipes.
+	ExternalCommandToComplete = defaultTimeout
+
+	// TestDRetryLoop is the timeout for testd retry loop when onlining a SCSI disk in LCOW
+	TestDRetryLoop = defaultTimeoutTestdRetry
+)
+
+func init() {
+	SystemCreate = durationFromEnvironment("HCSSHIM_TIMEOUT_SYSTEMCREATE", SystemCreate)
+	SystemStart = durationFromEnvironment("HCSSHIM_TIMEOUT_SYSTEMSTART", SystemStart)
+	SystemPause = durationFromEnvironment("HCSSHIM_TIMEOUT_SYSTEMPAUSE", SystemPause)
+	SystemResume = durationFromEnvironment("HCSSHIM_TIMEOUT_SYSTEMRESUME", SystemResume)
+	SyscallWatcher = durationFromEnvironment("HCSSHIM_TIMEOUT_SYSCALLWATCHER", SyscallWatcher)
+	Tar2VHD = durationFromEnvironment("HCSSHIM_TIMEOUT_TAR2VHD", Tar2VHD)
+	ExternalCommandToStart = durationFromEnvironment("HCSSHIM_TIMEOUT_EXTERNALCOMMANDSTART", ExternalCommandToStart)
+	ExternalCommandToComplete = durationFromEnvironment("HCSSHIM_TIMEOUT_EXTERNALCOMMANDCOMPLETE", ExternalCommandToComplete)
+	TestDRetryLoop = durationFromEnvironment("HCSSHIM_TIMEOUT_TESTDRETRYLOOP", TestDRetryLoop)
+}
+
+func durationFromEnvironment(env string, defaultValue time.Duration) time.Duration {
+	envTimeout := os.Getenv(env)
+	if len(envTimeout) > 0 {
+		e, err := strconv.Atoi(envTimeout)
+		if err == nil && e > 0 {
+			return time.Second * time.Duration(e)
+		}
+	}
+	return defaultValue
+}

vendor/github.com/Microsoft/hcsshim/internal/wclayer/activatelayer.go

@@ -0,0 +1,25 @@
+package wclayer
+
+import (
+	"github.com/Microsoft/hcsshim/internal/hcserror"
+	"github.com/sirupsen/logrus"
+)
+
+// ActivateLayer will find the layer with the given id and mount it's filesystem.
+// For a read/write layer, the mounted filesystem will appear as a volume on the
+// host, while a read-only layer is generally expected to be a no-op.
+// An activated layer must later be deactivated via DeactivateLayer.
+func ActivateLayer(path string) error {
+	title := "hcsshim::ActivateLayer "
+	logrus.Debugf(title+"path %s", path)
+
+	err := activateLayer(&stdDriverInfo, path)
+	if err != nil {
+		err = hcserror.Errorf(err, title, "path=%s", path)
+		logrus.Error(err)
+		return err
+	}
+
+	logrus.Debugf(title+" - succeeded path=%s", path)
+	return nil
+}

vendor/github.com/Microsoft/hcsshim/internal/wclayer/baselayer.go

@@ -0,0 +1,173 @@
+package wclayer
+
+import (
+	"errors"
+	"os"
+	"path/filepath"
+	"syscall"
+
+	"github.com/Microsoft/go-winio"
+	"github.com/Microsoft/hcsshim/internal/hcserror"
+	"github.com/Microsoft/hcsshim/internal/safefile"
+)
+
+type baseLayerWriter struct {
+	root         *os.File
+	f            *os.File
+	bw           *winio.BackupFileWriter
+	err          error
+	hasUtilityVM bool
+	dirInfo      []dirInfo
+}
+
+type dirInfo struct {
+	path     string
+	fileInfo winio.FileBasicInfo
+}
+
+// reapplyDirectoryTimes reapplies directory modification, creation, etc. times
+// after processing of the directory tree has completed. The times are expected
+// to be ordered such that parent directories come before child directories.
+func reapplyDirectoryTimes(root *os.File, dis []dirInfo) error {
+	for i := range dis {
+		di := &dis[len(dis)-i-1] // reverse order: process child directories first
+		f, err := safefile.OpenRelative(di.path, root, syscall.GENERIC_READ|syscall.GENERIC_WRITE, syscall.FILE_SHARE_READ, safefile.FILE_OPEN, safefile.FILE_DIRECTORY_FILE)
+		if err != nil {
+			return err
+		}
+
+		err = winio.SetFileBasicInfo(f, &di.fileInfo)
+		f.Close()
+		if err != nil {
+			return err
+		}
+	}
+	return nil
+}
+
+func (w *baseLayerWriter) closeCurrentFile() error {
+	if w.f != nil {
+		err := w.bw.Close()
+		err2 := w.f.Close()
+		w.f = nil
+		w.bw = nil
+		if err != nil {
+			return err
+		}
+		if err2 != nil {
+			return err2
+		}
+	}
+	return nil
+}
+
+func (w *baseLayerWriter) Add(name string, fileInfo *winio.FileBasicInfo) (err error) {
+	defer func() {
+		if err != nil {
+			w.err = err
+		}
+	}()
+
+	err = w.closeCurrentFile()
+	if err != nil {
+		return err
+	}
+
+	if filepath.ToSlash(name) == `UtilityVM/Files` {
+		w.hasUtilityVM = true
+	}
+
+	var f *os.File
+	defer func() {
+		if f != nil {
+			f.Close()
+		}
+	}()
+
+	extraFlags := uint32(0)
+	if fileInfo.FileAttributes&syscall.FILE_ATTRIBUTE_DIRECTORY != 0 {
+		extraFlags |= safefile.FILE_DIRECTORY_FILE
+		if fileInfo.FileAttributes&syscall.FILE_ATTRIBUTE_REPARSE_POINT == 0 {
+			w.dirInfo = append(w.dirInfo, dirInfo{name, *fileInfo})
+		}
+	}
+
+	mode := uint32(syscall.GENERIC_READ | syscall.GENERIC_WRITE | winio.WRITE_DAC | winio.WRITE_OWNER | winio.ACCESS_SYSTEM_SECURITY)
+	f, err = safefile.OpenRelative(name, w.root, mode, syscall.FILE_SHARE_READ, safefile.FILE_CREATE, extraFlags)
+	if err != nil {
+		return hcserror.New(err, "Failed to safefile.OpenRelative", name)
+	}
+
+	err = winio.SetFileBasicInfo(f, fileInfo)
+	if err != nil {
+		return hcserror.New(err, "Failed to SetFileBasicInfo", name)
+	}
+
+	w.f = f
+	w.bw = winio.NewBackupFileWriter(f, true)
+	f = nil
+	return nil
+}
+
+func (w *baseLayerWriter) AddLink(name string, target string) (err error) {
+	defer func() {
+		if err != nil {
+			w.err = err
+		}
+	}()
+
+	err = w.closeCurrentFile()
+	if err != nil {
+		return err
+	}
+
+	return safefile.LinkRelative(target, w.root, name, w.root)
+}
+
+func (w *baseLayerWriter) Remove(name string) error {
+	return errors.New("base layer cannot have tombstones")
+}
+
+func (w *baseLayerWriter) Write(b []byte) (int, error) {
+	n, err := w.bw.Write(b)
+	if err != nil {
+		w.err = err
+	}
+	return n, err
+}
+
+func (w *baseLayerWriter) Close() error {
+	defer func() {
+		w.root.Close()
+		w.root = nil
+	}()
+	err := w.closeCurrentFile()
+	if err != nil {
+		return err
+	}
+	if w.err == nil {
+		// Restore the file times of all the directories, since they may have
+		// been modified by creating child directories.
+		err = reapplyDirectoryTimes(w.root, w.dirInfo)
+		if err != nil {
+			return err
+		}
+
+		err = ProcessBaseLayer(w.root.Name())
+		if err != nil {
+			return err
+		}
+
+		if w.hasUtilityVM {
+			err := safefile.EnsureNotReparsePointRelative("UtilityVM", w.root)
+			if err != nil {
+				return err
+			}
+			err = ProcessUtilityVMImage(filepath.Join(w.root.Name(), "UtilityVM"))
+			if err != nil {
+				return err
+			}
+		}
+	}
+	return w.err
+}

vendor/github.com/Microsoft/hcsshim/internal/wclayer/createlayer.go

@@ -0,0 +1,23 @@
+package wclayer
+
+import (
+	"github.com/Microsoft/hcsshim/internal/hcserror"
+	"github.com/sirupsen/logrus"
+)
+
+// CreateLayer creates a new, empty, read-only layer on the filesystem based on
+// the parent layer provided.
+func CreateLayer(path, parent string) error {
+	title := "hcsshim::CreateLayer "
+	logrus.Debugf(title+"ID %s parent %s", path, parent)
+
+	err := createLayer(&stdDriverInfo, path, parent)
+	if err != nil {
+		err = hcserror.Errorf(err, title, "path=%s parent=%s", path, parent)
+		logrus.Error(err)
+		return err
+	}
+
+	logrus.Debugf(title+"- succeeded path=%s parent=%s", path, parent)
+	return nil
+}

vendor/github.com/Microsoft/hcsshim/internal/wclayer/createscratchlayer.go

@@ -0,0 +1,31 @@
+package wclayer
+
+import (
+	"github.com/Microsoft/hcsshim/internal/hcserror"
+	"github.com/sirupsen/logrus"
+)
+
+// CreateScratchLayer creates and populates new read-write layer for use by a container.
+// This requires both the id of the direct parent layer, as well as the full list
+// of paths to all parent layers up to the base (and including the direct parent
+// whose id was provided).
+func CreateScratchLayer(path string, parentLayerPaths []string) error {
+	title := "hcsshim::CreateScratchLayer "
+	logrus.Debugf(title+"path %s", path)
+
+	// Generate layer descriptors
+	layers, err := layerPathsToDescriptors(parentLayerPaths)
+	if err != nil {
+		return err
+	}
+
+	err = createSandboxLayer(&stdDriverInfo, path, 0, layers)
+	if err != nil {
+		err = hcserror.Errorf(err, title, "path=%s", path)
+		logrus.Error(err)
+		return err
+	}
+
+	logrus.Debugf(title+"- succeeded path=%s", path)
+	return nil
+}

vendor/github.com/Microsoft/hcsshim/internal/wclayer/deactivatelayer.go

@@ -0,0 +1,22 @@
+package wclayer
+
+import (
+	"github.com/Microsoft/hcsshim/internal/hcserror"
+	"github.com/sirupsen/logrus"
+)
+
+// DeactivateLayer will dismount a layer that was mounted via ActivateLayer.
+func DeactivateLayer(path string) error {
+	title := "hcsshim::DeactivateLayer "
+	logrus.Debugf(title+"path %s", path)
+
+	err := deactivateLayer(&stdDriverInfo, path)
+	if err != nil {
+		err = hcserror.Errorf(err, title, "path=%s", path)
+		logrus.Error(err)
+		return err
+	}
+
+	logrus.Debugf(title+"succeeded path=%s", path)
+	return nil
+}

vendor/github.com/Microsoft/hcsshim/internal/wclayer/destroylayer.go

@@ -0,0 +1,23 @@
+package wclayer
+
+import (
+	"github.com/Microsoft/hcsshim/internal/hcserror"
+	"github.com/sirupsen/logrus"
+)
+
+// DestroyLayer will remove the on-disk files representing the layer with the given
+// path, including that layer's containing folder, if any.
+func DestroyLayer(path string) error {
+	title := "hcsshim::DestroyLayer "
+	logrus.Debugf(title+"path %s", path)
+
+	err := destroyLayer(&stdDriverInfo, path)
+	if err != nil {
+		err = hcserror.Errorf(err, title, "path=%s", path)
+		logrus.Error(err)
+		return err
+	}
+
+	logrus.Debugf(title+"succeeded path=%s", path)
+	return nil
+}

vendor/github.com/Microsoft/hcsshim/internal/wclayer/expandscratchsize.go

@@ -0,0 +1,22 @@
+package wclayer
+
+import (
+	"github.com/Microsoft/hcsshim/internal/hcserror"
+	"github.com/sirupsen/logrus"
+)
+
+// ExpandScratchSize expands the size of a layer to at least size bytes.
+func ExpandScratchSize(path string, size uint64) error {
+	title := "hcsshim::ExpandScratchSize "
+	logrus.Debugf(title+"path=%s size=%d", path, size)
+
+	err := expandSandboxSize(&stdDriverInfo, path, size)
+	if err != nil {
+		err = hcserror.Errorf(err, title, "path=%s size=%d", path, size)
+		logrus.Error(err)
+		return err
+	}
+
+	logrus.Debugf(title+"- succeeded path=%s size=%d", path, size)
+	return nil
+}

vendor/github.com/Microsoft/hcsshim/internal/wclayer/exportlayer.go

@@ -0,0 +1,147 @@
+package wclayer
+
+import (
+	"io"
+	"io/ioutil"
+	"os"
+	"syscall"
+
+	"github.com/Microsoft/go-winio"
+	"github.com/Microsoft/hcsshim/internal/hcserror"
+	"github.com/Microsoft/hcsshim/internal/interop"
+	"github.com/sirupsen/logrus"
+)
+
+// ExportLayer will create a folder at exportFolderPath and fill that folder with
+// the transport format version of the layer identified by layerId. This transport
+// format includes any metadata required for later importing the layer (using
+// ImportLayer), and requires the full list of parent layer paths in order to
+// perform the export.
+func ExportLayer(path string, exportFolderPath string, parentLayerPaths []string) error {
+	title := "hcsshim::ExportLayer "
+	logrus.Debugf(title+"path %s folder %s", path, exportFolderPath)
+
+	// Generate layer descriptors
+	layers, err := layerPathsToDescriptors(parentLayerPaths)
+	if err != nil {
+		return err
+	}
+
+	err = exportLayer(&stdDriverInfo, path, exportFolderPath, layers)
+	if err != nil {
+		err = hcserror.Errorf(err, title, "path=%s folder=%s", path, exportFolderPath)
+		logrus.Error(err)
+		return err
+	}
+
+	logrus.Debugf(title+"succeeded path=%s folder=%s", path, exportFolderPath)
+	return nil
+}
+
+type LayerReader interface {
+	Next() (string, int64, *winio.FileBasicInfo, error)
+	Read(b []byte) (int, error)
+	Close() error
+}
+
+// FilterLayerReader provides an interface for extracting the contents of an on-disk layer.
+type FilterLayerReader struct {
+	context uintptr
+}
+
+// Next reads the next available file from a layer, ensuring that parent directories are always read
+// before child files and directories.
+//
+// Next returns the file's relative path, size, and basic file metadata. Read() should be used to
+// extract a Win32 backup stream with the remainder of the metadata and the data.
+func (r *FilterLayerReader) Next() (string, int64, *winio.FileBasicInfo, error) {
+	var fileNamep *uint16
+	fileInfo := &winio.FileBasicInfo{}
+	var deleted uint32
+	var fileSize int64
+	err := exportLayerNext(r.context, &fileNamep, fileInfo, &fileSize, &deleted)
+	if err != nil {
+		if err == syscall.ERROR_NO_MORE_FILES {
+			err = io.EOF
+		} else {
+			err = hcserror.New(err, "ExportLayerNext", "")
+		}
+		return "", 0, nil, err
+	}
+	fileName := interop.ConvertAndFreeCoTaskMemString(fileNamep)
+	if deleted != 0 {
+		fileInfo = nil
+	}
+	if fileName[0] == '\\' {
+		fileName = fileName[1:]
+	}
+	return fileName, fileSize, fileInfo, nil
+}
+
+// Read reads from the current file's Win32 backup stream.
+func (r *FilterLayerReader) Read(b []byte) (int, error) {
+	var bytesRead uint32
+	err := exportLayerRead(r.context, b, &bytesRead)
+	if err != nil {
+		return 0, hcserror.New(err, "ExportLayerRead", "")
+	}
+	if bytesRead == 0 {
+		return 0, io.EOF
+	}
+	return int(bytesRead), nil
+}
+
+// Close frees resources associated with the layer reader. It will return an
+// error if there was an error while reading the layer or of the layer was not
+// completely read.
+func (r *FilterLayerReader) Close() (err error) {
+	if r.context != 0 {
+		err = exportLayerEnd(r.context)
+		if err != nil {
+			err = hcserror.New(err, "ExportLayerEnd", "")
+		}
+		r.context = 0
+	}
+	return
+}
+
+// NewLayerReader returns a new layer reader for reading the contents of an on-disk layer.
+// The caller must have taken the SeBackupPrivilege privilege
+// to call this and any methods on the resulting LayerReader.
+func NewLayerReader(path string, parentLayerPaths []string) (LayerReader, error) {
+	if procExportLayerBegin.Find() != nil {
+		// The new layer reader is not available on this Windows build. Fall back to the
+		// legacy export code path.
+		exportPath, err := ioutil.TempDir("", "hcs")
+		if err != nil {
+			return nil, err
+		}
+		err = ExportLayer(path, exportPath, parentLayerPaths)
+		if err != nil {
+			os.RemoveAll(exportPath)
+			return nil, err
+		}
+		return &legacyLayerReaderWrapper{newLegacyLayerReader(exportPath)}, nil
+	}
+
+	layers, err := layerPathsToDescriptors(parentLayerPaths)
+	if err != nil {
+		return nil, err
+	}
+	r := &FilterLayerReader{}
+	err = exportLayerBegin(&stdDriverInfo, path, layers, &r.context)
+	if err != nil {
+		return nil, hcserror.New(err, "ExportLayerBegin", "")
+	}
+	return r, err
+}
+
+type legacyLayerReaderWrapper struct {
+	*legacyLayerReader
+}
+
+func (r *legacyLayerReaderWrapper) Close() error {
+	err := r.legacyLayerReader.Close()
+	os.RemoveAll(r.root)
+	return err
+}

vendor/github.com/Microsoft/hcsshim/internal/wclayer/getlayermountpath.go

@@ -0,0 +1,49 @@
+package wclayer
+
+import (
+	"syscall"
+
+	"github.com/Microsoft/hcsshim/internal/hcserror"
+	"github.com/sirupsen/logrus"
+)
+
+// GetLayerMountPath will look for a mounted layer with the given path and return
+// the path at which that layer can be accessed.  This path may be a volume path
+// if the layer is a mounted read-write layer, otherwise it is expected to be the
+// folder path at which the layer is stored.
+func GetLayerMountPath(path string) (string, error) {
+	title := "hcsshim::GetLayerMountPath "
+	logrus.Debugf(title+"path %s", path)
+
+	var mountPathLength uintptr
+	mountPathLength = 0
+
+	// Call the procedure itself.
+	logrus.Debugf("Calling proc (1)")
+	err := getLayerMountPath(&stdDriverInfo, path, &mountPathLength, nil)
+	if err != nil {
+		err = hcserror.Errorf(err, title, "(first call) path=%s", path)
+		logrus.Error(err)
+		return "", err
+	}
+
+	// Allocate a mount path of the returned length.
+	if mountPathLength == 0 {
+		return "", nil
+	}
+	mountPathp := make([]uint16, mountPathLength)
+	mountPathp[0] = 0
+
+	// Call the procedure again
+	logrus.Debugf("Calling proc (2)")
+	err = getLayerMountPath(&stdDriverInfo, path, &mountPathLength, &mountPathp[0])
+	if err != nil {
+		err = hcserror.Errorf(err, title, "(second call) path=%s", path)
+		logrus.Error(err)
+		return "", err
+	}
+
+	mountPath := syscall.UTF16ToString(mountPathp[0:])
+	logrus.Debugf(title+"succeeded path=%s mountPath=%s", path, mountPath)
+	return mountPath, nil
+}

vendor/github.com/Microsoft/hcsshim/internal/wclayer/getsharedbaseimages.go

@@ -0,0 +1,26 @@
+package wclayer
+
+import (
+	"github.com/Microsoft/hcsshim/internal/hcserror"
+	"github.com/Microsoft/hcsshim/internal/interop"
+	"github.com/sirupsen/logrus"
+)
+
+// GetSharedBaseImages will enumerate the images stored in the common central
+// image store and return descriptive info about those images for the purpose
+// of registering them with the graphdriver, graph, and tagstore.
+func GetSharedBaseImages() (imageData string, err error) {
+	title := "hcsshim::GetSharedBaseImages "
+
+	logrus.Debugf("Calling proc")
+	var buffer *uint16
+	err = getBaseImages(&buffer)
+	if err != nil {
+		err = hcserror.New(err, title, "")
+		logrus.Error(err)
+		return
+	}
+	imageData = interop.ConvertAndFreeCoTaskMemString(buffer)
+	logrus.Debugf(title+" - succeeded output=%s", imageData)
+	return
+}

vendor/github.com/Microsoft/hcsshim/internal/wclayer/grantvmaccess.go

@@ -0,0 +1,24 @@
+package wclayer
+
+import (
+	"fmt"
+
+	"github.com/Microsoft/hcsshim/internal/hcserror"
+	"github.com/sirupsen/logrus"
+)
+
+// GrantVmAccess adds access to a file for a given VM
+func GrantVmAccess(vmid string, filepath string) error {
+	title := fmt.Sprintf("hcsshim::GrantVmAccess id:%s path:%s ", vmid, filepath)
+	logrus.Debugf(title)
+
+	err := grantVmAccess(vmid, filepath)
+	if err != nil {
+		err = hcserror.Errorf(err, title, "path=%s", filepath)
+		logrus.Error(err)
+		return err
+	}
+
+	logrus.Debugf(title + " - succeeded")
+	return nil
+}

vendor/github.com/Microsoft/hcsshim/internal/wclayer/importlayer.go

@@ -0,0 +1,206 @@
+package wclayer
+
+import (
+	"errors"
+	"io/ioutil"
+	"os"
+	"path/filepath"
+
+	"github.com/Microsoft/go-winio"
+	"github.com/Microsoft/hcsshim/internal/hcserror"
+	"github.com/Microsoft/hcsshim/internal/safefile"
+	"github.com/sirupsen/logrus"
+)
+
+// ImportLayer will take the contents of the folder at importFolderPath and import
+// that into a layer with the id layerId.  Note that in order to correctly populate
+// the layer and interperet the transport format, all parent layers must already
+// be present on the system at the paths provided in parentLayerPaths.
+func ImportLayer(path string, importFolderPath string, parentLayerPaths []string) error {
+	title := "hcsshim::ImportLayer "
+	logrus.Debugf(title+"path %s folder %s", path, importFolderPath)
+
+	// Generate layer descriptors
+	layers, err := layerPathsToDescriptors(parentLayerPaths)
+	if err != nil {
+		return err
+	}
+
+	err = importLayer(&stdDriverInfo, path, importFolderPath, layers)
+	if err != nil {
+		err = hcserror.Errorf(err, title, "path=%s folder=%s", path, importFolderPath)
+		logrus.Error(err)
+		return err
+	}
+
+	logrus.Debugf(title+"succeeded path=%s folder=%s", path, importFolderPath)
+	return nil
+}
+
+// LayerWriter is an interface that supports writing a new container image layer.
+type LayerWriter interface {
+	// Add adds a file to the layer with given metadata.
+	Add(name string, fileInfo *winio.FileBasicInfo) error
+	// AddLink adds a hard link to the layer. The target must already have been added.
+	AddLink(name string, target string) error
+	// Remove removes a file that was present in a parent layer from the layer.
+	Remove(name string) error
+	// Write writes data to the current file. The data must be in the format of a Win32
+	// backup stream.
+	Write(b []byte) (int, error)
+	// Close finishes the layer writing process and releases any resources.
+	Close() error
+}
+
+// FilterLayerWriter provides an interface to write the contents of a layer to the file system.
+type FilterLayerWriter struct {
+	context uintptr
+}
+
+// Add adds a file or directory to the layer. The file's parent directory must have already been added.
+//
+// name contains the file's relative path. fileInfo contains file times and file attributes; the rest
+// of the file metadata and the file data must be written as a Win32 backup stream to the Write() method.
+// winio.BackupStreamWriter can be used to facilitate this.
+func (w *FilterLayerWriter) Add(name string, fileInfo *winio.FileBasicInfo) error {
+	if name[0] != '\\' {
+		name = `\` + name
+	}
+	err := importLayerNext(w.context, name, fileInfo)
+	if err != nil {
+		return hcserror.New(err, "ImportLayerNext", "")
+	}
+	return nil
+}
+
+// AddLink adds a hard link to the layer. The target of the link must have already been added.
+func (w *FilterLayerWriter) AddLink(name string, target string) error {
+	return errors.New("hard links not yet supported")
+}
+
+// Remove removes a file from the layer. The file must have been present in the parent layer.
+//
+// name contains the file's relative path.
+func (w *FilterLayerWriter) Remove(name string) error {
+	if name[0] != '\\' {
+		name = `\` + name
+	}
+	err := importLayerNext(w.context, name, nil)
+	if err != nil {
+		return hcserror.New(err, "ImportLayerNext", "")
+	}
+	return nil
+}
+
+// Write writes more backup stream data to the current file.
+func (w *FilterLayerWriter) Write(b []byte) (int, error) {
+	err := importLayerWrite(w.context, b)
+	if err != nil {
+		err = hcserror.New(err, "ImportLayerWrite", "")
+		return 0, err
+	}
+	return len(b), err
+}
+
+// Close completes the layer write operation. The error must be checked to ensure that the
+// operation was successful.
+func (w *FilterLayerWriter) Close() (err error) {
+	if w.context != 0 {
+		err = importLayerEnd(w.context)
+		if err != nil {
+			err = hcserror.New(err, "ImportLayerEnd", "")
+		}
+		w.context = 0
+	}
+	return
+}
+
+type legacyLayerWriterWrapper struct {
+	*legacyLayerWriter
+	path             string
+	parentLayerPaths []string
+}
+
+func (r *legacyLayerWriterWrapper) Close() error {
+	defer os.RemoveAll(r.root.Name())
+	defer r.legacyLayerWriter.CloseRoots()
+	err := r.legacyLayerWriter.Close()
+	if err != nil {
+		return err
+	}
+
+	if err = ImportLayer(r.destRoot.Name(), r.path, r.parentLayerPaths); err != nil {
+		return err
+	}
+	for _, name := range r.Tombstones {
+		if err = safefile.RemoveRelative(name, r.destRoot); err != nil && !os.IsNotExist(err) {
+			return err
+		}
+	}
+	// Add any hard links that were collected.
+	for _, lnk := range r.PendingLinks {
+		if err = safefile.RemoveRelative(lnk.Path, r.destRoot); err != nil && !os.IsNotExist(err) {
+			return err
+		}
+		if err = safefile.LinkRelative(lnk.Target, lnk.TargetRoot, lnk.Path, r.destRoot); err != nil {
+			return err
+		}
+	}
+	// Prepare the utility VM for use if one is present in the layer.
+	if r.HasUtilityVM {
+		err := safefile.EnsureNotReparsePointRelative("UtilityVM", r.destRoot)
+		if err != nil {
+			return err
+		}
+		err = ProcessUtilityVMImage(filepath.Join(r.destRoot.Name(), "UtilityVM"))
+		if err != nil {
+			return err
+		}
+	}
+	return nil
+}
+
+// NewLayerWriter returns a new layer writer for creating a layer on disk.
+// The caller must have taken the SeBackupPrivilege and SeRestorePrivilege privileges
+// to call this and any methods on the resulting LayerWriter.
+func NewLayerWriter(path string, parentLayerPaths []string) (LayerWriter, error) {
+	if len(parentLayerPaths) == 0 {
+		// This is a base layer. It gets imported differently.
+		f, err := safefile.OpenRoot(path)
+		if err != nil {
+			return nil, err
+		}
+		return &baseLayerWriter{
+			root: f,
+		}, nil
+	}
+
+	if procImportLayerBegin.Find() != nil {
+		// The new layer reader is not available on this Windows build. Fall back to the
+		// legacy export code path.
+		importPath, err := ioutil.TempDir("", "hcs")
+		if err != nil {
+			return nil, err
+		}
+		w, err := newLegacyLayerWriter(importPath, parentLayerPaths, path)
+		if err != nil {
+			return nil, err
+		}
+		return &legacyLayerWriterWrapper{
+			legacyLayerWriter: w,
+			path:              importPath,
+			parentLayerPaths:  parentLayerPaths,
+		}, nil
+	}
+	layers, err := layerPathsToDescriptors(parentLayerPaths)
+	if err != nil {
+		return nil, err
+	}
+
+	w := &FilterLayerWriter{}
+	err = importLayerBegin(&stdDriverInfo, path, layers, &w.context)
+	if err != nil {
+		return nil, hcserror.New(err, "ImportLayerStart", "")
+	}
+	return w, nil
+}

vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerexists.go

@@ -0,0 +1,25 @@
+package wclayer
+
+import (
+	"github.com/Microsoft/hcsshim/internal/hcserror"
+	"github.com/sirupsen/logrus"
+)
+
+// LayerExists will return true if a layer with the given id exists and is known
+// to the system.
+func LayerExists(path string) (bool, error) {
+	title := "hcsshim::LayerExists "
+	logrus.Debugf(title+"path %s", path)
+
+	// Call the procedure itself.
+	var exists uint32
+	err := layerExists(&stdDriverInfo, path, &exists)
+	if err != nil {
+		err = hcserror.Errorf(err, title, "path=%s", path)
+		logrus.Error(err)
+		return false, err
+	}
+
+	logrus.Debugf(title+"succeeded path=%s exists=%d", path, exists)
+	return exists != 0, nil
+}

vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerid.go

@@ -0,0 +1,13 @@
+package wclayer
+
+import (
+	"path/filepath"
+
+	"github.com/Microsoft/hcsshim/internal/guid"
+)
+
+// LayerID returns the layer ID of a layer on disk.
+func LayerID(path string) (guid.GUID, error) {
+	_, file := filepath.Split(path)
+	return NameToGuid(file)
+}

vendor/github.com/Microsoft/hcsshim/internal/wclayer/layerutils.go

@@ -0,0 +1,96 @@
+package wclayer
+
+// This file contains utility functions to support storage (graph) related
+// functionality.
+
+import (
+	"syscall"
+
+	"github.com/Microsoft/hcsshim/internal/guid"
+	"github.com/sirupsen/logrus"
+)
+
+/* To pass into syscall, we need a struct matching the following:
+enum GraphDriverType
+{
+    DiffDriver,
+    FilterDriver
+};
+
+struct DriverInfo {
+    GraphDriverType Flavour;
+    LPCWSTR HomeDir;
+};
+*/
+
+type driverInfo struct {
+	Flavour  int
+	HomeDirp *uint16
+}
+
+var (
+	utf16EmptyString uint16
+	stdDriverInfo    = driverInfo{1, &utf16EmptyString}
+)
+
+/* To pass into syscall, we need a struct matching the following:
+typedef struct _WC_LAYER_DESCRIPTOR {
+
+    //
+    // The ID of the layer
+    //
+
+    GUID LayerId;
+
+    //
+    // Additional flags
+    //
+
+    union {
+        struct {
+            ULONG Reserved : 31;
+            ULONG Dirty : 1;    // Created from sandbox as a result of snapshot
+        };
+        ULONG Value;
+    } Flags;
+
+    //
+    // Path to the layer root directory, null-terminated
+    //
+
+    PCWSTR Path;
+
+} WC_LAYER_DESCRIPTOR, *PWC_LAYER_DESCRIPTOR;
+*/
+type WC_LAYER_DESCRIPTOR struct {
+	LayerId guid.GUID
+	Flags   uint32
+	Pathp   *uint16
+}
+
+func layerPathsToDescriptors(parentLayerPaths []string) ([]WC_LAYER_DESCRIPTOR, error) {
+	// Array of descriptors that gets constructed.
+	var layers []WC_LAYER_DESCRIPTOR
+
+	for i := 0; i < len(parentLayerPaths); i++ {
+		g, err := LayerID(parentLayerPaths[i])
+		if err != nil {
+			logrus.Debugf("Failed to convert name to guid %s", err)
+			return nil, err
+		}
+
+		p, err := syscall.UTF16PtrFromString(parentLayerPaths[i])
+		if err != nil {
+			logrus.Debugf("Failed conversion of parentLayerPath to pointer %s", err)
+			return nil, err
+		}
+
+		layers = append(layers, WC_LAYER_DESCRIPTOR{
+			LayerId: g,
+			Flags:   0,
+			Pathp:   p,
+		})
+	}
+
+	return layers, nil
+}

vendor/github.com/Microsoft/hcsshim/internal/wclayer/legacy.go

@@ -0,0 +1,815 @@
+package wclayer
+
+import (
+	"bufio"
+	"encoding/binary"
+	"errors"
+	"fmt"
+	"io"
+	"io/ioutil"
+	"os"
+	"path/filepath"
+	"strings"
+	"syscall"
+
+	"github.com/Microsoft/go-winio"
+	"github.com/Microsoft/hcsshim/internal/longpath"
+	"github.com/Microsoft/hcsshim/internal/safefile"
+)
+
+var errorIterationCanceled = errors.New("")
+
+var mutatedUtilityVMFiles = map[string]bool{
+	`EFI\Microsoft\Boot\BCD`:      true,
+	`EFI\Microsoft\Boot\BCD.LOG`:  true,
+	`EFI\Microsoft\Boot\BCD.LOG1`: true,
+	`EFI\Microsoft\Boot\BCD.LOG2`: true,
+}
+
+const (
+	filesPath          = `Files`
+	hivesPath          = `Hives`
+	utilityVMPath      = `UtilityVM`
+	utilityVMFilesPath = `UtilityVM\Files`
+)
+
+func openFileOrDir(path string, mode uint32, createDisposition uint32) (file *os.File, err error) {
+	return winio.OpenForBackup(path, mode, syscall.FILE_SHARE_READ, createDisposition)
+}
+
+func hasPathPrefix(p, prefix string) bool {
+	return strings.HasPrefix(p, prefix) && len(p) > len(prefix) && p[len(prefix)] == '\\'
+}
+
+type fileEntry struct {
+	path string
+	fi   os.FileInfo
+	err  error
+}
+
+type legacyLayerReader struct {
+	root         string
+	result       chan *fileEntry
+	proceed      chan bool
+	currentFile  *os.File
+	backupReader *winio.BackupFileReader
+}
+
+// newLegacyLayerReader returns a new LayerReader that can read the Windows
+// container layer transport format from disk.
+func newLegacyLayerReader(root string) *legacyLayerReader {
+	r := &legacyLayerReader{
+		root:    root,
+		result:  make(chan *fileEntry),
+		proceed: make(chan bool),
+	}
+	go r.walk()
+	return r
+}
+
+func readTombstones(path string) (map[string]([]string), error) {
+	tf, err := os.Open(filepath.Join(path, "tombstones.txt"))
+	if err != nil {
+		return nil, err
+	}
+	defer tf.Close()
+	s := bufio.NewScanner(tf)
+	if !s.Scan() || s.Text() != "\xef\xbb\xbfVersion 1.0" {
+		return nil, errors.New("Invalid tombstones file")
+	}
+
+	ts := make(map[string]([]string))
+	for s.Scan() {
+		t := filepath.Join(filesPath, s.Text()[1:]) // skip leading `\`
+		dir := filepath.Dir(t)
+		ts[dir] = append(ts[dir], t)
+	}
+	if err = s.Err(); err != nil {
+		return nil, err
+	}
+
+	return ts, nil
+}
+
+func (r *legacyLayerReader) walkUntilCancelled() error {
+	root, err := longpath.LongAbs(r.root)
+	if err != nil {
+		return err
+	}
+
+	r.root = root
+	ts, err := readTombstones(r.root)
+	if err != nil {
+		return err
+	}
+
+	err = filepath.Walk(r.root, func(path string, info os.FileInfo, err error) error {
+		if err != nil {
+			return err
+		}
+
+		// Indirect fix for https://github.com/moby/moby/issues/32838#issuecomment-343610048.
+		// Handle failure from what may be a golang bug in the conversion of
+		// UTF16 to UTF8 in files which are left in the recycle bin. Os.Lstat
+		// which is called by filepath.Walk will fail when a filename contains
+		// unicode characters. Skip the recycle bin regardless which is goodness.
+		if strings.EqualFold(path, filepath.Join(r.root, `Files\$Recycle.Bin`)) && info.IsDir() {
+			return filepath.SkipDir
+		}
+
+		if path == r.root || path == filepath.Join(r.root, "tombstones.txt") || strings.HasSuffix(path, ".$wcidirs$") {
+			return nil
+		}
+
+		r.result <- &fileEntry{path, info, nil}
+		if !<-r.proceed {
+			return errorIterationCanceled
+		}
+
+		// List all the tombstones.
+		if info.IsDir() {
+			relPath, err := filepath.Rel(r.root, path)
+			if err != nil {
+				return err
+			}
+			if dts, ok := ts[relPath]; ok {
+				for _, t := range dts {
+					r.result <- &fileEntry{filepath.Join(r.root, t), nil, nil}
+					if !<-r.proceed {
+						return errorIterationCanceled
+					}
+				}
+			}
+		}
+		return nil
+	})
+	if err == errorIterationCanceled {
+		return nil
+	}
+	if err == nil {
+		return io.EOF
+	}
+	return err
+}
+
+func (r *legacyLayerReader) walk() {
+	defer close(r.result)
+	if !<-r.proceed {
+		return
+	}
+
+	err := r.walkUntilCancelled()
+	if err != nil {
+		for {
+			r.result <- &fileEntry{err: err}
+			if !<-r.proceed {
+				return
+			}
+		}
+	}
+}
+
+func (r *legacyLayerReader) reset() {
+	if r.backupReader != nil {
+		r.backupReader.Close()
+		r.backupReader = nil
+	}
+	if r.currentFile != nil {
+		r.currentFile.Close()
+		r.currentFile = nil
+	}
+}
+
+func findBackupStreamSize(r io.Reader) (int64, error) {
+	br := winio.NewBackupStreamReader(r)
+	for {
+		hdr, err := br.Next()
+		if err != nil {
+			if err == io.EOF {
+				err = nil
+			}
+			return 0, err
+		}
+		if hdr.Id == winio.BackupData {
+			return hdr.Size, nil
+		}
+	}
+}
+
+func (r *legacyLayerReader) Next() (path string, size int64, fileInfo *winio.FileBasicInfo, err error) {
+	r.reset()
+	r.proceed <- true
+	fe := <-r.result
+	if fe == nil {
+		err = errors.New("LegacyLayerReader closed")
+		return
+	}
+	if fe.err != nil {
+		err = fe.err
+		return
+	}
+
+	path, err = filepath.Rel(r.root, fe.path)
+	if err != nil {
+		return
+	}
+
+	if fe.fi == nil {
+		// This is a tombstone. Return a nil fileInfo.
+		return
+	}
+
+	if fe.fi.IsDir() && hasPathPrefix(path, filesPath) {
+		fe.path += ".$wcidirs$"
+	}
+
+	f, err := openFileOrDir(fe.path, syscall.GENERIC_READ, syscall.OPEN_EXISTING)
+	if err != nil {
+		return
+	}
+	defer func() {
+		if f != nil {
+			f.Close()
+		}
+	}()
+
+	fileInfo, err = winio.GetFileBasicInfo(f)
+	if err != nil {
+		return
+	}
+
+	if !hasPathPrefix(path, filesPath) {
+		size = fe.fi.Size()
+		r.backupReader = winio.NewBackupFileReader(f, false)
+		if path == hivesPath || path == filesPath {
+			// The Hives directory has a non-deterministic file time because of the
+			// nature of the import process. Use the times from System_Delta.
+			var g *os.File
+			g, err = os.Open(filepath.Join(r.root, hivesPath, `System_Delta`))
+			if err != nil {
+				return
+			}
+			attr := fileInfo.FileAttributes
+			fileInfo, err = winio.GetFileBasicInfo(g)
+			g.Close()
+			if err != nil {
+				return
+			}
+			fileInfo.FileAttributes = attr
+		}
+
+		// The creation time and access time get reset for files outside of the Files path.
+		fileInfo.CreationTime = fileInfo.LastWriteTime
+		fileInfo.LastAccessTime = fileInfo.LastWriteTime
+
+	} else {
+		// The file attributes are written before the backup stream.
+		var attr uint32
+		err = binary.Read(f, binary.LittleEndian, &attr)
+		if err != nil {
+			return
+		}
+		fileInfo.FileAttributes = attr
+		beginning := int64(4)
+
+		// Find the accurate file size.
+		if !fe.fi.IsDir() {
+			size, err = findBackupStreamSize(f)
+			if err != nil {
+				err = &os.PathError{Op: "findBackupStreamSize", Path: fe.path, Err: err}
+				return
+			}
+		}
+
+		// Return back to the beginning of the backup stream.
+		_, err = f.Seek(beginning, 0)
+		if err != nil {
+			return
+		}
+	}
+
+	r.currentFile = f
+	f = nil
+	return
+}
+
+func (r *legacyLayerReader) Read(b []byte) (int, error) {
+	if r.backupReader == nil {
+		if r.currentFile == nil {
+			return 0, io.EOF
+		}
+		return r.currentFile.Read(b)
+	}
+	return r.backupReader.Read(b)
+}
+
+func (r *legacyLayerReader) Seek(offset int64, whence int) (int64, error) {
+	if r.backupReader == nil {
+		if r.currentFile == nil {
+			return 0, errors.New("no current file")
+		}
+		return r.currentFile.Seek(offset, whence)
+	}
+	return 0, errors.New("seek not supported on this stream")
+}
+
+func (r *legacyLayerReader) Close() error {
+	r.proceed <- false
+	<-r.result
+	r.reset()
+	return nil
+}
+
+type pendingLink struct {
+	Path, Target string
+	TargetRoot   *os.File
+}
+
+type pendingDir struct {
+	Path string
+	Root *os.File
+}
+
+type legacyLayerWriter struct {
+	root            *os.File
+	destRoot        *os.File
+	parentRoots     []*os.File
+	currentFile     *os.File
+	bufWriter       *bufio.Writer
+	currentFileName string
+	currentFileRoot *os.File
+	backupWriter    *winio.BackupFileWriter
+	Tombstones      []string
+	HasUtilityVM    bool
+	uvmDi           []dirInfo
+	addedFiles      map[string]bool
+	PendingLinks    []pendingLink
+	pendingDirs     []pendingDir
+	currentIsDir    bool
+}
+
+// newLegacyLayerWriter returns a LayerWriter that can write the contaler layer
+// transport format to disk.
+func newLegacyLayerWriter(root string, parentRoots []string, destRoot string) (w *legacyLayerWriter, err error) {
+	w = &legacyLayerWriter{
+		addedFiles: make(map[string]bool),
+	}
+	defer func() {
+		if err != nil {
+			w.CloseRoots()
+			w = nil
+		}
+	}()
+	w.root, err = safefile.OpenRoot(root)
+	if err != nil {
+		return
+	}
+	w.destRoot, err = safefile.OpenRoot(destRoot)
+	if err != nil {
+		return
+	}
+	for _, r := range parentRoots {
+		f, err := safefile.OpenRoot(r)
+		if err != nil {
+			return w, err
+		}
+		w.parentRoots = append(w.parentRoots, f)
+	}
+	w.bufWriter = bufio.NewWriterSize(ioutil.Discard, 65536)
+	return
+}
+
+func (w *legacyLayerWriter) CloseRoots() {
+	if w.root != nil {
+		w.root.Close()
+		w.root = nil
+	}
+	if w.destRoot != nil {
+		w.destRoot.Close()
+		w.destRoot = nil
+	}
+	for i := range w.parentRoots {
+		w.parentRoots[i].Close()
+	}
+	w.parentRoots = nil
+}
+
+func (w *legacyLayerWriter) initUtilityVM() error {
+	if !w.HasUtilityVM {
+		err := safefile.MkdirRelative(utilityVMPath, w.destRoot)
+		if err != nil {
+			return err
+		}
+		// Server 2016 does not support multiple layers for the utility VM, so
+		// clone the utility VM from the parent layer into this layer. Use hard
+		// links to avoid unnecessary copying, since most of the files are
+		// immutable.
+		err = cloneTree(w.parentRoots[0], w.destRoot, utilityVMFilesPath, mutatedUtilityVMFiles)
+		if err != nil {
+			return fmt.Errorf("cloning the parent utility VM image failed: %s", err)
+		}
+		w.HasUtilityVM = true
+	}
+	return nil
+}
+
+func (w *legacyLayerWriter) reset() error {
+	err := w.bufWriter.Flush()
+	if err != nil {
+		return err
+	}
+	w.bufWriter.Reset(ioutil.Discard)
+	if w.currentIsDir {
+		r := w.currentFile
+		br := winio.NewBackupStreamReader(r)
+		// Seek to the beginning of the backup stream, skipping the fileattrs
+		if _, err := r.Seek(4, io.SeekStart); err != nil {
+			return err
+		}
+
+		for {
+			bhdr, err := br.Next()
+			if err == io.EOF {
+				// end of backupstream data
+				break
+			}
+			if err != nil {
+				return err
+			}
+			switch bhdr.Id {
+			case winio.BackupReparseData:
+				// The current file is a `.$wcidirs$` metadata file that
+				// describes a directory reparse point. Delete the placeholder
+				// directory to prevent future files being added into the
+				// destination of the reparse point during the ImportLayer call
+				if err := safefile.RemoveRelative(w.currentFileName, w.currentFileRoot); err != nil {
+					return err
+				}
+				w.pendingDirs = append(w.pendingDirs, pendingDir{Path: w.currentFileName, Root: w.currentFileRoot})
+			default:
+				// ignore all other stream types, as we only care about directory reparse points
+			}
+		}
+		w.currentIsDir = false
+	}
+	if w.backupWriter != nil {
+		w.backupWriter.Close()
+		w.backupWriter = nil
+	}
+	if w.currentFile != nil {
+		w.currentFile.Close()
+		w.currentFile = nil
+		w.currentFileName = ""
+		w.currentFileRoot = nil
+	}
+	return nil
+}
+
+// copyFileWithMetadata copies a file using the backup/restore APIs in order to preserve metadata
+func copyFileWithMetadata(srcRoot, destRoot *os.File, subPath string, isDir bool) (fileInfo *winio.FileBasicInfo, err error) {
+	src, err := safefile.OpenRelative(
+		subPath,
+		srcRoot,
+		syscall.GENERIC_READ|winio.ACCESS_SYSTEM_SECURITY,
+		syscall.FILE_SHARE_READ,
+		safefile.FILE_OPEN,
+		safefile.FILE_OPEN_REPARSE_POINT)
+	if err != nil {
+		return nil, err
+	}
+	defer src.Close()
+	srcr := winio.NewBackupFileReader(src, true)
+	defer srcr.Close()
+
+	fileInfo, err = winio.GetFileBasicInfo(src)
+	if err != nil {
+		return nil, err
+	}
+
+	extraFlags := uint32(0)
+	if isDir {
+		extraFlags |= safefile.FILE_DIRECTORY_FILE
+	}
+	dest, err := safefile.OpenRelative(
+		subPath,
+		destRoot,
+		syscall.GENERIC_READ|syscall.GENERIC_WRITE|winio.WRITE_DAC|winio.WRITE_OWNER|winio.ACCESS_SYSTEM_SECURITY,
+		syscall.FILE_SHARE_READ,
+		safefile.FILE_CREATE,
+		extraFlags)
+	if err != nil {
+		return nil, err
+	}
+	defer dest.Close()
+
+	err = winio.SetFileBasicInfo(dest, fileInfo)
+	if err != nil {
+		return nil, err
+	}
+
+	destw := winio.NewBackupFileWriter(dest, true)
+	defer func() {
+		cerr := destw.Close()
+		if err == nil {
+			err = cerr
+		}
+	}()
+
+	_, err = io.Copy(destw, srcr)
+	if err != nil {
+		return nil, err
+	}
+
+	return fileInfo, nil
+}
+
+// cloneTree clones a directory tree using hard links. It skips hard links for
+// the file names in the provided map and just copies those files.
+func cloneTree(srcRoot *os.File, destRoot *os.File, subPath string, mutatedFiles map[string]bool) error {
+	var di []dirInfo
+	err := safefile.EnsureNotReparsePointRelative(subPath, srcRoot)
+	if err != nil {
+		return err
+	}
+	err = filepath.Walk(filepath.Join(srcRoot.Name(), subPath), func(srcFilePath string, info os.FileInfo, err error) error {
+		if err != nil {
+			return err
+		}
+
+		relPath, err := filepath.Rel(srcRoot.Name(), srcFilePath)
+		if err != nil {
+			return err
+		}
+
+		fileAttributes := info.Sys().(*syscall.Win32FileAttributeData).FileAttributes
+		// Directories, reparse points, and files that will be mutated during
+		// utility VM import must be copied. All other files can be hard linked.
+		isReparsePoint := fileAttributes&syscall.FILE_ATTRIBUTE_REPARSE_POINT != 0
+		// In go1.9, FileInfo.IsDir() returns false if the directory is also a symlink.
+		// See: https://github.com/golang/go/commit/1989921aef60c83e6f9127a8448fb5ede10e9acc
+		// Fixes the problem by checking syscall.FILE_ATTRIBUTE_DIRECTORY directly
+		isDir := fileAttributes&syscall.FILE_ATTRIBUTE_DIRECTORY != 0
+
+		if isDir || isReparsePoint || mutatedFiles[relPath] {
+			fi, err := copyFileWithMetadata(srcRoot, destRoot, relPath, isDir)
+			if err != nil {
+				return err
+			}
+			if isDir && !isReparsePoint {
+				di = append(di, dirInfo{path: relPath, fileInfo: *fi})
+			}
+		} else {
+			err = safefile.LinkRelative(relPath, srcRoot, relPath, destRoot)
+			if err != nil {
+				return err
+			}
+		}
+
+		return nil
+	})
+	if err != nil {
+		return err
+	}
+
+	return reapplyDirectoryTimes(destRoot, di)
+}
+
+func (w *legacyLayerWriter) Add(name string, fileInfo *winio.FileBasicInfo) error {
+	if err := w.reset(); err != nil {
+		return err
+	}
+
+	if name == utilityVMPath {
+		return w.initUtilityVM()
+	}
+
+	name = filepath.Clean(name)
+	if hasPathPrefix(name, utilityVMPath) {
+		if !w.HasUtilityVM {
+			return errors.New("missing UtilityVM directory")
+		}
+		if !hasPathPrefix(name, utilityVMFilesPath) && name != utilityVMFilesPath {
+			return errors.New("invalid UtilityVM layer")
+		}
+		createDisposition := uint32(safefile.FILE_OPEN)
+		if (fileInfo.FileAttributes & syscall.FILE_ATTRIBUTE_DIRECTORY) != 0 {
+			st, err := safefile.LstatRelative(name, w.destRoot)
+			if err != nil && !os.IsNotExist(err) {
+				return err
+			}
+			if st != nil {
+				// Delete the existing file/directory if it is not the same type as this directory.
+				existingAttr := st.Sys().(*syscall.Win32FileAttributeData).FileAttributes
+				if (uint32(fileInfo.FileAttributes)^existingAttr)&(syscall.FILE_ATTRIBUTE_DIRECTORY|syscall.FILE_ATTRIBUTE_REPARSE_POINT) != 0 {
+					if err = safefile.RemoveAllRelative(name, w.destRoot); err != nil {
+						return err
+					}
+					st = nil
+				}
+			}
+			if st == nil {
+				if err = safefile.MkdirRelative(name, w.destRoot); err != nil {
+					return err
+				}
+			}
+			if fileInfo.FileAttributes&syscall.FILE_ATTRIBUTE_REPARSE_POINT == 0 {
+				w.uvmDi = append(w.uvmDi, dirInfo{path: name, fileInfo: *fileInfo})
+			}
+		} else {
+			// Overwrite any existing hard link.
+			err := safefile.RemoveRelative(name, w.destRoot)
+			if err != nil && !os.IsNotExist(err) {
+				return err
+			}
+			createDisposition = safefile.FILE_CREATE
+		}
+
+		f, err := safefile.OpenRelative(
+			name,
+			w.destRoot,
+			syscall.GENERIC_READ|syscall.GENERIC_WRITE|winio.WRITE_DAC|winio.WRITE_OWNER|winio.ACCESS_SYSTEM_SECURITY,
+			syscall.FILE_SHARE_READ,
+			createDisposition,
+			safefile.FILE_OPEN_REPARSE_POINT,
+		)
+		if err != nil {
+			return err
+		}
+		defer func() {
+			if f != nil {
+				f.Close()
+				safefile.RemoveRelative(name, w.destRoot)
+			}
+		}()
+
+		err = winio.SetFileBasicInfo(f, fileInfo)
+		if err != nil {
+			return err
+		}
+
+		w.backupWriter = winio.NewBackupFileWriter(f, true)
+		w.bufWriter.Reset(w.backupWriter)
+		w.currentFile = f
+		w.currentFileName = name
+		w.currentFileRoot = w.destRoot
+		w.addedFiles[name] = true
+		f = nil
+		return nil
+	}
+
+	fname := name
+	if (fileInfo.FileAttributes & syscall.FILE_ATTRIBUTE_DIRECTORY) != 0 {
+		err := safefile.MkdirRelative(name, w.root)
+		if err != nil {
+			return err
+		}
+		fname += ".$wcidirs$"
+		w.currentIsDir = true
+	}
+
+	f, err := safefile.OpenRelative(fname, w.root, syscall.GENERIC_READ|syscall.GENERIC_WRITE, syscall.FILE_SHARE_READ, safefile.FILE_CREATE, 0)
+	if err != nil {
+		return err
+	}
+	defer func() {
+		if f != nil {
+			f.Close()
+			safefile.RemoveRelative(fname, w.root)
+		}
+	}()
+
+	strippedFi := *fileInfo
+	strippedFi.FileAttributes = 0
+	err = winio.SetFileBasicInfo(f, &strippedFi)
+	if err != nil {
+		return err
+	}
+
+	if hasPathPrefix(name, hivesPath) {
+		w.backupWriter = winio.NewBackupFileWriter(f, false)
+		w.bufWriter.Reset(w.backupWriter)
+	} else {
+		w.bufWriter.Reset(f)
+		// The file attributes are written before the stream.
+		err = binary.Write(w.bufWriter, binary.LittleEndian, uint32(fileInfo.FileAttributes))
+		if err != nil {
+			w.bufWriter.Reset(ioutil.Discard)
+			return err
+		}
+	}
+
+	w.currentFile = f
+	w.currentFileName = name
+	w.currentFileRoot = w.root
+	w.addedFiles[name] = true
+	f = nil
+	return nil
+}
+
+func (w *legacyLayerWriter) AddLink(name string, target string) error {
+	if err := w.reset(); err != nil {
+		return err
+	}
+
+	target = filepath.Clean(target)
+	var roots []*os.File
+	if hasPathPrefix(target, filesPath) {
+		// Look for cross-layer hard link targets in the parent layers, since
+		// nothing is in the destination path yet.
+		roots = w.parentRoots
+	} else if hasPathPrefix(target, utilityVMFilesPath) {
+		// Since the utility VM is fully cloned into the destination path
+		// already, look for cross-layer hard link targets directly in the
+		// destination path.
+		roots = []*os.File{w.destRoot}
+	}
+
+	if roots == nil || (!hasPathPrefix(name, filesPath) && !hasPathPrefix(name, utilityVMFilesPath)) {
+		return errors.New("invalid hard link in layer")
+	}
+
+	// Find to try the target of the link in a previously added file. If that
+	// fails, search in parent layers.
+	var selectedRoot *os.File
+	if _, ok := w.addedFiles[target]; ok {
+		selectedRoot = w.destRoot
+	} else {
+		for _, r := range roots {
+			if _, err := safefile.LstatRelative(target, r); err != nil {
+				if !os.IsNotExist(err) {
+					return err
+				}
+			} else {
+				selectedRoot = r
+				break
+			}
+		}
+		if selectedRoot == nil {
+			return fmt.Errorf("failed to find link target for '%s' -> '%s'", name, target)
+		}
+	}
+
+	// The link can't be written until after the ImportLayer call.
+	w.PendingLinks = append(w.PendingLinks, pendingLink{
+		Path:       name,
+		Target:     target,
+		TargetRoot: selectedRoot,
+	})
+	w.addedFiles[name] = true
+	return nil
+}
+
+func (w *legacyLayerWriter) Remove(name string) error {
+	name = filepath.Clean(name)
+	if hasPathPrefix(name, filesPath) {
+		w.Tombstones = append(w.Tombstones, name)
+	} else if hasPathPrefix(name, utilityVMFilesPath) {
+		err := w.initUtilityVM()
+		if err != nil {
+			return err
+		}
+		// Make sure the path exists; os.RemoveAll will not fail if the file is
+		// already gone, and this needs to be a fatal error for diagnostics
+		// purposes.
+		if _, err := safefile.LstatRelative(name, w.destRoot); err != nil {
+			return err
+		}
+		err = safefile.RemoveAllRelative(name, w.destRoot)
+		if err != nil {
+			return err
+		}
+	} else {
+		return fmt.Errorf("invalid tombstone %s", name)
+	}
+
+	return nil
+}
+
+func (w *legacyLayerWriter) Write(b []byte) (int, error) {
+	if w.backupWriter == nil && w.currentFile == nil {
+		return 0, errors.New("closed")
+	}
+	return w.bufWriter.Write(b)
+}
+
+func (w *legacyLayerWriter) Close() error {
+	if err := w.reset(); err != nil {
+		return err
+	}
+	if err := safefile.RemoveRelative("tombstones.txt", w.root); err != nil && !os.IsNotExist(err) {
+		return err
+	}
+	for _, pd := range w.pendingDirs {
+		err := safefile.MkdirRelative(pd.Path, pd.Root)
+		if err != nil {
+			return err
+		}
+	}
+	if w.HasUtilityVM {
+		err := reapplyDirectoryTimes(w.destRoot, w.uvmDi)
+		if err != nil {
+			return err
+		}
+	}
+	return nil
+}

vendor/github.com/Microsoft/hcsshim/internal/wclayer/nametoguid.go

@@ -0,0 +1,24 @@
+package wclayer
+
+import (
+	"github.com/Microsoft/hcsshim/internal/guid"
+	"github.com/Microsoft/hcsshim/internal/hcserror"
+	"github.com/sirupsen/logrus"
+)
+
+// NameToGuid converts the given string into a GUID using the algorithm in the
+// Host Compute Service, ensuring GUIDs generated with the same string are common
+// across all clients.
+func NameToGuid(name string) (id guid.GUID, err error) {
+	title := "hcsshim::NameToGuid "
+
+	err = nameToGuid(name, &id)
+	if err != nil {
+		err = hcserror.Errorf(err, title, "name=%s", name)
+		logrus.Error(err)
+		return
+	}
+
+	logrus.Debugf(title+"name:%s guid:%s", name, id.String())
+	return
+}

vendor/github.com/Microsoft/hcsshim/internal/wclayer/preparelayer.go

@@ -0,0 +1,40 @@
+package wclayer
+
+import (
+	"sync"
+
+	"github.com/Microsoft/hcsshim/internal/hcserror"
+	"github.com/sirupsen/logrus"
+)
+
+var prepareLayerLock sync.Mutex
+
+// PrepareLayer finds a mounted read-write layer matching path and enables the
+// the filesystem filter for use on that layer.  This requires the paths to all
+// parent layers, and is necessary in order to view or interact with the layer
+// as an actual filesystem (reading and writing files, creating directories, etc).
+// Disabling the filter must be done via UnprepareLayer.
+func PrepareLayer(path string, parentLayerPaths []string) error {
+	title := "hcsshim::PrepareLayer "
+	logrus.Debugf(title+"path %s", path)
+
+	// Generate layer descriptors
+	layers, err := layerPathsToDescriptors(parentLayerPaths)
+	if err != nil {
+		return err
+	}
+
+	// This lock is a temporary workaround for a Windows bug. Only allowing one
+	// call to prepareLayer at a time vastly reduces the chance of a timeout.
+	prepareLayerLock.Lock()
+	defer prepareLayerLock.Unlock()
+	err = prepareLayer(&stdDriverInfo, path, layers)
+	if err != nil {
+		err = hcserror.Errorf(err, title, "path=%s", path)
+		logrus.Error(err)
+		return err
+	}
+
+	logrus.Debugf(title+"succeeded path=%s", path)
+	return nil
+}