Update Vendor

(*) github.com/Microsoft/hcsshim
    (*) golang.org/x/sys
    (*) github.com/x/cyrpto
    (*) github.com/sirupsen/logrus
    (*) github.com/Microsoft/go-winio
    (*) github.com/juju/errors
    (*) github.com/buger/jsonparser
This commit is contained in:
MaiWJ
2018-08-23 11:46:58 +08:00
parent 35b87a34db
commit e1d29e9fe4
400 changed files with 84213 additions and 27920 deletions

2
.gitignore vendored
View File

@@ -26,5 +26,5 @@ _testmain.go
bin/
gopath/
.vagrant
.idea
/release-*

96
Godeps/Godeps.json generated
View File

@@ -6,10 +6,79 @@
"./..."
],
"Deps": [
{
"ImportPath": "github.com/Microsoft/go-winio",
"Comment": "v0.4.11",
"Rev": "97e4973ce50b2ff5f09635a57e2b88a037aae829"
},
{
"ImportPath": "github.com/Microsoft/hcsshim",
"Comment": "v0.7.4",
"Rev": "e44e499d29527b244d6858772f1b9090eeaddc4e"
},
{
"ImportPath": "github.com/Microsoft/hcsshim/internal/guid",
"Comment": "v0.7.4",
"Rev": "e44e499d29527b244d6858772f1b9090eeaddc4e"
},
{
"ImportPath": "github.com/Microsoft/hcsshim/internal/hcs",
"Comment": "v0.7.4",
"Rev": "e44e499d29527b244d6858772f1b9090eeaddc4e"
},
{
"ImportPath": "github.com/Microsoft/hcsshim/internal/hcserror",
"Comment": "v0.7.4",
"Rev": "e44e499d29527b244d6858772f1b9090eeaddc4e"
},
{
"ImportPath": "github.com/Microsoft/hcsshim/internal/hns",
"Comment": "v0.7.4",
"Rev": "e44e499d29527b244d6858772f1b9090eeaddc4e"
},
{
"ImportPath": "github.com/Microsoft/hcsshim/internal/interop",
"Comment": "v0.7.4",
"Rev": "e44e499d29527b244d6858772f1b9090eeaddc4e"
},
{
"ImportPath": "github.com/Microsoft/hcsshim/internal/longpath",
"Comment": "v0.7.4",
"Rev": "e44e499d29527b244d6858772f1b9090eeaddc4e"
},
{
"ImportPath": "github.com/Microsoft/hcsshim/internal/mergemaps",
"Comment": "v0.7.4",
"Rev": "e44e499d29527b244d6858772f1b9090eeaddc4e"
},
{
"ImportPath": "github.com/Microsoft/hcsshim/internal/safefile",
"Comment": "v0.7.4",
"Rev": "e44e499d29527b244d6858772f1b9090eeaddc4e"
},
{
"ImportPath": "github.com/Microsoft/hcsshim/internal/schema1",
"Comment": "v0.7.4",
"Rev": "e44e499d29527b244d6858772f1b9090eeaddc4e"
},
{
"ImportPath": "github.com/Microsoft/hcsshim/internal/timeout",
"Comment": "v0.7.4",
"Rev": "e44e499d29527b244d6858772f1b9090eeaddc4e"
},
{
"ImportPath": "github.com/Microsoft/hcsshim/internal/wclayer",
"Comment": "v0.7.4",
"Rev": "e44e499d29527b244d6858772f1b9090eeaddc4e"
},
{
"ImportPath": "github.com/alexflint/go-filemutex",
"Rev": "72bdc8eae2aef913234599b837f5dda445ca9bd9"
},
{
"ImportPath": "github.com/buger/jsonparser",
"Rev": "f4dd9f5a6b441265aefc1d44872a6f8c10f42b37"
},
{
"ImportPath": "github.com/containernetworking/cni/libcni",
"Comment": "v0.7.0-alpha1",
@@ -67,10 +136,22 @@
"ImportPath": "github.com/d2g/dhcp4server",
"Rev": "1b74244053681c90de5cf1af3d6b5c93b74e3abb"
},
{
"ImportPath": "github.com/d2g/dhcp4server/leasepool",
"Rev": "1b74244053681c90de5cf1af3d6b5c93b74e3abb"
},
{
"ImportPath": "github.com/d2g/dhcp4server/leasepool/memorypool",
"Rev": "1b74244053681c90de5cf1af3d6b5c93b74e3abb"
},
{
"ImportPath": "github.com/j-keck/arping",
"Rev": "2cf9dc699c5640a7e2c81403a44127bf28033600"
},
{
"ImportPath": "github.com/juju/errors",
"Rev": "22422dad46e14561a0854ad42497a75af9b61909"
},
{
"ImportPath": "github.com/mattn/go-shellwords",
"Comment": "v1.0.3",
@@ -230,6 +311,11 @@
"ImportPath": "github.com/safchain/ethtool",
"Rev": "7ff1ba29eca231991280817541cb3903f6be15d1"
},
{
"ImportPath": "github.com/sirupsen/logrus",
"Comment": "v1.0.6",
"Rev": "3e01752db0189b9157070a0e1668a620f9a85da2"
},
{
"ImportPath": "github.com/vishvananda/netlink",
"Rev": "6e453822d85ef5721799774b654d4d02fed62afb"
@@ -242,6 +328,10 @@
"ImportPath": "github.com/vishvananda/netns",
"Rev": "54f0e4339ce73702a0607f49922aaa1e749b418d"
},
{
"ImportPath": "golang.org/x/crypto/ssh/terminal",
"Rev": "94eea52f7b742c7cbe0b03b22f0c4c8631ece122"
},
{
"ImportPath": "golang.org/x/net/bpf",
"Rev": "e90d6d0afc4c315a0d87a568ae68577cc15149a0"
@@ -256,7 +346,11 @@
},
{
"ImportPath": "golang.org/x/sys/unix",
"Rev": "076b546753157f758b316e59bcb51e6807c04057"
"Rev": "d5840adf789d732bc8b00f37b26ca956a7cc8e79"
},
{
"ImportPath": "golang.org/x/sys/windows",
"Rev": "d5840adf789d732bc8b00f37b26ca956a7cc8e79"
}
]
}

1
vendor/github.com/Microsoft/go-winio/.gitignore generated vendored Normal file
View File

@@ -0,0 +1 @@
*.exe

22
vendor/github.com/Microsoft/go-winio/LICENSE generated vendored Normal file
View File

@@ -0,0 +1,22 @@
The MIT License (MIT)
Copyright (c) 2015 Microsoft
Permission is hereby granted, free of charge, to any person obtaining a copy
of this software and associated documentation files (the "Software"), to deal
in the Software without restriction, including without limitation the rights
to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
copies of the Software, and to permit persons to whom the Software is
furnished to do so, subject to the following conditions:
The above copyright notice and this permission notice shall be included in all
copies or substantial portions of the Software.
THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
SOFTWARE.

22
vendor/github.com/Microsoft/go-winio/README.md generated vendored Normal file
View File

@@ -0,0 +1,22 @@
# go-winio
This repository contains utilities for efficiently performing Win32 IO operations in
Go. Currently, this is focused on accessing named pipes and other file handles, and
for using named pipes as a net transport.
This code relies on IO completion ports to avoid blocking IO on system threads, allowing Go
to reuse the thread to schedule another goroutine. This limits support to Windows Vista and
newer operating systems. This is similar to the implementation of network sockets in Go's net
package.
Please see the LICENSE file for licensing information.
This project has adopted the [Microsoft Open Source Code of
Conduct](https://opensource.microsoft.com/codeofconduct/). For more information
see the [Code of Conduct
FAQ](https://opensource.microsoft.com/codeofconduct/faq/) or contact
[opencode@microsoft.com](mailto:opencode@microsoft.com) with any additional
questions or comments.
Thanks to natefinch for the inspiration for this library. See https://github.com/natefinch/npipe
for another named pipe implementation.

280
vendor/github.com/Microsoft/go-winio/backup.go generated vendored Normal file
View File

@@ -0,0 +1,280 @@
// +build windows
package winio
import (
"encoding/binary"
"errors"
"fmt"
"io"
"io/ioutil"
"os"
"runtime"
"syscall"
"unicode/utf16"
)
//sys backupRead(h syscall.Handle, b []byte, bytesRead *uint32, abort bool, processSecurity bool, context *uintptr) (err error) = BackupRead
//sys backupWrite(h syscall.Handle, b []byte, bytesWritten *uint32, abort bool, processSecurity bool, context *uintptr) (err error) = BackupWrite
const (
BackupData = uint32(iota + 1)
BackupEaData
BackupSecurity
BackupAlternateData
BackupLink
BackupPropertyData
BackupObjectId
BackupReparseData
BackupSparseBlock
BackupTxfsData
)
const (
StreamSparseAttributes = uint32(8)
)
const (
WRITE_DAC = 0x40000
WRITE_OWNER = 0x80000
ACCESS_SYSTEM_SECURITY = 0x1000000
)
// BackupHeader represents a backup stream of a file.
type BackupHeader struct {
Id uint32 // The backup stream ID
Attributes uint32 // Stream attributes
Size int64 // The size of the stream in bytes
Name string // The name of the stream (for BackupAlternateData only).
Offset int64 // The offset of the stream in the file (for BackupSparseBlock only).
}
type win32StreamId struct {
StreamId uint32
Attributes uint32
Size uint64
NameSize uint32
}
// BackupStreamReader reads from a stream produced by the BackupRead Win32 API and produces a series
// of BackupHeader values.
type BackupStreamReader struct {
r io.Reader
bytesLeft int64
}
// NewBackupStreamReader produces a BackupStreamReader from any io.Reader.
func NewBackupStreamReader(r io.Reader) *BackupStreamReader {
return &BackupStreamReader{r, 0}
}
// Next returns the next backup stream and prepares for calls to Read(). It skips the remainder of the current stream if
// it was not completely read.
func (r *BackupStreamReader) Next() (*BackupHeader, error) {
if r.bytesLeft > 0 {
if s, ok := r.r.(io.Seeker); ok {
// Make sure Seek on io.SeekCurrent sometimes succeeds
// before trying the actual seek.
if _, err := s.Seek(0, io.SeekCurrent); err == nil {
if _, err = s.Seek(r.bytesLeft, io.SeekCurrent); err != nil {
return nil, err
}
r.bytesLeft = 0
}
}
if _, err := io.Copy(ioutil.Discard, r); err != nil {
return nil, err
}
}
var wsi win32StreamId
if err := binary.Read(r.r, binary.LittleEndian, &wsi); err != nil {
return nil, err
}
hdr := &BackupHeader{
Id: wsi.StreamId,
Attributes: wsi.Attributes,
Size: int64(wsi.Size),
}
if wsi.NameSize != 0 {
name := make([]uint16, int(wsi.NameSize/2))
if err := binary.Read(r.r, binary.LittleEndian, name); err != nil {
return nil, err
}
hdr.Name = syscall.UTF16ToString(name)
}
if wsi.StreamId == BackupSparseBlock {
if err := binary.Read(r.r, binary.LittleEndian, &hdr.Offset); err != nil {
return nil, err
}
hdr.Size -= 8
}
r.bytesLeft = hdr.Size
return hdr, nil
}
// Read reads from the current backup stream.
func (r *BackupStreamReader) Read(b []byte) (int, error) {
if r.bytesLeft == 0 {
return 0, io.EOF
}
if int64(len(b)) > r.bytesLeft {
b = b[:r.bytesLeft]
}
n, err := r.r.Read(b)
r.bytesLeft -= int64(n)
if err == io.EOF {
err = io.ErrUnexpectedEOF
} else if r.bytesLeft == 0 && err == nil {
err = io.EOF
}
return n, err
}
// BackupStreamWriter writes a stream compatible with the BackupWrite Win32 API.
type BackupStreamWriter struct {
w io.Writer
bytesLeft int64
}
// NewBackupStreamWriter produces a BackupStreamWriter on top of an io.Writer.
func NewBackupStreamWriter(w io.Writer) *BackupStreamWriter {
return &BackupStreamWriter{w, 0}
}
// WriteHeader writes the next backup stream header and prepares for calls to Write().
func (w *BackupStreamWriter) WriteHeader(hdr *BackupHeader) error {
if w.bytesLeft != 0 {
return fmt.Errorf("missing %d bytes", w.bytesLeft)
}
name := utf16.Encode([]rune(hdr.Name))
wsi := win32StreamId{
StreamId: hdr.Id,
Attributes: hdr.Attributes,
Size: uint64(hdr.Size),
NameSize: uint32(len(name) * 2),
}
if hdr.Id == BackupSparseBlock {
// Include space for the int64 block offset
wsi.Size += 8
}
if err := binary.Write(w.w, binary.LittleEndian, &wsi); err != nil {
return err
}
if len(name) != 0 {
if err := binary.Write(w.w, binary.LittleEndian, name); err != nil {
return err
}
}
if hdr.Id == BackupSparseBlock {
if err := binary.Write(w.w, binary.LittleEndian, hdr.Offset); err != nil {
return err
}
}
w.bytesLeft = hdr.Size
return nil
}
// Write writes to the current backup stream.
func (w *BackupStreamWriter) Write(b []byte) (int, error) {
if w.bytesLeft < int64(len(b)) {
return 0, fmt.Errorf("too many bytes by %d", int64(len(b))-w.bytesLeft)
}
n, err := w.w.Write(b)
w.bytesLeft -= int64(n)
return n, err
}
// BackupFileReader provides an io.ReadCloser interface on top of the BackupRead Win32 API.
type BackupFileReader struct {
f *os.File
includeSecurity bool
ctx uintptr
}
// NewBackupFileReader returns a new BackupFileReader from a file handle. If includeSecurity is true,
// Read will attempt to read the security descriptor of the file.
func NewBackupFileReader(f *os.File, includeSecurity bool) *BackupFileReader {
r := &BackupFileReader{f, includeSecurity, 0}
return r
}
// Read reads a backup stream from the file by calling the Win32 API BackupRead().
func (r *BackupFileReader) Read(b []byte) (int, error) {
var bytesRead uint32
err := backupRead(syscall.Handle(r.f.Fd()), b, &bytesRead, false, r.includeSecurity, &r.ctx)
if err != nil {
return 0, &os.PathError{"BackupRead", r.f.Name(), err}
}
runtime.KeepAlive(r.f)
if bytesRead == 0 {
return 0, io.EOF
}
return int(bytesRead), nil
}
// Close frees Win32 resources associated with the BackupFileReader. It does not close
// the underlying file.
func (r *BackupFileReader) Close() error {
if r.ctx != 0 {
backupRead(syscall.Handle(r.f.Fd()), nil, nil, true, false, &r.ctx)
runtime.KeepAlive(r.f)
r.ctx = 0
}
return nil
}
// BackupFileWriter provides an io.WriteCloser interface on top of the BackupWrite Win32 API.
type BackupFileWriter struct {
f *os.File
includeSecurity bool
ctx uintptr
}
// NewBackupFileWriter returns a new BackupFileWriter from a file handle. If includeSecurity is true,
// Write() will attempt to restore the security descriptor from the stream.
func NewBackupFileWriter(f *os.File, includeSecurity bool) *BackupFileWriter {
w := &BackupFileWriter{f, includeSecurity, 0}
return w
}
// Write restores a portion of the file using the provided backup stream.
func (w *BackupFileWriter) Write(b []byte) (int, error) {
var bytesWritten uint32
err := backupWrite(syscall.Handle(w.f.Fd()), b, &bytesWritten, false, w.includeSecurity, &w.ctx)
if err != nil {
return 0, &os.PathError{"BackupWrite", w.f.Name(), err}
}
runtime.KeepAlive(w.f)
if int(bytesWritten) != len(b) {
return int(bytesWritten), errors.New("not all bytes could be written")
}
return len(b), nil
}
// Close frees Win32 resources associated with the BackupFileWriter. It does not
// close the underlying file.
func (w *BackupFileWriter) Close() error {
if w.ctx != 0 {
backupWrite(syscall.Handle(w.f.Fd()), nil, nil, true, false, &w.ctx)
runtime.KeepAlive(w.f)
w.ctx = 0
}
return nil
}
// OpenForBackup opens a file or directory, potentially skipping access checks if the backup
// or restore privileges have been acquired.
//
// If the file opened was a directory, it cannot be used with Readdir().
func OpenForBackup(path string, access uint32, share uint32, createmode uint32) (*os.File, error) {
winPath, err := syscall.UTF16FromString(path)
if err != nil {
return nil, err
}
h, err := syscall.CreateFile(&winPath[0], access, share, nil, createmode, syscall.FILE_FLAG_BACKUP_SEMANTICS|syscall.FILE_FLAG_OPEN_REPARSE_POINT, 0)
if err != nil {
err = &os.PathError{Op: "open", Path: path, Err: err}
return nil, err
}
return os.NewFile(uintptr(h), path), nil
}

137
vendor/github.com/Microsoft/go-winio/ea.go generated vendored Normal file
View File

@@ -0,0 +1,137 @@
package winio
import (
"bytes"
"encoding/binary"
"errors"
)
type fileFullEaInformation struct {
NextEntryOffset uint32
Flags uint8
NameLength uint8
ValueLength uint16
}
var (
fileFullEaInformationSize = binary.Size(&fileFullEaInformation{})
errInvalidEaBuffer = errors.New("invalid extended attribute buffer")
errEaNameTooLarge = errors.New("extended attribute name too large")
errEaValueTooLarge = errors.New("extended attribute value too large")
)
// ExtendedAttribute represents a single Windows EA.
type ExtendedAttribute struct {
Name string
Value []byte
Flags uint8
}
func parseEa(b []byte) (ea ExtendedAttribute, nb []byte, err error) {
var info fileFullEaInformation
err = binary.Read(bytes.NewReader(b), binary.LittleEndian, &info)
if err != nil {
err = errInvalidEaBuffer
return
}
nameOffset := fileFullEaInformationSize
nameLen := int(info.NameLength)
valueOffset := nameOffset + int(info.NameLength) + 1
valueLen := int(info.ValueLength)
nextOffset := int(info.NextEntryOffset)
if valueLen+valueOffset > len(b) || nextOffset < 0 || nextOffset > len(b) {
err = errInvalidEaBuffer
return
}
ea.Name = string(b[nameOffset : nameOffset+nameLen])
ea.Value = b[valueOffset : valueOffset+valueLen]
ea.Flags = info.Flags
if info.NextEntryOffset != 0 {
nb = b[info.NextEntryOffset:]
}
return
}
// DecodeExtendedAttributes decodes a list of EAs from a FILE_FULL_EA_INFORMATION
// buffer retrieved from BackupRead, ZwQueryEaFile, etc.
func DecodeExtendedAttributes(b []byte) (eas []ExtendedAttribute, err error) {
for len(b) != 0 {
ea, nb, err := parseEa(b)
if err != nil {
return nil, err
}
eas = append(eas, ea)
b = nb
}
return
}
func writeEa(buf *bytes.Buffer, ea *ExtendedAttribute, last bool) error {
if int(uint8(len(ea.Name))) != len(ea.Name) {
return errEaNameTooLarge
}
if int(uint16(len(ea.Value))) != len(ea.Value) {
return errEaValueTooLarge
}
entrySize := uint32(fileFullEaInformationSize + len(ea.Name) + 1 + len(ea.Value))
withPadding := (entrySize + 3) &^ 3
nextOffset := uint32(0)
if !last {
nextOffset = withPadding
}
info := fileFullEaInformation{
NextEntryOffset: nextOffset,
Flags: ea.Flags,
NameLength: uint8(len(ea.Name)),
ValueLength: uint16(len(ea.Value)),
}
err := binary.Write(buf, binary.LittleEndian, &info)
if err != nil {
return err
}
_, err = buf.Write([]byte(ea.Name))
if err != nil {
return err
}
err = buf.WriteByte(0)
if err != nil {
return err
}
_, err = buf.Write(ea.Value)
if err != nil {
return err
}
_, err = buf.Write([]byte{0, 0, 0}[0 : withPadding-entrySize])
if err != nil {
return err
}
return nil
}
// EncodeExtendedAttributes encodes a list of EAs into a FILE_FULL_EA_INFORMATION
// buffer for use with BackupWrite, ZwSetEaFile, etc.
func EncodeExtendedAttributes(eas []ExtendedAttribute) ([]byte, error) {
var buf bytes.Buffer
for i := range eas {
last := false
if i == len(eas)-1 {
last = true
}
err := writeEa(&buf, &eas[i], last)
if err != nil {
return nil, err
}
}
return buf.Bytes(), nil
}

307
vendor/github.com/Microsoft/go-winio/file.go generated vendored Normal file
View File

@@ -0,0 +1,307 @@
// +build windows
package winio
import (
"errors"
"io"
"runtime"
"sync"
"sync/atomic"
"syscall"
"time"
)
//sys cancelIoEx(file syscall.Handle, o *syscall.Overlapped) (err error) = CancelIoEx
//sys createIoCompletionPort(file syscall.Handle, port syscall.Handle, key uintptr, threadCount uint32) (newport syscall.Handle, err error) = CreateIoCompletionPort
//sys getQueuedCompletionStatus(port syscall.Handle, bytes *uint32, key *uintptr, o **ioOperation, timeout uint32) (err error) = GetQueuedCompletionStatus
//sys setFileCompletionNotificationModes(h syscall.Handle, flags uint8) (err error) = SetFileCompletionNotificationModes
type atomicBool int32
func (b *atomicBool) isSet() bool { return atomic.LoadInt32((*int32)(b)) != 0 }
func (b *atomicBool) setFalse() { atomic.StoreInt32((*int32)(b), 0) }
func (b *atomicBool) setTrue() { atomic.StoreInt32((*int32)(b), 1) }
func (b *atomicBool) swap(new bool) bool {
var newInt int32
if new {
newInt = 1
}
return atomic.SwapInt32((*int32)(b), newInt) == 1
}
const (
cFILE_SKIP_COMPLETION_PORT_ON_SUCCESS = 1
cFILE_SKIP_SET_EVENT_ON_HANDLE = 2
)
var (
ErrFileClosed = errors.New("file has already been closed")
ErrTimeout = &timeoutError{}
)
type timeoutError struct{}
func (e *timeoutError) Error() string { return "i/o timeout" }
func (e *timeoutError) Timeout() bool { return true }
func (e *timeoutError) Temporary() bool { return true }
type timeoutChan chan struct{}
var ioInitOnce sync.Once
var ioCompletionPort syscall.Handle
// ioResult contains the result of an asynchronous IO operation
type ioResult struct {
bytes uint32
err error
}
// ioOperation represents an outstanding asynchronous Win32 IO
type ioOperation struct {
o syscall.Overlapped
ch chan ioResult
}
func initIo() {
h, err := createIoCompletionPort(syscall.InvalidHandle, 0, 0, 0xffffffff)
if err != nil {
panic(err)
}
ioCompletionPort = h
go ioCompletionProcessor(h)
}
// win32File implements Reader, Writer, and Closer on a Win32 handle without blocking in a syscall.
// It takes ownership of this handle and will close it if it is garbage collected.
type win32File struct {
handle syscall.Handle
wg sync.WaitGroup
wgLock sync.RWMutex
closing atomicBool
readDeadline deadlineHandler
writeDeadline deadlineHandler
}
type deadlineHandler struct {
setLock sync.Mutex
channel timeoutChan
channelLock sync.RWMutex
timer *time.Timer
timedout atomicBool
}
// makeWin32File makes a new win32File from an existing file handle
func makeWin32File(h syscall.Handle) (*win32File, error) {
f := &win32File{handle: h}
ioInitOnce.Do(initIo)
_, err := createIoCompletionPort(h, ioCompletionPort, 0, 0xffffffff)
if err != nil {
return nil, err
}
err = setFileCompletionNotificationModes(h, cFILE_SKIP_COMPLETION_PORT_ON_SUCCESS|cFILE_SKIP_SET_EVENT_ON_HANDLE)
if err != nil {
return nil, err
}
f.readDeadline.channel = make(timeoutChan)
f.writeDeadline.channel = make(timeoutChan)
return f, nil
}
func MakeOpenFile(h syscall.Handle) (io.ReadWriteCloser, error) {
return makeWin32File(h)
}
// closeHandle closes the resources associated with a Win32 handle
func (f *win32File) closeHandle() {
f.wgLock.Lock()
// Atomically set that we are closing, releasing the resources only once.
if !f.closing.swap(true) {
f.wgLock.Unlock()
// cancel all IO and wait for it to complete
cancelIoEx(f.handle, nil)
f.wg.Wait()
// at this point, no new IO can start
syscall.Close(f.handle)
f.handle = 0
} else {
f.wgLock.Unlock()
}
}
// Close closes a win32File.
func (f *win32File) Close() error {
f.closeHandle()
return nil
}
// prepareIo prepares for a new IO operation.
// The caller must call f.wg.Done() when the IO is finished, prior to Close() returning.
func (f *win32File) prepareIo() (*ioOperation, error) {
f.wgLock.RLock()
if f.closing.isSet() {
f.wgLock.RUnlock()
return nil, ErrFileClosed
}
f.wg.Add(1)
f.wgLock.RUnlock()
c := &ioOperation{}
c.ch = make(chan ioResult)
return c, nil
}
// ioCompletionProcessor processes completed async IOs forever
func ioCompletionProcessor(h syscall.Handle) {
for {
var bytes uint32
var key uintptr
var op *ioOperation
err := getQueuedCompletionStatus(h, &bytes, &key, &op, syscall.INFINITE)
if op == nil {
panic(err)
}
op.ch <- ioResult{bytes, err}
}
}
// asyncIo processes the return value from ReadFile or WriteFile, blocking until
// the operation has actually completed.
func (f *win32File) asyncIo(c *ioOperation, d *deadlineHandler, bytes uint32, err error) (int, error) {
if err != syscall.ERROR_IO_PENDING {
return int(bytes), err
}
if f.closing.isSet() {
cancelIoEx(f.handle, &c.o)
}
var timeout timeoutChan
if d != nil {
d.channelLock.Lock()
timeout = d.channel
d.channelLock.Unlock()
}
var r ioResult
select {
case r = <-c.ch:
err = r.err
if err == syscall.ERROR_OPERATION_ABORTED {
if f.closing.isSet() {
err = ErrFileClosed
}
}
case <-timeout:
cancelIoEx(f.handle, &c.o)
r = <-c.ch
err = r.err
if err == syscall.ERROR_OPERATION_ABORTED {
err = ErrTimeout
}
}
// runtime.KeepAlive is needed, as c is passed via native
// code to ioCompletionProcessor, c must remain alive
// until the channel read is complete.
runtime.KeepAlive(c)
return int(r.bytes), err
}
// Read reads from a file handle.
func (f *win32File) Read(b []byte) (int, error) {
c, err := f.prepareIo()
if err != nil {
return 0, err
}
defer f.wg.Done()
if f.readDeadline.timedout.isSet() {
return 0, ErrTimeout
}
var bytes uint32
err = syscall.ReadFile(f.handle, b, &bytes, &c.o)
n, err := f.asyncIo(c, &f.readDeadline, bytes, err)
runtime.KeepAlive(b)
// Handle EOF conditions.
if err == nil && n == 0 && len(b) != 0 {
return 0, io.EOF
} else if err == syscall.ERROR_BROKEN_PIPE {
return 0, io.EOF
} else {
return n, err
}
}
// Write writes to a file handle.
func (f *win32File) Write(b []byte) (int, error) {
c, err := f.prepareIo()
if err != nil {
return 0, err
}
defer f.wg.Done()
if f.writeDeadline.timedout.isSet() {
return 0, ErrTimeout
}
var bytes uint32
err = syscall.WriteFile(f.handle, b, &bytes, &c.o)
n, err := f.asyncIo(c, &f.writeDeadline, bytes, err)
runtime.KeepAlive(b)
return n, err
}
func (f *win32File) SetReadDeadline(deadline time.Time) error {
return f.readDeadline.set(deadline)
}
func (f *win32File) SetWriteDeadline(deadline time.Time) error {
return f.writeDeadline.set(deadline)
}
func (f *win32File) Flush() error {
return syscall.FlushFileBuffers(f.handle)
}
func (d *deadlineHandler) set(deadline time.Time) error {
d.setLock.Lock()
defer d.setLock.Unlock()
if d.timer != nil {
if !d.timer.Stop() {
<-d.channel
}
d.timer = nil
}
d.timedout.setFalse()
select {
case <-d.channel:
d.channelLock.Lock()
d.channel = make(chan struct{})
d.channelLock.Unlock()
default:
}
if deadline.IsZero() {
return nil
}
timeoutIO := func() {
d.timedout.setTrue()
close(d.channel)
}
now := time.Now()
duration := deadline.Sub(now)
if deadline.After(now) {
// Deadline is in the future, set a timer to wait
d.timer = time.AfterFunc(duration, timeoutIO)
} else {
// Deadline is in the past. Cancel all pending IO now.
timeoutIO()
}
return nil
}

61
vendor/github.com/Microsoft/go-winio/fileinfo.go generated vendored Normal file
View File

@@ -0,0 +1,61 @@
// +build windows
package winio
import (
"os"
"runtime"
"syscall"
"unsafe"
)
//sys getFileInformationByHandleEx(h syscall.Handle, class uint32, buffer *byte, size uint32) (err error) = GetFileInformationByHandleEx
//sys setFileInformationByHandle(h syscall.Handle, class uint32, buffer *byte, size uint32) (err error) = SetFileInformationByHandle
const (
fileBasicInfo = 0
fileIDInfo = 0x12
)
// FileBasicInfo contains file access time and file attributes information.
type FileBasicInfo struct {
CreationTime, LastAccessTime, LastWriteTime, ChangeTime syscall.Filetime
FileAttributes uint32
pad uint32 // padding
}
// GetFileBasicInfo retrieves times and attributes for a file.
func GetFileBasicInfo(f *os.File) (*FileBasicInfo, error) {
bi := &FileBasicInfo{}
if err := getFileInformationByHandleEx(syscall.Handle(f.Fd()), fileBasicInfo, (*byte)(unsafe.Pointer(bi)), uint32(unsafe.Sizeof(*bi))); err != nil {
return nil, &os.PathError{Op: "GetFileInformationByHandleEx", Path: f.Name(), Err: err}
}
runtime.KeepAlive(f)
return bi, nil
}
// SetFileBasicInfo sets times and attributes for a file.
func SetFileBasicInfo(f *os.File, bi *FileBasicInfo) error {
if err := setFileInformationByHandle(syscall.Handle(f.Fd()), fileBasicInfo, (*byte)(unsafe.Pointer(bi)), uint32(unsafe.Sizeof(*bi))); err != nil {
return &os.PathError{Op: "SetFileInformationByHandle", Path: f.Name(), Err: err}
}
runtime.KeepAlive(f)
return nil
}
// FileIDInfo contains the volume serial number and file ID for a file. This pair should be
// unique on a system.
type FileIDInfo struct {
VolumeSerialNumber uint64
FileID [16]byte
}
// GetFileID retrieves the unique (volume, file ID) pair for a file.
func GetFileID(f *os.File) (*FileIDInfo, error) {
fileID := &FileIDInfo{}
if err := getFileInformationByHandleEx(syscall.Handle(f.Fd()), fileIDInfo, (*byte)(unsafe.Pointer(fileID)), uint32(unsafe.Sizeof(*fileID))); err != nil {
return nil, &os.PathError{Op: "GetFileInformationByHandleEx", Path: f.Name(), Err: err}
}
runtime.KeepAlive(f)
return fileID, nil
}

421
vendor/github.com/Microsoft/go-winio/pipe.go generated vendored Normal file
View File

@@ -0,0 +1,421 @@
// +build windows
package winio
import (
"errors"
"io"
"net"
"os"
"syscall"
"time"
"unsafe"
)
//sys connectNamedPipe(pipe syscall.Handle, o *syscall.Overlapped) (err error) = ConnectNamedPipe
//sys createNamedPipe(name string, flags uint32, pipeMode uint32, maxInstances uint32, outSize uint32, inSize uint32, defaultTimeout uint32, sa *syscall.SecurityAttributes) (handle syscall.Handle, err error) [failretval==syscall.InvalidHandle] = CreateNamedPipeW
//sys createFile(name string, access uint32, mode uint32, sa *syscall.SecurityAttributes, createmode uint32, attrs uint32, templatefile syscall.Handle) (handle syscall.Handle, err error) [failretval==syscall.InvalidHandle] = CreateFileW
//sys getNamedPipeInfo(pipe syscall.Handle, flags *uint32, outSize *uint32, inSize *uint32, maxInstances *uint32) (err error) = GetNamedPipeInfo
//sys getNamedPipeHandleState(pipe syscall.Handle, state *uint32, curInstances *uint32, maxCollectionCount *uint32, collectDataTimeout *uint32, userName *uint16, maxUserNameSize uint32) (err error) = GetNamedPipeHandleStateW
//sys localAlloc(uFlags uint32, length uint32) (ptr uintptr) = LocalAlloc
const (
cERROR_PIPE_BUSY = syscall.Errno(231)
cERROR_NO_DATA = syscall.Errno(232)
cERROR_PIPE_CONNECTED = syscall.Errno(535)
cERROR_SEM_TIMEOUT = syscall.Errno(121)
cPIPE_ACCESS_DUPLEX = 0x3
cFILE_FLAG_FIRST_PIPE_INSTANCE = 0x80000
cSECURITY_SQOS_PRESENT = 0x100000
cSECURITY_ANONYMOUS = 0
cPIPE_REJECT_REMOTE_CLIENTS = 0x8
cPIPE_UNLIMITED_INSTANCES = 255
cNMPWAIT_USE_DEFAULT_WAIT = 0
cNMPWAIT_NOWAIT = 1
cPIPE_TYPE_MESSAGE = 4
cPIPE_READMODE_MESSAGE = 2
)
var (
// ErrPipeListenerClosed is returned for pipe operations on listeners that have been closed.
// This error should match net.errClosing since docker takes a dependency on its text.
ErrPipeListenerClosed = errors.New("use of closed network connection")
errPipeWriteClosed = errors.New("pipe has been closed for write")
)
type win32Pipe struct {
*win32File
path string
}
type win32MessageBytePipe struct {
win32Pipe
writeClosed bool
readEOF bool
}
type pipeAddress string
func (f *win32Pipe) LocalAddr() net.Addr {
return pipeAddress(f.path)
}
func (f *win32Pipe) RemoteAddr() net.Addr {
return pipeAddress(f.path)
}
func (f *win32Pipe) SetDeadline(t time.Time) error {
f.SetReadDeadline(t)
f.SetWriteDeadline(t)
return nil
}
// CloseWrite closes the write side of a message pipe in byte mode.
func (f *win32MessageBytePipe) CloseWrite() error {
if f.writeClosed {
return errPipeWriteClosed
}
err := f.win32File.Flush()
if err != nil {
return err
}
_, err = f.win32File.Write(nil)
if err != nil {
return err
}
f.writeClosed = true
return nil
}
// Write writes bytes to a message pipe in byte mode. Zero-byte writes are ignored, since
// they are used to implement CloseWrite().
func (f *win32MessageBytePipe) Write(b []byte) (int, error) {
if f.writeClosed {
return 0, errPipeWriteClosed
}
if len(b) == 0 {
return 0, nil
}
return f.win32File.Write(b)
}
// Read reads bytes from a message pipe in byte mode. A read of a zero-byte message on a message
// mode pipe will return io.EOF, as will all subsequent reads.
func (f *win32MessageBytePipe) Read(b []byte) (int, error) {
if f.readEOF {
return 0, io.EOF
}
n, err := f.win32File.Read(b)
if err == io.EOF {
// If this was the result of a zero-byte read, then
// it is possible that the read was due to a zero-size
// message. Since we are simulating CloseWrite with a
// zero-byte message, ensure that all future Read() calls
// also return EOF.
f.readEOF = true
} else if err == syscall.ERROR_MORE_DATA {
// ERROR_MORE_DATA indicates that the pipe's read mode is message mode
// and the message still has more bytes. Treat this as a success, since
// this package presents all named pipes as byte streams.
err = nil
}
return n, err
}
func (s pipeAddress) Network() string {
return "pipe"
}
func (s pipeAddress) String() string {
return string(s)
}
// DialPipe connects to a named pipe by path, timing out if the connection
// takes longer than the specified duration. If timeout is nil, then we use
// a default timeout of 5 seconds. (We do not use WaitNamedPipe.)
func DialPipe(path string, timeout *time.Duration) (net.Conn, error) {
var absTimeout time.Time
if timeout != nil {
absTimeout = time.Now().Add(*timeout)
} else {
absTimeout = time.Now().Add(time.Second * 2)
}
var err error
var h syscall.Handle
for {
h, err = createFile(path, syscall.GENERIC_READ|syscall.GENERIC_WRITE, 0, nil, syscall.OPEN_EXISTING, syscall.FILE_FLAG_OVERLAPPED|cSECURITY_SQOS_PRESENT|cSECURITY_ANONYMOUS, 0)
if err != cERROR_PIPE_BUSY {
break
}
if time.Now().After(absTimeout) {
return nil, ErrTimeout
}
// Wait 10 msec and try again. This is a rather simplistic
// view, as we always try each 10 milliseconds.
time.Sleep(time.Millisecond * 10)
}
if err != nil {
return nil, &os.PathError{Op: "open", Path: path, Err: err}
}
var flags uint32
err = getNamedPipeInfo(h, &flags, nil, nil, nil)
if err != nil {
return nil, err
}
f, err := makeWin32File(h)
if err != nil {
syscall.Close(h)
return nil, err
}
// If the pipe is in message mode, return a message byte pipe, which
// supports CloseWrite().
if flags&cPIPE_TYPE_MESSAGE != 0 {
return &win32MessageBytePipe{
win32Pipe: win32Pipe{win32File: f, path: path},
}, nil
}
return &win32Pipe{win32File: f, path: path}, nil
}
type acceptResponse struct {
f *win32File
err error
}
type win32PipeListener struct {
firstHandle syscall.Handle
path string
securityDescriptor []byte
config PipeConfig
acceptCh chan (chan acceptResponse)
closeCh chan int
doneCh chan int
}
func makeServerPipeHandle(path string, securityDescriptor []byte, c *PipeConfig, first bool) (syscall.Handle, error) {
var flags uint32 = cPIPE_ACCESS_DUPLEX | syscall.FILE_FLAG_OVERLAPPED
if first {
flags |= cFILE_FLAG_FIRST_PIPE_INSTANCE
}
var mode uint32 = cPIPE_REJECT_REMOTE_CLIENTS
if c.MessageMode {
mode |= cPIPE_TYPE_MESSAGE
}
sa := &syscall.SecurityAttributes{}
sa.Length = uint32(unsafe.Sizeof(*sa))
if securityDescriptor != nil {
len := uint32(len(securityDescriptor))
sa.SecurityDescriptor = localAlloc(0, len)
defer localFree(sa.SecurityDescriptor)
copy((*[0xffff]byte)(unsafe.Pointer(sa.SecurityDescriptor))[:], securityDescriptor)
}
h, err := createNamedPipe(path, flags, mode, cPIPE_UNLIMITED_INSTANCES, uint32(c.OutputBufferSize), uint32(c.InputBufferSize), 0, sa)
if err != nil {
return 0, &os.PathError{Op: "open", Path: path, Err: err}
}
return h, nil
}
func (l *win32PipeListener) makeServerPipe() (*win32File, error) {
h, err := makeServerPipeHandle(l.path, l.securityDescriptor, &l.config, false)
if err != nil {
return nil, err
}
f, err := makeWin32File(h)
if err != nil {
syscall.Close(h)
return nil, err
}
return f, nil
}
func (l *win32PipeListener) makeConnectedServerPipe() (*win32File, error) {
p, err := l.makeServerPipe()
if err != nil {
return nil, err
}
// Wait for the client to connect.
ch := make(chan error)
go func(p *win32File) {
ch <- connectPipe(p)
}(p)
select {
case err = <-ch:
if err != nil {
p.Close()
p = nil
}
case <-l.closeCh:
// Abort the connect request by closing the handle.
p.Close()
p = nil
err = <-ch
if err == nil || err == ErrFileClosed {
err = ErrPipeListenerClosed
}
}
return p, err
}
func (l *win32PipeListener) listenerRoutine() {
closed := false
for !closed {
select {
case <-l.closeCh:
closed = true
case responseCh := <-l.acceptCh:
var (
p *win32File
err error
)
for {
p, err = l.makeConnectedServerPipe()
// If the connection was immediately closed by the client, try
// again.
if err != cERROR_NO_DATA {
break
}
}
responseCh <- acceptResponse{p, err}
closed = err == ErrPipeListenerClosed
}
}
syscall.Close(l.firstHandle)
l.firstHandle = 0
// Notify Close() and Accept() callers that the handle has been closed.
close(l.doneCh)
}
// PipeConfig contain configuration for the pipe listener.
type PipeConfig struct {
// SecurityDescriptor contains a Windows security descriptor in SDDL format.
SecurityDescriptor string
// MessageMode determines whether the pipe is in byte or message mode. In either
// case the pipe is read in byte mode by default. The only practical difference in
// this implementation is that CloseWrite() is only supported for message mode pipes;
// CloseWrite() is implemented as a zero-byte write, but zero-byte writes are only
// transferred to the reader (and returned as io.EOF in this implementation)
// when the pipe is in message mode.
MessageMode bool
// InputBufferSize specifies the size the input buffer, in bytes.
InputBufferSize int32
// OutputBufferSize specifies the size the input buffer, in bytes.
OutputBufferSize int32
}
// ListenPipe creates a listener on a Windows named pipe path, e.g. \\.\pipe\mypipe.
// The pipe must not already exist.
func ListenPipe(path string, c *PipeConfig) (net.Listener, error) {
var (
sd []byte
err error
)
if c == nil {
c = &PipeConfig{}
}
if c.SecurityDescriptor != "" {
sd, err = SddlToSecurityDescriptor(c.SecurityDescriptor)
if err != nil {
return nil, err
}
}
h, err := makeServerPipeHandle(path, sd, c, true)
if err != nil {
return nil, err
}
// Create a client handle and connect it. This results in the pipe
// instance always existing, so that clients see ERROR_PIPE_BUSY
// rather than ERROR_FILE_NOT_FOUND. This ties the first instance
// up so that no other instances can be used. This would have been
// cleaner if the Win32 API matched CreateFile with ConnectNamedPipe
// instead of CreateNamedPipe. (Apparently created named pipes are
// considered to be in listening state regardless of whether any
// active calls to ConnectNamedPipe are outstanding.)
h2, err := createFile(path, 0, 0, nil, syscall.OPEN_EXISTING, cSECURITY_SQOS_PRESENT|cSECURITY_ANONYMOUS, 0)
if err != nil {
syscall.Close(h)
return nil, err
}
// Close the client handle. The server side of the instance will
// still be busy, leading to ERROR_PIPE_BUSY instead of
// ERROR_NOT_FOUND, as long as we don't close the server handle,
// or disconnect the client with DisconnectNamedPipe.
syscall.Close(h2)
l := &win32PipeListener{
firstHandle: h,
path: path,
securityDescriptor: sd,
config: *c,
acceptCh: make(chan (chan acceptResponse)),
closeCh: make(chan int),
doneCh: make(chan int),
}
go l.listenerRoutine()
return l, nil
}
func connectPipe(p *win32File) error {
c, err := p.prepareIo()
if err != nil {
return err
}
defer p.wg.Done()
err = connectNamedPipe(p.handle, &c.o)
_, err = p.asyncIo(c, nil, 0, err)
if err != nil && err != cERROR_PIPE_CONNECTED {
return err
}
return nil
}
func (l *win32PipeListener) Accept() (net.Conn, error) {
ch := make(chan acceptResponse)
select {
case l.acceptCh <- ch:
response := <-ch
err := response.err
if err != nil {
return nil, err
}
if l.config.MessageMode {
return &win32MessageBytePipe{
win32Pipe: win32Pipe{win32File: response.f, path: l.path},
}, nil
}
return &win32Pipe{win32File: response.f, path: l.path}, nil
case <-l.doneCh:
return nil, ErrPipeListenerClosed
}
}
func (l *win32PipeListener) Close() error {
select {
case l.closeCh <- 1:
<-l.doneCh
case <-l.doneCh:
}
return nil
}
func (l *win32PipeListener) Addr() net.Addr {
return pipeAddress(l.path)
}

202
vendor/github.com/Microsoft/go-winio/privilege.go generated vendored Normal file
View File

@@ -0,0 +1,202 @@
// +build windows
package winio
import (
"bytes"
"encoding/binary"
"fmt"
"runtime"
"sync"
"syscall"
"unicode/utf16"
"golang.org/x/sys/windows"
)
//sys adjustTokenPrivileges(token windows.Token, releaseAll bool, input *byte, outputSize uint32, output *byte, requiredSize *uint32) (success bool, err error) [true] = advapi32.AdjustTokenPrivileges
//sys impersonateSelf(level uint32) (err error) = advapi32.ImpersonateSelf
//sys revertToSelf() (err error) = advapi32.RevertToSelf
//sys openThreadToken(thread syscall.Handle, accessMask uint32, openAsSelf bool, token *windows.Token) (err error) = advapi32.OpenThreadToken
//sys getCurrentThread() (h syscall.Handle) = GetCurrentThread
//sys lookupPrivilegeValue(systemName string, name string, luid *uint64) (err error) = advapi32.LookupPrivilegeValueW
//sys lookupPrivilegeName(systemName string, luid *uint64, buffer *uint16, size *uint32) (err error) = advapi32.LookupPrivilegeNameW
//sys lookupPrivilegeDisplayName(systemName string, name *uint16, buffer *uint16, size *uint32, languageId *uint32) (err error) = advapi32.LookupPrivilegeDisplayNameW
const (
SE_PRIVILEGE_ENABLED = 2
ERROR_NOT_ALL_ASSIGNED syscall.Errno = 1300
SeBackupPrivilege = "SeBackupPrivilege"
SeRestorePrivilege = "SeRestorePrivilege"
)
const (
securityAnonymous = iota
securityIdentification
securityImpersonation
securityDelegation
)
var (
privNames = make(map[string]uint64)
privNameMutex sync.Mutex
)
// PrivilegeError represents an error enabling privileges.
type PrivilegeError struct {
privileges []uint64
}
func (e *PrivilegeError) Error() string {
s := ""
if len(e.privileges) > 1 {
s = "Could not enable privileges "
} else {
s = "Could not enable privilege "
}
for i, p := range e.privileges {
if i != 0 {
s += ", "
}
s += `"`
s += getPrivilegeName(p)
s += `"`
}
return s
}
// RunWithPrivilege enables a single privilege for a function call.
func RunWithPrivilege(name string, fn func() error) error {
return RunWithPrivileges([]string{name}, fn)
}
// RunWithPrivileges enables privileges for a function call.
func RunWithPrivileges(names []string, fn func() error) error {
privileges, err := mapPrivileges(names)
if err != nil {
return err
}
runtime.LockOSThread()
defer runtime.UnlockOSThread()
token, err := newThreadToken()
if err != nil {
return err
}
defer releaseThreadToken(token)
err = adjustPrivileges(token, privileges, SE_PRIVILEGE_ENABLED)
if err != nil {
return err
}
return fn()
}
func mapPrivileges(names []string) ([]uint64, error) {
var privileges []uint64
privNameMutex.Lock()
defer privNameMutex.Unlock()
for _, name := range names {
p, ok := privNames[name]
if !ok {
err := lookupPrivilegeValue("", name, &p)
if err != nil {
return nil, err
}
privNames[name] = p
}
privileges = append(privileges, p)
}
return privileges, nil
}
// EnableProcessPrivileges enables privileges globally for the process.
func EnableProcessPrivileges(names []string) error {
return enableDisableProcessPrivilege(names, SE_PRIVILEGE_ENABLED)
}
// DisableProcessPrivileges disables privileges globally for the process.
func DisableProcessPrivileges(names []string) error {
return enableDisableProcessPrivilege(names, 0)
}
func enableDisableProcessPrivilege(names []string, action uint32) error {
privileges, err := mapPrivileges(names)
if err != nil {
return err
}
p, _ := windows.GetCurrentProcess()
var token windows.Token
err = windows.OpenProcessToken(p, windows.TOKEN_ADJUST_PRIVILEGES|windows.TOKEN_QUERY, &token)
if err != nil {
return err
}
defer token.Close()
return adjustPrivileges(token, privileges, action)
}
func adjustPrivileges(token windows.Token, privileges []uint64, action uint32) error {
var b bytes.Buffer
binary.Write(&b, binary.LittleEndian, uint32(len(privileges)))
for _, p := range privileges {
binary.Write(&b, binary.LittleEndian, p)
binary.Write(&b, binary.LittleEndian, action)
}
prevState := make([]byte, b.Len())
reqSize := uint32(0)
success, err := adjustTokenPrivileges(token, false, &b.Bytes()[0], uint32(len(prevState)), &prevState[0], &reqSize)
if !success {
return err
}
if err == ERROR_NOT_ALL_ASSIGNED {
return &PrivilegeError{privileges}
}
return nil
}
func getPrivilegeName(luid uint64) string {
var nameBuffer [256]uint16
bufSize := uint32(len(nameBuffer))
err := lookupPrivilegeName("", &luid, &nameBuffer[0], &bufSize)
if err != nil {
return fmt.Sprintf("<unknown privilege %d>", luid)
}
var displayNameBuffer [256]uint16
displayBufSize := uint32(len(displayNameBuffer))
var langID uint32
err = lookupPrivilegeDisplayName("", &nameBuffer[0], &displayNameBuffer[0], &displayBufSize, &langID)
if err != nil {
return fmt.Sprintf("<unknown privilege %s>", string(utf16.Decode(nameBuffer[:bufSize])))
}
return string(utf16.Decode(displayNameBuffer[:displayBufSize]))
}
func newThreadToken() (windows.Token, error) {
err := impersonateSelf(securityImpersonation)
if err != nil {
return 0, err
}
var token windows.Token
err = openThreadToken(getCurrentThread(), syscall.TOKEN_ADJUST_PRIVILEGES|syscall.TOKEN_QUERY, false, &token)
if err != nil {
rerr := revertToSelf()
if rerr != nil {
panic(rerr)
}
return 0, err
}
return token, nil
}
func releaseThreadToken(h windows.Token) {
err := revertToSelf()
if err != nil {
panic(err)
}
h.Close()
}

128
vendor/github.com/Microsoft/go-winio/reparse.go generated vendored Normal file
View File

@@ -0,0 +1,128 @@
package winio
import (
"bytes"
"encoding/binary"
"fmt"
"strings"
"unicode/utf16"
"unsafe"
)
const (
reparseTagMountPoint = 0xA0000003
reparseTagSymlink = 0xA000000C
)
type reparseDataBuffer struct {
ReparseTag uint32
ReparseDataLength uint16
Reserved uint16
SubstituteNameOffset uint16
SubstituteNameLength uint16
PrintNameOffset uint16
PrintNameLength uint16
}
// ReparsePoint describes a Win32 symlink or mount point.
type ReparsePoint struct {
Target string
IsMountPoint bool
}
// UnsupportedReparsePointError is returned when trying to decode a non-symlink or
// mount point reparse point.
type UnsupportedReparsePointError struct {
Tag uint32
}
func (e *UnsupportedReparsePointError) Error() string {
return fmt.Sprintf("unsupported reparse point %x", e.Tag)
}
// DecodeReparsePoint decodes a Win32 REPARSE_DATA_BUFFER structure containing either a symlink
// or a mount point.
func DecodeReparsePoint(b []byte) (*ReparsePoint, error) {
tag := binary.LittleEndian.Uint32(b[0:4])
return DecodeReparsePointData(tag, b[8:])
}
func DecodeReparsePointData(tag uint32, b []byte) (*ReparsePoint, error) {
isMountPoint := false
switch tag {
case reparseTagMountPoint:
isMountPoint = true
case reparseTagSymlink:
default:
return nil, &UnsupportedReparsePointError{tag}
}
nameOffset := 8 + binary.LittleEndian.Uint16(b[4:6])
if !isMountPoint {
nameOffset += 4
}
nameLength := binary.LittleEndian.Uint16(b[6:8])
name := make([]uint16, nameLength/2)
err := binary.Read(bytes.NewReader(b[nameOffset:nameOffset+nameLength]), binary.LittleEndian, &name)
if err != nil {
return nil, err
}
return &ReparsePoint{string(utf16.Decode(name)), isMountPoint}, nil
}
func isDriveLetter(c byte) bool {
return (c >= 'a' && c <= 'z') || (c >= 'A' && c <= 'Z')
}
// EncodeReparsePoint encodes a Win32 REPARSE_DATA_BUFFER structure describing a symlink or
// mount point.
func EncodeReparsePoint(rp *ReparsePoint) []byte {
// Generate an NT path and determine if this is a relative path.
var ntTarget string
relative := false
if strings.HasPrefix(rp.Target, `\\?\`) {
ntTarget = `\??\` + rp.Target[4:]
} else if strings.HasPrefix(rp.Target, `\\`) {
ntTarget = `\??\UNC\` + rp.Target[2:]
} else if len(rp.Target) >= 2 && isDriveLetter(rp.Target[0]) && rp.Target[1] == ':' {
ntTarget = `\??\` + rp.Target
} else {
ntTarget = rp.Target
relative = true
}
// The paths must be NUL-terminated even though they are counted strings.
target16 := utf16.Encode([]rune(rp.Target + "\x00"))
ntTarget16 := utf16.Encode([]rune(ntTarget + "\x00"))
size := int(unsafe.Sizeof(reparseDataBuffer{})) - 8
size += len(ntTarget16)*2 + len(target16)*2
tag := uint32(reparseTagMountPoint)
if !rp.IsMountPoint {
tag = reparseTagSymlink
size += 4 // Add room for symlink flags
}
data := reparseDataBuffer{
ReparseTag: tag,
ReparseDataLength: uint16(size),
SubstituteNameOffset: 0,
SubstituteNameLength: uint16((len(ntTarget16) - 1) * 2),
PrintNameOffset: uint16(len(ntTarget16) * 2),
PrintNameLength: uint16((len(target16) - 1) * 2),
}
var b bytes.Buffer
binary.Write(&b, binary.LittleEndian, &data)
if !rp.IsMountPoint {
flags := uint32(0)
if relative {
flags |= 1
}
binary.Write(&b, binary.LittleEndian, flags)
}
binary.Write(&b, binary.LittleEndian, ntTarget16)
binary.Write(&b, binary.LittleEndian, target16)
return b.Bytes()
}

98
vendor/github.com/Microsoft/go-winio/sd.go generated vendored Normal file
View File

@@ -0,0 +1,98 @@
// +build windows
package winio
import (
"syscall"
"unsafe"
)
//sys lookupAccountName(systemName *uint16, accountName string, sid *byte, sidSize *uint32, refDomain *uint16, refDomainSize *uint32, sidNameUse *uint32) (err error) = advapi32.LookupAccountNameW
//sys convertSidToStringSid(sid *byte, str **uint16) (err error) = advapi32.ConvertSidToStringSidW
//sys convertStringSecurityDescriptorToSecurityDescriptor(str string, revision uint32, sd *uintptr, size *uint32) (err error) = advapi32.ConvertStringSecurityDescriptorToSecurityDescriptorW
//sys convertSecurityDescriptorToStringSecurityDescriptor(sd *byte, revision uint32, secInfo uint32, sddl **uint16, sddlSize *uint32) (err error) = advapi32.ConvertSecurityDescriptorToStringSecurityDescriptorW
//sys localFree(mem uintptr) = LocalFree
//sys getSecurityDescriptorLength(sd uintptr) (len uint32) = advapi32.GetSecurityDescriptorLength
const (
cERROR_NONE_MAPPED = syscall.Errno(1332)
)
type AccountLookupError struct {
Name string
Err error
}
func (e *AccountLookupError) Error() string {
if e.Name == "" {
return "lookup account: empty account name specified"
}
var s string
switch e.Err {
case cERROR_NONE_MAPPED:
s = "not found"
default:
s = e.Err.Error()
}
return "lookup account " + e.Name + ": " + s
}
type SddlConversionError struct {
Sddl string
Err error
}
func (e *SddlConversionError) Error() string {
return "convert " + e.Sddl + ": " + e.Err.Error()
}
// LookupSidByName looks up the SID of an account by name
func LookupSidByName(name string) (sid string, err error) {
if name == "" {
return "", &AccountLookupError{name, cERROR_NONE_MAPPED}
}
var sidSize, sidNameUse, refDomainSize uint32
err = lookupAccountName(nil, name, nil, &sidSize, nil, &refDomainSize, &sidNameUse)
if err != nil && err != syscall.ERROR_INSUFFICIENT_BUFFER {
return "", &AccountLookupError{name, err}
}
sidBuffer := make([]byte, sidSize)
refDomainBuffer := make([]uint16, refDomainSize)
err = lookupAccountName(nil, name, &sidBuffer[0], &sidSize, &refDomainBuffer[0], &refDomainSize, &sidNameUse)
if err != nil {
return "", &AccountLookupError{name, err}
}
var strBuffer *uint16
err = convertSidToStringSid(&sidBuffer[0], &strBuffer)
if err != nil {
return "", &AccountLookupError{name, err}
}
sid = syscall.UTF16ToString((*[0xffff]uint16)(unsafe.Pointer(strBuffer))[:])
localFree(uintptr(unsafe.Pointer(strBuffer)))
return sid, nil
}
func SddlToSecurityDescriptor(sddl string) ([]byte, error) {
var sdBuffer uintptr
err := convertStringSecurityDescriptorToSecurityDescriptor(sddl, 1, &sdBuffer, nil)
if err != nil {
return nil, &SddlConversionError{sddl, err}
}
defer localFree(sdBuffer)
sd := make([]byte, getSecurityDescriptorLength(sdBuffer))
copy(sd, (*[0xffff]byte)(unsafe.Pointer(sdBuffer))[:len(sd)])
return sd, nil
}
func SecurityDescriptorToSddl(sd []byte) (string, error) {
var sddl *uint16
// The returned string length seems to including an aribtrary number of terminating NULs.
// Don't use it.
err := convertSecurityDescriptorToStringSecurityDescriptor(&sd[0], 1, 0xff, &sddl, nil)
if err != nil {
return "", err
}
defer localFree(uintptr(unsafe.Pointer(sddl)))
return syscall.UTF16ToString((*[0xffff]uint16)(unsafe.Pointer(sddl))[:]), nil
}

3
vendor/github.com/Microsoft/go-winio/syscall.go generated vendored Normal file
View File

@@ -0,0 +1,3 @@
package winio
//go:generate go run $GOROOT/src/syscall/mksyscall_windows.go -output zsyscall_windows.go file.go pipe.go sd.go fileinfo.go privilege.go backup.go

View File

@@ -0,0 +1,520 @@
// MACHINE GENERATED BY 'go generate' COMMAND; DO NOT EDIT
package winio
import (
"syscall"
"unsafe"
"golang.org/x/sys/windows"
)
var _ unsafe.Pointer
// Do the interface allocations only once for common
// Errno values.
const (
errnoERROR_IO_PENDING = 997
)
var (
errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING)
)
// errnoErr returns common boxed Errno values, to prevent
// allocations at runtime.
func errnoErr(e syscall.Errno) error {
switch e {
case 0:
return nil
case errnoERROR_IO_PENDING:
return errERROR_IO_PENDING
}
// TODO: add more here, after collecting data on the common
// error values see on Windows. (perhaps when running
// all.bat?)
return e
}
var (
modkernel32 = windows.NewLazySystemDLL("kernel32.dll")
modadvapi32 = windows.NewLazySystemDLL("advapi32.dll")
procCancelIoEx = modkernel32.NewProc("CancelIoEx")
procCreateIoCompletionPort = modkernel32.NewProc("CreateIoCompletionPort")
procGetQueuedCompletionStatus = modkernel32.NewProc("GetQueuedCompletionStatus")
procSetFileCompletionNotificationModes = modkernel32.NewProc("SetFileCompletionNotificationModes")
procConnectNamedPipe = modkernel32.NewProc("ConnectNamedPipe")
procCreateNamedPipeW = modkernel32.NewProc("CreateNamedPipeW")
procCreateFileW = modkernel32.NewProc("CreateFileW")
procWaitNamedPipeW = modkernel32.NewProc("WaitNamedPipeW")
procGetNamedPipeInfo = modkernel32.NewProc("GetNamedPipeInfo")
procGetNamedPipeHandleStateW = modkernel32.NewProc("GetNamedPipeHandleStateW")
procLocalAlloc = modkernel32.NewProc("LocalAlloc")
procLookupAccountNameW = modadvapi32.NewProc("LookupAccountNameW")
procConvertSidToStringSidW = modadvapi32.NewProc("ConvertSidToStringSidW")
procConvertStringSecurityDescriptorToSecurityDescriptorW = modadvapi32.NewProc("ConvertStringSecurityDescriptorToSecurityDescriptorW")
procConvertSecurityDescriptorToStringSecurityDescriptorW = modadvapi32.NewProc("ConvertSecurityDescriptorToStringSecurityDescriptorW")
procLocalFree = modkernel32.NewProc("LocalFree")
procGetSecurityDescriptorLength = modadvapi32.NewProc("GetSecurityDescriptorLength")
procGetFileInformationByHandleEx = modkernel32.NewProc("GetFileInformationByHandleEx")
procSetFileInformationByHandle = modkernel32.NewProc("SetFileInformationByHandle")
procAdjustTokenPrivileges = modadvapi32.NewProc("AdjustTokenPrivileges")
procImpersonateSelf = modadvapi32.NewProc("ImpersonateSelf")
procRevertToSelf = modadvapi32.NewProc("RevertToSelf")
procOpenThreadToken = modadvapi32.NewProc("OpenThreadToken")
procGetCurrentThread = modkernel32.NewProc("GetCurrentThread")
procLookupPrivilegeValueW = modadvapi32.NewProc("LookupPrivilegeValueW")
procLookupPrivilegeNameW = modadvapi32.NewProc("LookupPrivilegeNameW")
procLookupPrivilegeDisplayNameW = modadvapi32.NewProc("LookupPrivilegeDisplayNameW")
procBackupRead = modkernel32.NewProc("BackupRead")
procBackupWrite = modkernel32.NewProc("BackupWrite")
)
func cancelIoEx(file syscall.Handle, o *syscall.Overlapped) (err error) {
r1, _, e1 := syscall.Syscall(procCancelIoEx.Addr(), 2, uintptr(file), uintptr(unsafe.Pointer(o)), 0)
if r1 == 0 {
if e1 != 0 {
err = errnoErr(e1)
} else {
err = syscall.EINVAL
}
}
return
}
func createIoCompletionPort(file syscall.Handle, port syscall.Handle, key uintptr, threadCount uint32) (newport syscall.Handle, err error) {
r0, _, e1 := syscall.Syscall6(procCreateIoCompletionPort.Addr(), 4, uintptr(file), uintptr(port), uintptr(key), uintptr(threadCount), 0, 0)
newport = syscall.Handle(r0)
if newport == 0 {
if e1 != 0 {
err = errnoErr(e1)
} else {
err = syscall.EINVAL
}
}
return
}
func getQueuedCompletionStatus(port syscall.Handle, bytes *uint32, key *uintptr, o **ioOperation, timeout uint32) (err error) {
r1, _, e1 := syscall.Syscall6(procGetQueuedCompletionStatus.Addr(), 5, uintptr(port), uintptr(unsafe.Pointer(bytes)), uintptr(unsafe.Pointer(key)), uintptr(unsafe.Pointer(o)), uintptr(timeout), 0)
if r1 == 0 {
if e1 != 0 {
err = errnoErr(e1)
} else {
err = syscall.EINVAL
}
}
return
}
func setFileCompletionNotificationModes(h syscall.Handle, flags uint8) (err error) {
r1, _, e1 := syscall.Syscall(procSetFileCompletionNotificationModes.Addr(), 2, uintptr(h), uintptr(flags), 0)
if r1 == 0 {
if e1 != 0 {
err = errnoErr(e1)
} else {
err = syscall.EINVAL
}
}
return
}
func connectNamedPipe(pipe syscall.Handle, o *syscall.Overlapped) (err error) {
r1, _, e1 := syscall.Syscall(procConnectNamedPipe.Addr(), 2, uintptr(pipe), uintptr(unsafe.Pointer(o)), 0)
if r1 == 0 {
if e1 != 0 {
err = errnoErr(e1)
} else {
err = syscall.EINVAL
}
}
return
}
func createNamedPipe(name string, flags uint32, pipeMode uint32, maxInstances uint32, outSize uint32, inSize uint32, defaultTimeout uint32, sa *syscall.SecurityAttributes) (handle syscall.Handle, err error) {
var _p0 *uint16
_p0, err = syscall.UTF16PtrFromString(name)
if err != nil {
return
}
return _createNamedPipe(_p0, flags, pipeMode, maxInstances, outSize, inSize, defaultTimeout, sa)
}
func _createNamedPipe(name *uint16, flags uint32, pipeMode uint32, maxInstances uint32, outSize uint32, inSize uint32, defaultTimeout uint32, sa *syscall.SecurityAttributes) (handle syscall.Handle, err error) {
r0, _, e1 := syscall.Syscall9(procCreateNamedPipeW.Addr(), 8, uintptr(unsafe.Pointer(name)), uintptr(flags), uintptr(pipeMode), uintptr(maxInstances), uintptr(outSize), uintptr(inSize), uintptr(defaultTimeout), uintptr(unsafe.Pointer(sa)), 0)
handle = syscall.Handle(r0)
if handle == syscall.InvalidHandle {
if e1 != 0 {
err = errnoErr(e1)
} else {
err = syscall.EINVAL
}
}
return
}
func createFile(name string, access uint32, mode uint32, sa *syscall.SecurityAttributes, createmode uint32, attrs uint32, templatefile syscall.Handle) (handle syscall.Handle, err error) {
var _p0 *uint16
_p0, err = syscall.UTF16PtrFromString(name)
if err != nil {
return
}
return _createFile(_p0, access, mode, sa, createmode, attrs, templatefile)
}
func _createFile(name *uint16, access uint32, mode uint32, sa *syscall.SecurityAttributes, createmode uint32, attrs uint32, templatefile syscall.Handle) (handle syscall.Handle, err error) {
r0, _, e1 := syscall.Syscall9(procCreateFileW.Addr(), 7, uintptr(unsafe.Pointer(name)), uintptr(access), uintptr(mode), uintptr(unsafe.Pointer(sa)), uintptr(createmode), uintptr(attrs), uintptr(templatefile), 0, 0)
handle = syscall.Handle(r0)
if handle == syscall.InvalidHandle {
if e1 != 0 {
err = errnoErr(e1)
} else {
err = syscall.EINVAL
}
}
return
}
func waitNamedPipe(name string, timeout uint32) (err error) {
var _p0 *uint16
_p0, err = syscall.UTF16PtrFromString(name)
if err != nil {
return
}
return _waitNamedPipe(_p0, timeout)
}
func _waitNamedPipe(name *uint16, timeout uint32) (err error) {
r1, _, e1 := syscall.Syscall(procWaitNamedPipeW.Addr(), 2, uintptr(unsafe.Pointer(name)), uintptr(timeout), 0)
if r1 == 0 {
if e1 != 0 {
err = errnoErr(e1)
} else {
err = syscall.EINVAL
}
}
return
}
func getNamedPipeInfo(pipe syscall.Handle, flags *uint32, outSize *uint32, inSize *uint32, maxInstances *uint32) (err error) {
r1, _, e1 := syscall.Syscall6(procGetNamedPipeInfo.Addr(), 5, uintptr(pipe), uintptr(unsafe.Pointer(flags)), uintptr(unsafe.Pointer(outSize)), uintptr(unsafe.Pointer(inSize)), uintptr(unsafe.Pointer(maxInstances)), 0)
if r1 == 0 {
if e1 != 0 {
err = errnoErr(e1)
} else {
err = syscall.EINVAL
}
}
return
}
func getNamedPipeHandleState(pipe syscall.Handle, state *uint32, curInstances *uint32, maxCollectionCount *uint32, collectDataTimeout *uint32, userName *uint16, maxUserNameSize uint32) (err error) {
r1, _, e1 := syscall.Syscall9(procGetNamedPipeHandleStateW.Addr(), 7, uintptr(pipe), uintptr(unsafe.Pointer(state)), uintptr(unsafe.Pointer(curInstances)), uintptr(unsafe.Pointer(maxCollectionCount)), uintptr(unsafe.Pointer(collectDataTimeout)), uintptr(unsafe.Pointer(userName)), uintptr(maxUserNameSize), 0, 0)
if r1 == 0 {
if e1 != 0 {
err = errnoErr(e1)
} else {
err = syscall.EINVAL
}
}
return
}
func localAlloc(uFlags uint32, length uint32) (ptr uintptr) {
r0, _, _ := syscall.Syscall(procLocalAlloc.Addr(), 2, uintptr(uFlags), uintptr(length), 0)
ptr = uintptr(r0)
return
}
func lookupAccountName(systemName *uint16, accountName string, sid *byte, sidSize *uint32, refDomain *uint16, refDomainSize *uint32, sidNameUse *uint32) (err error) {
var _p0 *uint16
_p0, err = syscall.UTF16PtrFromString(accountName)
if err != nil {
return
}
return _lookupAccountName(systemName, _p0, sid, sidSize, refDomain, refDomainSize, sidNameUse)
}
func _lookupAccountName(systemName *uint16, accountName *uint16, sid *byte, sidSize *uint32, refDomain *uint16, refDomainSize *uint32, sidNameUse *uint32) (err error) {
r1, _, e1 := syscall.Syscall9(procLookupAccountNameW.Addr(), 7, uintptr(unsafe.Pointer(systemName)), uintptr(unsafe.Pointer(accountName)), uintptr(unsafe.Pointer(sid)), uintptr(unsafe.Pointer(sidSize)), uintptr(unsafe.Pointer(refDomain)), uintptr(unsafe.Pointer(refDomainSize)), uintptr(unsafe.Pointer(sidNameUse)), 0, 0)
if r1 == 0 {
if e1 != 0 {
err = errnoErr(e1)
} else {
err = syscall.EINVAL
}
}
return
}
func convertSidToStringSid(sid *byte, str **uint16) (err error) {
r1, _, e1 := syscall.Syscall(procConvertSidToStringSidW.Addr(), 2, uintptr(unsafe.Pointer(sid)), uintptr(unsafe.Pointer(str)), 0)
if r1 == 0 {
if e1 != 0 {
err = errnoErr(e1)
} else {
err = syscall.EINVAL
}
}
return
}
func convertStringSecurityDescriptorToSecurityDescriptor(str string, revision uint32, sd *uintptr, size *uint32) (err error) {
var _p0 *uint16
_p0, err = syscall.UTF16PtrFromString(str)
if err != nil {
return
}
return _convertStringSecurityDescriptorToSecurityDescriptor(_p0, revision, sd, size)
}
func _convertStringSecurityDescriptorToSecurityDescriptor(str *uint16, revision uint32, sd *uintptr, size *uint32) (err error) {
r1, _, e1 := syscall.Syscall6(procConvertStringSecurityDescriptorToSecurityDescriptorW.Addr(), 4, uintptr(unsafe.Pointer(str)), uintptr(revision), uintptr(unsafe.Pointer(sd)), uintptr(unsafe.Pointer(size)), 0, 0)
if r1 == 0 {
if e1 != 0 {
err = errnoErr(e1)
} else {
err = syscall.EINVAL
}
}
return
}
func convertSecurityDescriptorToStringSecurityDescriptor(sd *byte, revision uint32, secInfo uint32, sddl **uint16, sddlSize *uint32) (err error) {
r1, _, e1 := syscall.Syscall6(procConvertSecurityDescriptorToStringSecurityDescriptorW.Addr(), 5, uintptr(unsafe.Pointer(sd)), uintptr(revision), uintptr(secInfo), uintptr(unsafe.Pointer(sddl)), uintptr(unsafe.Pointer(sddlSize)), 0)
if r1 == 0 {
if e1 != 0 {
err = errnoErr(e1)
} else {
err = syscall.EINVAL
}
}
return
}
func localFree(mem uintptr) {
syscall.Syscall(procLocalFree.Addr(), 1, uintptr(mem), 0, 0)
return
}
func getSecurityDescriptorLength(sd uintptr) (len uint32) {
r0, _, _ := syscall.Syscall(procGetSecurityDescriptorLength.Addr(), 1, uintptr(sd), 0, 0)
len = uint32(r0)
return
}
func getFileInformationByHandleEx(h syscall.Handle, class uint32, buffer *byte, size uint32) (err error) {
r1, _, e1 := syscall.Syscall6(procGetFileInformationByHandleEx.Addr(), 4, uintptr(h), uintptr(class), uintptr(unsafe.Pointer(buffer)), uintptr(size), 0, 0)
if r1 == 0 {
if e1 != 0 {
err = errnoErr(e1)
} else {
err = syscall.EINVAL
}
}
return
}
func setFileInformationByHandle(h syscall.Handle, class uint32, buffer *byte, size uint32) (err error) {
r1, _, e1 := syscall.Syscall6(procSetFileInformationByHandle.Addr(), 4, uintptr(h), uintptr(class), uintptr(unsafe.Pointer(buffer)), uintptr(size), 0, 0)
if r1 == 0 {
if e1 != 0 {
err = errnoErr(e1)
} else {
err = syscall.EINVAL
}
}
return
}
func adjustTokenPrivileges(token windows.Token, releaseAll bool, input *byte, outputSize uint32, output *byte, requiredSize *uint32) (success bool, err error) {
var _p0 uint32
if releaseAll {
_p0 = 1
} else {
_p0 = 0
}
r0, _, e1 := syscall.Syscall6(procAdjustTokenPrivileges.Addr(), 6, uintptr(token), uintptr(_p0), uintptr(unsafe.Pointer(input)), uintptr(outputSize), uintptr(unsafe.Pointer(output)), uintptr(unsafe.Pointer(requiredSize)))
success = r0 != 0
if true {
if e1 != 0 {
err = errnoErr(e1)
} else {
err = syscall.EINVAL
}
}
return
}
func impersonateSelf(level uint32) (err error) {
r1, _, e1 := syscall.Syscall(procImpersonateSelf.Addr(), 1, uintptr(level), 0, 0)
if r1 == 0 {
if e1 != 0 {
err = errnoErr(e1)
} else {
err = syscall.EINVAL
}
}
return
}
func revertToSelf() (err error) {
r1, _, e1 := syscall.Syscall(procRevertToSelf.Addr(), 0, 0, 0, 0)
if r1 == 0 {
if e1 != 0 {
err = errnoErr(e1)
} else {
err = syscall.EINVAL
}
}
return
}
func openThreadToken(thread syscall.Handle, accessMask uint32, openAsSelf bool, token *windows.Token) (err error) {
var _p0 uint32
if openAsSelf {
_p0 = 1
} else {
_p0 = 0
}
r1, _, e1 := syscall.Syscall6(procOpenThreadToken.Addr(), 4, uintptr(thread), uintptr(accessMask), uintptr(_p0), uintptr(unsafe.Pointer(token)), 0, 0)
if r1 == 0 {
if e1 != 0 {
err = errnoErr(e1)
} else {
err = syscall.EINVAL
}
}
return
}
func getCurrentThread() (h syscall.Handle) {
r0, _, _ := syscall.Syscall(procGetCurrentThread.Addr(), 0, 0, 0, 0)
h = syscall.Handle(r0)
return
}
func lookupPrivilegeValue(systemName string, name string, luid *uint64) (err error) {
var _p0 *uint16
_p0, err = syscall.UTF16PtrFromString(systemName)
if err != nil {
return
}
var _p1 *uint16
_p1, err = syscall.UTF16PtrFromString(name)
if err != nil {
return
}
return _lookupPrivilegeValue(_p0, _p1, luid)
}
func _lookupPrivilegeValue(systemName *uint16, name *uint16, luid *uint64) (err error) {
r1, _, e1 := syscall.Syscall(procLookupPrivilegeValueW.Addr(), 3, uintptr(unsafe.Pointer(systemName)), uintptr(unsafe.Pointer(name)), uintptr(unsafe.Pointer(luid)))
if r1 == 0 {
if e1 != 0 {
err = errnoErr(e1)
} else {
err = syscall.EINVAL
}
}
return
}
func lookupPrivilegeName(systemName string, luid *uint64, buffer *uint16, size *uint32) (err error) {
var _p0 *uint16
_p0, err = syscall.UTF16PtrFromString(systemName)
if err != nil {
return
}
return _lookupPrivilegeName(_p0, luid, buffer, size)
}
func _lookupPrivilegeName(systemName *uint16, luid *uint64, buffer *uint16, size *uint32) (err error) {
r1, _, e1 := syscall.Syscall6(procLookupPrivilegeNameW.Addr(), 4, uintptr(unsafe.Pointer(systemName)), uintptr(unsafe.Pointer(luid)), uintptr(unsafe.Pointer(buffer)), uintptr(unsafe.Pointer(size)), 0, 0)
if r1 == 0 {
if e1 != 0 {
err = errnoErr(e1)
} else {
err = syscall.EINVAL
}
}
return
}
func lookupPrivilegeDisplayName(systemName string, name *uint16, buffer *uint16, size *uint32, languageId *uint32) (err error) {
var _p0 *uint16
_p0, err = syscall.UTF16PtrFromString(systemName)
if err != nil {
return
}
return _lookupPrivilegeDisplayName(_p0, name, buffer, size, languageId)
}
func _lookupPrivilegeDisplayName(systemName *uint16, name *uint16, buffer *uint16, size *uint32, languageId *uint32) (err error) {
r1, _, e1 := syscall.Syscall6(procLookupPrivilegeDisplayNameW.Addr(), 5, uintptr(unsafe.Pointer(systemName)), uintptr(unsafe.Pointer(name)), uintptr(unsafe.Pointer(buffer)), uintptr(unsafe.Pointer(size)), uintptr(unsafe.Pointer(languageId)), 0)
if r1 == 0 {
if e1 != 0 {
err = errnoErr(e1)
} else {
err = syscall.EINVAL
}
}
return
}
func backupRead(h syscall.Handle, b []byte, bytesRead *uint32, abort bool, processSecurity bool, context *uintptr) (err error) {
var _p0 *byte
if len(b) > 0 {
_p0 = &b[0]
}
var _p1 uint32
if abort {
_p1 = 1
} else {
_p1 = 0
}
var _p2 uint32
if processSecurity {
_p2 = 1
} else {
_p2 = 0
}
r1, _, e1 := syscall.Syscall9(procBackupRead.Addr(), 7, uintptr(h), uintptr(unsafe.Pointer(_p0)), uintptr(len(b)), uintptr(unsafe.Pointer(bytesRead)), uintptr(_p1), uintptr(_p2), uintptr(unsafe.Pointer(context)), 0, 0)
if r1 == 0 {
if e1 != 0 {
err = errnoErr(e1)
} else {
err = syscall.EINVAL
}
}
return
}
func backupWrite(h syscall.Handle, b []byte, bytesWritten *uint32, abort bool, processSecurity bool, context *uintptr) (err error) {
var _p0 *byte
if len(b) > 0 {
_p0 = &b[0]
}
var _p1 uint32
if abort {
_p1 = 1
} else {
_p1 = 0
}
var _p2 uint32
if processSecurity {
_p2 = 1
} else {
_p2 = 0
}
r1, _, e1 := syscall.Syscall9(procBackupWrite.Addr(), 7, uintptr(h), uintptr(unsafe.Pointer(_p0)), uintptr(len(b)), uintptr(unsafe.Pointer(bytesWritten)), uintptr(_p1), uintptr(_p2), uintptr(unsafe.Pointer(context)), 0, 0)
if r1 == 0 {
if e1 != 0 {
err = errnoErr(e1)
} else {
err = syscall.EINVAL
}
}
return
}

1
vendor/github.com/Microsoft/hcsshim/.gitignore generated vendored Normal file
View File

@@ -0,0 +1 @@
*.exe

21
vendor/github.com/Microsoft/hcsshim/LICENSE generated vendored Normal file
View File

@@ -0,0 +1,21 @@
The MIT License (MIT)
Copyright (c) 2015 Microsoft
Permission is hereby granted, free of charge, to any person obtaining a copy
of this software and associated documentation files (the "Software"), to deal
in the Software without restriction, including without limitation the rights
to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
copies of the Software, and to permit persons to whom the Software is
furnished to do so, subject to the following conditions:
The above copyright notice and this permission notice shall be included in all
copies or substantial portions of the Software.
THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
SOFTWARE.

41
vendor/github.com/Microsoft/hcsshim/README.md generated vendored Normal file
View File

@@ -0,0 +1,41 @@
# hcsshim
[![Build status](https://ci.appveyor.com/api/projects/status/nbcw28mnkqml0loa/branch/master?svg=true)](https://ci.appveyor.com/project/WindowsVirtualization/hcsshim/branch/master)
This package contains the Golang interface for using the Windows [Host Compute Service](https://blogs.technet.microsoft.com/virtualization/2017/01/27/introducing-the-host-compute-service-hcs/) (HCS) to launch and manage [Windows Containers](https://docs.microsoft.com/en-us/virtualization/windowscontainers/about/). It also contains other helpers and functions for managing Windows Containers such as the Golang interface for the Host Network Service (HNS).
It is primarily used in the [Moby Project](https://github.com/moby/moby), but it can be freely used by other projects as well.
## Contributing
This project welcomes contributions and suggestions. Most contributions require you to agree to a
Contributor License Agreement (CLA) declaring that you have the right to, and actually do, grant us
the rights to use your contribution. For details, visit https://cla.microsoft.com.
When you submit a pull request, a CLA-bot will automatically determine whether you need to provide
a CLA and decorate the PR appropriately (e.g., label, comment). Simply follow the instructions
provided by the bot. You will only need to do this once across all repos using our CLA.
This project has adopted the [Microsoft Open Source Code of Conduct](https://opensource.microsoft.com/codeofconduct/).
For more information see the [Code of Conduct FAQ](https://opensource.microsoft.com/codeofconduct/faq/) or
contact [opencode@microsoft.com](mailto:opencode@microsoft.com) with any additional questions or comments.
## Dependencies
This project requires Golang 1.9 or newer to build.
For system requirements to run this project, see the Microsoft docs on [Windows Container requirements](https://docs.microsoft.com/en-us/virtualization/windowscontainers/deploy-containers/system-requirements).
## Reporting Security Issues
Security issues and bugs should be reported privately, via email, to the Microsoft Security
Response Center (MSRC) at [secure@microsoft.com](mailto:secure@microsoft.com). You should
receive a response within 24 hours. If for some reason you do not, please follow up via
email to ensure we received your original message. Further information, including the
[MSRC PGP](https://technet.microsoft.com/en-us/security/dn606155) key, can be found in
the [Security TechCenter](https://technet.microsoft.com/en-us/security/default).
For additional details, see [Report a Computer Security Vulnerability](https://technet.microsoft.com/en-us/security/ff852094.aspx) on Technet
---------------
Copyright (c) 2018 Microsoft Corp. All rights reserved.

19
vendor/github.com/Microsoft/hcsshim/appveyor.yml generated vendored Normal file
View File

@@ -0,0 +1,19 @@
version: 0.1.{build}
image: Visual Studio 2017
clone_folder: c:\gopath\src\github.com\Microsoft\hcsshim
environment:
GOPATH: c:\gopath
PATH: C:\mingw-w64\x86_64-7.2.0-posix-seh-rt_v5-rev1\mingw64\bin;%PATH%
build_script:
- go get -v -t ./...
- go build ./cmd/wclayer
- go build ./cmd/runhcs
- go test -v ./... -tags admin
artifacts:
- path: 'wclayer.exe'
- path: 'runhcs.exe'

192
vendor/github.com/Microsoft/hcsshim/container.go generated vendored Normal file
View File

@@ -0,0 +1,192 @@
package hcsshim
import (
"fmt"
"os"
"time"
"github.com/Microsoft/hcsshim/internal/hcs"
"github.com/Microsoft/hcsshim/internal/mergemaps"
"github.com/Microsoft/hcsshim/internal/schema1"
)
// ContainerProperties holds the properties for a container and the processes running in that container
type ContainerProperties = schema1.ContainerProperties
// MemoryStats holds the memory statistics for a container
type MemoryStats = schema1.MemoryStats
// ProcessorStats holds the processor statistics for a container
type ProcessorStats = schema1.ProcessorStats
// StorageStats holds the storage statistics for a container
type StorageStats = schema1.StorageStats
// NetworkStats holds the network statistics for a container
type NetworkStats = schema1.NetworkStats
// Statistics is the structure returned by a statistics call on a container
type Statistics = schema1.Statistics
// ProcessList is the structure of an item returned by a ProcessList call on a container
type ProcessListItem = schema1.ProcessListItem
// MappedVirtualDiskController is the structure of an item returned by a MappedVirtualDiskList call on a container
type MappedVirtualDiskController = schema1.MappedVirtualDiskController
// Type of Request Support in ModifySystem
type RequestType = schema1.RequestType
// Type of Resource Support in ModifySystem
type ResourceType = schema1.ResourceType
// RequestType const
const (
Add = schema1.Add
Remove = schema1.Remove
Network = schema1.Network
)
// ResourceModificationRequestResponse is the structure used to send request to the container to modify the system
// Supported resource types are Network and Request Types are Add/Remove
type ResourceModificationRequestResponse = schema1.ResourceModificationRequestResponse
type container struct {
system *hcs.System
}
// createComputeSystemAdditionalJSON is read from the environment at initialisation
// time. It allows an environment variable to define additional JSON which
// is merged in the CreateComputeSystem call to HCS.
var createContainerAdditionalJSON []byte
func init() {
createContainerAdditionalJSON = ([]byte)(os.Getenv("HCSSHIM_CREATECONTAINER_ADDITIONALJSON"))
}
// CreateContainer creates a new container with the given configuration but does not start it.
func CreateContainer(id string, c *ContainerConfig) (Container, error) {
fullConfig, err := mergemaps.MergeJSON(c, createContainerAdditionalJSON)
if err != nil {
return nil, fmt.Errorf("failed to merge additional JSON '%s': %s", createContainerAdditionalJSON, err)
}
system, err := hcs.CreateComputeSystem(id, fullConfig)
if err != nil {
return nil, err
}
return &container{system}, err
}
// OpenContainer opens an existing container by ID.
func OpenContainer(id string) (Container, error) {
system, err := hcs.OpenComputeSystem(id)
if err != nil {
return nil, err
}
return &container{system}, err
}
// GetContainers gets a list of the containers on the system that match the query
func GetContainers(q ComputeSystemQuery) ([]ContainerProperties, error) {
return hcs.GetComputeSystems(q)
}
// Start synchronously starts the container.
func (container *container) Start() error {
return convertSystemError(container.system.Start(), container)
}
// Shutdown requests a container shutdown, but it may not actually be shutdown until Wait() succeeds.
func (container *container) Shutdown() error {
return convertSystemError(container.system.Shutdown(), container)
}
// Terminate requests a container terminate, but it may not actually be terminated until Wait() succeeds.
func (container *container) Terminate() error {
return convertSystemError(container.system.Terminate(), container)
}
// Waits synchronously waits for the container to shutdown or terminate.
func (container *container) Wait() error {
return convertSystemError(container.system.Wait(), container)
}
// WaitTimeout synchronously waits for the container to terminate or the duration to elapse. It
// returns false if timeout occurs.
func (container *container) WaitTimeout(t time.Duration) error {
return convertSystemError(container.system.WaitTimeout(t), container)
}
// Pause pauses the execution of a container.
func (container *container) Pause() error {
return convertSystemError(container.system.Pause(), container)
}
// Resume resumes the execution of a container.
func (container *container) Resume() error {
return convertSystemError(container.system.Resume(), container)
}
// HasPendingUpdates returns true if the container has updates pending to install
func (container *container) HasPendingUpdates() (bool, error) {
return false, nil
}
// Statistics returns statistics for the container. This is a legacy v1 call
func (container *container) Statistics() (Statistics, error) {
properties, err := container.system.Properties(schema1.PropertyTypeStatistics)
if err != nil {
return Statistics{}, convertSystemError(err, container)
}
return properties.Statistics, nil
}
// ProcessList returns an array of ProcessListItems for the container. This is a legacy v1 call
func (container *container) ProcessList() ([]ProcessListItem, error) {
properties, err := container.system.Properties(schema1.PropertyTypeProcessList)
if err != nil {
return nil, convertSystemError(err, container)
}
return properties.ProcessList, nil
}
// This is a legacy v1 call
func (container *container) MappedVirtualDisks() (map[int]MappedVirtualDiskController, error) {
properties, err := container.system.Properties(schema1.PropertyTypeMappedVirtualDisk)
if err != nil {
return nil, convertSystemError(err, container)
}
return properties.MappedVirtualDiskControllers, nil
}
// CreateProcess launches a new process within the container.
func (container *container) CreateProcess(c *ProcessConfig) (Process, error) {
p, err := container.system.CreateProcess(c)
if err != nil {
return nil, convertSystemError(err, container)
}
return &process{p}, nil
}
// OpenProcess gets an interface to an existing process within the container.
func (container *container) OpenProcess(pid int) (Process, error) {
p, err := container.system.OpenProcess(pid)
if err != nil {
return nil, convertSystemError(err, container)
}
return &process{p}, nil
}
// Close cleans up any state associated with the container but does not terminate or wait for it.
func (container *container) Close() error {
return convertSystemError(container.system.Close(), container)
}
// Modify the System
func (container *container) Modify(config *ResourceModificationRequestResponse) error {
return convertSystemError(container.system.Modify(config), container)
}

257
vendor/github.com/Microsoft/hcsshim/errors.go generated vendored Normal file
View File

@@ -0,0 +1,257 @@
package hcsshim
import (
"fmt"
"syscall"
"github.com/Microsoft/hcsshim/internal/hns"
"github.com/Microsoft/hcsshim/internal/hcs"
"github.com/Microsoft/hcsshim/internal/hcserror"
)
var (
// ErrComputeSystemDoesNotExist is an error encountered when the container being operated on no longer exists = hcs.exist
ErrComputeSystemDoesNotExist = hcs.ErrComputeSystemDoesNotExist
// ErrElementNotFound is an error encountered when the object being referenced does not exist
ErrElementNotFound = hcs.ErrElementNotFound
// ErrElementNotFound is an error encountered when the object being referenced does not exist
ErrNotSupported = hcs.ErrNotSupported
// ErrInvalidData is an error encountered when the request being sent to hcs is invalid/unsupported
// decimal -2147024883 / hex 0x8007000d
ErrInvalidData = hcs.ErrInvalidData
// ErrHandleClose is an error encountered when the handle generating the notification being waited on has been closed
ErrHandleClose = hcs.ErrHandleClose
// ErrAlreadyClosed is an error encountered when using a handle that has been closed by the Close method
ErrAlreadyClosed = hcs.ErrAlreadyClosed
// ErrInvalidNotificationType is an error encountered when an invalid notification type is used
ErrInvalidNotificationType = hcs.ErrInvalidNotificationType
// ErrInvalidProcessState is an error encountered when the process is not in a valid state for the requested operation
ErrInvalidProcessState = hcs.ErrInvalidProcessState
// ErrTimeout is an error encountered when waiting on a notification times out
ErrTimeout = hcs.ErrTimeout
// ErrUnexpectedContainerExit is the error encountered when a container exits while waiting for
// a different expected notification
ErrUnexpectedContainerExit = hcs.ErrUnexpectedContainerExit
// ErrUnexpectedProcessAbort is the error encountered when communication with the compute service
// is lost while waiting for a notification
ErrUnexpectedProcessAbort = hcs.ErrUnexpectedProcessAbort
// ErrUnexpectedValue is an error encountered when hcs returns an invalid value
ErrUnexpectedValue = hcs.ErrUnexpectedValue
// ErrVmcomputeAlreadyStopped is an error encountered when a shutdown or terminate request is made on a stopped container
ErrVmcomputeAlreadyStopped = hcs.ErrVmcomputeAlreadyStopped
// ErrVmcomputeOperationPending is an error encountered when the operation is being completed asynchronously
ErrVmcomputeOperationPending = hcs.ErrVmcomputeOperationPending
// ErrVmcomputeOperationInvalidState is an error encountered when the compute system is not in a valid state for the requested operation
ErrVmcomputeOperationInvalidState = hcs.ErrVmcomputeOperationInvalidState
// ErrProcNotFound is an error encountered when the the process cannot be found
ErrProcNotFound = hcs.ErrProcNotFound
// ErrVmcomputeOperationAccessIsDenied is an error which can be encountered when enumerating compute systems in RS1/RS2
// builds when the underlying silo might be in the process of terminating. HCS was fixed in RS3.
ErrVmcomputeOperationAccessIsDenied = hcs.ErrVmcomputeOperationAccessIsDenied
// ErrVmcomputeInvalidJSON is an error encountered when the compute system does not support/understand the messages sent by management
ErrVmcomputeInvalidJSON = hcs.ErrVmcomputeInvalidJSON
// ErrVmcomputeUnknownMessage is an error encountered guest compute system doesn't support the message
ErrVmcomputeUnknownMessage = hcs.ErrVmcomputeUnknownMessage
// ErrNotSupported is an error encountered when hcs doesn't support the request
ErrPlatformNotSupported = hcs.ErrPlatformNotSupported
)
type EndpointNotFoundError = hns.EndpointNotFoundError
type NetworkNotFoundError = hns.NetworkNotFoundError
// ProcessError is an error encountered in HCS during an operation on a Process object
type ProcessError struct {
Process *process
Operation string
ExtraInfo string
Err error
Events []hcs.ErrorEvent
}
// ContainerError is an error encountered in HCS during an operation on a Container object
type ContainerError struct {
Container *container
Operation string
ExtraInfo string
Err error
Events []hcs.ErrorEvent
}
func (e *ContainerError) Error() string {
if e == nil {
return "<nil>"
}
if e.Container == nil {
return "unexpected nil container for error: " + e.Err.Error()
}
s := "container " + e.Container.system.ID()
if e.Operation != "" {
s += " encountered an error during " + e.Operation
}
switch e.Err.(type) {
case nil:
break
case syscall.Errno:
s += fmt.Sprintf(": failure in a Windows system call: %s (0x%x)", e.Err, hcserror.Win32FromError(e.Err))
default:
s += fmt.Sprintf(": %s", e.Err.Error())
}
for _, ev := range e.Events {
s += "\n" + ev.String()
}
if e.ExtraInfo != "" {
s += " extra info: " + e.ExtraInfo
}
return s
}
func makeContainerError(container *container, operation string, extraInfo string, err error) error {
// Don't double wrap errors
if _, ok := err.(*ContainerError); ok {
return err
}
containerError := &ContainerError{Container: container, Operation: operation, ExtraInfo: extraInfo, Err: err}
return containerError
}
func (e *ProcessError) Error() string {
if e == nil {
return "<nil>"
}
if e.Process == nil {
return "Unexpected nil process for error: " + e.Err.Error()
}
s := fmt.Sprintf("process %d in container %s", e.Process.p.Pid(), e.Process.p.SystemID())
if e.Operation != "" {
s += " encountered an error during " + e.Operation
}
switch e.Err.(type) {
case nil:
break
case syscall.Errno:
s += fmt.Sprintf(": failure in a Windows system call: %s (0x%x)", e.Err, hcserror.Win32FromError(e.Err))
default:
s += fmt.Sprintf(": %s", e.Err.Error())
}
for _, ev := range e.Events {
s += "\n" + ev.String()
}
return s
}
func makeProcessError(process *process, operation string, extraInfo string, err error) error {
// Don't double wrap errors
if _, ok := err.(*ProcessError); ok {
return err
}
processError := &ProcessError{Process: process, Operation: operation, ExtraInfo: extraInfo, Err: err}
return processError
}
// IsNotExist checks if an error is caused by the Container or Process not existing.
// Note: Currently, ErrElementNotFound can mean that a Process has either
// already exited, or does not exist. Both IsAlreadyStopped and IsNotExist
// will currently return true when the error is ErrElementNotFound or ErrProcNotFound.
func IsNotExist(err error) bool {
if _, ok := err.(EndpointNotFoundError); ok {
return true
}
if _, ok := err.(NetworkNotFoundError); ok {
return true
}
return hcs.IsNotExist(getInnerError(err))
}
// IsAlreadyClosed checks if an error is caused by the Container or Process having been
// already closed by a call to the Close() method.
func IsAlreadyClosed(err error) bool {
return hcs.IsAlreadyClosed(getInnerError(err))
}
// IsPending returns a boolean indicating whether the error is that
// the requested operation is being completed in the background.
func IsPending(err error) bool {
return hcs.IsPending(getInnerError(err))
}
// IsTimeout returns a boolean indicating whether the error is caused by
// a timeout waiting for the operation to complete.
func IsTimeout(err error) bool {
return hcs.IsTimeout(getInnerError(err))
}
// IsAlreadyStopped returns a boolean indicating whether the error is caused by
// a Container or Process being already stopped.
// Note: Currently, ErrElementNotFound can mean that a Process has either
// already exited, or does not exist. Both IsAlreadyStopped and IsNotExist
// will currently return true when the error is ErrElementNotFound or ErrProcNotFound.
func IsAlreadyStopped(err error) bool {
return hcs.IsAlreadyStopped(getInnerError(err))
}
// IsNotSupported returns a boolean indicating whether the error is caused by
// unsupported platform requests
// Note: Currently Unsupported platform requests can be mean either
// ErrVmcomputeInvalidJSON, ErrInvalidData, ErrNotSupported or ErrVmcomputeUnknownMessage
// is thrown from the Platform
func IsNotSupported(err error) bool {
return hcs.IsNotSupported(getInnerError(err))
}
func getInnerError(err error) error {
switch pe := err.(type) {
case nil:
return nil
case *ContainerError:
err = pe.Err
case *ProcessError:
err = pe.Err
}
return err
}
func convertSystemError(err error, c *container) error {
if serr, ok := err.(*hcs.SystemError); ok {
return &ContainerError{Container: c, Operation: serr.Op, ExtraInfo: serr.Extra, Err: serr.Err, Events: serr.Events}
}
return err
}
func convertProcessError(err error, p *process) error {
if perr, ok := err.(*hcs.ProcessError); ok {
return &ProcessError{Process: p, Operation: perr.Op, Err: perr.Err, Events: perr.Events}
}
return err
}

View File

@@ -0,0 +1,12 @@
# Requirements so far:
# dockerd running
# - image microsoft/nanoserver (matching host base image) docker load -i c:\baseimages\nanoserver.tar
# - image alpine (linux) docker pull --platform=linux alpine
# TODO: Add this a parameter for debugging. ie "functional-tests -debug=$true"
#$env:HCSSHIM_FUNCTIONAL_TESTS_DEBUG="yes please"
#pushd uvm
go test -v -tags "functional uvmcreate uvmscratch uvmscsi uvmvpmem uvmvsmb uvmp9" ./...
#popd

28
vendor/github.com/Microsoft/hcsshim/hcsshim.go generated vendored Normal file
View File

@@ -0,0 +1,28 @@
// Shim for the Host Compute Service (HCS) to manage Windows Server
// containers and Hyper-V containers.
package hcsshim
import (
"syscall"
"github.com/Microsoft/hcsshim/internal/hcserror"
)
//go:generate go run mksyscall_windows.go -output zsyscall_windows.go hcsshim.go
//sys SetCurrentThreadCompartmentId(compartmentId uint32) (hr error) = iphlpapi.SetCurrentThreadCompartmentId
const (
// Specific user-visible exit codes
WaitErrExecFailed = 32767
ERROR_GEN_FAILURE = hcserror.ERROR_GEN_FAILURE
ERROR_SHUTDOWN_IN_PROGRESS = syscall.Errno(1115)
WSAEINVAL = syscall.Errno(10022)
// Timeout on wait calls
TimeoutInfinite = 0xFFFFFFFF
)
type HcsError = hcserror.HcsError

91
vendor/github.com/Microsoft/hcsshim/hnsendpoint.go generated vendored Normal file
View File

@@ -0,0 +1,91 @@
package hcsshim
import (
"github.com/Microsoft/hcsshim/internal/hns"
)
// HNSEndpoint represents a network endpoint in HNS
type HNSEndpoint = hns.HNSEndpoint
//SystemType represents the type of the system on which actions are done
type SystemType string
// SystemType const
const (
ContainerType SystemType = "Container"
VirtualMachineType SystemType = "VirtualMachine"
HostType SystemType = "Host"
)
// EndpointAttachDetachRequest is the structure used to send request to the container to modify the system
// Supported resource types are Network and Request Types are Add/Remove
type EndpointAttachDetachRequest = hns.EndpointAttachDetachRequest
// EndpointResquestResponse is object to get the endpoint request response
type EndpointResquestResponse = hns.EndpointResquestResponse
// HNSEndpointRequest makes a HNS call to modify/query a network endpoint
func HNSEndpointRequest(method, path, request string) (*HNSEndpoint, error) {
return hns.HNSEndpointRequest(method, path, request)
}
// HNSListEndpointRequest makes a HNS call to query the list of available endpoints
func HNSListEndpointRequest() ([]HNSEndpoint, error) {
return hns.HNSListEndpointRequest()
}
// HotAttachEndpoint makes a HCS Call to attach the endpoint to the container
func HotAttachEndpoint(containerID string, endpointID string) error {
return modifyNetworkEndpoint(containerID, endpointID, Add)
}
// HotDetachEndpoint makes a HCS Call to detach the endpoint from the container
func HotDetachEndpoint(containerID string, endpointID string) error {
return modifyNetworkEndpoint(containerID, endpointID, Remove)
}
// ModifyContainer corresponding to the container id, by sending a request
func modifyContainer(id string, request *ResourceModificationRequestResponse) error {
container, err := OpenContainer(id)
if err != nil {
if IsNotExist(err) {
return ErrComputeSystemDoesNotExist
}
return getInnerError(err)
}
defer container.Close()
err = container.Modify(request)
if err != nil {
if IsNotSupported(err) {
return ErrPlatformNotSupported
}
return getInnerError(err)
}
return nil
}
func modifyNetworkEndpoint(containerID string, endpointID string, request RequestType) error {
requestMessage := &ResourceModificationRequestResponse{
Resource: Network,
Request: request,
Data: endpointID,
}
err := modifyContainer(containerID, requestMessage)
if err != nil {
return err
}
return nil
}
// GetHNSEndpointByID get the Endpoint by ID
func GetHNSEndpointByID(endpointID string) (*HNSEndpoint, error) {
return hns.GetHNSEndpointByID(endpointID)
}
// GetHNSEndpointByName gets the endpoint filtered by Name
func GetHNSEndpointByName(endpointName string) (*HNSEndpoint, error) {
return hns.GetHNSEndpointByName(endpointName)
}

16
vendor/github.com/Microsoft/hcsshim/hnsglobals.go generated vendored Normal file
View File

@@ -0,0 +1,16 @@
package hcsshim
import (
"github.com/Microsoft/hcsshim/internal/hns"
)
type HNSGlobals = hns.HNSGlobals
type HNSVersion = hns.HNSVersion
var (
HNSVersion1803 = hns.HNSVersion1803
)
func GetHNSGlobals() (*HNSGlobals, error) {
return hns.GetHNSGlobals()
}

36
vendor/github.com/Microsoft/hcsshim/hnsnetwork.go generated vendored Normal file
View File

@@ -0,0 +1,36 @@
package hcsshim
import (
"github.com/Microsoft/hcsshim/internal/hns"
)
// Subnet is assoicated with a network and represents a list
// of subnets available to the network
type Subnet = hns.Subnet
// MacPool is assoicated with a network and represents a list
// of macaddresses available to the network
type MacPool = hns.MacPool
// HNSNetwork represents a network in HNS
type HNSNetwork = hns.HNSNetwork
// HNSNetworkRequest makes a call into HNS to update/query a single network
func HNSNetworkRequest(method, path, request string) (*HNSNetwork, error) {
return hns.HNSNetworkRequest(method, path, request)
}
// HNSListNetworkRequest makes a HNS call to query the list of available networks
func HNSListNetworkRequest(method, path, request string) ([]HNSNetwork, error) {
return hns.HNSListNetworkRequest(method, path, request)
}
// GetHNSNetworkByID
func GetHNSNetworkByID(networkID string) (*HNSNetwork, error) {
return hns.GetHNSNetworkByID(networkID)
}
// GetHNSNetworkName filtered by Name
func GetHNSNetworkByName(networkName string) (*HNSNetwork, error) {
return hns.GetHNSNetworkByName(networkName)
}

57
vendor/github.com/Microsoft/hcsshim/hnspolicy.go generated vendored Normal file
View File

@@ -0,0 +1,57 @@
package hcsshim
import (
"github.com/Microsoft/hcsshim/internal/hns"
)
// Type of Request Support in ModifySystem
type PolicyType = hns.PolicyType
// RequestType const
const (
Nat = hns.Nat
ACL = hns.ACL
PA = hns.PA
VLAN = hns.VLAN
VSID = hns.VSID
VNet = hns.VNet
L2Driver = hns.L2Driver
Isolation = hns.Isolation
QOS = hns.QOS
OutboundNat = hns.OutboundNat
ExternalLoadBalancer = hns.ExternalLoadBalancer
Route = hns.Route
)
type NatPolicy = hns.NatPolicy
type QosPolicy = hns.QosPolicy
type IsolationPolicy = hns.IsolationPolicy
type VlanPolicy = hns.VlanPolicy
type VsidPolicy = hns.VsidPolicy
type PaPolicy = hns.PaPolicy
type OutboundNatPolicy = hns.OutboundNatPolicy
type ActionType = hns.ActionType
type DirectionType = hns.DirectionType
type RuleType = hns.RuleType
const (
Allow = hns.Allow
Block = hns.Block
In = hns.In
Out = hns.Out
Host = hns.Host
Switch = hns.Switch
)
type ACLPolicy = hns.ACLPolicy
type Policy = hns.Policy

47
vendor/github.com/Microsoft/hcsshim/hnspolicylist.go generated vendored Normal file
View File

@@ -0,0 +1,47 @@
package hcsshim
import (
"github.com/Microsoft/hcsshim/internal/hns"
)
// RoutePolicy is a structure defining schema for Route based Policy
type RoutePolicy = hns.RoutePolicy
// ELBPolicy is a structure defining schema for ELB LoadBalancing based Policy
type ELBPolicy = hns.ELBPolicy
// LBPolicy is a structure defining schema for LoadBalancing based Policy
type LBPolicy = hns.LBPolicy
// PolicyList is a structure defining schema for Policy list request
type PolicyList = hns.PolicyList
// HNSPolicyListRequest makes a call into HNS to update/query a single network
func HNSPolicyListRequest(method, path, request string) (*PolicyList, error) {
return hns.HNSPolicyListRequest(method, path, request)
}
// HNSListPolicyListRequest gets all the policy list
func HNSListPolicyListRequest() ([]PolicyList, error) {
return hns.HNSListPolicyListRequest()
}
// PolicyListRequest makes a HNS call to modify/query a network policy list
func PolicyListRequest(method, path, request string) (*PolicyList, error) {
return hns.PolicyListRequest(method, path, request)
}
// GetPolicyListByID get the policy list by ID
func GetPolicyListByID(policyListID string) (*PolicyList, error) {
return hns.GetPolicyListByID(policyListID)
}
// AddLoadBalancer policy list for the specified endpoints
func AddLoadBalancer(endpoints []HNSEndpoint, isILB bool, sourceVIP, vip string, protocol uint16, internalPort uint16, externalPort uint16) (*PolicyList, error) {
return hns.AddLoadBalancer(endpoints, isILB, sourceVIP, vip, protocol, internalPort, externalPort)
}
// AddRoute adds route policy list for the specified endpoints
func AddRoute(endpoints []HNSEndpoint, destinationPrefix string, nextHop string, encapEnabled bool) (*PolicyList, error) {
return hns.AddRoute(endpoints, destinationPrefix, nextHop, encapEnabled)
}

13
vendor/github.com/Microsoft/hcsshim/hnssupport.go generated vendored Normal file
View File

@@ -0,0 +1,13 @@
package hcsshim
import (
"github.com/Microsoft/hcsshim/internal/hns"
)
type HNSSupportedFeatures = hns.HNSSupportedFeatures
type HNSAclFeatures = hns.HNSAclFeatures
func GetHNSSupportedFeatures() HNSSupportedFeatures {
return hns.GetHNSSupportedFeatures()
}

109
vendor/github.com/Microsoft/hcsshim/interface.go generated vendored Normal file
View File

@@ -0,0 +1,109 @@
package hcsshim
import (
"io"
"time"
"github.com/Microsoft/hcsshim/internal/schema1"
)
// ProcessConfig is used as both the input of Container.CreateProcess
// and to convert the parameters to JSON for passing onto the HCS
type ProcessConfig = schema1.ProcessConfig
type Layer = schema1.Layer
type MappedDir = schema1.MappedDir
type MappedPipe = schema1.MappedPipe
type HvRuntime = schema1.HvRuntime
type MappedVirtualDisk = schema1.MappedVirtualDisk
// ContainerConfig is used as both the input of CreateContainer
// and to convert the parameters to JSON for passing onto the HCS
type ContainerConfig = schema1.ContainerConfig
type ComputeSystemQuery = schema1.ComputeSystemQuery
// Container represents a created (but not necessarily running) container.
type Container interface {
// Start synchronously starts the container.
Start() error
// Shutdown requests a container shutdown, but it may not actually be shutdown until Wait() succeeds.
Shutdown() error
// Terminate requests a container terminate, but it may not actually be terminated until Wait() succeeds.
Terminate() error
// Waits synchronously waits for the container to shutdown or terminate.
Wait() error
// WaitTimeout synchronously waits for the container to terminate or the duration to elapse. It
// returns false if timeout occurs.
WaitTimeout(time.Duration) error
// Pause pauses the execution of a container.
Pause() error
// Resume resumes the execution of a container.
Resume() error
// HasPendingUpdates returns true if the container has updates pending to install.
HasPendingUpdates() (bool, error)
// Statistics returns statistics for a container.
Statistics() (Statistics, error)
// ProcessList returns details for the processes in a container.
ProcessList() ([]ProcessListItem, error)
// MappedVirtualDisks returns virtual disks mapped to a utility VM, indexed by controller
MappedVirtualDisks() (map[int]MappedVirtualDiskController, error)
// CreateProcess launches a new process within the container.
CreateProcess(c *ProcessConfig) (Process, error)
// OpenProcess gets an interface to an existing process within the container.
OpenProcess(pid int) (Process, error)
// Close cleans up any state associated with the container but does not terminate or wait for it.
Close() error
// Modify the System
Modify(config *ResourceModificationRequestResponse) error
}
// Process represents a running or exited process.
type Process interface {
// Pid returns the process ID of the process within the container.
Pid() int
// Kill signals the process to terminate but does not wait for it to finish terminating.
Kill() error
// Wait waits for the process to exit.
Wait() error
// WaitTimeout waits for the process to exit or the duration to elapse. It returns
// false if timeout occurs.
WaitTimeout(time.Duration) error
// ExitCode returns the exit code of the process. The process must have
// already terminated.
ExitCode() (int, error)
// ResizeConsole resizes the console of the process.
ResizeConsole(width, height uint16) error
// Stdio returns the stdin, stdout, and stderr pipes, respectively. Closing
// these pipes does not close the underlying pipes; it should be possible to
// call this multiple times to get multiple interfaces.
Stdio() (io.WriteCloser, io.ReadCloser, io.ReadCloser, error)
// CloseStdin closes the write side of the stdin pipe so that the process is
// notified on the read side that there is no more data in stdin.
CloseStdin() error
// Close cleans up any state associated with the process but does not kill
// or wait on it.
Close() error
}

View File

@@ -0,0 +1,69 @@
package guid
import (
"crypto/rand"
"encoding/json"
"fmt"
"io"
"strconv"
"strings"
)
var _ = (json.Marshaler)(&GUID{})
var _ = (json.Unmarshaler)(&GUID{})
type GUID [16]byte
func New() GUID {
g := GUID{}
_, err := io.ReadFull(rand.Reader, g[:])
if err != nil {
panic(err)
}
return g
}
func (g GUID) String() string {
return fmt.Sprintf("%02x%02x%02x%02x-%02x%02x-%02x%02x-%02x-%02x", g[3], g[2], g[1], g[0], g[5], g[4], g[7], g[6], g[8:10], g[10:])
}
func FromString(s string) GUID {
if len(s) != 36 {
panic(fmt.Sprintf("invalid GUID length: %d", len(s)))
}
if s[8] != '-' || s[13] != '-' || s[18] != '-' || s[23] != '-' {
panic("invalid GUID format")
}
indexOrder := [16]int{
0, 2, 4, 6,
9, 11,
14, 16,
19, 21,
24, 26, 28, 30, 32, 34,
}
byteOrder := [16]int{
3, 2, 1, 0,
5, 4,
7, 6,
8, 9,
10, 11, 12, 13, 14, 15,
}
var g GUID
for i, x := range indexOrder {
b, err := strconv.ParseInt(s[x:x+2], 16, 16)
if err != nil {
panic(err)
}
g[byteOrder[i]] = byte(b)
}
return g
}
func (g GUID) MarshalJSON() ([]byte, error) {
return json.Marshal(g.String())
}
func (g *GUID) UnmarshalJSON(data []byte) error {
*g = FromString(strings.Trim(string(data), "\""))
return nil
}

View File

@@ -0,0 +1,81 @@
package hcs
import (
"sync"
"syscall"
"github.com/Microsoft/hcsshim/internal/interop"
)
var (
nextCallback uintptr
callbackMap = map[uintptr]*notifcationWatcherContext{}
callbackMapLock = sync.RWMutex{}
notificationWatcherCallback = syscall.NewCallback(notificationWatcher)
// Notifications for HCS_SYSTEM handles
hcsNotificationSystemExited hcsNotification = 0x00000001
hcsNotificationSystemCreateCompleted hcsNotification = 0x00000002
hcsNotificationSystemStartCompleted hcsNotification = 0x00000003
hcsNotificationSystemPauseCompleted hcsNotification = 0x00000004
hcsNotificationSystemResumeCompleted hcsNotification = 0x00000005
// Notifications for HCS_PROCESS handles
hcsNotificationProcessExited hcsNotification = 0x00010000
// Common notifications
hcsNotificationInvalid hcsNotification = 0x00000000
hcsNotificationServiceDisconnect hcsNotification = 0x01000000
)
type hcsNotification uint32
type notificationChannel chan error
type notifcationWatcherContext struct {
channels notificationChannels
handle hcsCallback
}
type notificationChannels map[hcsNotification]notificationChannel
func newChannels() notificationChannels {
channels := make(notificationChannels)
channels[hcsNotificationSystemExited] = make(notificationChannel, 1)
channels[hcsNotificationSystemCreateCompleted] = make(notificationChannel, 1)
channels[hcsNotificationSystemStartCompleted] = make(notificationChannel, 1)
channels[hcsNotificationSystemPauseCompleted] = make(notificationChannel, 1)
channels[hcsNotificationSystemResumeCompleted] = make(notificationChannel, 1)
channels[hcsNotificationProcessExited] = make(notificationChannel, 1)
channels[hcsNotificationServiceDisconnect] = make(notificationChannel, 1)
return channels
}
func closeChannels(channels notificationChannels) {
close(channels[hcsNotificationSystemExited])
close(channels[hcsNotificationSystemCreateCompleted])
close(channels[hcsNotificationSystemStartCompleted])
close(channels[hcsNotificationSystemPauseCompleted])
close(channels[hcsNotificationSystemResumeCompleted])
close(channels[hcsNotificationProcessExited])
close(channels[hcsNotificationServiceDisconnect])
}
func notificationWatcher(notificationType hcsNotification, callbackNumber uintptr, notificationStatus uintptr, notificationData *uint16) uintptr {
var result error
if int32(notificationStatus) < 0 {
result = interop.Win32FromHresult(notificationStatus)
}
callbackMapLock.RLock()
context := callbackMap[callbackNumber]
callbackMapLock.RUnlock()
if context == nil {
return 0
}
context.channels[notificationType] <- result
return 0
}

View File

@@ -0,0 +1,7 @@
package hcs
import "C"
// This import is needed to make the library compile as CGO because HCSSHIM
// only works with CGO due to callbacks from HCS comming back from a C thread
// which is not supported without CGO. See https://github.com/golang/go/issues/10973

View File

@@ -0,0 +1,279 @@
package hcs
import (
"encoding/json"
"errors"
"fmt"
"syscall"
"github.com/Microsoft/hcsshim/internal/interop"
"github.com/sirupsen/logrus"
)
var (
// ErrComputeSystemDoesNotExist is an error encountered when the container being operated on no longer exists
ErrComputeSystemDoesNotExist = syscall.Errno(0xc037010e)
// ErrElementNotFound is an error encountered when the object being referenced does not exist
ErrElementNotFound = syscall.Errno(0x490)
// ErrElementNotFound is an error encountered when the object being referenced does not exist
ErrNotSupported = syscall.Errno(0x32)
// ErrInvalidData is an error encountered when the request being sent to hcs is invalid/unsupported
// decimal -2147024883 / hex 0x8007000d
ErrInvalidData = syscall.Errno(0xd)
// ErrHandleClose is an error encountered when the handle generating the notification being waited on has been closed
ErrHandleClose = errors.New("hcsshim: the handle generating this notification has been closed")
// ErrAlreadyClosed is an error encountered when using a handle that has been closed by the Close method
ErrAlreadyClosed = errors.New("hcsshim: the handle has already been closed")
// ErrInvalidNotificationType is an error encountered when an invalid notification type is used
ErrInvalidNotificationType = errors.New("hcsshim: invalid notification type")
// ErrInvalidProcessState is an error encountered when the process is not in a valid state for the requested operation
ErrInvalidProcessState = errors.New("the process is in an invalid state for the attempted operation")
// ErrTimeout is an error encountered when waiting on a notification times out
ErrTimeout = errors.New("hcsshim: timeout waiting for notification")
// ErrUnexpectedContainerExit is the error encountered when a container exits while waiting for
// a different expected notification
ErrUnexpectedContainerExit = errors.New("unexpected container exit")
// ErrUnexpectedProcessAbort is the error encountered when communication with the compute service
// is lost while waiting for a notification
ErrUnexpectedProcessAbort = errors.New("lost communication with compute service")
// ErrUnexpectedValue is an error encountered when hcs returns an invalid value
ErrUnexpectedValue = errors.New("unexpected value returned from hcs")
// ErrVmcomputeAlreadyStopped is an error encountered when a shutdown or terminate request is made on a stopped container
ErrVmcomputeAlreadyStopped = syscall.Errno(0xc0370110)
// ErrVmcomputeOperationPending is an error encountered when the operation is being completed asynchronously
ErrVmcomputeOperationPending = syscall.Errno(0xC0370103)
// ErrVmcomputeOperationInvalidState is an error encountered when the compute system is not in a valid state for the requested operation
ErrVmcomputeOperationInvalidState = syscall.Errno(0xc0370105)
// ErrProcNotFound is an error encountered when the the process cannot be found
ErrProcNotFound = syscall.Errno(0x7f)
// ErrVmcomputeOperationAccessIsDenied is an error which can be encountered when enumerating compute systems in RS1/RS2
// builds when the underlying silo might be in the process of terminating. HCS was fixed in RS3.
ErrVmcomputeOperationAccessIsDenied = syscall.Errno(0x5)
// ErrVmcomputeInvalidJSON is an error encountered when the compute system does not support/understand the messages sent by management
ErrVmcomputeInvalidJSON = syscall.Errno(0xc037010d)
// ErrVmcomputeUnknownMessage is an error encountered guest compute system doesn't support the message
ErrVmcomputeUnknownMessage = syscall.Errno(0xc037010b)
// ErrNotSupported is an error encountered when hcs doesn't support the request
ErrPlatformNotSupported = errors.New("unsupported platform request")
)
type ErrorEvent struct {
Message string `json:"Message,omitempty"` // Fully formated error message
StackTrace string `json:"StackTrace,omitempty"` // Stack trace in string form
Provider string `json:"Provider,omitempty"`
EventID uint16 `json:"EventId,omitempty"`
Flags uint32 `json:"Flags,omitempty"`
Source string `json:"Source,omitempty"`
//Data []EventData `json:"Data,omitempty"` // Omit this as HCS doesn't encode this well. It's more confusing to include. It is however logged in debug mode (see processHcsResult function)
}
type hcsResult struct {
Error int32
ErrorMessage string
ErrorEvents []ErrorEvent `json:"ErrorEvents,omitempty"`
}
func (ev *ErrorEvent) String() string {
evs := "[Event Detail: " + ev.Message
if ev.StackTrace != "" {
evs += " Stack Trace: " + ev.StackTrace
}
if ev.Provider != "" {
evs += " Provider: " + ev.Provider
}
if ev.EventID != 0 {
evs = fmt.Sprintf("%s EventID: %d", evs, ev.EventID)
}
if ev.Flags != 0 {
evs = fmt.Sprintf("%s flags: %d", evs, ev.Flags)
}
if ev.Source != "" {
evs += " Source: " + ev.Source
}
evs += "]"
return evs
}
func processHcsResult(resultp *uint16) []ErrorEvent {
if resultp != nil {
resultj := interop.ConvertAndFreeCoTaskMemString(resultp)
logrus.Debugf("Result: %s", resultj)
result := &hcsResult{}
if err := json.Unmarshal([]byte(resultj), result); err != nil {
logrus.Warnf("Could not unmarshal HCS result %s: %s", resultj, err)
return nil
}
return result.ErrorEvents
}
return nil
}
type HcsError struct {
Op string
Err error
Events []ErrorEvent
}
func (e *HcsError) Error() string {
s := e.Op + ": " + e.Err.Error()
for _, ev := range e.Events {
s += "\n" + ev.String()
}
return s
}
// ProcessError is an error encountered in HCS during an operation on a Process object
type ProcessError struct {
SystemID string
Pid int
Op string
Err error
Events []ErrorEvent
}
// SystemError is an error encountered in HCS during an operation on a Container object
type SystemError struct {
ID string
Op string
Err error
Extra string
Events []ErrorEvent
}
func (e *SystemError) Error() string {
s := e.Op + " " + e.ID + ": " + e.Err.Error()
for _, ev := range e.Events {
s += "\n" + ev.String()
}
if e.Extra != "" {
s += "\n(extra info: " + e.Extra + ")"
}
return s
}
func makeSystemError(system *System, op string, extra string, err error, events []ErrorEvent) error {
// Don't double wrap errors
if _, ok := err.(*SystemError); ok {
return err
}
return &SystemError{
ID: system.ID(),
Op: op,
Extra: extra,
Err: err,
Events: events,
}
}
func (e *ProcessError) Error() string {
s := fmt.Sprintf("%s %s:%d: %s", e.Op, e.SystemID, e.Pid, e.Err.Error())
for _, ev := range e.Events {
s += "\n" + ev.String()
}
return s
}
func makeProcessError(process *Process, op string, err error, events []ErrorEvent) error {
// Don't double wrap errors
if _, ok := err.(*ProcessError); ok {
return err
}
return &ProcessError{
Pid: process.Pid(),
SystemID: process.SystemID(),
Op: op,
Err: err,
Events: events,
}
}
// IsNotExist checks if an error is caused by the Container or Process not existing.
// Note: Currently, ErrElementNotFound can mean that a Process has either
// already exited, or does not exist. Both IsAlreadyStopped and IsNotExist
// will currently return true when the error is ErrElementNotFound or ErrProcNotFound.
func IsNotExist(err error) bool {
err = getInnerError(err)
return err == ErrComputeSystemDoesNotExist ||
err == ErrElementNotFound ||
err == ErrProcNotFound
}
// IsAlreadyClosed checks if an error is caused by the Container or Process having been
// already closed by a call to the Close() method.
func IsAlreadyClosed(err error) bool {
err = getInnerError(err)
return err == ErrAlreadyClosed
}
// IsPending returns a boolean indicating whether the error is that
// the requested operation is being completed in the background.
func IsPending(err error) bool {
err = getInnerError(err)
return err == ErrVmcomputeOperationPending
}
// IsTimeout returns a boolean indicating whether the error is caused by
// a timeout waiting for the operation to complete.
func IsTimeout(err error) bool {
err = getInnerError(err)
return err == ErrTimeout
}
// IsAlreadyStopped returns a boolean indicating whether the error is caused by
// a Container or Process being already stopped.
// Note: Currently, ErrElementNotFound can mean that a Process has either
// already exited, or does not exist. Both IsAlreadyStopped and IsNotExist
// will currently return true when the error is ErrElementNotFound or ErrProcNotFound.
func IsAlreadyStopped(err error) bool {
err = getInnerError(err)
return err == ErrVmcomputeAlreadyStopped ||
err == ErrElementNotFound ||
err == ErrProcNotFound
}
// IsNotSupported returns a boolean indicating whether the error is caused by
// unsupported platform requests
// Note: Currently Unsupported platform requests can be mean either
// ErrVmcomputeInvalidJSON, ErrInvalidData, ErrNotSupported or ErrVmcomputeUnknownMessage
// is thrown from the Platform
func IsNotSupported(err error) bool {
err = getInnerError(err)
// If Platform doesn't recognize or support the request sent, below errors are seen
return err == ErrVmcomputeInvalidJSON ||
err == ErrInvalidData ||
err == ErrNotSupported ||
err == ErrVmcomputeUnknownMessage
}
func getInnerError(err error) error {
switch pe := err.(type) {
case nil:
return nil
case *HcsError:
err = pe.Err
case *SystemError:
err = pe.Err
case *ProcessError:
err = pe.Err
}
return err
}

View File

@@ -0,0 +1,47 @@
// Shim for the Host Compute Service (HCS) to manage Windows Server
// containers and Hyper-V containers.
package hcs
import (
"syscall"
)
//go:generate go run ../../mksyscall_windows.go -output zsyscall_windows.go hcs.go
//sys hcsEnumerateComputeSystems(query string, computeSystems **uint16, result **uint16) (hr error) = vmcompute.HcsEnumerateComputeSystems?
//sys hcsCreateComputeSystem(id string, configuration string, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) = vmcompute.HcsCreateComputeSystem?
//sys hcsOpenComputeSystem(id string, computeSystem *hcsSystem, result **uint16) (hr error) = vmcompute.HcsOpenComputeSystem?
//sys hcsCloseComputeSystem(computeSystem hcsSystem) (hr error) = vmcompute.HcsCloseComputeSystem?
//sys hcsStartComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsStartComputeSystem?
//sys hcsShutdownComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsShutdownComputeSystem?
//sys hcsTerminateComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsTerminateComputeSystem?
//sys hcsPauseComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsPauseComputeSystem?
//sys hcsResumeComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsResumeComputeSystem?
//sys hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) = vmcompute.HcsGetComputeSystemProperties?
//sys hcsModifyComputeSystem(computeSystem hcsSystem, configuration string, result **uint16) (hr error) = vmcompute.HcsModifyComputeSystem?
//sys hcsRegisterComputeSystemCallback(computeSystem hcsSystem, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) = vmcompute.HcsRegisterComputeSystemCallback?
//sys hcsUnregisterComputeSystemCallback(callbackHandle hcsCallback) (hr error) = vmcompute.HcsUnregisterComputeSystemCallback?
//sys hcsCreateProcess(computeSystem hcsSystem, processParameters string, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) = vmcompute.HcsCreateProcess?
//sys hcsOpenProcess(computeSystem hcsSystem, pid uint32, process *hcsProcess, result **uint16) (hr error) = vmcompute.HcsOpenProcess?
//sys hcsCloseProcess(process hcsProcess) (hr error) = vmcompute.HcsCloseProcess?
//sys hcsTerminateProcess(process hcsProcess, result **uint16) (hr error) = vmcompute.HcsTerminateProcess?
//sys hcsGetProcessInfo(process hcsProcess, processInformation *hcsProcessInformation, result **uint16) (hr error) = vmcompute.HcsGetProcessInfo?
//sys hcsGetProcessProperties(process hcsProcess, processProperties **uint16, result **uint16) (hr error) = vmcompute.HcsGetProcessProperties?
//sys hcsModifyProcess(process hcsProcess, settings string, result **uint16) (hr error) = vmcompute.HcsModifyProcess?
//sys hcsGetServiceProperties(propertyQuery string, properties **uint16, result **uint16) (hr error) = vmcompute.HcsGetServiceProperties?
//sys hcsRegisterProcessCallback(process hcsProcess, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) = vmcompute.HcsRegisterProcessCallback?
//sys hcsUnregisterProcessCallback(callbackHandle hcsCallback) (hr error) = vmcompute.HcsUnregisterProcessCallback?
type hcsSystem syscall.Handle
type hcsProcess syscall.Handle
type hcsCallback syscall.Handle
type hcsProcessInformation struct {
ProcessId uint32
Reserved uint32
StdInput syscall.Handle
StdOutput syscall.Handle
StdError syscall.Handle
}

View File

@@ -0,0 +1,393 @@
package hcs
import (
"encoding/json"
"fmt"
"io"
"sync"
"syscall"
"time"
"github.com/Microsoft/hcsshim/internal/interop"
"github.com/sirupsen/logrus"
)
// ContainerError is an error encountered in HCS
type Process struct {
handleLock sync.RWMutex
handle hcsProcess
processID int
system *System
cachedPipes *cachedPipes
callbackNumber uintptr
}
type cachedPipes struct {
stdIn syscall.Handle
stdOut syscall.Handle
stdErr syscall.Handle
}
type processModifyRequest struct {
Operation string
ConsoleSize *consoleSize `json:",omitempty"`
CloseHandle *closeHandle `json:",omitempty"`
}
type consoleSize struct {
Height uint16
Width uint16
}
type closeHandle struct {
Handle string
}
type ProcessStatus struct {
ProcessID uint32
Exited bool
ExitCode uint32
LastWaitResult int32
}
const (
stdIn string = "StdIn"
stdOut string = "StdOut"
stdErr string = "StdErr"
)
const (
modifyConsoleSize string = "ConsoleSize"
modifyCloseHandle string = "CloseHandle"
)
// Pid returns the process ID of the process within the container.
func (process *Process) Pid() int {
return process.processID
}
// SystemID returns the ID of the process's compute system.
func (process *Process) SystemID() string {
return process.system.ID()
}
// Kill signals the process to terminate but does not wait for it to finish terminating.
func (process *Process) Kill() error {
process.handleLock.RLock()
defer process.handleLock.RUnlock()
operation := "Kill"
title := "hcsshim::Process::" + operation
logrus.Debugf(title+" processid=%d", process.processID)
if process.handle == 0 {
return makeProcessError(process, operation, ErrAlreadyClosed, nil)
}
var resultp *uint16
completed := false
go syscallWatcher(fmt.Sprintf("TerminateProcess %s: %d", process.SystemID(), process.Pid()), &completed)
err := hcsTerminateProcess(process.handle, &resultp)
completed = true
events := processHcsResult(resultp)
if err != nil {
return makeProcessError(process, operation, err, events)
}
logrus.Debugf(title+" succeeded processid=%d", process.processID)
return nil
}
// Wait waits for the process to exit.
func (process *Process) Wait() error {
operation := "Wait"
title := "hcsshim::Process::" + operation
logrus.Debugf(title+" processid=%d", process.processID)
err := waitForNotification(process.callbackNumber, hcsNotificationProcessExited, nil)
if err != nil {
return makeProcessError(process, operation, err, nil)
}
logrus.Debugf(title+" succeeded processid=%d", process.processID)
return nil
}
// WaitTimeout waits for the process to exit or the duration to elapse. It returns
// false if timeout occurs.
func (process *Process) WaitTimeout(timeout time.Duration) error {
operation := "WaitTimeout"
title := "hcsshim::Process::" + operation
logrus.Debugf(title+" processid=%d", process.processID)
err := waitForNotification(process.callbackNumber, hcsNotificationProcessExited, &timeout)
if err != nil {
return makeProcessError(process, operation, err, nil)
}
logrus.Debugf(title+" succeeded processid=%d", process.processID)
return nil
}
// ResizeConsole resizes the console of the process.
func (process *Process) ResizeConsole(width, height uint16) error {
process.handleLock.RLock()
defer process.handleLock.RUnlock()
operation := "ResizeConsole"
title := "hcsshim::Process::" + operation
logrus.Debugf(title+" processid=%d", process.processID)
if process.handle == 0 {
return makeProcessError(process, operation, ErrAlreadyClosed, nil)
}
modifyRequest := processModifyRequest{
Operation: modifyConsoleSize,
ConsoleSize: &consoleSize{
Height: height,
Width: width,
},
}
modifyRequestb, err := json.Marshal(modifyRequest)
if err != nil {
return err
}
modifyRequestStr := string(modifyRequestb)
var resultp *uint16
err = hcsModifyProcess(process.handle, modifyRequestStr, &resultp)
events := processHcsResult(resultp)
if err != nil {
return makeProcessError(process, operation, err, events)
}
logrus.Debugf(title+" succeeded processid=%d", process.processID)
return nil
}
func (process *Process) Properties() (*ProcessStatus, error) {
process.handleLock.RLock()
defer process.handleLock.RUnlock()
operation := "Properties"
title := "hcsshim::Process::" + operation
logrus.Debugf(title+" processid=%d", process.processID)
if process.handle == 0 {
return nil, makeProcessError(process, operation, ErrAlreadyClosed, nil)
}
var (
resultp *uint16
propertiesp *uint16
)
completed := false
go syscallWatcher(fmt.Sprintf("GetProcessProperties %s: %d", process.SystemID(), process.Pid()), &completed)
err := hcsGetProcessProperties(process.handle, &propertiesp, &resultp)
completed = true
events := processHcsResult(resultp)
if err != nil {
return nil, makeProcessError(process, operation, err, events)
}
if propertiesp == nil {
return nil, ErrUnexpectedValue
}
propertiesRaw := interop.ConvertAndFreeCoTaskMemBytes(propertiesp)
properties := &ProcessStatus{}
if err := json.Unmarshal(propertiesRaw, properties); err != nil {
return nil, makeProcessError(process, operation, err, nil)
}
logrus.Debugf(title+" succeeded processid=%d, properties=%s", process.processID, propertiesRaw)
return properties, nil
}
// ExitCode returns the exit code of the process. The process must have
// already terminated.
func (process *Process) ExitCode() (int, error) {
operation := "ExitCode"
properties, err := process.Properties()
if err != nil {
return 0, makeProcessError(process, operation, err, nil)
}
if properties.Exited == false {
return 0, makeProcessError(process, operation, ErrInvalidProcessState, nil)
}
if properties.LastWaitResult != 0 {
return 0, makeProcessError(process, operation, syscall.Errno(properties.LastWaitResult), nil)
}
return int(properties.ExitCode), nil
}
// Stdio returns the stdin, stdout, and stderr pipes, respectively. Closing
// these pipes does not close the underlying pipes; it should be possible to
// call this multiple times to get multiple interfaces.
func (process *Process) Stdio() (io.WriteCloser, io.ReadCloser, io.ReadCloser, error) {
process.handleLock.RLock()
defer process.handleLock.RUnlock()
operation := "Stdio"
title := "hcsshim::Process::" + operation
logrus.Debugf(title+" processid=%d", process.processID)
if process.handle == 0 {
return nil, nil, nil, makeProcessError(process, operation, ErrAlreadyClosed, nil)
}
var stdIn, stdOut, stdErr syscall.Handle
if process.cachedPipes == nil {
var (
processInfo hcsProcessInformation
resultp *uint16
)
err := hcsGetProcessInfo(process.handle, &processInfo, &resultp)
events := processHcsResult(resultp)
if err != nil {
return nil, nil, nil, makeProcessError(process, operation, err, events)
}
stdIn, stdOut, stdErr = processInfo.StdInput, processInfo.StdOutput, processInfo.StdError
} else {
// Use cached pipes
stdIn, stdOut, stdErr = process.cachedPipes.stdIn, process.cachedPipes.stdOut, process.cachedPipes.stdErr
// Invalidate the cache
process.cachedPipes = nil
}
pipes, err := makeOpenFiles([]syscall.Handle{stdIn, stdOut, stdErr})
if err != nil {
return nil, nil, nil, makeProcessError(process, operation, err, nil)
}
logrus.Debugf(title+" succeeded processid=%d", process.processID)
return pipes[0], pipes[1], pipes[2], nil
}
// CloseStdin closes the write side of the stdin pipe so that the process is
// notified on the read side that there is no more data in stdin.
func (process *Process) CloseStdin() error {
process.handleLock.RLock()
defer process.handleLock.RUnlock()
operation := "CloseStdin"
title := "hcsshim::Process::" + operation
logrus.Debugf(title+" processid=%d", process.processID)
if process.handle == 0 {
return makeProcessError(process, operation, ErrAlreadyClosed, nil)
}
modifyRequest := processModifyRequest{
Operation: modifyCloseHandle,
CloseHandle: &closeHandle{
Handle: stdIn,
},
}
modifyRequestb, err := json.Marshal(modifyRequest)
if err != nil {
return err
}
modifyRequestStr := string(modifyRequestb)
var resultp *uint16
err = hcsModifyProcess(process.handle, modifyRequestStr, &resultp)
events := processHcsResult(resultp)
if err != nil {
return makeProcessError(process, operation, err, events)
}
logrus.Debugf(title+" succeeded processid=%d", process.processID)
return nil
}
// Close cleans up any state associated with the process but does not kill
// or wait on it.
func (process *Process) Close() error {
process.handleLock.Lock()
defer process.handleLock.Unlock()
operation := "Close"
title := "hcsshim::Process::" + operation
logrus.Debugf(title+" processid=%d", process.processID)
// Don't double free this
if process.handle == 0 {
return nil
}
if err := process.unregisterCallback(); err != nil {
return makeProcessError(process, operation, err, nil)
}
if err := hcsCloseProcess(process.handle); err != nil {
return makeProcessError(process, operation, err, nil)
}
process.handle = 0
logrus.Debugf(title+" succeeded processid=%d", process.processID)
return nil
}
func (process *Process) registerCallback() error {
context := &notifcationWatcherContext{
channels: newChannels(),
}
callbackMapLock.Lock()
callbackNumber := nextCallback
nextCallback++
callbackMap[callbackNumber] = context
callbackMapLock.Unlock()
var callbackHandle hcsCallback
err := hcsRegisterProcessCallback(process.handle, notificationWatcherCallback, callbackNumber, &callbackHandle)
if err != nil {
return err
}
context.handle = callbackHandle
process.callbackNumber = callbackNumber
return nil
}
func (process *Process) unregisterCallback() error {
callbackNumber := process.callbackNumber
callbackMapLock.RLock()
context := callbackMap[callbackNumber]
callbackMapLock.RUnlock()
if context == nil {
return nil
}
handle := context.handle
if handle == 0 {
return nil
}
// hcsUnregisterProcessCallback has its own syncronization
// to wait for all callbacks to complete. We must NOT hold the callbackMapLock.
err := hcsUnregisterProcessCallback(handle)
if err != nil {
return err
}
closeChannels(context.channels)
callbackMapLock.Lock()
callbackMap[callbackNumber] = nil
callbackMapLock.Unlock()
handle = 0
return nil
}

View File

@@ -0,0 +1,585 @@
package hcs
import (
"encoding/json"
"fmt"
"os"
"strconv"
"sync"
"syscall"
"time"
"github.com/Microsoft/hcsshim/internal/interop"
"github.com/Microsoft/hcsshim/internal/schema1"
"github.com/Microsoft/hcsshim/internal/timeout"
"github.com/sirupsen/logrus"
)
// currentContainerStarts is used to limit the number of concurrent container
// starts.
var currentContainerStarts containerStarts
type containerStarts struct {
maxParallel int
inProgress int
sync.Mutex
}
func init() {
mpsS := os.Getenv("HCSSHIM_MAX_PARALLEL_START")
if len(mpsS) > 0 {
mpsI, err := strconv.Atoi(mpsS)
if err != nil || mpsI < 0 {
return
}
currentContainerStarts.maxParallel = mpsI
}
}
type System struct {
handleLock sync.RWMutex
handle hcsSystem
id string
callbackNumber uintptr
}
// CreateComputeSystem creates a new compute system with the given configuration but does not start it.
func CreateComputeSystem(id string, hcsDocumentInterface interface{}) (*System, error) {
operation := "CreateComputeSystem"
title := "hcsshim::" + operation
computeSystem := &System{
id: id,
}
hcsDocumentB, err := json.Marshal(hcsDocumentInterface)
if err != nil {
return nil, err
}
hcsDocument := string(hcsDocumentB)
logrus.Debugf(title+" ID=%s config=%s", id, hcsDocument)
var (
resultp *uint16
identity syscall.Handle
)
completed := false
go syscallWatcher(fmt.Sprintf("CreateCompleteSystem %s: %s", id, hcsDocument), &completed)
createError := hcsCreateComputeSystem(id, hcsDocument, identity, &computeSystem.handle, &resultp)
completed = true
if createError == nil || IsPending(createError) {
if err := computeSystem.registerCallback(); err != nil {
// Terminate the compute system if it still exists. We're okay to
// ignore a failure here.
computeSystem.Terminate()
return nil, makeSystemError(computeSystem, operation, "", err, nil)
}
}
events, err := processAsyncHcsResult(createError, resultp, computeSystem.callbackNumber, hcsNotificationSystemCreateCompleted, &timeout.SystemCreate)
if err != nil {
if err == ErrTimeout {
// Terminate the compute system if it still exists. We're okay to
// ignore a failure here.
computeSystem.Terminate()
}
return nil, makeSystemError(computeSystem, operation, hcsDocument, err, events)
}
logrus.Debugf(title+" succeeded id=%s handle=%d", id, computeSystem.handle)
return computeSystem, nil
}
// OpenComputeSystem opens an existing compute system by ID.
func OpenComputeSystem(id string) (*System, error) {
operation := "OpenComputeSystem"
title := "hcsshim::" + operation
logrus.Debugf(title+" ID=%s", id)
computeSystem := &System{
id: id,
}
var (
handle hcsSystem
resultp *uint16
)
err := hcsOpenComputeSystem(id, &handle, &resultp)
events := processHcsResult(resultp)
if err != nil {
return nil, makeSystemError(computeSystem, operation, "", err, events)
}
computeSystem.handle = handle
if err := computeSystem.registerCallback(); err != nil {
return nil, makeSystemError(computeSystem, operation, "", err, nil)
}
logrus.Debugf(title+" succeeded id=%s handle=%d", id, handle)
return computeSystem, nil
}
// GetComputeSystems gets a list of the compute systems on the system that match the query
func GetComputeSystems(q schema1.ComputeSystemQuery) ([]schema1.ContainerProperties, error) {
operation := "GetComputeSystems"
title := "hcsshim::" + operation
queryb, err := json.Marshal(q)
if err != nil {
return nil, err
}
query := string(queryb)
logrus.Debugf(title+" query=%s", query)
var (
resultp *uint16
computeSystemsp *uint16
)
completed := false
go syscallWatcher(fmt.Sprintf("GetComputeSystems %s:", query), &completed)
err = hcsEnumerateComputeSystems(query, &computeSystemsp, &resultp)
completed = true
events := processHcsResult(resultp)
if err != nil {
return nil, &HcsError{Op: operation, Err: err, Events: events}
}
if computeSystemsp == nil {
return nil, ErrUnexpectedValue
}
computeSystemsRaw := interop.ConvertAndFreeCoTaskMemBytes(computeSystemsp)
computeSystems := []schema1.ContainerProperties{}
if err := json.Unmarshal(computeSystemsRaw, &computeSystems); err != nil {
return nil, err
}
logrus.Debugf(title + " succeeded")
return computeSystems, nil
}
// Start synchronously starts the computeSystem.
func (computeSystem *System) Start() error {
computeSystem.handleLock.RLock()
defer computeSystem.handleLock.RUnlock()
title := "hcsshim::ComputeSystem::Start ID=" + computeSystem.ID()
logrus.Debugf(title)
if computeSystem.handle == 0 {
return makeSystemError(computeSystem, "Start", "", ErrAlreadyClosed, nil)
}
// This is a very simple backoff-retry loop to limit the number
// of parallel container starts if environment variable
// HCSSHIM_MAX_PARALLEL_START is set to a positive integer.
// It should generally only be used as a workaround to various
// platform issues that exist between RS1 and RS4 as of Aug 2018
if currentContainerStarts.maxParallel > 0 {
for {
currentContainerStarts.Lock()
if currentContainerStarts.inProgress < currentContainerStarts.maxParallel {
currentContainerStarts.inProgress++
currentContainerStarts.Unlock()
break
}
if currentContainerStarts.inProgress == currentContainerStarts.maxParallel {
currentContainerStarts.Unlock()
time.Sleep(100 * time.Millisecond)
}
}
// Make sure we decrement the count when we are done.
defer func() {
currentContainerStarts.Lock()
currentContainerStarts.inProgress--
currentContainerStarts.Unlock()
}()
}
var resultp *uint16
completed := false
go syscallWatcher(fmt.Sprintf("StartComputeSystem %s:", computeSystem.ID()), &completed)
err := hcsStartComputeSystem(computeSystem.handle, "", &resultp)
completed = true
events, err := processAsyncHcsResult(err, resultp, computeSystem.callbackNumber, hcsNotificationSystemStartCompleted, &timeout.SystemStart)
if err != nil {
return makeSystemError(computeSystem, "Start", "", err, events)
}
logrus.Debugf(title + " succeeded")
return nil
}
// ID returns the compute system's identifier.
func (computeSystem *System) ID() string {
return computeSystem.id
}
// Shutdown requests a compute system shutdown, if IsPending() on the error returned is true,
// it may not actually be shut down until Wait() succeeds.
func (computeSystem *System) Shutdown() error {
computeSystem.handleLock.RLock()
defer computeSystem.handleLock.RUnlock()
title := "hcsshim::ComputeSystem::Shutdown"
logrus.Debugf(title)
if computeSystem.handle == 0 {
return makeSystemError(computeSystem, "Shutdown", "", ErrAlreadyClosed, nil)
}
var resultp *uint16
completed := false
go syscallWatcher(fmt.Sprintf("ShutdownComputeSystem %s:", computeSystem.ID()), &completed)
err := hcsShutdownComputeSystem(computeSystem.handle, "", &resultp)
completed = true
events := processHcsResult(resultp)
if err != nil {
return makeSystemError(computeSystem, "Shutdown", "", err, events)
}
logrus.Debugf(title + " succeeded")
return nil
}
// Terminate requests a compute system terminate, if IsPending() on the error returned is true,
// it may not actually be shut down until Wait() succeeds.
func (computeSystem *System) Terminate() error {
computeSystem.handleLock.RLock()
defer computeSystem.handleLock.RUnlock()
title := "hcsshim::ComputeSystem::Terminate ID=" + computeSystem.ID()
logrus.Debugf(title)
if computeSystem.handle == 0 {
return makeSystemError(computeSystem, "Terminate", "", ErrAlreadyClosed, nil)
}
var resultp *uint16
completed := false
go syscallWatcher(fmt.Sprintf("TerminateComputeSystem %s:", computeSystem.ID()), &completed)
err := hcsTerminateComputeSystem(computeSystem.handle, "", &resultp)
completed = true
events := processHcsResult(resultp)
if err != nil {
return makeSystemError(computeSystem, "Terminate", "", err, events)
}
logrus.Debugf(title + " succeeded")
return nil
}
// Wait synchronously waits for the compute system to shutdown or terminate.
func (computeSystem *System) Wait() error {
title := "hcsshim::ComputeSystem::Wait ID=" + computeSystem.ID()
logrus.Debugf(title)
err := waitForNotification(computeSystem.callbackNumber, hcsNotificationSystemExited, nil)
if err != nil {
return makeSystemError(computeSystem, "Wait", "", err, nil)
}
logrus.Debugf(title + " succeeded")
return nil
}
// WaitTimeout synchronously waits for the compute system to terminate or the duration to elapse.
// If the timeout expires, IsTimeout(err) == true
func (computeSystem *System) WaitTimeout(timeout time.Duration) error {
title := "hcsshim::ComputeSystem::WaitTimeout ID=" + computeSystem.ID()
logrus.Debugf(title)
err := waitForNotification(computeSystem.callbackNumber, hcsNotificationSystemExited, &timeout)
if err != nil {
return makeSystemError(computeSystem, "WaitTimeout", "", err, nil)
}
logrus.Debugf(title + " succeeded")
return nil
}
func (computeSystem *System) Properties(types ...schema1.PropertyType) (*schema1.ContainerProperties, error) {
computeSystem.handleLock.RLock()
defer computeSystem.handleLock.RUnlock()
queryj, err := json.Marshal(schema1.PropertyQuery{types})
if err != nil {
return nil, makeSystemError(computeSystem, "Properties", "", err, nil)
}
var resultp, propertiesp *uint16
completed := false
go syscallWatcher(fmt.Sprintf("GetComputeSystemProperties %s:", computeSystem.ID()), &completed)
err = hcsGetComputeSystemProperties(computeSystem.handle, string(queryj), &propertiesp, &resultp)
completed = true
events := processHcsResult(resultp)
if err != nil {
return nil, makeSystemError(computeSystem, "Properties", "", err, events)
}
if propertiesp == nil {
return nil, ErrUnexpectedValue
}
propertiesRaw := interop.ConvertAndFreeCoTaskMemBytes(propertiesp)
properties := &schema1.ContainerProperties{}
if err := json.Unmarshal(propertiesRaw, properties); err != nil {
return nil, makeSystemError(computeSystem, "Properties", "", err, nil)
}
return properties, nil
}
// Pause pauses the execution of the computeSystem. This feature is not enabled in TP5.
func (computeSystem *System) Pause() error {
computeSystem.handleLock.RLock()
defer computeSystem.handleLock.RUnlock()
title := "hcsshim::ComputeSystem::Pause ID=" + computeSystem.ID()
logrus.Debugf(title)
if computeSystem.handle == 0 {
return makeSystemError(computeSystem, "Pause", "", ErrAlreadyClosed, nil)
}
var resultp *uint16
completed := false
go syscallWatcher(fmt.Sprintf("PauseComputeSystem %s:", computeSystem.ID()), &completed)
err := hcsPauseComputeSystem(computeSystem.handle, "", &resultp)
completed = true
events, err := processAsyncHcsResult(err, resultp, computeSystem.callbackNumber, hcsNotificationSystemPauseCompleted, &timeout.SystemPause)
if err != nil {
return makeSystemError(computeSystem, "Pause", "", err, events)
}
logrus.Debugf(title + " succeeded")
return nil
}
// Resume resumes the execution of the computeSystem. This feature is not enabled in TP5.
func (computeSystem *System) Resume() error {
computeSystem.handleLock.RLock()
defer computeSystem.handleLock.RUnlock()
title := "hcsshim::ComputeSystem::Resume ID=" + computeSystem.ID()
logrus.Debugf(title)
if computeSystem.handle == 0 {
return makeSystemError(computeSystem, "Resume", "", ErrAlreadyClosed, nil)
}
var resultp *uint16
completed := false
go syscallWatcher(fmt.Sprintf("ResumeComputeSystem %s:", computeSystem.ID()), &completed)
err := hcsResumeComputeSystem(computeSystem.handle, "", &resultp)
completed = true
events, err := processAsyncHcsResult(err, resultp, computeSystem.callbackNumber, hcsNotificationSystemResumeCompleted, &timeout.SystemResume)
if err != nil {
return makeSystemError(computeSystem, "Resume", "", err, events)
}
logrus.Debugf(title + " succeeded")
return nil
}
// CreateProcess launches a new process within the computeSystem.
func (computeSystem *System) CreateProcess(c interface{}) (*Process, error) {
computeSystem.handleLock.RLock()
defer computeSystem.handleLock.RUnlock()
title := "hcsshim::ComputeSystem::CreateProcess ID=" + computeSystem.ID()
var (
processInfo hcsProcessInformation
processHandle hcsProcess
resultp *uint16
)
if computeSystem.handle == 0 {
return nil, makeSystemError(computeSystem, "CreateProcess", "", ErrAlreadyClosed, nil)
}
configurationb, err := json.Marshal(c)
if err != nil {
return nil, makeSystemError(computeSystem, "CreateProcess", "", err, nil)
}
configuration := string(configurationb)
logrus.Debugf(title+" config=%s", configuration)
completed := false
go syscallWatcher(fmt.Sprintf("CreateProcess %s: %s", computeSystem.ID(), configuration), &completed)
err = hcsCreateProcess(computeSystem.handle, configuration, &processInfo, &processHandle, &resultp)
completed = true
events := processHcsResult(resultp)
if err != nil {
return nil, makeSystemError(computeSystem, "CreateProcess", configuration, err, events)
}
process := &Process{
handle: processHandle,
processID: int(processInfo.ProcessId),
system: computeSystem,
cachedPipes: &cachedPipes{
stdIn: processInfo.StdInput,
stdOut: processInfo.StdOutput,
stdErr: processInfo.StdError,
},
}
if err := process.registerCallback(); err != nil {
return nil, makeSystemError(computeSystem, "CreateProcess", "", err, nil)
}
logrus.Debugf(title+" succeeded processid=%d", process.processID)
return process, nil
}
// OpenProcess gets an interface to an existing process within the computeSystem.
func (computeSystem *System) OpenProcess(pid int) (*Process, error) {
computeSystem.handleLock.RLock()
defer computeSystem.handleLock.RUnlock()
title := "hcsshim::ComputeSystem::OpenProcess ID=" + computeSystem.ID()
logrus.Debugf(title+" processid=%d", pid)
var (
processHandle hcsProcess
resultp *uint16
)
if computeSystem.handle == 0 {
return nil, makeSystemError(computeSystem, "OpenProcess", "", ErrAlreadyClosed, nil)
}
completed := false
go syscallWatcher(fmt.Sprintf("OpenProcess %s: %d", computeSystem.ID(), pid), &completed)
err := hcsOpenProcess(computeSystem.handle, uint32(pid), &processHandle, &resultp)
completed = true
events := processHcsResult(resultp)
if err != nil {
return nil, makeSystemError(computeSystem, "OpenProcess", "", err, events)
}
process := &Process{
handle: processHandle,
processID: pid,
system: computeSystem,
}
if err := process.registerCallback(); err != nil {
return nil, makeSystemError(computeSystem, "OpenProcess", "", err, nil)
}
logrus.Debugf(title+" succeeded processid=%s", process.processID)
return process, nil
}
// Close cleans up any state associated with the compute system but does not terminate or wait for it.
func (computeSystem *System) Close() error {
computeSystem.handleLock.Lock()
defer computeSystem.handleLock.Unlock()
title := "hcsshim::ComputeSystem::Close ID=" + computeSystem.ID()
logrus.Debugf(title)
// Don't double free this
if computeSystem.handle == 0 {
return nil
}
if err := computeSystem.unregisterCallback(); err != nil {
return makeSystemError(computeSystem, "Close", "", err, nil)
}
completed := false
go syscallWatcher(fmt.Sprintf("CloseComputeSystem %s:", computeSystem.ID()), &completed)
err := hcsCloseComputeSystem(computeSystem.handle)
completed = true
if err != nil {
return makeSystemError(computeSystem, "Close", "", err, nil)
}
computeSystem.handle = 0
logrus.Debugf(title + " succeeded")
return nil
}
func (computeSystem *System) registerCallback() error {
context := &notifcationWatcherContext{
channels: newChannels(),
}
callbackMapLock.Lock()
callbackNumber := nextCallback
nextCallback++
callbackMap[callbackNumber] = context
callbackMapLock.Unlock()
var callbackHandle hcsCallback
err := hcsRegisterComputeSystemCallback(computeSystem.handle, notificationWatcherCallback, callbackNumber, &callbackHandle)
if err != nil {
return err
}
context.handle = callbackHandle
computeSystem.callbackNumber = callbackNumber
return nil
}
func (computeSystem *System) unregisterCallback() error {
callbackNumber := computeSystem.callbackNumber
callbackMapLock.RLock()
context := callbackMap[callbackNumber]
callbackMapLock.RUnlock()
if context == nil {
return nil
}
handle := context.handle
if handle == 0 {
return nil
}
// hcsUnregisterComputeSystemCallback has its own syncronization
// to wait for all callbacks to complete. We must NOT hold the callbackMapLock.
err := hcsUnregisterComputeSystemCallback(handle)
if err != nil {
return err
}
closeChannels(context.channels)
callbackMapLock.Lock()
callbackMap[callbackNumber] = nil
callbackMapLock.Unlock()
handle = 0
return nil
}
// Modifies the System by sending a request to HCS
func (computeSystem *System) Modify(config interface{}) error {
computeSystem.handleLock.RLock()
defer computeSystem.handleLock.RUnlock()
title := "hcsshim::Modify ID=" + computeSystem.id
if computeSystem.handle == 0 {
return makeSystemError(computeSystem, "Modify", "", ErrAlreadyClosed, nil)
}
requestJSON, err := json.Marshal(config)
if err != nil {
return err
}
requestString := string(requestJSON)
logrus.Debugf(title + " " + requestString)
var resultp *uint16
completed := false
go syscallWatcher(fmt.Sprintf("ModifyComputeSystem %s: %s", computeSystem.ID(), requestString), &completed)
err = hcsModifyComputeSystem(computeSystem.handle, requestString, &resultp)
completed = true
events := processHcsResult(resultp)
if err != nil {
return makeSystemError(computeSystem, "Modify", requestString, err, events)
}
logrus.Debugf(title + " succeeded ")
return nil
}

View File

@@ -0,0 +1,33 @@
package hcs
import (
"io"
"syscall"
"github.com/Microsoft/go-winio"
)
// makeOpenFiles calls winio.MakeOpenFile for each handle in a slice but closes all the handles
// if there is an error.
func makeOpenFiles(hs []syscall.Handle) (_ []io.ReadWriteCloser, err error) {
fs := make([]io.ReadWriteCloser, len(hs))
for i, h := range hs {
if h != syscall.Handle(0) {
if err == nil {
fs[i], err = winio.MakeOpenFile(h)
}
if err != nil {
syscall.Close(h)
}
}
}
if err != nil {
for _, f := range fs {
if f != nil {
f.Close()
}
}
return nil, err
}
return fs, nil
}

View File

@@ -0,0 +1,63 @@
package hcs
import (
"time"
"github.com/sirupsen/logrus"
)
func processAsyncHcsResult(err error, resultp *uint16, callbackNumber uintptr, expectedNotification hcsNotification, timeout *time.Duration) ([]ErrorEvent, error) {
events := processHcsResult(resultp)
if IsPending(err) {
return nil, waitForNotification(callbackNumber, expectedNotification, timeout)
}
return events, err
}
func waitForNotification(callbackNumber uintptr, expectedNotification hcsNotification, timeout *time.Duration) error {
callbackMapLock.RLock()
channels := callbackMap[callbackNumber].channels
callbackMapLock.RUnlock()
expectedChannel := channels[expectedNotification]
if expectedChannel == nil {
logrus.Errorf("unknown notification type in waitForNotification %x", expectedNotification)
return ErrInvalidNotificationType
}
var c <-chan time.Time
if timeout != nil {
timer := time.NewTimer(*timeout)
c = timer.C
defer timer.Stop()
}
select {
case err, ok := <-expectedChannel:
if !ok {
return ErrHandleClose
}
return err
case err, ok := <-channels[hcsNotificationSystemExited]:
if !ok {
return ErrHandleClose
}
// If the expected notification is hcsNotificationSystemExited which of the two selects
// chosen is random. Return the raw error if hcsNotificationSystemExited is expected
if channels[hcsNotificationSystemExited] == expectedChannel {
return err
}
return ErrUnexpectedContainerExit
case _, ok := <-channels[hcsNotificationServiceDisconnect]:
if !ok {
return ErrHandleClose
}
// hcsNotificationServiceDisconnect should never be an expected notification
// it does not need the same handling as hcsNotificationSystemExited
return ErrUnexpectedProcessAbort
case <-c:
return ErrTimeout
}
return nil
}

View File

@@ -0,0 +1,30 @@
package hcs
import (
"time"
"github.com/Microsoft/hcsshim/internal/timeout"
"github.com/sirupsen/logrus"
)
// syscallWatcher is used as a very simple goroutine around calls into
// the platform. In some cases, we have seen HCS APIs not returning due to
// various bugs, and the goroutine making the syscall ends up not returning,
// prior to its async callback. By spinning up a syscallWatcher, it allows
// us to at least log a warning if a syscall doesn't complete in a reasonable
// amount of time.
//
// Usage is:
//
// completed := false
// go syscallWatcher("some description", &completed)
// <syscall>
// completed = true
//
func syscallWatcher(description string, syscallCompleted *bool) {
time.Sleep(timeout.SyscallWatcher)
if *syscallCompleted {
return
}
logrus.Warnf("%s: Did not complete within %s. This may indicate a platform issue. If it appears to be making no forward progress, obtain the stacks and see is there is a syscall stuck in the platform API for a significant length of time.", description, timeout.SyscallWatcher)
}

View File

@@ -0,0 +1,441 @@
// MACHINE GENERATED BY 'go generate' COMMAND; DO NOT EDIT
package hcs
import (
"syscall"
"unsafe"
"github.com/Microsoft/hcsshim/internal/interop"
"golang.org/x/sys/windows"
)
var _ unsafe.Pointer
// Do the interface allocations only once for common
// Errno values.
const (
errnoERROR_IO_PENDING = 997
)
var (
errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING)
)
// errnoErr returns common boxed Errno values, to prevent
// allocations at runtime.
func errnoErr(e syscall.Errno) error {
switch e {
case 0:
return nil
case errnoERROR_IO_PENDING:
return errERROR_IO_PENDING
}
// TODO: add more here, after collecting data on the common
// error values see on Windows. (perhaps when running
// all.bat?)
return e
}
var (
modvmcompute = windows.NewLazySystemDLL("vmcompute.dll")
procHcsEnumerateComputeSystems = modvmcompute.NewProc("HcsEnumerateComputeSystems")
procHcsCreateComputeSystem = modvmcompute.NewProc("HcsCreateComputeSystem")
procHcsOpenComputeSystem = modvmcompute.NewProc("HcsOpenComputeSystem")
procHcsCloseComputeSystem = modvmcompute.NewProc("HcsCloseComputeSystem")
procHcsStartComputeSystem = modvmcompute.NewProc("HcsStartComputeSystem")
procHcsShutdownComputeSystem = modvmcompute.NewProc("HcsShutdownComputeSystem")
procHcsTerminateComputeSystem = modvmcompute.NewProc("HcsTerminateComputeSystem")
procHcsPauseComputeSystem = modvmcompute.NewProc("HcsPauseComputeSystem")
procHcsResumeComputeSystem = modvmcompute.NewProc("HcsResumeComputeSystem")
procHcsGetComputeSystemProperties = modvmcompute.NewProc("HcsGetComputeSystemProperties")
procHcsModifyComputeSystem = modvmcompute.NewProc("HcsModifyComputeSystem")
procHcsRegisterComputeSystemCallback = modvmcompute.NewProc("HcsRegisterComputeSystemCallback")
procHcsUnregisterComputeSystemCallback = modvmcompute.NewProc("HcsUnregisterComputeSystemCallback")
procHcsCreateProcess = modvmcompute.NewProc("HcsCreateProcess")
procHcsOpenProcess = modvmcompute.NewProc("HcsOpenProcess")
procHcsCloseProcess = modvmcompute.NewProc("HcsCloseProcess")
procHcsTerminateProcess = modvmcompute.NewProc("HcsTerminateProcess")
procHcsGetProcessInfo = modvmcompute.NewProc("HcsGetProcessInfo")
procHcsGetProcessProperties = modvmcompute.NewProc("HcsGetProcessProperties")
procHcsModifyProcess = modvmcompute.NewProc("HcsModifyProcess")
procHcsGetServiceProperties = modvmcompute.NewProc("HcsGetServiceProperties")
procHcsRegisterProcessCallback = modvmcompute.NewProc("HcsRegisterProcessCallback")
procHcsUnregisterProcessCallback = modvmcompute.NewProc("HcsUnregisterProcessCallback")
)
func hcsEnumerateComputeSystems(query string, computeSystems **uint16, result **uint16) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(query)
if hr != nil {
return
}
return _hcsEnumerateComputeSystems(_p0, computeSystems, result)
}
func _hcsEnumerateComputeSystems(query *uint16, computeSystems **uint16, result **uint16) (hr error) {
if hr = procHcsEnumerateComputeSystems.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procHcsEnumerateComputeSystems.Addr(), 3, uintptr(unsafe.Pointer(query)), uintptr(unsafe.Pointer(computeSystems)), uintptr(unsafe.Pointer(result)))
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func hcsCreateComputeSystem(id string, configuration string, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(id)
if hr != nil {
return
}
var _p1 *uint16
_p1, hr = syscall.UTF16PtrFromString(configuration)
if hr != nil {
return
}
return _hcsCreateComputeSystem(_p0, _p1, identity, computeSystem, result)
}
func _hcsCreateComputeSystem(id *uint16, configuration *uint16, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) {
if hr = procHcsCreateComputeSystem.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall6(procHcsCreateComputeSystem.Addr(), 5, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(configuration)), uintptr(identity), uintptr(unsafe.Pointer(computeSystem)), uintptr(unsafe.Pointer(result)), 0)
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func hcsOpenComputeSystem(id string, computeSystem *hcsSystem, result **uint16) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(id)
if hr != nil {
return
}
return _hcsOpenComputeSystem(_p0, computeSystem, result)
}
func _hcsOpenComputeSystem(id *uint16, computeSystem *hcsSystem, result **uint16) (hr error) {
if hr = procHcsOpenComputeSystem.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procHcsOpenComputeSystem.Addr(), 3, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(computeSystem)), uintptr(unsafe.Pointer(result)))
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func hcsCloseComputeSystem(computeSystem hcsSystem) (hr error) {
if hr = procHcsCloseComputeSystem.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procHcsCloseComputeSystem.Addr(), 1, uintptr(computeSystem), 0, 0)
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func hcsStartComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(options)
if hr != nil {
return
}
return _hcsStartComputeSystem(computeSystem, _p0, result)
}
func _hcsStartComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) {
if hr = procHcsStartComputeSystem.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procHcsStartComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result)))
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func hcsShutdownComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(options)
if hr != nil {
return
}
return _hcsShutdownComputeSystem(computeSystem, _p0, result)
}
func _hcsShutdownComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) {
if hr = procHcsShutdownComputeSystem.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procHcsShutdownComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result)))
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func hcsTerminateComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(options)
if hr != nil {
return
}
return _hcsTerminateComputeSystem(computeSystem, _p0, result)
}
func _hcsTerminateComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) {
if hr = procHcsTerminateComputeSystem.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procHcsTerminateComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result)))
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func hcsPauseComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(options)
if hr != nil {
return
}
return _hcsPauseComputeSystem(computeSystem, _p0, result)
}
func _hcsPauseComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) {
if hr = procHcsPauseComputeSystem.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procHcsPauseComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result)))
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func hcsResumeComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(options)
if hr != nil {
return
}
return _hcsResumeComputeSystem(computeSystem, _p0, result)
}
func _hcsResumeComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) {
if hr = procHcsResumeComputeSystem.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procHcsResumeComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result)))
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(propertyQuery)
if hr != nil {
return
}
return _hcsGetComputeSystemProperties(computeSystem, _p0, properties, result)
}
func _hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery *uint16, properties **uint16, result **uint16) (hr error) {
if hr = procHcsGetComputeSystemProperties.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall6(procHcsGetComputeSystemProperties.Addr(), 4, uintptr(computeSystem), uintptr(unsafe.Pointer(propertyQuery)), uintptr(unsafe.Pointer(properties)), uintptr(unsafe.Pointer(result)), 0, 0)
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func hcsModifyComputeSystem(computeSystem hcsSystem, configuration string, result **uint16) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(configuration)
if hr != nil {
return
}
return _hcsModifyComputeSystem(computeSystem, _p0, result)
}
func _hcsModifyComputeSystem(computeSystem hcsSystem, configuration *uint16, result **uint16) (hr error) {
if hr = procHcsModifyComputeSystem.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procHcsModifyComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(configuration)), uintptr(unsafe.Pointer(result)))
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func hcsRegisterComputeSystemCallback(computeSystem hcsSystem, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) {
if hr = procHcsRegisterComputeSystemCallback.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall6(procHcsRegisterComputeSystemCallback.Addr(), 4, uintptr(computeSystem), uintptr(callback), uintptr(context), uintptr(unsafe.Pointer(callbackHandle)), 0, 0)
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func hcsUnregisterComputeSystemCallback(callbackHandle hcsCallback) (hr error) {
if hr = procHcsUnregisterComputeSystemCallback.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procHcsUnregisterComputeSystemCallback.Addr(), 1, uintptr(callbackHandle), 0, 0)
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func hcsCreateProcess(computeSystem hcsSystem, processParameters string, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(processParameters)
if hr != nil {
return
}
return _hcsCreateProcess(computeSystem, _p0, processInformation, process, result)
}
func _hcsCreateProcess(computeSystem hcsSystem, processParameters *uint16, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) {
if hr = procHcsCreateProcess.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall6(procHcsCreateProcess.Addr(), 5, uintptr(computeSystem), uintptr(unsafe.Pointer(processParameters)), uintptr(unsafe.Pointer(processInformation)), uintptr(unsafe.Pointer(process)), uintptr(unsafe.Pointer(result)), 0)
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func hcsOpenProcess(computeSystem hcsSystem, pid uint32, process *hcsProcess, result **uint16) (hr error) {
if hr = procHcsOpenProcess.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall6(procHcsOpenProcess.Addr(), 4, uintptr(computeSystem), uintptr(pid), uintptr(unsafe.Pointer(process)), uintptr(unsafe.Pointer(result)), 0, 0)
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func hcsCloseProcess(process hcsProcess) (hr error) {
if hr = procHcsCloseProcess.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procHcsCloseProcess.Addr(), 1, uintptr(process), 0, 0)
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func hcsTerminateProcess(process hcsProcess, result **uint16) (hr error) {
if hr = procHcsTerminateProcess.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procHcsTerminateProcess.Addr(), 2, uintptr(process), uintptr(unsafe.Pointer(result)), 0)
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func hcsGetProcessInfo(process hcsProcess, processInformation *hcsProcessInformation, result **uint16) (hr error) {
if hr = procHcsGetProcessInfo.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procHcsGetProcessInfo.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(processInformation)), uintptr(unsafe.Pointer(result)))
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func hcsGetProcessProperties(process hcsProcess, processProperties **uint16, result **uint16) (hr error) {
if hr = procHcsGetProcessProperties.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procHcsGetProcessProperties.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(processProperties)), uintptr(unsafe.Pointer(result)))
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func hcsModifyProcess(process hcsProcess, settings string, result **uint16) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(settings)
if hr != nil {
return
}
return _hcsModifyProcess(process, _p0, result)
}
func _hcsModifyProcess(process hcsProcess, settings *uint16, result **uint16) (hr error) {
if hr = procHcsModifyProcess.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procHcsModifyProcess.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(settings)), uintptr(unsafe.Pointer(result)))
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func hcsGetServiceProperties(propertyQuery string, properties **uint16, result **uint16) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(propertyQuery)
if hr != nil {
return
}
return _hcsGetServiceProperties(_p0, properties, result)
}
func _hcsGetServiceProperties(propertyQuery *uint16, properties **uint16, result **uint16) (hr error) {
if hr = procHcsGetServiceProperties.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procHcsGetServiceProperties.Addr(), 3, uintptr(unsafe.Pointer(propertyQuery)), uintptr(unsafe.Pointer(properties)), uintptr(unsafe.Pointer(result)))
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func hcsRegisterProcessCallback(process hcsProcess, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) {
if hr = procHcsRegisterProcessCallback.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall6(procHcsRegisterProcessCallback.Addr(), 4, uintptr(process), uintptr(callback), uintptr(context), uintptr(unsafe.Pointer(callbackHandle)), 0, 0)
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func hcsUnregisterProcessCallback(callbackHandle hcsCallback) (hr error) {
if hr = procHcsUnregisterProcessCallback.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procHcsUnregisterProcessCallback.Addr(), 1, uintptr(callbackHandle), 0, 0)
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}

View File

@@ -0,0 +1,51 @@
package hcserror
import (
"fmt"
"syscall"
)
const ERROR_GEN_FAILURE = syscall.Errno(31)
type HcsError struct {
title string
rest string
Err error
}
func (e *HcsError) Error() string {
s := e.title
if len(s) > 0 && s[len(s)-1] != ' ' {
s += " "
}
s += fmt.Sprintf("failed in Win32: %s (0x%x)", e.Err, Win32FromError(e.Err))
if e.rest != "" {
if e.rest[0] != ' ' {
s += " "
}
s += e.rest
}
return s
}
func New(err error, title, rest string) error {
// Pass through DLL errors directly since they do not originate from HCS.
if _, ok := err.(*syscall.DLLError); ok {
return err
}
return &HcsError{title, rest, err}
}
func Errorf(err error, title, format string, a ...interface{}) error {
return New(err, title, fmt.Sprintf(format, a...))
}
func Win32FromError(err error) uint32 {
if herr, ok := err.(*HcsError); ok {
return Win32FromError(herr.Err)
}
if code, ok := err.(syscall.Errno); ok {
return uint32(code)
}
return uint32(ERROR_GEN_FAILURE)
}

View File

@@ -0,0 +1,23 @@
package hns
import "fmt"
//go:generate go run ../../mksyscall_windows.go -output zsyscall_windows.go hns.go
//sys _hnsCall(method string, path string, object string, response **uint16) (hr error) = vmcompute.HNSCall?
type EndpointNotFoundError struct {
EndpointName string
}
func (e EndpointNotFoundError) Error() string {
return fmt.Sprintf("Endpoint %s not found", e.EndpointName)
}
type NetworkNotFoundError struct {
NetworkName string
}
func (e NetworkNotFoundError) Error() string {
return fmt.Sprintf("Network %s not found", e.NetworkName)
}

View File

@@ -0,0 +1,260 @@
package hns
import (
"encoding/json"
"net"
"github.com/sirupsen/logrus"
)
// HNSEndpoint represents a network endpoint in HNS
type HNSEndpoint struct {
Id string `json:"ID,omitempty"`
Name string `json:",omitempty"`
VirtualNetwork string `json:",omitempty"`
VirtualNetworkName string `json:",omitempty"`
Policies []json.RawMessage `json:",omitempty"`
MacAddress string `json:",omitempty"`
IPAddress net.IP `json:",omitempty"`
DNSSuffix string `json:",omitempty"`
DNSServerList string `json:",omitempty"`
GatewayAddress string `json:",omitempty"`
EnableInternalDNS bool `json:",omitempty"`
DisableICC bool `json:",omitempty"`
PrefixLength uint8 `json:",omitempty"`
IsRemoteEndpoint bool `json:",omitempty"`
Namespace *Namespace `json:",omitempty"`
}
//SystemType represents the type of the system on which actions are done
type SystemType string
// SystemType const
const (
ContainerType SystemType = "Container"
VirtualMachineType SystemType = "VirtualMachine"
HostType SystemType = "Host"
)
// EndpointAttachDetachRequest is the structure used to send request to the container to modify the system
// Supported resource types are Network and Request Types are Add/Remove
type EndpointAttachDetachRequest struct {
ContainerID string `json:"ContainerId,omitempty"`
SystemType SystemType `json:"SystemType"`
CompartmentID uint16 `json:"CompartmentId,omitempty"`
VirtualNICName string `json:"VirtualNicName,omitempty"`
}
// EndpointResquestResponse is object to get the endpoint request response
type EndpointResquestResponse struct {
Success bool
Error string
}
// HNSEndpointRequest makes a HNS call to modify/query a network endpoint
func HNSEndpointRequest(method, path, request string) (*HNSEndpoint, error) {
endpoint := &HNSEndpoint{}
err := hnsCall(method, "/endpoints/"+path, request, &endpoint)
if err != nil {
return nil, err
}
return endpoint, nil
}
// HNSListEndpointRequest makes a HNS call to query the list of available endpoints
func HNSListEndpointRequest() ([]HNSEndpoint, error) {
var endpoint []HNSEndpoint
err := hnsCall("GET", "/endpoints/", "", &endpoint)
if err != nil {
return nil, err
}
return endpoint, nil
}
// GetHNSEndpointByID get the Endpoint by ID
func GetHNSEndpointByID(endpointID string) (*HNSEndpoint, error) {
return HNSEndpointRequest("GET", endpointID, "")
}
// GetHNSEndpointByName gets the endpoint filtered by Name
func GetHNSEndpointByName(endpointName string) (*HNSEndpoint, error) {
hnsResponse, err := HNSListEndpointRequest()
if err != nil {
return nil, err
}
for _, hnsEndpoint := range hnsResponse {
if hnsEndpoint.Name == endpointName {
return &hnsEndpoint, nil
}
}
return nil, EndpointNotFoundError{EndpointName: endpointName}
}
// Create Endpoint by sending EndpointRequest to HNS. TODO: Create a separate HNS interface to place all these methods
func (endpoint *HNSEndpoint) Create() (*HNSEndpoint, error) {
operation := "Create"
title := "hcsshim::HNSEndpoint::" + operation
logrus.Debugf(title+" id=%s", endpoint.Id)
jsonString, err := json.Marshal(endpoint)
if err != nil {
return nil, err
}
return HNSEndpointRequest("POST", "", string(jsonString))
}
// Delete Endpoint by sending EndpointRequest to HNS
func (endpoint *HNSEndpoint) Delete() (*HNSEndpoint, error) {
operation := "Delete"
title := "hcsshim::HNSEndpoint::" + operation
logrus.Debugf(title+" id=%s", endpoint.Id)
return HNSEndpointRequest("DELETE", endpoint.Id, "")
}
// Update Endpoint
func (endpoint *HNSEndpoint) Update() (*HNSEndpoint, error) {
operation := "Update"
title := "hcsshim::HNSEndpoint::" + operation
logrus.Debugf(title+" id=%s", endpoint.Id)
jsonString, err := json.Marshal(endpoint)
if err != nil {
return nil, err
}
err = hnsCall("POST", "/endpoints/"+endpoint.Id, string(jsonString), &endpoint)
return endpoint, err
}
// ApplyACLPolicy applies a set of ACL Policies on the Endpoint
func (endpoint *HNSEndpoint) ApplyACLPolicy(policies ...*ACLPolicy) error {
operation := "ApplyACLPolicy"
title := "hcsshim::HNSEndpoint::" + operation
logrus.Debugf(title+" id=%s", endpoint.Id)
for _, policy := range policies {
if policy == nil {
continue
}
jsonString, err := json.Marshal(policy)
if err != nil {
return err
}
endpoint.Policies = append(endpoint.Policies, jsonString)
}
_, err := endpoint.Update()
return err
}
// ContainerAttach attaches an endpoint to container
func (endpoint *HNSEndpoint) ContainerAttach(containerID string, compartmentID uint16) error {
operation := "ContainerAttach"
title := "hcsshim::HNSEndpoint::" + operation
logrus.Debugf(title+" id=%s", endpoint.Id)
requestMessage := &EndpointAttachDetachRequest{
ContainerID: containerID,
CompartmentID: compartmentID,
SystemType: ContainerType,
}
response := &EndpointResquestResponse{}
jsonString, err := json.Marshal(requestMessage)
if err != nil {
return err
}
return hnsCall("POST", "/endpoints/"+endpoint.Id+"/attach", string(jsonString), &response)
}
// ContainerDetach detaches an endpoint from container
func (endpoint *HNSEndpoint) ContainerDetach(containerID string) error {
operation := "ContainerDetach"
title := "hcsshim::HNSEndpoint::" + operation
logrus.Debugf(title+" id=%s", endpoint.Id)
requestMessage := &EndpointAttachDetachRequest{
ContainerID: containerID,
SystemType: ContainerType,
}
response := &EndpointResquestResponse{}
jsonString, err := json.Marshal(requestMessage)
if err != nil {
return err
}
return hnsCall("POST", "/endpoints/"+endpoint.Id+"/detach", string(jsonString), &response)
}
// HostAttach attaches a nic on the host
func (endpoint *HNSEndpoint) HostAttach(compartmentID uint16) error {
operation := "HostAttach"
title := "hcsshim::HNSEndpoint::" + operation
logrus.Debugf(title+" id=%s", endpoint.Id)
requestMessage := &EndpointAttachDetachRequest{
CompartmentID: compartmentID,
SystemType: HostType,
}
response := &EndpointResquestResponse{}
jsonString, err := json.Marshal(requestMessage)
if err != nil {
return err
}
return hnsCall("POST", "/endpoints/"+endpoint.Id+"/attach", string(jsonString), &response)
}
// HostDetach detaches a nic on the host
func (endpoint *HNSEndpoint) HostDetach() error {
operation := "HostDetach"
title := "hcsshim::HNSEndpoint::" + operation
logrus.Debugf(title+" id=%s", endpoint.Id)
requestMessage := &EndpointAttachDetachRequest{
SystemType: HostType,
}
response := &EndpointResquestResponse{}
jsonString, err := json.Marshal(requestMessage)
if err != nil {
return err
}
return hnsCall("POST", "/endpoints/"+endpoint.Id+"/detach", string(jsonString), &response)
}
// VirtualMachineNICAttach attaches a endpoint to a virtual machine
func (endpoint *HNSEndpoint) VirtualMachineNICAttach(virtualMachineNICName string) error {
operation := "VirtualMachineNicAttach"
title := "hcsshim::HNSEndpoint::" + operation
logrus.Debugf(title+" id=%s", endpoint.Id)
requestMessage := &EndpointAttachDetachRequest{
VirtualNICName: virtualMachineNICName,
SystemType: VirtualMachineType,
}
response := &EndpointResquestResponse{}
jsonString, err := json.Marshal(requestMessage)
if err != nil {
return err
}
return hnsCall("POST", "/endpoints/"+endpoint.Id+"/attach", string(jsonString), &response)
}
// VirtualMachineNICDetach detaches a endpoint from a virtual machine
func (endpoint *HNSEndpoint) VirtualMachineNICDetach() error {
operation := "VirtualMachineNicDetach"
title := "hcsshim::HNSEndpoint::" + operation
logrus.Debugf(title+" id=%s", endpoint.Id)
requestMessage := &EndpointAttachDetachRequest{
SystemType: VirtualMachineType,
}
response := &EndpointResquestResponse{}
jsonString, err := json.Marshal(requestMessage)
if err != nil {
return err
}
return hnsCall("POST", "/endpoints/"+endpoint.Id+"/detach", string(jsonString), &response)
}

View File

@@ -0,0 +1,42 @@
package hns
import (
"encoding/json"
"fmt"
"github.com/Microsoft/hcsshim/internal/hcserror"
"github.com/Microsoft/hcsshim/internal/interop"
"github.com/sirupsen/logrus"
)
func hnsCall(method, path, request string, returnResponse interface{}) error {
var responseBuffer *uint16
logrus.Debugf("[%s]=>[%s] Request : %s", method, path, request)
err := _hnsCall(method, path, request, &responseBuffer)
if err != nil {
return hcserror.New(err, "hnsCall ", "")
}
response := interop.ConvertAndFreeCoTaskMemString(responseBuffer)
hnsresponse := &hnsResponse{}
if err = json.Unmarshal([]byte(response), &hnsresponse); err != nil {
return err
}
if !hnsresponse.Success {
return fmt.Errorf("HNS failed with error : %s", hnsresponse.Error)
}
if len(hnsresponse.Output) == 0 {
return nil
}
logrus.Debugf("Network Response : %s", hnsresponse.Output)
err = json.Unmarshal(hnsresponse.Output, returnResponse)
if err != nil {
return err
}
return nil
}

View File

@@ -0,0 +1,28 @@
package hns
type HNSGlobals struct {
Version HNSVersion `json:"Version"`
}
type HNSVersion struct {
Major int `json:"Major"`
Minor int `json:"Minor"`
}
var (
HNSVersion1803 = HNSVersion{Major: 7, Minor: 2}
)
func GetHNSGlobals() (*HNSGlobals, error) {
var version HNSVersion
err := hnsCall("GET", "/globals/version", "", &version)
if err != nil {
return nil, err
}
globals := &HNSGlobals{
Version: version,
}
return globals, nil
}

View File

@@ -0,0 +1,141 @@
package hns
import (
"encoding/json"
"net"
"github.com/sirupsen/logrus"
)
// Subnet is assoicated with a network and represents a list
// of subnets available to the network
type Subnet struct {
AddressPrefix string `json:",omitempty"`
GatewayAddress string `json:",omitempty"`
Policies []json.RawMessage `json:",omitempty"`
}
// MacPool is assoicated with a network and represents a list
// of macaddresses available to the network
type MacPool struct {
StartMacAddress string `json:",omitempty"`
EndMacAddress string `json:",omitempty"`
}
// HNSNetwork represents a network in HNS
type HNSNetwork struct {
Id string `json:"ID,omitempty"`
Name string `json:",omitempty"`
Type string `json:",omitempty"`
NetworkAdapterName string `json:",omitempty"`
SourceMac string `json:",omitempty"`
Policies []json.RawMessage `json:",omitempty"`
MacPools []MacPool `json:",omitempty"`
Subnets []Subnet `json:",omitempty"`
DNSSuffix string `json:",omitempty"`
DNSServerList string `json:",omitempty"`
DNSServerCompartment uint32 `json:",omitempty"`
ManagementIP string `json:",omitempty"`
AutomaticDNS bool `json:",omitempty"`
}
type hnsNetworkResponse struct {
Success bool
Error string
Output HNSNetwork
}
type hnsResponse struct {
Success bool
Error string
Output json.RawMessage
}
// HNSNetworkRequest makes a call into HNS to update/query a single network
func HNSNetworkRequest(method, path, request string) (*HNSNetwork, error) {
var network HNSNetwork
err := hnsCall(method, "/networks/"+path, request, &network)
if err != nil {
return nil, err
}
return &network, nil
}
// HNSListNetworkRequest makes a HNS call to query the list of available networks
func HNSListNetworkRequest(method, path, request string) ([]HNSNetwork, error) {
var network []HNSNetwork
err := hnsCall(method, "/networks/"+path, request, &network)
if err != nil {
return nil, err
}
return network, nil
}
// GetHNSNetworkByID
func GetHNSNetworkByID(networkID string) (*HNSNetwork, error) {
return HNSNetworkRequest("GET", networkID, "")
}
// GetHNSNetworkName filtered by Name
func GetHNSNetworkByName(networkName string) (*HNSNetwork, error) {
hsnnetworks, err := HNSListNetworkRequest("GET", "", "")
if err != nil {
return nil, err
}
for _, hnsnetwork := range hsnnetworks {
if hnsnetwork.Name == networkName {
return &hnsnetwork, nil
}
}
return nil, NetworkNotFoundError{NetworkName: networkName}
}
// Create Network by sending NetworkRequest to HNS.
func (network *HNSNetwork) Create() (*HNSNetwork, error) {
operation := "Create"
title := "hcsshim::HNSNetwork::" + operation
logrus.Debugf(title+" id=%s", network.Id)
jsonString, err := json.Marshal(network)
if err != nil {
return nil, err
}
return HNSNetworkRequest("POST", "", string(jsonString))
}
// Delete Network by sending NetworkRequest to HNS
func (network *HNSNetwork) Delete() (*HNSNetwork, error) {
operation := "Delete"
title := "hcsshim::HNSNetwork::" + operation
logrus.Debugf(title+" id=%s", network.Id)
return HNSNetworkRequest("DELETE", network.Id, "")
}
// Creates an endpoint on the Network.
func (network *HNSNetwork) NewEndpoint(ipAddress net.IP, macAddress net.HardwareAddr) *HNSEndpoint {
return &HNSEndpoint{
VirtualNetwork: network.Id,
IPAddress: ipAddress,
MacAddress: string(macAddress),
}
}
func (network *HNSNetwork) CreateEndpoint(endpoint *HNSEndpoint) (*HNSEndpoint, error) {
operation := "CreateEndpoint"
title := "hcsshim::HNSNetwork::" + operation
logrus.Debugf(title+" id=%s, endpointId=%s", network.Id, endpoint.Id)
endpoint.VirtualNetwork = network.Id
return endpoint.Create()
}
func (network *HNSNetwork) CreateRemoteEndpoint(endpoint *HNSEndpoint) (*HNSEndpoint, error) {
operation := "CreateRemoteEndpoint"
title := "hcsshim::HNSNetwork::" + operation
logrus.Debugf(title+" id=%s", network.Id)
endpoint.IsRemoteEndpoint = true
return network.CreateEndpoint(endpoint)
}

View File

@@ -0,0 +1,98 @@
package hns
// Type of Request Support in ModifySystem
type PolicyType string
// RequestType const
const (
Nat PolicyType = "NAT"
ACL PolicyType = "ACL"
PA PolicyType = "PA"
VLAN PolicyType = "VLAN"
VSID PolicyType = "VSID"
VNet PolicyType = "VNET"
L2Driver PolicyType = "L2Driver"
Isolation PolicyType = "Isolation"
QOS PolicyType = "QOS"
OutboundNat PolicyType = "OutBoundNAT"
ExternalLoadBalancer PolicyType = "ELB"
Route PolicyType = "ROUTE"
)
type NatPolicy struct {
Type PolicyType `json:"Type"`
Protocol string
InternalPort uint16
ExternalPort uint16
}
type QosPolicy struct {
Type PolicyType `json:"Type"`
MaximumOutgoingBandwidthInBytes uint64
}
type IsolationPolicy struct {
Type PolicyType `json:"Type"`
VLAN uint
VSID uint
InDefaultIsolation bool
}
type VlanPolicy struct {
Type PolicyType `json:"Type"`
VLAN uint
}
type VsidPolicy struct {
Type PolicyType `json:"Type"`
VSID uint
}
type PaPolicy struct {
Type PolicyType `json:"Type"`
PA string `json:"PA"`
}
type OutboundNatPolicy struct {
Policy
VIP string `json:"VIP,omitempty"`
Exceptions []string `json:"ExceptionList,omitempty"`
}
type ActionType string
type DirectionType string
type RuleType string
const (
Allow ActionType = "Allow"
Block ActionType = "Block"
In DirectionType = "In"
Out DirectionType = "Out"
Host RuleType = "Host"
Switch RuleType = "Switch"
)
type ACLPolicy struct {
Type PolicyType `json:"Type"`
Id string `json:"Id,omitempty"`
Protocol uint16
Protocols string `json:"Protocols,omitempty"`
InternalPort uint16
Action ActionType
Direction DirectionType
LocalAddresses string
RemoteAddresses string
LocalPorts string `json:"LocalPorts,omitempty"`
LocalPort uint16
RemotePorts string `json:"RemotePorts,omitempty"`
RemotePort uint16
RuleType RuleType `json:"RuleType,omitempty"`
Priority uint16
ServiceName string
}
type Policy struct {
Type PolicyType `json:"Type"`
}

View File

@@ -0,0 +1,200 @@
package hns
import (
"encoding/json"
"github.com/sirupsen/logrus"
)
// RoutePolicy is a structure defining schema for Route based Policy
type RoutePolicy struct {
Policy
DestinationPrefix string `json:"DestinationPrefix,omitempty"`
NextHop string `json:"NextHop,omitempty"`
EncapEnabled bool `json:"NeedEncap,omitempty"`
}
// ELBPolicy is a structure defining schema for ELB LoadBalancing based Policy
type ELBPolicy struct {
LBPolicy
SourceVIP string `json:"SourceVIP,omitempty"`
VIPs []string `json:"VIPs,omitempty"`
ILB bool `json:"ILB,omitempty"`
}
// LBPolicy is a structure defining schema for LoadBalancing based Policy
type LBPolicy struct {
Policy
Protocol uint16 `json:"Protocol,omitempty"`
InternalPort uint16
ExternalPort uint16
}
// PolicyList is a structure defining schema for Policy list request
type PolicyList struct {
ID string `json:"ID,omitempty"`
EndpointReferences []string `json:"References,omitempty"`
Policies []json.RawMessage `json:"Policies,omitempty"`
}
// HNSPolicyListRequest makes a call into HNS to update/query a single network
func HNSPolicyListRequest(method, path, request string) (*PolicyList, error) {
var policy PolicyList
err := hnsCall(method, "/policylists/"+path, request, &policy)
if err != nil {
return nil, err
}
return &policy, nil
}
// HNSListPolicyListRequest gets all the policy list
func HNSListPolicyListRequest() ([]PolicyList, error) {
var plist []PolicyList
err := hnsCall("GET", "/policylists/", "", &plist)
if err != nil {
return nil, err
}
return plist, nil
}
// PolicyListRequest makes a HNS call to modify/query a network policy list
func PolicyListRequest(method, path, request string) (*PolicyList, error) {
policylist := &PolicyList{}
err := hnsCall(method, "/policylists/"+path, request, &policylist)
if err != nil {
return nil, err
}
return policylist, nil
}
// GetPolicyListByID get the policy list by ID
func GetPolicyListByID(policyListID string) (*PolicyList, error) {
return PolicyListRequest("GET", policyListID, "")
}
// Create PolicyList by sending PolicyListRequest to HNS.
func (policylist *PolicyList) Create() (*PolicyList, error) {
operation := "Create"
title := "hcsshim::PolicyList::" + operation
logrus.Debugf(title+" id=%s", policylist.ID)
jsonString, err := json.Marshal(policylist)
if err != nil {
return nil, err
}
return PolicyListRequest("POST", "", string(jsonString))
}
// Delete deletes PolicyList
func (policylist *PolicyList) Delete() (*PolicyList, error) {
operation := "Delete"
title := "hcsshim::PolicyList::" + operation
logrus.Debugf(title+" id=%s", policylist.ID)
return PolicyListRequest("DELETE", policylist.ID, "")
}
// AddEndpoint add an endpoint to a Policy List
func (policylist *PolicyList) AddEndpoint(endpoint *HNSEndpoint) (*PolicyList, error) {
operation := "AddEndpoint"
title := "hcsshim::PolicyList::" + operation
logrus.Debugf(title+" id=%s, endpointId:%s", policylist.ID, endpoint.Id)
_, err := policylist.Delete()
if err != nil {
return nil, err
}
// Add Endpoint to the Existing List
policylist.EndpointReferences = append(policylist.EndpointReferences, "/endpoints/"+endpoint.Id)
return policylist.Create()
}
// RemoveEndpoint removes an endpoint from the Policy List
func (policylist *PolicyList) RemoveEndpoint(endpoint *HNSEndpoint) (*PolicyList, error) {
operation := "RemoveEndpoint"
title := "hcsshim::PolicyList::" + operation
logrus.Debugf(title+" id=%s, endpointId:%s", policylist.ID, endpoint.Id)
_, err := policylist.Delete()
if err != nil {
return nil, err
}
elementToRemove := "/endpoints/" + endpoint.Id
var references []string
for _, endpointReference := range policylist.EndpointReferences {
if endpointReference == elementToRemove {
continue
}
references = append(references, endpointReference)
}
policylist.EndpointReferences = references
return policylist.Create()
}
// AddLoadBalancer policy list for the specified endpoints
func AddLoadBalancer(endpoints []HNSEndpoint, isILB bool, sourceVIP, vip string, protocol uint16, internalPort uint16, externalPort uint16) (*PolicyList, error) {
operation := "AddLoadBalancer"
title := "hcsshim::PolicyList::" + operation
logrus.Debugf(title+" endpointId=%v, isILB=%v, sourceVIP=%s, vip=%s, protocol=%v, internalPort=%v, externalPort=%v", endpoints, isILB, sourceVIP, vip, protocol, internalPort, externalPort)
policylist := &PolicyList{}
elbPolicy := &ELBPolicy{
SourceVIP: sourceVIP,
ILB: isILB,
}
if len(vip) > 0 {
elbPolicy.VIPs = []string{vip}
}
elbPolicy.Type = ExternalLoadBalancer
elbPolicy.Protocol = protocol
elbPolicy.InternalPort = internalPort
elbPolicy.ExternalPort = externalPort
for _, endpoint := range endpoints {
policylist.EndpointReferences = append(policylist.EndpointReferences, "/endpoints/"+endpoint.Id)
}
jsonString, err := json.Marshal(elbPolicy)
if err != nil {
return nil, err
}
policylist.Policies = append(policylist.Policies, jsonString)
return policylist.Create()
}
// AddRoute adds route policy list for the specified endpoints
func AddRoute(endpoints []HNSEndpoint, destinationPrefix string, nextHop string, encapEnabled bool) (*PolicyList, error) {
operation := "AddRoute"
title := "hcsshim::PolicyList::" + operation
logrus.Debugf(title+" destinationPrefix:%s", destinationPrefix)
policylist := &PolicyList{}
rPolicy := &RoutePolicy{
DestinationPrefix: destinationPrefix,
NextHop: nextHop,
EncapEnabled: encapEnabled,
}
rPolicy.Type = Route
for _, endpoint := range endpoints {
policylist.EndpointReferences = append(policylist.EndpointReferences, "/endpoints/"+endpoint.Id)
}
jsonString, err := json.Marshal(rPolicy)
if err != nil {
return nil, err
}
policylist.Policies = append(policylist.Policies, jsonString)
return policylist.Create()
}

View File

@@ -0,0 +1,49 @@
package hns
import (
"github.com/sirupsen/logrus"
)
type HNSSupportedFeatures struct {
Acl HNSAclFeatures `json:"ACL"`
}
type HNSAclFeatures struct {
AclAddressLists bool `json:"AclAddressLists"`
AclNoHostRulePriority bool `json:"AclHostRulePriority"`
AclPortRanges bool `json:"AclPortRanges"`
AclRuleId bool `json:"AclRuleId"`
}
func GetHNSSupportedFeatures() HNSSupportedFeatures {
var hnsFeatures HNSSupportedFeatures
globals, err := GetHNSGlobals()
if err != nil {
// Expected on pre-1803 builds, all features will be false/unsupported
logrus.Debugf("Unable to obtain HNS globals: %s", err)
return hnsFeatures
}
hnsFeatures.Acl = HNSAclFeatures{
AclAddressLists: isHNSFeatureSupported(globals.Version, HNSVersion1803),
AclNoHostRulePriority: isHNSFeatureSupported(globals.Version, HNSVersion1803),
AclPortRanges: isHNSFeatureSupported(globals.Version, HNSVersion1803),
AclRuleId: isHNSFeatureSupported(globals.Version, HNSVersion1803),
}
return hnsFeatures
}
func isHNSFeatureSupported(currentVersion HNSVersion, minVersionSupported HNSVersion) bool {
if currentVersion.Major < minVersionSupported.Major {
return false
}
if currentVersion.Major > minVersionSupported.Major {
return true
}
if currentVersion.Minor < minVersionSupported.Minor {
return false
}
return true
}

View File

@@ -0,0 +1,110 @@
package hns
import (
"encoding/json"
"fmt"
"os"
"path"
"strings"
)
type namespaceRequest struct {
IsDefault bool `json:",omitempty"`
}
type namespaceEndpointRequest struct {
ID string `json:"Id"`
}
type NamespaceResource struct {
Type string
Data json.RawMessage
}
type namespaceResourceRequest struct {
Type string
Data interface{}
}
type Namespace struct {
ID string
IsDefault bool `json:",omitempty"`
ResourceList []NamespaceResource `json:",omitempty"`
}
func issueNamespaceRequest(id *string, method, subpath string, request interface{}) (*Namespace, error) {
var err error
hnspath := "/namespaces/"
if id != nil {
hnspath = path.Join(hnspath, *id)
}
if subpath != "" {
hnspath = path.Join(hnspath, subpath)
}
var reqJSON []byte
if request != nil {
if reqJSON, err = json.Marshal(request); err != nil {
return nil, err
}
}
var ns Namespace
err = hnsCall(method, hnspath, string(reqJSON), &ns)
if err != nil {
if strings.Contains(err.Error(), "Element not found.") {
return nil, os.ErrNotExist
}
return nil, fmt.Errorf("%s %s: %s", method, hnspath, err)
}
return &ns, err
}
func CreateNamespace() (string, error) {
req := namespaceRequest{}
ns, err := issueNamespaceRequest(nil, "POST", "", &req)
if err != nil {
return "", err
}
return ns.ID, nil
}
func RemoveNamespace(id string) error {
_, err := issueNamespaceRequest(&id, "DELETE", "", nil)
return err
}
func GetNamespaceEndpoints(id string) ([]string, error) {
ns, err := issueNamespaceRequest(&id, "GET", "", nil)
if err != nil {
return nil, err
}
var endpoints []string
for _, rsrc := range ns.ResourceList {
if rsrc.Type == "Endpoint" {
var endpoint namespaceEndpointRequest
err = json.Unmarshal(rsrc.Data, &endpoint)
if err != nil {
return nil, fmt.Errorf("unmarshal endpoint: %s", err)
}
endpoints = append(endpoints, endpoint.ID)
}
}
return endpoints, nil
}
func AddNamespaceEndpoint(id string, endpointID string) error {
resource := namespaceResourceRequest{
Type: "Endpoint",
Data: namespaceEndpointRequest{endpointID},
}
_, err := issueNamespaceRequest(&id, "POST", "addresource", &resource)
return err
}
func RemoveNamespaceEndpoint(id string, endpointID string) error {
resource := namespaceResourceRequest{
Type: "Endpoint",
Data: namespaceEndpointRequest{endpointID},
}
_, err := issueNamespaceRequest(&id, "POST", "removeresource", &resource)
return err
}

View File

@@ -0,0 +1,74 @@
// MACHINE GENERATED BY 'go generate' COMMAND; DO NOT EDIT
package hns
import (
"syscall"
"unsafe"
"github.com/Microsoft/hcsshim/internal/interop"
"golang.org/x/sys/windows"
)
var _ unsafe.Pointer
// Do the interface allocations only once for common
// Errno values.
const (
errnoERROR_IO_PENDING = 997
)
var (
errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING)
)
// errnoErr returns common boxed Errno values, to prevent
// allocations at runtime.
func errnoErr(e syscall.Errno) error {
switch e {
case 0:
return nil
case errnoERROR_IO_PENDING:
return errERROR_IO_PENDING
}
// TODO: add more here, after collecting data on the common
// error values see on Windows. (perhaps when running
// all.bat?)
return e
}
var (
modvmcompute = windows.NewLazySystemDLL("vmcompute.dll")
procHNSCall = modvmcompute.NewProc("HNSCall")
)
func _hnsCall(method string, path string, object string, response **uint16) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(method)
if hr != nil {
return
}
var _p1 *uint16
_p1, hr = syscall.UTF16PtrFromString(path)
if hr != nil {
return
}
var _p2 *uint16
_p2, hr = syscall.UTF16PtrFromString(object)
if hr != nil {
return
}
return __hnsCall(_p0, _p1, _p2, response)
}
func __hnsCall(method *uint16, path *uint16, object *uint16, response **uint16) (hr error) {
if hr = procHNSCall.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall6(procHNSCall.Addr(), 4, uintptr(unsafe.Pointer(method)), uintptr(unsafe.Pointer(path)), uintptr(unsafe.Pointer(object)), uintptr(unsafe.Pointer(response)), 0, 0)
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}

View File

@@ -0,0 +1,27 @@
package interop
import (
"syscall"
"unsafe"
)
//go:generate go run $GOROOT/src/syscall/mksyscall_windows.go -output zsyscall_windows.go interop.go
//sys coTaskMemFree(buffer unsafe.Pointer) = ole32.CoTaskMemFree
func ConvertAndFreeCoTaskMemString(buffer *uint16) string {
str := syscall.UTF16ToString((*[1 << 29]uint16)(unsafe.Pointer(buffer))[:])
coTaskMemFree(unsafe.Pointer(buffer))
return str
}
func ConvertAndFreeCoTaskMemBytes(buffer *uint16) []byte {
return []byte(ConvertAndFreeCoTaskMemString(buffer))
}
func Win32FromHresult(hr uintptr) syscall.Errno {
if hr&0x1fff0000 == 0x00070000 {
return syscall.Errno(hr & 0xffff)
}
return syscall.Errno(hr)
}

View File

@@ -0,0 +1,48 @@
// Code generated by 'go generate'; DO NOT EDIT.
package interop
import (
"syscall"
"unsafe"
"golang.org/x/sys/windows"
)
var _ unsafe.Pointer
// Do the interface allocations only once for common
// Errno values.
const (
errnoERROR_IO_PENDING = 997
)
var (
errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING)
)
// errnoErr returns common boxed Errno values, to prevent
// allocations at runtime.
func errnoErr(e syscall.Errno) error {
switch e {
case 0:
return nil
case errnoERROR_IO_PENDING:
return errERROR_IO_PENDING
}
// TODO: add more here, after collecting data on the common
// error values see on Windows. (perhaps when running
// all.bat?)
return e
}
var (
modole32 = windows.NewLazySystemDLL("ole32.dll")
procCoTaskMemFree = modole32.NewProc("CoTaskMemFree")
)
func coTaskMemFree(buffer unsafe.Pointer) {
syscall.Syscall(procCoTaskMemFree.Addr(), 1, uintptr(buffer), 0, 0)
return
}

View File

@@ -0,0 +1,24 @@
package longpath
import (
"path/filepath"
"strings"
)
// LongAbs makes a path absolute and returns it in NT long path form.
func LongAbs(path string) (string, error) {
if strings.HasPrefix(path, `\\?\`) || strings.HasPrefix(path, `\\.\`) {
return path, nil
}
if !filepath.IsAbs(path) {
absPath, err := filepath.Abs(path)
if err != nil {
return "", err
}
path = absPath
}
if strings.HasPrefix(path, `\\`) {
return `\\?\UNC\` + path[2:], nil
}
return `\\?\` + path, nil
}

View File

@@ -0,0 +1,52 @@
package mergemaps
import "encoding/json"
// Merge recursively merges map `fromMap` into map `ToMap`. Any pre-existing values
// in ToMap are overwritten. Values in fromMap are added to ToMap.
// From http://stackoverflow.com/questions/40491438/merging-two-json-strings-in-golang
func Merge(fromMap, ToMap interface{}) interface{} {
switch fromMap := fromMap.(type) {
case map[string]interface{}:
ToMap, ok := ToMap.(map[string]interface{})
if !ok {
return fromMap
}
for keyToMap, valueToMap := range ToMap {
if valueFromMap, ok := fromMap[keyToMap]; ok {
fromMap[keyToMap] = Merge(valueFromMap, valueToMap)
} else {
fromMap[keyToMap] = valueToMap
}
}
case nil:
// merge(nil, map[string]interface{...}) -> map[string]interface{...}
ToMap, ok := ToMap.(map[string]interface{})
if ok {
return ToMap
}
}
return fromMap
}
// MergeJSON merges the contents of a JSON string into an object representation,
// returning a new object suitable for translating to JSON.
func MergeJSON(object interface{}, additionalJSON []byte) (interface{}, error) {
if len(additionalJSON) == 0 {
return object, nil
}
objectJSON, err := json.Marshal(object)
if err != nil {
return nil, err
}
var objectMap, newMap map[string]interface{}
err = json.Unmarshal(objectJSON, &objectMap)
if err != nil {
return nil, err
}
err = json.Unmarshal(additionalJSON, &newMap)
if err != nil {
return nil, err
}
return Merge(newMap, objectMap), nil
}

View File

@@ -0,0 +1,431 @@
package safefile
import (
"errors"
"io"
"os"
"path/filepath"
"strings"
"syscall"
"unicode/utf16"
"unsafe"
"github.com/Microsoft/hcsshim/internal/longpath"
winio "github.com/Microsoft/go-winio"
)
//go:generate go run $GOROOT\src\syscall\mksyscall_windows.go -output zsyscall_windows.go safeopen.go
//sys ntCreateFile(handle *uintptr, accessMask uint32, oa *objectAttributes, iosb *ioStatusBlock, allocationSize *uint64, fileAttributes uint32, shareAccess uint32, createDisposition uint32, createOptions uint32, eaBuffer *byte, eaLength uint32) (status uint32) = ntdll.NtCreateFile
//sys ntSetInformationFile(handle uintptr, iosb *ioStatusBlock, information uintptr, length uint32, class uint32) (status uint32) = ntdll.NtSetInformationFile
//sys rtlNtStatusToDosError(status uint32) (winerr error) = ntdll.RtlNtStatusToDosErrorNoTeb
//sys localAlloc(flags uint32, size int) (ptr uintptr) = kernel32.LocalAlloc
//sys localFree(ptr uintptr) = kernel32.LocalFree
type ioStatusBlock struct {
Status, Information uintptr
}
type objectAttributes struct {
Length uintptr
RootDirectory uintptr
ObjectName uintptr
Attributes uintptr
SecurityDescriptor uintptr
SecurityQoS uintptr
}
type unicodeString struct {
Length uint16
MaximumLength uint16
Buffer uintptr
}
type fileLinkInformation struct {
ReplaceIfExists bool
RootDirectory uintptr
FileNameLength uint32
FileName [1]uint16
}
type fileDispositionInformationEx struct {
Flags uintptr
}
const (
_FileLinkInformation = 11
_FileDispositionInformationEx = 64
FILE_READ_ATTRIBUTES = 0x0080
FILE_WRITE_ATTRIBUTES = 0x0100
DELETE = 0x10000
FILE_OPEN = 1
FILE_CREATE = 2
FILE_DIRECTORY_FILE = 0x00000001
FILE_SYNCHRONOUS_IO_NONALERT = 0x00000020
FILE_DELETE_ON_CLOSE = 0x00001000
FILE_OPEN_FOR_BACKUP_INTENT = 0x00004000
FILE_OPEN_REPARSE_POINT = 0x00200000
FILE_DISPOSITION_DELETE = 0x00000001
_OBJ_DONT_REPARSE = 0x1000
_STATUS_REPARSE_POINT_ENCOUNTERED = 0xC000050B
)
func OpenRoot(path string) (*os.File, error) {
longpath, err := longpath.LongAbs(path)
if err != nil {
return nil, err
}
return winio.OpenForBackup(longpath, syscall.GENERIC_READ, syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE, syscall.OPEN_EXISTING)
}
func ntRelativePath(path string) ([]uint16, error) {
path = filepath.Clean(path)
if strings.Contains(":", path) {
// Since alternate data streams must follow the file they
// are attached to, finding one here (out of order) is invalid.
return nil, errors.New("path contains invalid character `:`")
}
fspath := filepath.FromSlash(path)
if len(fspath) > 0 && fspath[0] == '\\' {
return nil, errors.New("expected relative path")
}
path16 := utf16.Encode(([]rune)(fspath))
if len(path16) > 32767 {
return nil, syscall.ENAMETOOLONG
}
return path16, nil
}
// openRelativeInternal opens a relative path from the given root, failing if
// any of the intermediate path components are reparse points.
func openRelativeInternal(path string, root *os.File, accessMask uint32, shareFlags uint32, createDisposition uint32, flags uint32) (*os.File, error) {
var (
h uintptr
iosb ioStatusBlock
oa objectAttributes
)
path16, err := ntRelativePath(path)
if err != nil {
return nil, err
}
if root == nil || root.Fd() == 0 {
return nil, errors.New("missing root directory")
}
upathBuffer := localAlloc(0, int(unsafe.Sizeof(unicodeString{}))+len(path16)*2)
defer localFree(upathBuffer)
upath := (*unicodeString)(unsafe.Pointer(upathBuffer))
upath.Length = uint16(len(path16) * 2)
upath.MaximumLength = upath.Length
upath.Buffer = upathBuffer + unsafe.Sizeof(*upath)
copy((*[32768]uint16)(unsafe.Pointer(upath.Buffer))[:], path16)
oa.Length = unsafe.Sizeof(oa)
oa.ObjectName = upathBuffer
oa.RootDirectory = uintptr(root.Fd())
oa.Attributes = _OBJ_DONT_REPARSE
status := ntCreateFile(
&h,
accessMask|syscall.SYNCHRONIZE,
&oa,
&iosb,
nil,
0,
shareFlags,
createDisposition,
FILE_OPEN_FOR_BACKUP_INTENT|FILE_SYNCHRONOUS_IO_NONALERT|flags,
nil,
0,
)
if status != 0 {
return nil, rtlNtStatusToDosError(status)
}
fullPath, err := longpath.LongAbs(filepath.Join(root.Name(), path))
if err != nil {
syscall.Close(syscall.Handle(h))
return nil, err
}
return os.NewFile(h, fullPath), nil
}
// OpenRelative opens a relative path from the given root, failing if
// any of the intermediate path components are reparse points.
func OpenRelative(path string, root *os.File, accessMask uint32, shareFlags uint32, createDisposition uint32, flags uint32) (*os.File, error) {
f, err := openRelativeInternal(path, root, accessMask, shareFlags, createDisposition, flags)
if err != nil {
err = &os.PathError{Op: "open", Path: filepath.Join(root.Name(), path), Err: err}
}
return f, err
}
// LinkRelative creates a hard link from oldname to newname (relative to oldroot
// and newroot), failing if any of the intermediate path components are reparse
// points.
func LinkRelative(oldname string, oldroot *os.File, newname string, newroot *os.File) error {
// Open the old file.
oldf, err := openRelativeInternal(
oldname,
oldroot,
syscall.FILE_WRITE_ATTRIBUTES,
syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE,
FILE_OPEN,
0,
)
if err != nil {
return &os.LinkError{Op: "link", Old: filepath.Join(oldroot.Name(), oldname), New: filepath.Join(newroot.Name(), newname), Err: err}
}
defer oldf.Close()
// Open the parent of the new file.
var parent *os.File
parentPath := filepath.Dir(newname)
if parentPath != "." {
parent, err = openRelativeInternal(
parentPath,
newroot,
syscall.GENERIC_READ,
syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE,
FILE_OPEN,
FILE_DIRECTORY_FILE)
if err != nil {
return &os.LinkError{Op: "link", Old: oldf.Name(), New: filepath.Join(newroot.Name(), newname), Err: err}
}
defer parent.Close()
fi, err := winio.GetFileBasicInfo(parent)
if err != nil {
return err
}
if (fi.FileAttributes & syscall.FILE_ATTRIBUTE_REPARSE_POINT) != 0 {
return &os.LinkError{Op: "link", Old: oldf.Name(), New: filepath.Join(newroot.Name(), newname), Err: rtlNtStatusToDosError(_STATUS_REPARSE_POINT_ENCOUNTERED)}
}
} else {
parent = newroot
}
// Issue an NT call to create the link. This will be safe because NT will
// not open any more directories to create the link, so it cannot walk any
// more reparse points.
newbase := filepath.Base(newname)
newbase16, err := ntRelativePath(newbase)
if err != nil {
return err
}
size := int(unsafe.Offsetof(fileLinkInformation{}.FileName)) + len(newbase16)*2
linkinfoBuffer := localAlloc(0, size)
defer localFree(linkinfoBuffer)
linkinfo := (*fileLinkInformation)(unsafe.Pointer(linkinfoBuffer))
linkinfo.RootDirectory = parent.Fd()
linkinfo.FileNameLength = uint32(len(newbase16) * 2)
copy((*[32768]uint16)(unsafe.Pointer(&linkinfo.FileName[0]))[:], newbase16)
var iosb ioStatusBlock
status := ntSetInformationFile(
oldf.Fd(),
&iosb,
linkinfoBuffer,
uint32(size),
_FileLinkInformation,
)
if status != 0 {
return &os.LinkError{Op: "link", Old: oldf.Name(), New: filepath.Join(parent.Name(), newbase), Err: rtlNtStatusToDosError(status)}
}
return nil
}
// deleteOnClose marks a file to be deleted when the handle is closed.
func deleteOnClose(f *os.File) error {
disposition := fileDispositionInformationEx{Flags: FILE_DISPOSITION_DELETE}
var iosb ioStatusBlock
status := ntSetInformationFile(
f.Fd(),
&iosb,
uintptr(unsafe.Pointer(&disposition)),
uint32(unsafe.Sizeof(disposition)),
_FileDispositionInformationEx,
)
if status != 0 {
return rtlNtStatusToDosError(status)
}
return nil
}
// clearReadOnly clears the readonly attribute on a file.
func clearReadOnly(f *os.File) error {
bi, err := winio.GetFileBasicInfo(f)
if err != nil {
return err
}
if bi.FileAttributes&syscall.FILE_ATTRIBUTE_READONLY == 0 {
return nil
}
sbi := winio.FileBasicInfo{
FileAttributes: bi.FileAttributes &^ syscall.FILE_ATTRIBUTE_READONLY,
}
if sbi.FileAttributes == 0 {
sbi.FileAttributes = syscall.FILE_ATTRIBUTE_NORMAL
}
return winio.SetFileBasicInfo(f, &sbi)
}
// RemoveRelative removes a file or directory relative to a root, failing if any
// intermediate path components are reparse points.
func RemoveRelative(path string, root *os.File) error {
f, err := openRelativeInternal(
path,
root,
FILE_READ_ATTRIBUTES|FILE_WRITE_ATTRIBUTES|DELETE,
syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE,
FILE_OPEN,
FILE_OPEN_REPARSE_POINT)
if err == nil {
defer f.Close()
err = deleteOnClose(f)
if err == syscall.ERROR_ACCESS_DENIED {
// Maybe the file is marked readonly. Clear the bit and retry.
clearReadOnly(f)
err = deleteOnClose(f)
}
}
if err != nil {
return &os.PathError{Op: "remove", Path: filepath.Join(root.Name(), path), Err: err}
}
return nil
}
// RemoveAllRelative removes a directory tree relative to a root, failing if any
// intermediate path components are reparse points.
func RemoveAllRelative(path string, root *os.File) error {
fi, err := LstatRelative(path, root)
if err != nil {
if os.IsNotExist(err) {
return nil
}
return err
}
fileAttributes := fi.Sys().(*syscall.Win32FileAttributeData).FileAttributes
if fileAttributes&syscall.FILE_ATTRIBUTE_DIRECTORY == 0 || fileAttributes&syscall.FILE_ATTRIBUTE_REPARSE_POINT != 0 {
// If this is a reparse point, it can't have children. Simple remove will do.
err := RemoveRelative(path, root)
if err == nil || os.IsNotExist(err) {
return nil
}
return err
}
// It is necessary to use os.Open as Readdirnames does not work with
// OpenRelative. This is safe because the above lstatrelative fails
// if the target is outside the root, and we know this is not a
// symlink from the above FILE_ATTRIBUTE_REPARSE_POINT check.
fd, err := os.Open(filepath.Join(root.Name(), path))
if err != nil {
if os.IsNotExist(err) {
// Race. It was deleted between the Lstat and Open.
// Return nil per RemoveAll's docs.
return nil
}
return err
}
// Remove contents & return first error.
for {
names, err1 := fd.Readdirnames(100)
for _, name := range names {
err1 := RemoveAllRelative(path+string(os.PathSeparator)+name, root)
if err == nil {
err = err1
}
}
if err1 == io.EOF {
break
}
// If Readdirnames returned an error, use it.
if err == nil {
err = err1
}
if len(names) == 0 {
break
}
}
fd.Close()
// Remove directory.
err1 := RemoveRelative(path, root)
if err1 == nil || os.IsNotExist(err1) {
return nil
}
if err == nil {
err = err1
}
return err
}
// MkdirRelative creates a directory relative to a root, failing if any
// intermediate path components are reparse points.
func MkdirRelative(path string, root *os.File) error {
f, err := openRelativeInternal(
path,
root,
0,
syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE,
FILE_CREATE,
FILE_DIRECTORY_FILE)
if err == nil {
f.Close()
} else {
err = &os.PathError{Op: "mkdir", Path: filepath.Join(root.Name(), path), Err: err}
}
return err
}
// LstatRelative performs a stat operation on a file relative to a root, failing
// if any intermediate path components are reparse points.
func LstatRelative(path string, root *os.File) (os.FileInfo, error) {
f, err := openRelativeInternal(
path,
root,
FILE_READ_ATTRIBUTES,
syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE,
FILE_OPEN,
FILE_OPEN_REPARSE_POINT)
if err != nil {
return nil, &os.PathError{Op: "stat", Path: filepath.Join(root.Name(), path), Err: err}
}
defer f.Close()
return f.Stat()
}
// EnsureNotReparsePointRelative validates that a given file (relative to a
// root) and all intermediate path components are not a reparse points.
func EnsureNotReparsePointRelative(path string, root *os.File) error {
// Perform an open with OBJ_DONT_REPARSE but without specifying FILE_OPEN_REPARSE_POINT.
f, err := OpenRelative(
path,
root,
0,
syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE,
FILE_OPEN,
0)
if err != nil {
return err
}
f.Close()
return nil
}

View File

@@ -0,0 +1,79 @@
// Code generated by 'go generate'; DO NOT EDIT.
package safefile
import (
"syscall"
"unsafe"
"golang.org/x/sys/windows"
)
var _ unsafe.Pointer
// Do the interface allocations only once for common
// Errno values.
const (
errnoERROR_IO_PENDING = 997
)
var (
errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING)
)
// errnoErr returns common boxed Errno values, to prevent
// allocations at runtime.
func errnoErr(e syscall.Errno) error {
switch e {
case 0:
return nil
case errnoERROR_IO_PENDING:
return errERROR_IO_PENDING
}
// TODO: add more here, after collecting data on the common
// error values see on Windows. (perhaps when running
// all.bat?)
return e
}
var (
modntdll = windows.NewLazySystemDLL("ntdll.dll")
modkernel32 = windows.NewLazySystemDLL("kernel32.dll")
procNtCreateFile = modntdll.NewProc("NtCreateFile")
procNtSetInformationFile = modntdll.NewProc("NtSetInformationFile")
procRtlNtStatusToDosErrorNoTeb = modntdll.NewProc("RtlNtStatusToDosErrorNoTeb")
procLocalAlloc = modkernel32.NewProc("LocalAlloc")
procLocalFree = modkernel32.NewProc("LocalFree")
)
func ntCreateFile(handle *uintptr, accessMask uint32, oa *objectAttributes, iosb *ioStatusBlock, allocationSize *uint64, fileAttributes uint32, shareAccess uint32, createDisposition uint32, createOptions uint32, eaBuffer *byte, eaLength uint32) (status uint32) {
r0, _, _ := syscall.Syscall12(procNtCreateFile.Addr(), 11, uintptr(unsafe.Pointer(handle)), uintptr(accessMask), uintptr(unsafe.Pointer(oa)), uintptr(unsafe.Pointer(iosb)), uintptr(unsafe.Pointer(allocationSize)), uintptr(fileAttributes), uintptr(shareAccess), uintptr(createDisposition), uintptr(createOptions), uintptr(unsafe.Pointer(eaBuffer)), uintptr(eaLength), 0)
status = uint32(r0)
return
}
func ntSetInformationFile(handle uintptr, iosb *ioStatusBlock, information uintptr, length uint32, class uint32) (status uint32) {
r0, _, _ := syscall.Syscall6(procNtSetInformationFile.Addr(), 5, uintptr(handle), uintptr(unsafe.Pointer(iosb)), uintptr(information), uintptr(length), uintptr(class), 0)
status = uint32(r0)
return
}
func rtlNtStatusToDosError(status uint32) (winerr error) {
r0, _, _ := syscall.Syscall(procRtlNtStatusToDosErrorNoTeb.Addr(), 1, uintptr(status), 0, 0)
if r0 != 0 {
winerr = syscall.Errno(r0)
}
return
}
func localAlloc(flags uint32, size int) (ptr uintptr) {
r0, _, _ := syscall.Syscall(procLocalAlloc.Addr(), 2, uintptr(flags), uintptr(size), 0)
ptr = uintptr(r0)
return
}
func localFree(ptr uintptr) {
syscall.Syscall(procLocalFree.Addr(), 1, uintptr(ptr), 0, 0)
return
}

View File

@@ -0,0 +1,228 @@
package schema1
import (
"encoding/json"
"time"
)
// ProcessConfig is used as both the input of Container.CreateProcess
// and to convert the parameters to JSON for passing onto the HCS
type ProcessConfig struct {
ApplicationName string `json:",omitempty"`
CommandLine string `json:",omitempty"`
CommandArgs []string `json:",omitempty"` // Used by Linux Containers on Windows
User string `json:",omitempty"`
WorkingDirectory string `json:",omitempty"`
Environment map[string]string `json:",omitempty"`
EmulateConsole bool `json:",omitempty"`
CreateStdInPipe bool `json:",omitempty"`
CreateStdOutPipe bool `json:",omitempty"`
CreateStdErrPipe bool `json:",omitempty"`
ConsoleSize [2]uint `json:",omitempty"`
CreateInUtilityVm bool `json:",omitempty"` // Used by Linux Containers on Windows
OCISpecification *json.RawMessage `json:",omitempty"` // Used by Linux Containers on Windows
}
type Layer struct {
ID string
Path string
}
type MappedDir struct {
HostPath string
ContainerPath string
ReadOnly bool
BandwidthMaximum uint64
IOPSMaximum uint64
CreateInUtilityVM bool
// LinuxMetadata - Support added in 1803/RS4+.
LinuxMetadata bool `json:",omitempty"`
}
type MappedPipe struct {
HostPath string
ContainerPipeName string
}
type HvRuntime struct {
ImagePath string `json:",omitempty"`
SkipTemplate bool `json:",omitempty"`
LinuxInitrdFile string `json:",omitempty"` // File under ImagePath on host containing an initrd image for starting a Linux utility VM
LinuxKernelFile string `json:",omitempty"` // File under ImagePath on host containing a kernel for starting a Linux utility VM
LinuxBootParameters string `json:",omitempty"` // Additional boot parameters for starting a Linux Utility VM in initrd mode
BootSource string `json:",omitempty"` // "Vhd" for Linux Utility VM booting from VHD
WritableBootSource bool `json:",omitempty"` // Linux Utility VM booting from VHD
}
type MappedVirtualDisk struct {
HostPath string `json:",omitempty"` // Path to VHD on the host
ContainerPath string // Platform-specific mount point path in the container
CreateInUtilityVM bool `json:",omitempty"`
ReadOnly bool `json:",omitempty"`
Cache string `json:",omitempty"` // "" (Unspecified); "Disabled"; "Enabled"; "Private"; "PrivateAllowSharing"
AttachOnly bool `json:",omitempty:`
}
// AssignedDevice represents a device that has been directly assigned to a container
//
// NOTE: Support added in RS5
type AssignedDevice struct {
// InterfaceClassGUID of the device to assign to container.
InterfaceClassGUID string `json:"InterfaceClassGuid,omitempty"`
}
// ContainerConfig is used as both the input of CreateContainer
// and to convert the parameters to JSON for passing onto the HCS
type ContainerConfig struct {
SystemType string // HCS requires this to be hard-coded to "Container"
Name string // Name of the container. We use the docker ID.
Owner string `json:",omitempty"` // The management platform that created this container
VolumePath string `json:",omitempty"` // Windows volume path for scratch space. Used by Windows Server Containers only. Format \\?\\Volume{GUID}
IgnoreFlushesDuringBoot bool `json:",omitempty"` // Optimization hint for container startup in Windows
LayerFolderPath string `json:",omitempty"` // Where the layer folders are located. Used by Windows Server Containers only. Format %root%\windowsfilter\containerID
Layers []Layer // List of storage layers. Required for Windows Server and Hyper-V Containers. Format ID=GUID;Path=%root%\windowsfilter\layerID
Credentials string `json:",omitempty"` // Credentials information
ProcessorCount uint32 `json:",omitempty"` // Number of processors to assign to the container.
ProcessorWeight uint64 `json:",omitempty"` // CPU shares (relative weight to other containers with cpu shares). Range is from 1 to 10000. A value of 0 results in default shares.
ProcessorMaximum int64 `json:",omitempty"` // Specifies the portion of processor cycles that this container can use as a percentage times 100. Range is from 1 to 10000. A value of 0 results in no limit.
StorageIOPSMaximum uint64 `json:",omitempty"` // Maximum Storage IOPS
StorageBandwidthMaximum uint64 `json:",omitempty"` // Maximum Storage Bandwidth in bytes per second
StorageSandboxSize uint64 `json:",omitempty"` // Size in bytes that the container system drive should be expanded to if smaller
MemoryMaximumInMB int64 `json:",omitempty"` // Maximum memory available to the container in Megabytes
HostName string `json:",omitempty"` // Hostname
MappedDirectories []MappedDir `json:",omitempty"` // List of mapped directories (volumes/mounts)
MappedPipes []MappedPipe `json:",omitempty"` // List of mapped Windows named pipes
HvPartition bool // True if it a Hyper-V Container
NetworkSharedContainerName string `json:",omitempty"` // Name (ID) of the container that we will share the network stack with.
EndpointList []string `json:",omitempty"` // List of networking endpoints to be attached to container
HvRuntime *HvRuntime `json:",omitempty"` // Hyper-V container settings. Used by Hyper-V containers only. Format ImagePath=%root%\BaseLayerID\UtilityVM
Servicing bool `json:",omitempty"` // True if this container is for servicing
AllowUnqualifiedDNSQuery bool `json:",omitempty"` // True to allow unqualified DNS name resolution
DNSSearchList string `json:",omitempty"` // Comma seperated list of DNS suffixes to use for name resolution
ContainerType string `json:",omitempty"` // "Linux" for Linux containers on Windows. Omitted otherwise.
TerminateOnLastHandleClosed bool `json:",omitempty"` // Should HCS terminate the container once all handles have been closed
MappedVirtualDisks []MappedVirtualDisk `json:",omitempty"` // Array of virtual disks to mount at start
AssignedDevices []AssignedDevice `json:",omitempty"` // Array of devices to assign. NOTE: Support added in RS5
}
type ComputeSystemQuery struct {
IDs []string `json:"Ids,omitempty"`
Types []string `json:",omitempty"`
Names []string `json:",omitempty"`
Owners []string `json:",omitempty"`
}
type PropertyType string
const (
PropertyTypeStatistics PropertyType = "Statistics"
PropertyTypeProcessList = "ProcessList"
PropertyTypeMappedVirtualDisk = "MappedVirtualDisk"
)
type PropertyQuery struct {
PropertyTypes []PropertyType `json:",omitempty"`
}
// ContainerProperties holds the properties for a container and the processes running in that container
type ContainerProperties struct {
ID string `json:"Id"`
State string
Name string
SystemType string
Owner string
SiloGUID string `json:"SiloGuid,omitempty"`
RuntimeID string `json:"RuntimeId,omitempty"`
IsRuntimeTemplate bool `json:",omitempty"`
RuntimeImagePath string `json:",omitempty"`
Stopped bool `json:",omitempty"`
ExitType string `json:",omitempty"`
AreUpdatesPending bool `json:",omitempty"`
ObRoot string `json:",omitempty"`
Statistics Statistics `json:",omitempty"`
ProcessList []ProcessListItem `json:",omitempty"`
MappedVirtualDiskControllers map[int]MappedVirtualDiskController `json:",omitempty"`
}
// MemoryStats holds the memory statistics for a container
type MemoryStats struct {
UsageCommitBytes uint64 `json:"MemoryUsageCommitBytes,omitempty"`
UsageCommitPeakBytes uint64 `json:"MemoryUsageCommitPeakBytes,omitempty"`
UsagePrivateWorkingSetBytes uint64 `json:"MemoryUsagePrivateWorkingSetBytes,omitempty"`
}
// ProcessorStats holds the processor statistics for a container
type ProcessorStats struct {
TotalRuntime100ns uint64 `json:",omitempty"`
RuntimeUser100ns uint64 `json:",omitempty"`
RuntimeKernel100ns uint64 `json:",omitempty"`
}
// StorageStats holds the storage statistics for a container
type StorageStats struct {
ReadCountNormalized uint64 `json:",omitempty"`
ReadSizeBytes uint64 `json:",omitempty"`
WriteCountNormalized uint64 `json:",omitempty"`
WriteSizeBytes uint64 `json:",omitempty"`
}
// NetworkStats holds the network statistics for a container
type NetworkStats struct {
BytesReceived uint64 `json:",omitempty"`
BytesSent uint64 `json:",omitempty"`
PacketsReceived uint64 `json:",omitempty"`
PacketsSent uint64 `json:",omitempty"`
DroppedPacketsIncoming uint64 `json:",omitempty"`
DroppedPacketsOutgoing uint64 `json:",omitempty"`
EndpointId string `json:",omitempty"`
InstanceId string `json:",omitempty"`
}
// Statistics is the structure returned by a statistics call on a container
type Statistics struct {
Timestamp time.Time `json:",omitempty"`
ContainerStartTime time.Time `json:",omitempty"`
Uptime100ns uint64 `json:",omitempty"`
Memory MemoryStats `json:",omitempty"`
Processor ProcessorStats `json:",omitempty"`
Storage StorageStats `json:",omitempty"`
Network []NetworkStats `json:",omitempty"`
}
// ProcessList is the structure of an item returned by a ProcessList call on a container
type ProcessListItem struct {
CreateTimestamp time.Time `json:",omitempty"`
ImageName string `json:",omitempty"`
KernelTime100ns uint64 `json:",omitempty"`
MemoryCommitBytes uint64 `json:",omitempty"`
MemoryWorkingSetPrivateBytes uint64 `json:",omitempty"`
MemoryWorkingSetSharedBytes uint64 `json:",omitempty"`
ProcessId uint32 `json:",omitempty"`
UserTime100ns uint64 `json:",omitempty"`
}
// MappedVirtualDiskController is the structure of an item returned by a MappedVirtualDiskList call on a container
type MappedVirtualDiskController struct {
MappedVirtualDisks map[int]MappedVirtualDisk `json:",omitempty"`
}
// Type of Request Support in ModifySystem
type RequestType string
// Type of Resource Support in ModifySystem
type ResourceType string
// RequestType const
const (
Add RequestType = "Add"
Remove RequestType = "Remove"
Network ResourceType = "Network"
)
// ResourceModificationRequestResponse is the structure used to send request to the container to modify the system
// Supported resource types are Network and Request Types are Add/Remove
type ResourceModificationRequestResponse struct {
Resource ResourceType `json:"ResourceType"`
Data interface{} `json:"Settings"`
Request RequestType `json:"RequestType,omitempty"`
}

View File

@@ -0,0 +1,70 @@
package timeout
import (
"os"
"strconv"
"time"
)
var (
// defaultTimeout is the timeout for most operations that is not overridden.
defaultTimeout = 4 * time.Minute
// defaultTimeoutTestdRetry is the retry loop timeout for testd to respond
// for a disk to come online in LCOW.
defaultTimeoutTestdRetry = 5 * time.Second
)
// External variables for HCSShim consumers to use.
var (
// SystemCreate is the timeout for creating a compute system
SystemCreate time.Duration = defaultTimeout
// SystemStart is the timeout for starting a compute system
SystemStart time.Duration = defaultTimeout
// SystemPause is the timeout for pausing a compute system
SystemPause time.Duration = defaultTimeout
// SystemResume is the timeout for resuming a compute system
SystemResume time.Duration = defaultTimeout
// SyscallWatcher is the timeout before warning of a potential stuck platform syscall.
SyscallWatcher time.Duration = defaultTimeout
// Tar2VHD is the timeout for the tar2vhd operation to complete
Tar2VHD time.Duration = defaultTimeout
// ExternalCommandToStart is the timeout for external commands to start
ExternalCommandToStart = defaultTimeout
// ExternalCommandToComplete is the timeout for external commands to complete.
// Generally this means copying data from their stdio pipes.
ExternalCommandToComplete = defaultTimeout
// TestDRetryLoop is the timeout for testd retry loop when onlining a SCSI disk in LCOW
TestDRetryLoop = defaultTimeoutTestdRetry
)
func init() {
SystemCreate = durationFromEnvironment("HCSSHIM_TIMEOUT_SYSTEMCREATE", SystemCreate)
SystemStart = durationFromEnvironment("HCSSHIM_TIMEOUT_SYSTEMSTART", SystemStart)
SystemPause = durationFromEnvironment("HCSSHIM_TIMEOUT_SYSTEMPAUSE", SystemPause)
SystemResume = durationFromEnvironment("HCSSHIM_TIMEOUT_SYSTEMRESUME", SystemResume)
SyscallWatcher = durationFromEnvironment("HCSSHIM_TIMEOUT_SYSCALLWATCHER", SyscallWatcher)
Tar2VHD = durationFromEnvironment("HCSSHIM_TIMEOUT_TAR2VHD", Tar2VHD)
ExternalCommandToStart = durationFromEnvironment("HCSSHIM_TIMEOUT_EXTERNALCOMMANDSTART", ExternalCommandToStart)
ExternalCommandToComplete = durationFromEnvironment("HCSSHIM_TIMEOUT_EXTERNALCOMMANDCOMPLETE", ExternalCommandToComplete)
TestDRetryLoop = durationFromEnvironment("HCSSHIM_TIMEOUT_TESTDRETRYLOOP", TestDRetryLoop)
}
func durationFromEnvironment(env string, defaultValue time.Duration) time.Duration {
envTimeout := os.Getenv(env)
if len(envTimeout) > 0 {
e, err := strconv.Atoi(envTimeout)
if err == nil && e > 0 {
return time.Second * time.Duration(e)
}
}
return defaultValue
}

View File

@@ -0,0 +1,25 @@
package wclayer
import (
"github.com/Microsoft/hcsshim/internal/hcserror"
"github.com/sirupsen/logrus"
)
// ActivateLayer will find the layer with the given id and mount it's filesystem.
// For a read/write layer, the mounted filesystem will appear as a volume on the
// host, while a read-only layer is generally expected to be a no-op.
// An activated layer must later be deactivated via DeactivateLayer.
func ActivateLayer(path string) error {
title := "hcsshim::ActivateLayer "
logrus.Debugf(title+"path %s", path)
err := activateLayer(&stdDriverInfo, path)
if err != nil {
err = hcserror.Errorf(err, title, "path=%s", path)
logrus.Error(err)
return err
}
logrus.Debugf(title+" - succeeded path=%s", path)
return nil
}

View File

@@ -0,0 +1,173 @@
package wclayer
import (
"errors"
"os"
"path/filepath"
"syscall"
"github.com/Microsoft/go-winio"
"github.com/Microsoft/hcsshim/internal/hcserror"
"github.com/Microsoft/hcsshim/internal/safefile"
)
type baseLayerWriter struct {
root *os.File
f *os.File
bw *winio.BackupFileWriter
err error
hasUtilityVM bool
dirInfo []dirInfo
}
type dirInfo struct {
path string
fileInfo winio.FileBasicInfo
}
// reapplyDirectoryTimes reapplies directory modification, creation, etc. times
// after processing of the directory tree has completed. The times are expected
// to be ordered such that parent directories come before child directories.
func reapplyDirectoryTimes(root *os.File, dis []dirInfo) error {
for i := range dis {
di := &dis[len(dis)-i-1] // reverse order: process child directories first
f, err := safefile.OpenRelative(di.path, root, syscall.GENERIC_READ|syscall.GENERIC_WRITE, syscall.FILE_SHARE_READ, safefile.FILE_OPEN, safefile.FILE_DIRECTORY_FILE)
if err != nil {
return err
}
err = winio.SetFileBasicInfo(f, &di.fileInfo)
f.Close()
if err != nil {
return err
}
}
return nil
}
func (w *baseLayerWriter) closeCurrentFile() error {
if w.f != nil {
err := w.bw.Close()
err2 := w.f.Close()
w.f = nil
w.bw = nil
if err != nil {
return err
}
if err2 != nil {
return err2
}
}
return nil
}
func (w *baseLayerWriter) Add(name string, fileInfo *winio.FileBasicInfo) (err error) {
defer func() {
if err != nil {
w.err = err
}
}()
err = w.closeCurrentFile()
if err != nil {
return err
}
if filepath.ToSlash(name) == `UtilityVM/Files` {
w.hasUtilityVM = true
}
var f *os.File
defer func() {
if f != nil {
f.Close()
}
}()
extraFlags := uint32(0)
if fileInfo.FileAttributes&syscall.FILE_ATTRIBUTE_DIRECTORY != 0 {
extraFlags |= safefile.FILE_DIRECTORY_FILE
if fileInfo.FileAttributes&syscall.FILE_ATTRIBUTE_REPARSE_POINT == 0 {
w.dirInfo = append(w.dirInfo, dirInfo{name, *fileInfo})
}
}
mode := uint32(syscall.GENERIC_READ | syscall.GENERIC_WRITE | winio.WRITE_DAC | winio.WRITE_OWNER | winio.ACCESS_SYSTEM_SECURITY)
f, err = safefile.OpenRelative(name, w.root, mode, syscall.FILE_SHARE_READ, safefile.FILE_CREATE, extraFlags)
if err != nil {
return hcserror.New(err, "Failed to safefile.OpenRelative", name)
}
err = winio.SetFileBasicInfo(f, fileInfo)
if err != nil {
return hcserror.New(err, "Failed to SetFileBasicInfo", name)
}
w.f = f
w.bw = winio.NewBackupFileWriter(f, true)
f = nil
return nil
}
func (w *baseLayerWriter) AddLink(name string, target string) (err error) {
defer func() {
if err != nil {
w.err = err
}
}()
err = w.closeCurrentFile()
if err != nil {
return err
}
return safefile.LinkRelative(target, w.root, name, w.root)
}
func (w *baseLayerWriter) Remove(name string) error {
return errors.New("base layer cannot have tombstones")
}
func (w *baseLayerWriter) Write(b []byte) (int, error) {
n, err := w.bw.Write(b)
if err != nil {
w.err = err
}
return n, err
}
func (w *baseLayerWriter) Close() error {
defer func() {
w.root.Close()
w.root = nil
}()
err := w.closeCurrentFile()
if err != nil {
return err
}
if w.err == nil {
// Restore the file times of all the directories, since they may have
// been modified by creating child directories.
err = reapplyDirectoryTimes(w.root, w.dirInfo)
if err != nil {
return err
}
err = ProcessBaseLayer(w.root.Name())
if err != nil {
return err
}
if w.hasUtilityVM {
err := safefile.EnsureNotReparsePointRelative("UtilityVM", w.root)
if err != nil {
return err
}
err = ProcessUtilityVMImage(filepath.Join(w.root.Name(), "UtilityVM"))
if err != nil {
return err
}
}
}
return w.err
}

View File

@@ -0,0 +1,23 @@
package wclayer
import (
"github.com/Microsoft/hcsshim/internal/hcserror"
"github.com/sirupsen/logrus"
)
// CreateLayer creates a new, empty, read-only layer on the filesystem based on
// the parent layer provided.
func CreateLayer(path, parent string) error {
title := "hcsshim::CreateLayer "
logrus.Debugf(title+"ID %s parent %s", path, parent)
err := createLayer(&stdDriverInfo, path, parent)
if err != nil {
err = hcserror.Errorf(err, title, "path=%s parent=%s", path, parent)
logrus.Error(err)
return err
}
logrus.Debugf(title+"- succeeded path=%s parent=%s", path, parent)
return nil
}

View File

@@ -0,0 +1,31 @@
package wclayer
import (
"github.com/Microsoft/hcsshim/internal/hcserror"
"github.com/sirupsen/logrus"
)
// CreateScratchLayer creates and populates new read-write layer for use by a container.
// This requires both the id of the direct parent layer, as well as the full list
// of paths to all parent layers up to the base (and including the direct parent
// whose id was provided).
func CreateScratchLayer(path string, parentLayerPaths []string) error {
title := "hcsshim::CreateScratchLayer "
logrus.Debugf(title+"path %s", path)
// Generate layer descriptors
layers, err := layerPathsToDescriptors(parentLayerPaths)
if err != nil {
return err
}
err = createSandboxLayer(&stdDriverInfo, path, 0, layers)
if err != nil {
err = hcserror.Errorf(err, title, "path=%s", path)
logrus.Error(err)
return err
}
logrus.Debugf(title+"- succeeded path=%s", path)
return nil
}

View File

@@ -0,0 +1,22 @@
package wclayer
import (
"github.com/Microsoft/hcsshim/internal/hcserror"
"github.com/sirupsen/logrus"
)
// DeactivateLayer will dismount a layer that was mounted via ActivateLayer.
func DeactivateLayer(path string) error {
title := "hcsshim::DeactivateLayer "
logrus.Debugf(title+"path %s", path)
err := deactivateLayer(&stdDriverInfo, path)
if err != nil {
err = hcserror.Errorf(err, title, "path=%s", path)
logrus.Error(err)
return err
}
logrus.Debugf(title+"succeeded path=%s", path)
return nil
}

View File

@@ -0,0 +1,23 @@
package wclayer
import (
"github.com/Microsoft/hcsshim/internal/hcserror"
"github.com/sirupsen/logrus"
)
// DestroyLayer will remove the on-disk files representing the layer with the given
// path, including that layer's containing folder, if any.
func DestroyLayer(path string) error {
title := "hcsshim::DestroyLayer "
logrus.Debugf(title+"path %s", path)
err := destroyLayer(&stdDriverInfo, path)
if err != nil {
err = hcserror.Errorf(err, title, "path=%s", path)
logrus.Error(err)
return err
}
logrus.Debugf(title+"succeeded path=%s", path)
return nil
}

View File

@@ -0,0 +1,22 @@
package wclayer
import (
"github.com/Microsoft/hcsshim/internal/hcserror"
"github.com/sirupsen/logrus"
)
// ExpandScratchSize expands the size of a layer to at least size bytes.
func ExpandScratchSize(path string, size uint64) error {
title := "hcsshim::ExpandScratchSize "
logrus.Debugf(title+"path=%s size=%d", path, size)
err := expandSandboxSize(&stdDriverInfo, path, size)
if err != nil {
err = hcserror.Errorf(err, title, "path=%s size=%d", path, size)
logrus.Error(err)
return err
}
logrus.Debugf(title+"- succeeded path=%s size=%d", path, size)
return nil
}

View File

@@ -0,0 +1,147 @@
package wclayer
import (
"io"
"io/ioutil"
"os"
"syscall"
"github.com/Microsoft/go-winio"
"github.com/Microsoft/hcsshim/internal/hcserror"
"github.com/Microsoft/hcsshim/internal/interop"
"github.com/sirupsen/logrus"
)
// ExportLayer will create a folder at exportFolderPath and fill that folder with
// the transport format version of the layer identified by layerId. This transport
// format includes any metadata required for later importing the layer (using
// ImportLayer), and requires the full list of parent layer paths in order to
// perform the export.
func ExportLayer(path string, exportFolderPath string, parentLayerPaths []string) error {
title := "hcsshim::ExportLayer "
logrus.Debugf(title+"path %s folder %s", path, exportFolderPath)
// Generate layer descriptors
layers, err := layerPathsToDescriptors(parentLayerPaths)
if err != nil {
return err
}
err = exportLayer(&stdDriverInfo, path, exportFolderPath, layers)
if err != nil {
err = hcserror.Errorf(err, title, "path=%s folder=%s", path, exportFolderPath)
logrus.Error(err)
return err
}
logrus.Debugf(title+"succeeded path=%s folder=%s", path, exportFolderPath)
return nil
}
type LayerReader interface {
Next() (string, int64, *winio.FileBasicInfo, error)
Read(b []byte) (int, error)
Close() error
}
// FilterLayerReader provides an interface for extracting the contents of an on-disk layer.
type FilterLayerReader struct {
context uintptr
}
// Next reads the next available file from a layer, ensuring that parent directories are always read
// before child files and directories.
//
// Next returns the file's relative path, size, and basic file metadata. Read() should be used to
// extract a Win32 backup stream with the remainder of the metadata and the data.
func (r *FilterLayerReader) Next() (string, int64, *winio.FileBasicInfo, error) {
var fileNamep *uint16
fileInfo := &winio.FileBasicInfo{}
var deleted uint32
var fileSize int64
err := exportLayerNext(r.context, &fileNamep, fileInfo, &fileSize, &deleted)
if err != nil {
if err == syscall.ERROR_NO_MORE_FILES {
err = io.EOF
} else {
err = hcserror.New(err, "ExportLayerNext", "")
}
return "", 0, nil, err
}
fileName := interop.ConvertAndFreeCoTaskMemString(fileNamep)
if deleted != 0 {
fileInfo = nil
}
if fileName[0] == '\\' {
fileName = fileName[1:]
}
return fileName, fileSize, fileInfo, nil
}
// Read reads from the current file's Win32 backup stream.
func (r *FilterLayerReader) Read(b []byte) (int, error) {
var bytesRead uint32
err := exportLayerRead(r.context, b, &bytesRead)
if err != nil {
return 0, hcserror.New(err, "ExportLayerRead", "")
}
if bytesRead == 0 {
return 0, io.EOF
}
return int(bytesRead), nil
}
// Close frees resources associated with the layer reader. It will return an
// error if there was an error while reading the layer or of the layer was not
// completely read.
func (r *FilterLayerReader) Close() (err error) {
if r.context != 0 {
err = exportLayerEnd(r.context)
if err != nil {
err = hcserror.New(err, "ExportLayerEnd", "")
}
r.context = 0
}
return
}
// NewLayerReader returns a new layer reader for reading the contents of an on-disk layer.
// The caller must have taken the SeBackupPrivilege privilege
// to call this and any methods on the resulting LayerReader.
func NewLayerReader(path string, parentLayerPaths []string) (LayerReader, error) {
if procExportLayerBegin.Find() != nil {
// The new layer reader is not available on this Windows build. Fall back to the
// legacy export code path.
exportPath, err := ioutil.TempDir("", "hcs")
if err != nil {
return nil, err
}
err = ExportLayer(path, exportPath, parentLayerPaths)
if err != nil {
os.RemoveAll(exportPath)
return nil, err
}
return &legacyLayerReaderWrapper{newLegacyLayerReader(exportPath)}, nil
}
layers, err := layerPathsToDescriptors(parentLayerPaths)
if err != nil {
return nil, err
}
r := &FilterLayerReader{}
err = exportLayerBegin(&stdDriverInfo, path, layers, &r.context)
if err != nil {
return nil, hcserror.New(err, "ExportLayerBegin", "")
}
return r, err
}
type legacyLayerReaderWrapper struct {
*legacyLayerReader
}
func (r *legacyLayerReaderWrapper) Close() error {
err := r.legacyLayerReader.Close()
os.RemoveAll(r.root)
return err
}

View File

@@ -0,0 +1,49 @@
package wclayer
import (
"syscall"
"github.com/Microsoft/hcsshim/internal/hcserror"
"github.com/sirupsen/logrus"
)
// GetLayerMountPath will look for a mounted layer with the given path and return
// the path at which that layer can be accessed. This path may be a volume path
// if the layer is a mounted read-write layer, otherwise it is expected to be the
// folder path at which the layer is stored.
func GetLayerMountPath(path string) (string, error) {
title := "hcsshim::GetLayerMountPath "
logrus.Debugf(title+"path %s", path)
var mountPathLength uintptr
mountPathLength = 0
// Call the procedure itself.
logrus.Debugf("Calling proc (1)")
err := getLayerMountPath(&stdDriverInfo, path, &mountPathLength, nil)
if err != nil {
err = hcserror.Errorf(err, title, "(first call) path=%s", path)
logrus.Error(err)
return "", err
}
// Allocate a mount path of the returned length.
if mountPathLength == 0 {
return "", nil
}
mountPathp := make([]uint16, mountPathLength)
mountPathp[0] = 0
// Call the procedure again
logrus.Debugf("Calling proc (2)")
err = getLayerMountPath(&stdDriverInfo, path, &mountPathLength, &mountPathp[0])
if err != nil {
err = hcserror.Errorf(err, title, "(second call) path=%s", path)
logrus.Error(err)
return "", err
}
mountPath := syscall.UTF16ToString(mountPathp[0:])
logrus.Debugf(title+"succeeded path=%s mountPath=%s", path, mountPath)
return mountPath, nil
}

View File

@@ -0,0 +1,26 @@
package wclayer
import (
"github.com/Microsoft/hcsshim/internal/hcserror"
"github.com/Microsoft/hcsshim/internal/interop"
"github.com/sirupsen/logrus"
)
// GetSharedBaseImages will enumerate the images stored in the common central
// image store and return descriptive info about those images for the purpose
// of registering them with the graphdriver, graph, and tagstore.
func GetSharedBaseImages() (imageData string, err error) {
title := "hcsshim::GetSharedBaseImages "
logrus.Debugf("Calling proc")
var buffer *uint16
err = getBaseImages(&buffer)
if err != nil {
err = hcserror.New(err, title, "")
logrus.Error(err)
return
}
imageData = interop.ConvertAndFreeCoTaskMemString(buffer)
logrus.Debugf(title+" - succeeded output=%s", imageData)
return
}

View File

@@ -0,0 +1,24 @@
package wclayer
import (
"fmt"
"github.com/Microsoft/hcsshim/internal/hcserror"
"github.com/sirupsen/logrus"
)
// GrantVmAccess adds access to a file for a given VM
func GrantVmAccess(vmid string, filepath string) error {
title := fmt.Sprintf("hcsshim::GrantVmAccess id:%s path:%s ", vmid, filepath)
logrus.Debugf(title)
err := grantVmAccess(vmid, filepath)
if err != nil {
err = hcserror.Errorf(err, title, "path=%s", filepath)
logrus.Error(err)
return err
}
logrus.Debugf(title + " - succeeded")
return nil
}

View File

@@ -0,0 +1,206 @@
package wclayer
import (
"errors"
"io/ioutil"
"os"
"path/filepath"
"github.com/Microsoft/go-winio"
"github.com/Microsoft/hcsshim/internal/hcserror"
"github.com/Microsoft/hcsshim/internal/safefile"
"github.com/sirupsen/logrus"
)
// ImportLayer will take the contents of the folder at importFolderPath and import
// that into a layer with the id layerId. Note that in order to correctly populate
// the layer and interperet the transport format, all parent layers must already
// be present on the system at the paths provided in parentLayerPaths.
func ImportLayer(path string, importFolderPath string, parentLayerPaths []string) error {
title := "hcsshim::ImportLayer "
logrus.Debugf(title+"path %s folder %s", path, importFolderPath)
// Generate layer descriptors
layers, err := layerPathsToDescriptors(parentLayerPaths)
if err != nil {
return err
}
err = importLayer(&stdDriverInfo, path, importFolderPath, layers)
if err != nil {
err = hcserror.Errorf(err, title, "path=%s folder=%s", path, importFolderPath)
logrus.Error(err)
return err
}
logrus.Debugf(title+"succeeded path=%s folder=%s", path, importFolderPath)
return nil
}
// LayerWriter is an interface that supports writing a new container image layer.
type LayerWriter interface {
// Add adds a file to the layer with given metadata.
Add(name string, fileInfo *winio.FileBasicInfo) error
// AddLink adds a hard link to the layer. The target must already have been added.
AddLink(name string, target string) error
// Remove removes a file that was present in a parent layer from the layer.
Remove(name string) error
// Write writes data to the current file. The data must be in the format of a Win32
// backup stream.
Write(b []byte) (int, error)
// Close finishes the layer writing process and releases any resources.
Close() error
}
// FilterLayerWriter provides an interface to write the contents of a layer to the file system.
type FilterLayerWriter struct {
context uintptr
}
// Add adds a file or directory to the layer. The file's parent directory must have already been added.
//
// name contains the file's relative path. fileInfo contains file times and file attributes; the rest
// of the file metadata and the file data must be written as a Win32 backup stream to the Write() method.
// winio.BackupStreamWriter can be used to facilitate this.
func (w *FilterLayerWriter) Add(name string, fileInfo *winio.FileBasicInfo) error {
if name[0] != '\\' {
name = `\` + name
}
err := importLayerNext(w.context, name, fileInfo)
if err != nil {
return hcserror.New(err, "ImportLayerNext", "")
}
return nil
}
// AddLink adds a hard link to the layer. The target of the link must have already been added.
func (w *FilterLayerWriter) AddLink(name string, target string) error {
return errors.New("hard links not yet supported")
}
// Remove removes a file from the layer. The file must have been present in the parent layer.
//
// name contains the file's relative path.
func (w *FilterLayerWriter) Remove(name string) error {
if name[0] != '\\' {
name = `\` + name
}
err := importLayerNext(w.context, name, nil)
if err != nil {
return hcserror.New(err, "ImportLayerNext", "")
}
return nil
}
// Write writes more backup stream data to the current file.
func (w *FilterLayerWriter) Write(b []byte) (int, error) {
err := importLayerWrite(w.context, b)
if err != nil {
err = hcserror.New(err, "ImportLayerWrite", "")
return 0, err
}
return len(b), err
}
// Close completes the layer write operation. The error must be checked to ensure that the
// operation was successful.
func (w *FilterLayerWriter) Close() (err error) {
if w.context != 0 {
err = importLayerEnd(w.context)
if err != nil {
err = hcserror.New(err, "ImportLayerEnd", "")
}
w.context = 0
}
return
}
type legacyLayerWriterWrapper struct {
*legacyLayerWriter
path string
parentLayerPaths []string
}
func (r *legacyLayerWriterWrapper) Close() error {
defer os.RemoveAll(r.root.Name())
defer r.legacyLayerWriter.CloseRoots()
err := r.legacyLayerWriter.Close()
if err != nil {
return err
}
if err = ImportLayer(r.destRoot.Name(), r.path, r.parentLayerPaths); err != nil {
return err
}
for _, name := range r.Tombstones {
if err = safefile.RemoveRelative(name, r.destRoot); err != nil && !os.IsNotExist(err) {
return err
}
}
// Add any hard links that were collected.
for _, lnk := range r.PendingLinks {
if err = safefile.RemoveRelative(lnk.Path, r.destRoot); err != nil && !os.IsNotExist(err) {
return err
}
if err = safefile.LinkRelative(lnk.Target, lnk.TargetRoot, lnk.Path, r.destRoot); err != nil {
return err
}
}
// Prepare the utility VM for use if one is present in the layer.
if r.HasUtilityVM {
err := safefile.EnsureNotReparsePointRelative("UtilityVM", r.destRoot)
if err != nil {
return err
}
err = ProcessUtilityVMImage(filepath.Join(r.destRoot.Name(), "UtilityVM"))
if err != nil {
return err
}
}
return nil
}
// NewLayerWriter returns a new layer writer for creating a layer on disk.
// The caller must have taken the SeBackupPrivilege and SeRestorePrivilege privileges
// to call this and any methods on the resulting LayerWriter.
func NewLayerWriter(path string, parentLayerPaths []string) (LayerWriter, error) {
if len(parentLayerPaths) == 0 {
// This is a base layer. It gets imported differently.
f, err := safefile.OpenRoot(path)
if err != nil {
return nil, err
}
return &baseLayerWriter{
root: f,
}, nil
}
if procImportLayerBegin.Find() != nil {
// The new layer reader is not available on this Windows build. Fall back to the
// legacy export code path.
importPath, err := ioutil.TempDir("", "hcs")
if err != nil {
return nil, err
}
w, err := newLegacyLayerWriter(importPath, parentLayerPaths, path)
if err != nil {
return nil, err
}
return &legacyLayerWriterWrapper{
legacyLayerWriter: w,
path: importPath,
parentLayerPaths: parentLayerPaths,
}, nil
}
layers, err := layerPathsToDescriptors(parentLayerPaths)
if err != nil {
return nil, err
}
w := &FilterLayerWriter{}
err = importLayerBegin(&stdDriverInfo, path, layers, &w.context)
if err != nil {
return nil, hcserror.New(err, "ImportLayerStart", "")
}
return w, nil
}

View File

@@ -0,0 +1,25 @@
package wclayer
import (
"github.com/Microsoft/hcsshim/internal/hcserror"
"github.com/sirupsen/logrus"
)
// LayerExists will return true if a layer with the given id exists and is known
// to the system.
func LayerExists(path string) (bool, error) {
title := "hcsshim::LayerExists "
logrus.Debugf(title+"path %s", path)
// Call the procedure itself.
var exists uint32
err := layerExists(&stdDriverInfo, path, &exists)
if err != nil {
err = hcserror.Errorf(err, title, "path=%s", path)
logrus.Error(err)
return false, err
}
logrus.Debugf(title+"succeeded path=%s exists=%d", path, exists)
return exists != 0, nil
}

View File

@@ -0,0 +1,13 @@
package wclayer
import (
"path/filepath"
"github.com/Microsoft/hcsshim/internal/guid"
)
// LayerID returns the layer ID of a layer on disk.
func LayerID(path string) (guid.GUID, error) {
_, file := filepath.Split(path)
return NameToGuid(file)
}

View File

@@ -0,0 +1,96 @@
package wclayer
// This file contains utility functions to support storage (graph) related
// functionality.
import (
"syscall"
"github.com/Microsoft/hcsshim/internal/guid"
"github.com/sirupsen/logrus"
)
/* To pass into syscall, we need a struct matching the following:
enum GraphDriverType
{
DiffDriver,
FilterDriver
};
struct DriverInfo {
GraphDriverType Flavour;
LPCWSTR HomeDir;
};
*/
type driverInfo struct {
Flavour int
HomeDirp *uint16
}
var (
utf16EmptyString uint16
stdDriverInfo = driverInfo{1, &utf16EmptyString}
)
/* To pass into syscall, we need a struct matching the following:
typedef struct _WC_LAYER_DESCRIPTOR {
//
// The ID of the layer
//
GUID LayerId;
//
// Additional flags
//
union {
struct {
ULONG Reserved : 31;
ULONG Dirty : 1; // Created from sandbox as a result of snapshot
};
ULONG Value;
} Flags;
//
// Path to the layer root directory, null-terminated
//
PCWSTR Path;
} WC_LAYER_DESCRIPTOR, *PWC_LAYER_DESCRIPTOR;
*/
type WC_LAYER_DESCRIPTOR struct {
LayerId guid.GUID
Flags uint32
Pathp *uint16
}
func layerPathsToDescriptors(parentLayerPaths []string) ([]WC_LAYER_DESCRIPTOR, error) {
// Array of descriptors that gets constructed.
var layers []WC_LAYER_DESCRIPTOR
for i := 0; i < len(parentLayerPaths); i++ {
g, err := LayerID(parentLayerPaths[i])
if err != nil {
logrus.Debugf("Failed to convert name to guid %s", err)
return nil, err
}
p, err := syscall.UTF16PtrFromString(parentLayerPaths[i])
if err != nil {
logrus.Debugf("Failed conversion of parentLayerPath to pointer %s", err)
return nil, err
}
layers = append(layers, WC_LAYER_DESCRIPTOR{
LayerId: g,
Flags: 0,
Pathp: p,
})
}
return layers, nil
}

View File

@@ -0,0 +1,815 @@
package wclayer
import (
"bufio"
"encoding/binary"
"errors"
"fmt"
"io"
"io/ioutil"
"os"
"path/filepath"
"strings"
"syscall"
"github.com/Microsoft/go-winio"
"github.com/Microsoft/hcsshim/internal/longpath"
"github.com/Microsoft/hcsshim/internal/safefile"
)
var errorIterationCanceled = errors.New("")
var mutatedUtilityVMFiles = map[string]bool{
`EFI\Microsoft\Boot\BCD`: true,
`EFI\Microsoft\Boot\BCD.LOG`: true,
`EFI\Microsoft\Boot\BCD.LOG1`: true,
`EFI\Microsoft\Boot\BCD.LOG2`: true,
}
const (
filesPath = `Files`
hivesPath = `Hives`
utilityVMPath = `UtilityVM`
utilityVMFilesPath = `UtilityVM\Files`
)
func openFileOrDir(path string, mode uint32, createDisposition uint32) (file *os.File, err error) {
return winio.OpenForBackup(path, mode, syscall.FILE_SHARE_READ, createDisposition)
}
func hasPathPrefix(p, prefix string) bool {
return strings.HasPrefix(p, prefix) && len(p) > len(prefix) && p[len(prefix)] == '\\'
}
type fileEntry struct {
path string
fi os.FileInfo
err error
}
type legacyLayerReader struct {
root string
result chan *fileEntry
proceed chan bool
currentFile *os.File
backupReader *winio.BackupFileReader
}
// newLegacyLayerReader returns a new LayerReader that can read the Windows
// container layer transport format from disk.
func newLegacyLayerReader(root string) *legacyLayerReader {
r := &legacyLayerReader{
root: root,
result: make(chan *fileEntry),
proceed: make(chan bool),
}
go r.walk()
return r
}
func readTombstones(path string) (map[string]([]string), error) {
tf, err := os.Open(filepath.Join(path, "tombstones.txt"))
if err != nil {
return nil, err
}
defer tf.Close()
s := bufio.NewScanner(tf)
if !s.Scan() || s.Text() != "\xef\xbb\xbfVersion 1.0" {
return nil, errors.New("Invalid tombstones file")
}
ts := make(map[string]([]string))
for s.Scan() {
t := filepath.Join(filesPath, s.Text()[1:]) // skip leading `\`
dir := filepath.Dir(t)
ts[dir] = append(ts[dir], t)
}
if err = s.Err(); err != nil {
return nil, err
}
return ts, nil
}
func (r *legacyLayerReader) walkUntilCancelled() error {
root, err := longpath.LongAbs(r.root)
if err != nil {
return err
}
r.root = root
ts, err := readTombstones(r.root)
if err != nil {
return err
}
err = filepath.Walk(r.root, func(path string, info os.FileInfo, err error) error {
if err != nil {
return err
}
// Indirect fix for https://github.com/moby/moby/issues/32838#issuecomment-343610048.
// Handle failure from what may be a golang bug in the conversion of
// UTF16 to UTF8 in files which are left in the recycle bin. Os.Lstat
// which is called by filepath.Walk will fail when a filename contains
// unicode characters. Skip the recycle bin regardless which is goodness.
if strings.EqualFold(path, filepath.Join(r.root, `Files\$Recycle.Bin`)) && info.IsDir() {
return filepath.SkipDir
}
if path == r.root || path == filepath.Join(r.root, "tombstones.txt") || strings.HasSuffix(path, ".$wcidirs$") {
return nil
}
r.result <- &fileEntry{path, info, nil}
if !<-r.proceed {
return errorIterationCanceled
}
// List all the tombstones.
if info.IsDir() {
relPath, err := filepath.Rel(r.root, path)
if err != nil {
return err
}
if dts, ok := ts[relPath]; ok {
for _, t := range dts {
r.result <- &fileEntry{filepath.Join(r.root, t), nil, nil}
if !<-r.proceed {
return errorIterationCanceled
}
}
}
}
return nil
})
if err == errorIterationCanceled {
return nil
}
if err == nil {
return io.EOF
}
return err
}
func (r *legacyLayerReader) walk() {
defer close(r.result)
if !<-r.proceed {
return
}
err := r.walkUntilCancelled()
if err != nil {
for {
r.result <- &fileEntry{err: err}
if !<-r.proceed {
return
}
}
}
}
func (r *legacyLayerReader) reset() {
if r.backupReader != nil {
r.backupReader.Close()
r.backupReader = nil
}
if r.currentFile != nil {
r.currentFile.Close()
r.currentFile = nil
}
}
func findBackupStreamSize(r io.Reader) (int64, error) {
br := winio.NewBackupStreamReader(r)
for {
hdr, err := br.Next()
if err != nil {
if err == io.EOF {
err = nil
}
return 0, err
}
if hdr.Id == winio.BackupData {
return hdr.Size, nil
}
}
}
func (r *legacyLayerReader) Next() (path string, size int64, fileInfo *winio.FileBasicInfo, err error) {
r.reset()
r.proceed <- true
fe := <-r.result
if fe == nil {
err = errors.New("LegacyLayerReader closed")
return
}
if fe.err != nil {
err = fe.err
return
}
path, err = filepath.Rel(r.root, fe.path)
if err != nil {
return
}
if fe.fi == nil {
// This is a tombstone. Return a nil fileInfo.
return
}
if fe.fi.IsDir() && hasPathPrefix(path, filesPath) {
fe.path += ".$wcidirs$"
}
f, err := openFileOrDir(fe.path, syscall.GENERIC_READ, syscall.OPEN_EXISTING)
if err != nil {
return
}
defer func() {
if f != nil {
f.Close()
}
}()
fileInfo, err = winio.GetFileBasicInfo(f)
if err != nil {
return
}
if !hasPathPrefix(path, filesPath) {
size = fe.fi.Size()
r.backupReader = winio.NewBackupFileReader(f, false)
if path == hivesPath || path == filesPath {
// The Hives directory has a non-deterministic file time because of the
// nature of the import process. Use the times from System_Delta.
var g *os.File
g, err = os.Open(filepath.Join(r.root, hivesPath, `System_Delta`))
if err != nil {
return
}
attr := fileInfo.FileAttributes
fileInfo, err = winio.GetFileBasicInfo(g)
g.Close()
if err != nil {
return
}
fileInfo.FileAttributes = attr
}
// The creation time and access time get reset for files outside of the Files path.
fileInfo.CreationTime = fileInfo.LastWriteTime
fileInfo.LastAccessTime = fileInfo.LastWriteTime
} else {
// The file attributes are written before the backup stream.
var attr uint32
err = binary.Read(f, binary.LittleEndian, &attr)
if err != nil {
return
}
fileInfo.FileAttributes = attr
beginning := int64(4)
// Find the accurate file size.
if !fe.fi.IsDir() {
size, err = findBackupStreamSize(f)
if err != nil {
err = &os.PathError{Op: "findBackupStreamSize", Path: fe.path, Err: err}
return
}
}
// Return back to the beginning of the backup stream.
_, err = f.Seek(beginning, 0)
if err != nil {
return
}
}
r.currentFile = f
f = nil
return
}
func (r *legacyLayerReader) Read(b []byte) (int, error) {
if r.backupReader == nil {
if r.currentFile == nil {
return 0, io.EOF
}
return r.currentFile.Read(b)
}
return r.backupReader.Read(b)
}
func (r *legacyLayerReader) Seek(offset int64, whence int) (int64, error) {
if r.backupReader == nil {
if r.currentFile == nil {
return 0, errors.New("no current file")
}
return r.currentFile.Seek(offset, whence)
}
return 0, errors.New("seek not supported on this stream")
}
func (r *legacyLayerReader) Close() error {
r.proceed <- false
<-r.result
r.reset()
return nil
}
type pendingLink struct {
Path, Target string
TargetRoot *os.File
}
type pendingDir struct {
Path string
Root *os.File
}
type legacyLayerWriter struct {
root *os.File
destRoot *os.File
parentRoots []*os.File
currentFile *os.File
bufWriter *bufio.Writer
currentFileName string
currentFileRoot *os.File
backupWriter *winio.BackupFileWriter
Tombstones []string
HasUtilityVM bool
uvmDi []dirInfo
addedFiles map[string]bool
PendingLinks []pendingLink
pendingDirs []pendingDir
currentIsDir bool
}
// newLegacyLayerWriter returns a LayerWriter that can write the contaler layer
// transport format to disk.
func newLegacyLayerWriter(root string, parentRoots []string, destRoot string) (w *legacyLayerWriter, err error) {
w = &legacyLayerWriter{
addedFiles: make(map[string]bool),
}
defer func() {
if err != nil {
w.CloseRoots()
w = nil
}
}()
w.root, err = safefile.OpenRoot(root)
if err != nil {
return
}
w.destRoot, err = safefile.OpenRoot(destRoot)
if err != nil {
return
}
for _, r := range parentRoots {
f, err := safefile.OpenRoot(r)
if err != nil {
return w, err
}
w.parentRoots = append(w.parentRoots, f)
}
w.bufWriter = bufio.NewWriterSize(ioutil.Discard, 65536)
return
}
func (w *legacyLayerWriter) CloseRoots() {
if w.root != nil {
w.root.Close()
w.root = nil
}
if w.destRoot != nil {
w.destRoot.Close()
w.destRoot = nil
}
for i := range w.parentRoots {
w.parentRoots[i].Close()
}
w.parentRoots = nil
}
func (w *legacyLayerWriter) initUtilityVM() error {
if !w.HasUtilityVM {
err := safefile.MkdirRelative(utilityVMPath, w.destRoot)
if err != nil {
return err
}
// Server 2016 does not support multiple layers for the utility VM, so
// clone the utility VM from the parent layer into this layer. Use hard
// links to avoid unnecessary copying, since most of the files are
// immutable.
err = cloneTree(w.parentRoots[0], w.destRoot, utilityVMFilesPath, mutatedUtilityVMFiles)
if err != nil {
return fmt.Errorf("cloning the parent utility VM image failed: %s", err)
}
w.HasUtilityVM = true
}
return nil
}
func (w *legacyLayerWriter) reset() error {
err := w.bufWriter.Flush()
if err != nil {
return err
}
w.bufWriter.Reset(ioutil.Discard)
if w.currentIsDir {
r := w.currentFile
br := winio.NewBackupStreamReader(r)
// Seek to the beginning of the backup stream, skipping the fileattrs
if _, err := r.Seek(4, io.SeekStart); err != nil {
return err
}
for {
bhdr, err := br.Next()
if err == io.EOF {
// end of backupstream data
break
}
if err != nil {
return err
}
switch bhdr.Id {
case winio.BackupReparseData:
// The current file is a `.$wcidirs$` metadata file that
// describes a directory reparse point. Delete the placeholder
// directory to prevent future files being added into the
// destination of the reparse point during the ImportLayer call
if err := safefile.RemoveRelative(w.currentFileName, w.currentFileRoot); err != nil {
return err
}
w.pendingDirs = append(w.pendingDirs, pendingDir{Path: w.currentFileName, Root: w.currentFileRoot})
default:
// ignore all other stream types, as we only care about directory reparse points
}
}
w.currentIsDir = false
}
if w.backupWriter != nil {
w.backupWriter.Close()
w.backupWriter = nil
}
if w.currentFile != nil {
w.currentFile.Close()
w.currentFile = nil
w.currentFileName = ""
w.currentFileRoot = nil
}
return nil
}
// copyFileWithMetadata copies a file using the backup/restore APIs in order to preserve metadata
func copyFileWithMetadata(srcRoot, destRoot *os.File, subPath string, isDir bool) (fileInfo *winio.FileBasicInfo, err error) {
src, err := safefile.OpenRelative(
subPath,
srcRoot,
syscall.GENERIC_READ|winio.ACCESS_SYSTEM_SECURITY,
syscall.FILE_SHARE_READ,
safefile.FILE_OPEN,
safefile.FILE_OPEN_REPARSE_POINT)
if err != nil {
return nil, err
}
defer src.Close()
srcr := winio.NewBackupFileReader(src, true)
defer srcr.Close()
fileInfo, err = winio.GetFileBasicInfo(src)
if err != nil {
return nil, err
}
extraFlags := uint32(0)
if isDir {
extraFlags |= safefile.FILE_DIRECTORY_FILE
}
dest, err := safefile.OpenRelative(
subPath,
destRoot,
syscall.GENERIC_READ|syscall.GENERIC_WRITE|winio.WRITE_DAC|winio.WRITE_OWNER|winio.ACCESS_SYSTEM_SECURITY,
syscall.FILE_SHARE_READ,
safefile.FILE_CREATE,
extraFlags)
if err != nil {
return nil, err
}
defer dest.Close()
err = winio.SetFileBasicInfo(dest, fileInfo)
if err != nil {
return nil, err
}
destw := winio.NewBackupFileWriter(dest, true)
defer func() {
cerr := destw.Close()
if err == nil {
err = cerr
}
}()
_, err = io.Copy(destw, srcr)
if err != nil {
return nil, err
}
return fileInfo, nil
}
// cloneTree clones a directory tree using hard links. It skips hard links for
// the file names in the provided map and just copies those files.
func cloneTree(srcRoot *os.File, destRoot *os.File, subPath string, mutatedFiles map[string]bool) error {
var di []dirInfo
err := safefile.EnsureNotReparsePointRelative(subPath, srcRoot)
if err != nil {
return err
}
err = filepath.Walk(filepath.Join(srcRoot.Name(), subPath), func(srcFilePath string, info os.FileInfo, err error) error {
if err != nil {
return err
}
relPath, err := filepath.Rel(srcRoot.Name(), srcFilePath)
if err != nil {
return err
}
fileAttributes := info.Sys().(*syscall.Win32FileAttributeData).FileAttributes
// Directories, reparse points, and files that will be mutated during
// utility VM import must be copied. All other files can be hard linked.
isReparsePoint := fileAttributes&syscall.FILE_ATTRIBUTE_REPARSE_POINT != 0
// In go1.9, FileInfo.IsDir() returns false if the directory is also a symlink.
// See: https://github.com/golang/go/commit/1989921aef60c83e6f9127a8448fb5ede10e9acc
// Fixes the problem by checking syscall.FILE_ATTRIBUTE_DIRECTORY directly
isDir := fileAttributes&syscall.FILE_ATTRIBUTE_DIRECTORY != 0
if isDir || isReparsePoint || mutatedFiles[relPath] {
fi, err := copyFileWithMetadata(srcRoot, destRoot, relPath, isDir)
if err != nil {
return err
}
if isDir && !isReparsePoint {
di = append(di, dirInfo{path: relPath, fileInfo: *fi})
}
} else {
err = safefile.LinkRelative(relPath, srcRoot, relPath, destRoot)
if err != nil {
return err
}
}
return nil
})
if err != nil {
return err
}
return reapplyDirectoryTimes(destRoot, di)
}
func (w *legacyLayerWriter) Add(name string, fileInfo *winio.FileBasicInfo) error {
if err := w.reset(); err != nil {
return err
}
if name == utilityVMPath {
return w.initUtilityVM()
}
name = filepath.Clean(name)
if hasPathPrefix(name, utilityVMPath) {
if !w.HasUtilityVM {
return errors.New("missing UtilityVM directory")
}
if !hasPathPrefix(name, utilityVMFilesPath) && name != utilityVMFilesPath {
return errors.New("invalid UtilityVM layer")
}
createDisposition := uint32(safefile.FILE_OPEN)
if (fileInfo.FileAttributes & syscall.FILE_ATTRIBUTE_DIRECTORY) != 0 {
st, err := safefile.LstatRelative(name, w.destRoot)
if err != nil && !os.IsNotExist(err) {
return err
}
if st != nil {
// Delete the existing file/directory if it is not the same type as this directory.
existingAttr := st.Sys().(*syscall.Win32FileAttributeData).FileAttributes
if (uint32(fileInfo.FileAttributes)^existingAttr)&(syscall.FILE_ATTRIBUTE_DIRECTORY|syscall.FILE_ATTRIBUTE_REPARSE_POINT) != 0 {
if err = safefile.RemoveAllRelative(name, w.destRoot); err != nil {
return err
}
st = nil
}
}
if st == nil {
if err = safefile.MkdirRelative(name, w.destRoot); err != nil {
return err
}
}
if fileInfo.FileAttributes&syscall.FILE_ATTRIBUTE_REPARSE_POINT == 0 {
w.uvmDi = append(w.uvmDi, dirInfo{path: name, fileInfo: *fileInfo})
}
} else {
// Overwrite any existing hard link.
err := safefile.RemoveRelative(name, w.destRoot)
if err != nil && !os.IsNotExist(err) {
return err
}
createDisposition = safefile.FILE_CREATE
}
f, err := safefile.OpenRelative(
name,
w.destRoot,
syscall.GENERIC_READ|syscall.GENERIC_WRITE|winio.WRITE_DAC|winio.WRITE_OWNER|winio.ACCESS_SYSTEM_SECURITY,
syscall.FILE_SHARE_READ,
createDisposition,
safefile.FILE_OPEN_REPARSE_POINT,
)
if err != nil {
return err
}
defer func() {
if f != nil {
f.Close()
safefile.RemoveRelative(name, w.destRoot)
}
}()
err = winio.SetFileBasicInfo(f, fileInfo)
if err != nil {
return err
}
w.backupWriter = winio.NewBackupFileWriter(f, true)
w.bufWriter.Reset(w.backupWriter)
w.currentFile = f
w.currentFileName = name
w.currentFileRoot = w.destRoot
w.addedFiles[name] = true
f = nil
return nil
}
fname := name
if (fileInfo.FileAttributes & syscall.FILE_ATTRIBUTE_DIRECTORY) != 0 {
err := safefile.MkdirRelative(name, w.root)
if err != nil {
return err
}
fname += ".$wcidirs$"
w.currentIsDir = true
}
f, err := safefile.OpenRelative(fname, w.root, syscall.GENERIC_READ|syscall.GENERIC_WRITE, syscall.FILE_SHARE_READ, safefile.FILE_CREATE, 0)
if err != nil {
return err
}
defer func() {
if f != nil {
f.Close()
safefile.RemoveRelative(fname, w.root)
}
}()
strippedFi := *fileInfo
strippedFi.FileAttributes = 0
err = winio.SetFileBasicInfo(f, &strippedFi)
if err != nil {
return err
}
if hasPathPrefix(name, hivesPath) {
w.backupWriter = winio.NewBackupFileWriter(f, false)
w.bufWriter.Reset(w.backupWriter)
} else {
w.bufWriter.Reset(f)
// The file attributes are written before the stream.
err = binary.Write(w.bufWriter, binary.LittleEndian, uint32(fileInfo.FileAttributes))
if err != nil {
w.bufWriter.Reset(ioutil.Discard)
return err
}
}
w.currentFile = f
w.currentFileName = name
w.currentFileRoot = w.root
w.addedFiles[name] = true
f = nil
return nil
}
func (w *legacyLayerWriter) AddLink(name string, target string) error {
if err := w.reset(); err != nil {
return err
}
target = filepath.Clean(target)
var roots []*os.File
if hasPathPrefix(target, filesPath) {
// Look for cross-layer hard link targets in the parent layers, since
// nothing is in the destination path yet.
roots = w.parentRoots
} else if hasPathPrefix(target, utilityVMFilesPath) {
// Since the utility VM is fully cloned into the destination path
// already, look for cross-layer hard link targets directly in the
// destination path.
roots = []*os.File{w.destRoot}
}
if roots == nil || (!hasPathPrefix(name, filesPath) && !hasPathPrefix(name, utilityVMFilesPath)) {
return errors.New("invalid hard link in layer")
}
// Find to try the target of the link in a previously added file. If that
// fails, search in parent layers.
var selectedRoot *os.File
if _, ok := w.addedFiles[target]; ok {
selectedRoot = w.destRoot
} else {
for _, r := range roots {
if _, err := safefile.LstatRelative(target, r); err != nil {
if !os.IsNotExist(err) {
return err
}
} else {
selectedRoot = r
break
}
}
if selectedRoot == nil {
return fmt.Errorf("failed to find link target for '%s' -> '%s'", name, target)
}
}
// The link can't be written until after the ImportLayer call.
w.PendingLinks = append(w.PendingLinks, pendingLink{
Path: name,
Target: target,
TargetRoot: selectedRoot,
})
w.addedFiles[name] = true
return nil
}
func (w *legacyLayerWriter) Remove(name string) error {
name = filepath.Clean(name)
if hasPathPrefix(name, filesPath) {
w.Tombstones = append(w.Tombstones, name)
} else if hasPathPrefix(name, utilityVMFilesPath) {
err := w.initUtilityVM()
if err != nil {
return err
}
// Make sure the path exists; os.RemoveAll will not fail if the file is
// already gone, and this needs to be a fatal error for diagnostics
// purposes.
if _, err := safefile.LstatRelative(name, w.destRoot); err != nil {
return err
}
err = safefile.RemoveAllRelative(name, w.destRoot)
if err != nil {
return err
}
} else {
return fmt.Errorf("invalid tombstone %s", name)
}
return nil
}
func (w *legacyLayerWriter) Write(b []byte) (int, error) {
if w.backupWriter == nil && w.currentFile == nil {
return 0, errors.New("closed")
}
return w.bufWriter.Write(b)
}
func (w *legacyLayerWriter) Close() error {
if err := w.reset(); err != nil {
return err
}
if err := safefile.RemoveRelative("tombstones.txt", w.root); err != nil && !os.IsNotExist(err) {
return err
}
for _, pd := range w.pendingDirs {
err := safefile.MkdirRelative(pd.Path, pd.Root)
if err != nil {
return err
}
}
if w.HasUtilityVM {
err := reapplyDirectoryTimes(w.destRoot, w.uvmDi)
if err != nil {
return err
}
}
return nil
}

View File

@@ -0,0 +1,24 @@
package wclayer
import (
"github.com/Microsoft/hcsshim/internal/guid"
"github.com/Microsoft/hcsshim/internal/hcserror"
"github.com/sirupsen/logrus"
)
// NameToGuid converts the given string into a GUID using the algorithm in the
// Host Compute Service, ensuring GUIDs generated with the same string are common
// across all clients.
func NameToGuid(name string) (id guid.GUID, err error) {
title := "hcsshim::NameToGuid "
err = nameToGuid(name, &id)
if err != nil {
err = hcserror.Errorf(err, title, "name=%s", name)
logrus.Error(err)
return
}
logrus.Debugf(title+"name:%s guid:%s", name, id.String())
return
}

View File

@@ -0,0 +1,40 @@
package wclayer
import (
"sync"
"github.com/Microsoft/hcsshim/internal/hcserror"
"github.com/sirupsen/logrus"
)
var prepareLayerLock sync.Mutex
// PrepareLayer finds a mounted read-write layer matching path and enables the
// the filesystem filter for use on that layer. This requires the paths to all
// parent layers, and is necessary in order to view or interact with the layer
// as an actual filesystem (reading and writing files, creating directories, etc).
// Disabling the filter must be done via UnprepareLayer.
func PrepareLayer(path string, parentLayerPaths []string) error {
title := "hcsshim::PrepareLayer "
logrus.Debugf(title+"path %s", path)
// Generate layer descriptors
layers, err := layerPathsToDescriptors(parentLayerPaths)
if err != nil {
return err
}
// This lock is a temporary workaround for a Windows bug. Only allowing one
// call to prepareLayer at a time vastly reduces the chance of a timeout.
prepareLayerLock.Lock()
defer prepareLayerLock.Unlock()
err = prepareLayer(&stdDriverInfo, path, layers)
if err != nil {
err = hcserror.Errorf(err, title, "path=%s", path)
logrus.Error(err)
return err
}
logrus.Debugf(title+"succeeded path=%s", path)
return nil
}

View File

@@ -0,0 +1,23 @@
package wclayer
import "os"
// ProcessBaseLayer post-processes a base layer that has had its files extracted.
// The files should have been extracted to <path>\Files.
func ProcessBaseLayer(path string) error {
err := processBaseImage(path)
if err != nil {
return &os.PathError{Op: "ProcessBaseLayer", Path: path, Err: err}
}
return nil
}
// ProcessUtilityVMImage post-processes a utility VM image that has had its files extracted.
// The files should have been extracted to <path>\Files.
func ProcessUtilityVMImage(path string) error {
err := processUtilityImage(path)
if err != nil {
return &os.PathError{Op: "ProcessUtilityVMImage", Path: path, Err: err}
}
return nil
}

View File

@@ -0,0 +1,23 @@
package wclayer
import (
"github.com/Microsoft/hcsshim/internal/hcserror"
"github.com/sirupsen/logrus"
)
// UnprepareLayer disables the filesystem filter for the read-write layer with
// the given id.
func UnprepareLayer(path string) error {
title := "hcsshim::UnprepareLayer "
logrus.Debugf(title+"path %s", path)
err := unprepareLayer(&stdDriverInfo, path)
if err != nil {
err = hcserror.Errorf(err, title, "path=%s", path)
logrus.Error(err)
return err
}
logrus.Debugf(title+"succeeded path=%s", path)
return nil
}

View File

@@ -0,0 +1,37 @@
package wclayer
import "github.com/Microsoft/hcsshim/internal/guid"
//go:generate go run ../../mksyscall_windows.go -output zsyscall_windows.go -winio wclayer.go
//sys activateLayer(info *driverInfo, id string) (hr error) = vmcompute.ActivateLayer?
//sys copyLayer(info *driverInfo, srcId string, dstId string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) = vmcompute.CopyLayer?
//sys createLayer(info *driverInfo, id string, parent string) (hr error) = vmcompute.CreateLayer?
//sys createSandboxLayer(info *driverInfo, id string, parent uintptr, descriptors []WC_LAYER_DESCRIPTOR) (hr error) = vmcompute.CreateSandboxLayer?
//sys expandSandboxSize(info *driverInfo, id string, size uint64) (hr error) = vmcompute.ExpandSandboxSize?
//sys deactivateLayer(info *driverInfo, id string) (hr error) = vmcompute.DeactivateLayer?
//sys destroyLayer(info *driverInfo, id string) (hr error) = vmcompute.DestroyLayer?
//sys exportLayer(info *driverInfo, id string, path string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) = vmcompute.ExportLayer?
//sys getLayerMountPath(info *driverInfo, id string, length *uintptr, buffer *uint16) (hr error) = vmcompute.GetLayerMountPath?
//sys getBaseImages(buffer **uint16) (hr error) = vmcompute.GetBaseImages?
//sys importLayer(info *driverInfo, id string, path string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) = vmcompute.ImportLayer?
//sys layerExists(info *driverInfo, id string, exists *uint32) (hr error) = vmcompute.LayerExists?
//sys nameToGuid(name string, guid *_guid) (hr error) = vmcompute.NameToGuid?
//sys prepareLayer(info *driverInfo, id string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) = vmcompute.PrepareLayer?
//sys unprepareLayer(info *driverInfo, id string) (hr error) = vmcompute.UnprepareLayer?
//sys processBaseImage(path string) (hr error) = vmcompute.ProcessBaseImage?
//sys processUtilityImage(path string) (hr error) = vmcompute.ProcessUtilityImage?
//sys importLayerBegin(info *driverInfo, id string, descriptors []WC_LAYER_DESCRIPTOR, context *uintptr) (hr error) = vmcompute.ImportLayerBegin?
//sys importLayerNext(context uintptr, fileName string, fileInfo *winio.FileBasicInfo) (hr error) = vmcompute.ImportLayerNext?
//sys importLayerWrite(context uintptr, buffer []byte) (hr error) = vmcompute.ImportLayerWrite?
//sys importLayerEnd(context uintptr) (hr error) = vmcompute.ImportLayerEnd?
//sys exportLayerBegin(info *driverInfo, id string, descriptors []WC_LAYER_DESCRIPTOR, context *uintptr) (hr error) = vmcompute.ExportLayerBegin?
//sys exportLayerNext(context uintptr, fileName **uint16, fileInfo *winio.FileBasicInfo, fileSize *int64, deleted *uint32) (hr error) = vmcompute.ExportLayerNext?
//sys exportLayerRead(context uintptr, buffer []byte, bytesRead *uint32) (hr error) = vmcompute.ExportLayerRead?
//sys exportLayerEnd(context uintptr) (hr error) = vmcompute.ExportLayerEnd?
//sys grantVmAccess(vmid string, filepath string) (hr error) = vmcompute.GrantVmAccess?
type _guid = guid.GUID

View File

@@ -0,0 +1,597 @@
// MACHINE GENERATED BY 'go generate' COMMAND; DO NOT EDIT
package wclayer
import (
"syscall"
"unsafe"
"github.com/Microsoft/go-winio"
"github.com/Microsoft/hcsshim/internal/interop"
"golang.org/x/sys/windows"
)
var _ unsafe.Pointer
// Do the interface allocations only once for common
// Errno values.
const (
errnoERROR_IO_PENDING = 997
)
var (
errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING)
)
// errnoErr returns common boxed Errno values, to prevent
// allocations at runtime.
func errnoErr(e syscall.Errno) error {
switch e {
case 0:
return nil
case errnoERROR_IO_PENDING:
return errERROR_IO_PENDING
}
// TODO: add more here, after collecting data on the common
// error values see on Windows. (perhaps when running
// all.bat?)
return e
}
var (
modvmcompute = windows.NewLazySystemDLL("vmcompute.dll")
procActivateLayer = modvmcompute.NewProc("ActivateLayer")
procCopyLayer = modvmcompute.NewProc("CopyLayer")
procCreateLayer = modvmcompute.NewProc("CreateLayer")
procCreateSandboxLayer = modvmcompute.NewProc("CreateSandboxLayer")
procExpandSandboxSize = modvmcompute.NewProc("ExpandSandboxSize")
procDeactivateLayer = modvmcompute.NewProc("DeactivateLayer")
procDestroyLayer = modvmcompute.NewProc("DestroyLayer")
procExportLayer = modvmcompute.NewProc("ExportLayer")
procGetLayerMountPath = modvmcompute.NewProc("GetLayerMountPath")
procGetBaseImages = modvmcompute.NewProc("GetBaseImages")
procImportLayer = modvmcompute.NewProc("ImportLayer")
procLayerExists = modvmcompute.NewProc("LayerExists")
procNameToGuid = modvmcompute.NewProc("NameToGuid")
procPrepareLayer = modvmcompute.NewProc("PrepareLayer")
procUnprepareLayer = modvmcompute.NewProc("UnprepareLayer")
procProcessBaseImage = modvmcompute.NewProc("ProcessBaseImage")
procProcessUtilityImage = modvmcompute.NewProc("ProcessUtilityImage")
procImportLayerBegin = modvmcompute.NewProc("ImportLayerBegin")
procImportLayerNext = modvmcompute.NewProc("ImportLayerNext")
procImportLayerWrite = modvmcompute.NewProc("ImportLayerWrite")
procImportLayerEnd = modvmcompute.NewProc("ImportLayerEnd")
procExportLayerBegin = modvmcompute.NewProc("ExportLayerBegin")
procExportLayerNext = modvmcompute.NewProc("ExportLayerNext")
procExportLayerRead = modvmcompute.NewProc("ExportLayerRead")
procExportLayerEnd = modvmcompute.NewProc("ExportLayerEnd")
procGrantVmAccess = modvmcompute.NewProc("GrantVmAccess")
)
func activateLayer(info *driverInfo, id string) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(id)
if hr != nil {
return
}
return _activateLayer(info, _p0)
}
func _activateLayer(info *driverInfo, id *uint16) (hr error) {
if hr = procActivateLayer.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procActivateLayer.Addr(), 2, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), 0)
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func copyLayer(info *driverInfo, srcId string, dstId string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(srcId)
if hr != nil {
return
}
var _p1 *uint16
_p1, hr = syscall.UTF16PtrFromString(dstId)
if hr != nil {
return
}
return _copyLayer(info, _p0, _p1, descriptors)
}
func _copyLayer(info *driverInfo, srcId *uint16, dstId *uint16, descriptors []WC_LAYER_DESCRIPTOR) (hr error) {
var _p2 *WC_LAYER_DESCRIPTOR
if len(descriptors) > 0 {
_p2 = &descriptors[0]
}
if hr = procCopyLayer.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall6(procCopyLayer.Addr(), 5, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(srcId)), uintptr(unsafe.Pointer(dstId)), uintptr(unsafe.Pointer(_p2)), uintptr(len(descriptors)), 0)
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func createLayer(info *driverInfo, id string, parent string) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(id)
if hr != nil {
return
}
var _p1 *uint16
_p1, hr = syscall.UTF16PtrFromString(parent)
if hr != nil {
return
}
return _createLayer(info, _p0, _p1)
}
func _createLayer(info *driverInfo, id *uint16, parent *uint16) (hr error) {
if hr = procCreateLayer.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procCreateLayer.Addr(), 3, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(parent)))
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func createSandboxLayer(info *driverInfo, id string, parent uintptr, descriptors []WC_LAYER_DESCRIPTOR) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(id)
if hr != nil {
return
}
return _createSandboxLayer(info, _p0, parent, descriptors)
}
func _createSandboxLayer(info *driverInfo, id *uint16, parent uintptr, descriptors []WC_LAYER_DESCRIPTOR) (hr error) {
var _p1 *WC_LAYER_DESCRIPTOR
if len(descriptors) > 0 {
_p1 = &descriptors[0]
}
if hr = procCreateSandboxLayer.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall6(procCreateSandboxLayer.Addr(), 5, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(parent), uintptr(unsafe.Pointer(_p1)), uintptr(len(descriptors)), 0)
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func expandSandboxSize(info *driverInfo, id string, size uint64) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(id)
if hr != nil {
return
}
return _expandSandboxSize(info, _p0, size)
}
func _expandSandboxSize(info *driverInfo, id *uint16, size uint64) (hr error) {
if hr = procExpandSandboxSize.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procExpandSandboxSize.Addr(), 3, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(size))
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func deactivateLayer(info *driverInfo, id string) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(id)
if hr != nil {
return
}
return _deactivateLayer(info, _p0)
}
func _deactivateLayer(info *driverInfo, id *uint16) (hr error) {
if hr = procDeactivateLayer.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procDeactivateLayer.Addr(), 2, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), 0)
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func destroyLayer(info *driverInfo, id string) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(id)
if hr != nil {
return
}
return _destroyLayer(info, _p0)
}
func _destroyLayer(info *driverInfo, id *uint16) (hr error) {
if hr = procDestroyLayer.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procDestroyLayer.Addr(), 2, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), 0)
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func exportLayer(info *driverInfo, id string, path string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(id)
if hr != nil {
return
}
var _p1 *uint16
_p1, hr = syscall.UTF16PtrFromString(path)
if hr != nil {
return
}
return _exportLayer(info, _p0, _p1, descriptors)
}
func _exportLayer(info *driverInfo, id *uint16, path *uint16, descriptors []WC_LAYER_DESCRIPTOR) (hr error) {
var _p2 *WC_LAYER_DESCRIPTOR
if len(descriptors) > 0 {
_p2 = &descriptors[0]
}
if hr = procExportLayer.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall6(procExportLayer.Addr(), 5, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(path)), uintptr(unsafe.Pointer(_p2)), uintptr(len(descriptors)), 0)
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func getLayerMountPath(info *driverInfo, id string, length *uintptr, buffer *uint16) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(id)
if hr != nil {
return
}
return _getLayerMountPath(info, _p0, length, buffer)
}
func _getLayerMountPath(info *driverInfo, id *uint16, length *uintptr, buffer *uint16) (hr error) {
if hr = procGetLayerMountPath.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall6(procGetLayerMountPath.Addr(), 4, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(length)), uintptr(unsafe.Pointer(buffer)), 0, 0)
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func getBaseImages(buffer **uint16) (hr error) {
if hr = procGetBaseImages.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procGetBaseImages.Addr(), 1, uintptr(unsafe.Pointer(buffer)), 0, 0)
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func importLayer(info *driverInfo, id string, path string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(id)
if hr != nil {
return
}
var _p1 *uint16
_p1, hr = syscall.UTF16PtrFromString(path)
if hr != nil {
return
}
return _importLayer(info, _p0, _p1, descriptors)
}
func _importLayer(info *driverInfo, id *uint16, path *uint16, descriptors []WC_LAYER_DESCRIPTOR) (hr error) {
var _p2 *WC_LAYER_DESCRIPTOR
if len(descriptors) > 0 {
_p2 = &descriptors[0]
}
if hr = procImportLayer.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall6(procImportLayer.Addr(), 5, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(path)), uintptr(unsafe.Pointer(_p2)), uintptr(len(descriptors)), 0)
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func layerExists(info *driverInfo, id string, exists *uint32) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(id)
if hr != nil {
return
}
return _layerExists(info, _p0, exists)
}
func _layerExists(info *driverInfo, id *uint16, exists *uint32) (hr error) {
if hr = procLayerExists.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procLayerExists.Addr(), 3, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(exists)))
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func nameToGuid(name string, guid *_guid) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(name)
if hr != nil {
return
}
return _nameToGuid(_p0, guid)
}
func _nameToGuid(name *uint16, guid *_guid) (hr error) {
if hr = procNameToGuid.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procNameToGuid.Addr(), 2, uintptr(unsafe.Pointer(name)), uintptr(unsafe.Pointer(guid)), 0)
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func prepareLayer(info *driverInfo, id string, descriptors []WC_LAYER_DESCRIPTOR) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(id)
if hr != nil {
return
}
return _prepareLayer(info, _p0, descriptors)
}
func _prepareLayer(info *driverInfo, id *uint16, descriptors []WC_LAYER_DESCRIPTOR) (hr error) {
var _p1 *WC_LAYER_DESCRIPTOR
if len(descriptors) > 0 {
_p1 = &descriptors[0]
}
if hr = procPrepareLayer.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall6(procPrepareLayer.Addr(), 4, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(_p1)), uintptr(len(descriptors)), 0, 0)
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func unprepareLayer(info *driverInfo, id string) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(id)
if hr != nil {
return
}
return _unprepareLayer(info, _p0)
}
func _unprepareLayer(info *driverInfo, id *uint16) (hr error) {
if hr = procUnprepareLayer.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procUnprepareLayer.Addr(), 2, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), 0)
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func processBaseImage(path string) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(path)
if hr != nil {
return
}
return _processBaseImage(_p0)
}
func _processBaseImage(path *uint16) (hr error) {
if hr = procProcessBaseImage.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procProcessBaseImage.Addr(), 1, uintptr(unsafe.Pointer(path)), 0, 0)
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func processUtilityImage(path string) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(path)
if hr != nil {
return
}
return _processUtilityImage(_p0)
}
func _processUtilityImage(path *uint16) (hr error) {
if hr = procProcessUtilityImage.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procProcessUtilityImage.Addr(), 1, uintptr(unsafe.Pointer(path)), 0, 0)
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func importLayerBegin(info *driverInfo, id string, descriptors []WC_LAYER_DESCRIPTOR, context *uintptr) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(id)
if hr != nil {
return
}
return _importLayerBegin(info, _p0, descriptors, context)
}
func _importLayerBegin(info *driverInfo, id *uint16, descriptors []WC_LAYER_DESCRIPTOR, context *uintptr) (hr error) {
var _p1 *WC_LAYER_DESCRIPTOR
if len(descriptors) > 0 {
_p1 = &descriptors[0]
}
if hr = procImportLayerBegin.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall6(procImportLayerBegin.Addr(), 5, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(_p1)), uintptr(len(descriptors)), uintptr(unsafe.Pointer(context)), 0)
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func importLayerNext(context uintptr, fileName string, fileInfo *winio.FileBasicInfo) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(fileName)
if hr != nil {
return
}
return _importLayerNext(context, _p0, fileInfo)
}
func _importLayerNext(context uintptr, fileName *uint16, fileInfo *winio.FileBasicInfo) (hr error) {
if hr = procImportLayerNext.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procImportLayerNext.Addr(), 3, uintptr(context), uintptr(unsafe.Pointer(fileName)), uintptr(unsafe.Pointer(fileInfo)))
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func importLayerWrite(context uintptr, buffer []byte) (hr error) {
var _p0 *byte
if len(buffer) > 0 {
_p0 = &buffer[0]
}
if hr = procImportLayerWrite.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procImportLayerWrite.Addr(), 3, uintptr(context), uintptr(unsafe.Pointer(_p0)), uintptr(len(buffer)))
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func importLayerEnd(context uintptr) (hr error) {
if hr = procImportLayerEnd.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procImportLayerEnd.Addr(), 1, uintptr(context), 0, 0)
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func exportLayerBegin(info *driverInfo, id string, descriptors []WC_LAYER_DESCRIPTOR, context *uintptr) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(id)
if hr != nil {
return
}
return _exportLayerBegin(info, _p0, descriptors, context)
}
func _exportLayerBegin(info *driverInfo, id *uint16, descriptors []WC_LAYER_DESCRIPTOR, context *uintptr) (hr error) {
var _p1 *WC_LAYER_DESCRIPTOR
if len(descriptors) > 0 {
_p1 = &descriptors[0]
}
if hr = procExportLayerBegin.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall6(procExportLayerBegin.Addr(), 5, uintptr(unsafe.Pointer(info)), uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(_p1)), uintptr(len(descriptors)), uintptr(unsafe.Pointer(context)), 0)
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func exportLayerNext(context uintptr, fileName **uint16, fileInfo *winio.FileBasicInfo, fileSize *int64, deleted *uint32) (hr error) {
if hr = procExportLayerNext.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall6(procExportLayerNext.Addr(), 5, uintptr(context), uintptr(unsafe.Pointer(fileName)), uintptr(unsafe.Pointer(fileInfo)), uintptr(unsafe.Pointer(fileSize)), uintptr(unsafe.Pointer(deleted)), 0)
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func exportLayerRead(context uintptr, buffer []byte, bytesRead *uint32) (hr error) {
var _p0 *byte
if len(buffer) > 0 {
_p0 = &buffer[0]
}
if hr = procExportLayerRead.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall6(procExportLayerRead.Addr(), 4, uintptr(context), uintptr(unsafe.Pointer(_p0)), uintptr(len(buffer)), uintptr(unsafe.Pointer(bytesRead)), 0, 0)
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func exportLayerEnd(context uintptr) (hr error) {
if hr = procExportLayerEnd.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procExportLayerEnd.Addr(), 1, uintptr(context), 0, 0)
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}
func grantVmAccess(vmid string, filepath string) (hr error) {
var _p0 *uint16
_p0, hr = syscall.UTF16PtrFromString(vmid)
if hr != nil {
return
}
var _p1 *uint16
_p1, hr = syscall.UTF16PtrFromString(filepath)
if hr != nil {
return
}
return _grantVmAccess(_p0, _p1)
}
func _grantVmAccess(vmid *uint16, filepath *uint16) (hr error) {
if hr = procGrantVmAccess.Find(); hr != nil {
return
}
r0, _, _ := syscall.Syscall(procGrantVmAccess.Addr(), 2, uintptr(unsafe.Pointer(vmid)), uintptr(unsafe.Pointer(filepath)), 0)
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}

108
vendor/github.com/Microsoft/hcsshim/layer.go generated vendored Normal file
View File

@@ -0,0 +1,108 @@
package hcsshim
import (
"crypto/sha1"
"path/filepath"
"github.com/Microsoft/hcsshim/internal/guid"
"github.com/Microsoft/hcsshim/internal/wclayer"
)
func layerPath(info *DriverInfo, id string) string {
return filepath.Join(info.HomeDir, id)
}
func ActivateLayer(info DriverInfo, id string) error {
return wclayer.ActivateLayer(layerPath(&info, id))
}
func CreateLayer(info DriverInfo, id, parent string) error {
return wclayer.CreateLayer(layerPath(&info, id), parent)
}
// New clients should use CreateScratchLayer instead. Kept in to preserve API compatibility.
func CreateSandboxLayer(info DriverInfo, layerId, parentId string, parentLayerPaths []string) error {
return wclayer.CreateScratchLayer(layerPath(&info, layerId), parentLayerPaths)
}
func CreateScratchLayer(info DriverInfo, layerId, parentId string, parentLayerPaths []string) error {
return wclayer.CreateScratchLayer(layerPath(&info, layerId), parentLayerPaths)
}
func DeactivateLayer(info DriverInfo, id string) error {
return wclayer.DeactivateLayer(layerPath(&info, id))
}
func DestroyLayer(info DriverInfo, id string) error {
return wclayer.DestroyLayer(layerPath(&info, id))
}
// New clients should use ExpandScratchSize instead. Kept in to preserve API compatibility.
func ExpandSandboxSize(info DriverInfo, layerId string, size uint64) error {
return wclayer.ExpandScratchSize(layerPath(&info, layerId), size)
}
func ExpandScratchSize(info DriverInfo, layerId string, size uint64) error {
return wclayer.ExpandScratchSize(layerPath(&info, layerId), size)
}
func ExportLayer(info DriverInfo, layerId string, exportFolderPath string, parentLayerPaths []string) error {
return wclayer.ExportLayer(layerPath(&info, layerId), exportFolderPath, parentLayerPaths)
}
func GetLayerMountPath(info DriverInfo, id string) (string, error) {
return wclayer.GetLayerMountPath(layerPath(&info, id))
}
func GetSharedBaseImages() (imageData string, err error) {
return wclayer.GetSharedBaseImages()
}
func ImportLayer(info DriverInfo, layerID string, importFolderPath string, parentLayerPaths []string) error {
return wclayer.ImportLayer(layerPath(&info, layerID), importFolderPath, parentLayerPaths)
}
func LayerExists(info DriverInfo, id string) (bool, error) {
return wclayer.LayerExists(layerPath(&info, id))
}
func PrepareLayer(info DriverInfo, layerId string, parentLayerPaths []string) error {
return wclayer.PrepareLayer(layerPath(&info, layerId), parentLayerPaths)
}
func ProcessBaseLayer(path string) error {
return wclayer.ProcessBaseLayer(path)
}
func ProcessUtilityVMImage(path string) error {
return wclayer.ProcessUtilityVMImage(path)
}
func UnprepareLayer(info DriverInfo, layerId string) error {
return wclayer.UnprepareLayer(layerPath(&info, layerId))
}
type DriverInfo struct {
Flavour int
HomeDir string
}
type FilterLayerReader = wclayer.FilterLayerReader
type FilterLayerWriter = wclayer.FilterLayerWriter
type GUID [16]byte
func NameToGuid(name string) (id GUID, err error) {
g, err := wclayer.NameToGuid(name)
return GUID(g), err
}
func NewGUID(source string) *GUID {
h := sha1.Sum([]byte(source))
var g GUID
copy(g[0:], h[0:16])
return &g
}
func (g *GUID) ToString() string {
return (guid.GUID)(*g).String()
}
type LayerReader = wclayer.LayerReader
func NewLayerReader(info DriverInfo, layerID string, parentLayerPaths []string) (LayerReader, error) {
return wclayer.NewLayerReader(layerPath(&info, layerID), parentLayerPaths)
}
type LayerWriter = wclayer.LayerWriter
func NewLayerWriter(info DriverInfo, layerID string, parentLayerPaths []string) (LayerWriter, error) {
return wclayer.NewLayerWriter(layerPath(&info, layerID), parentLayerPaths)
}
type WC_LAYER_DESCRIPTOR = wclayer.WC_LAYER_DESCRIPTOR

View File

@@ -0,0 +1,938 @@
// Copyright 2013 The Go Authors. All rights reserved.
// Use of this source code is governed by a BSD-style
// license that can be found in the LICENSE file.
// +build ignore
/*
mksyscall_windows generates windows system call bodies
It parses all files specified on command line containing function
prototypes (like syscall_windows.go) and prints system call bodies
to standard output.
The prototypes are marked by lines beginning with "//sys" and read
like func declarations if //sys is replaced by func, but:
* The parameter lists must give a name for each argument. This
includes return parameters.
* The parameter lists must give a type for each argument:
the (x, y, z int) shorthand is not allowed.
* If the return parameter is an error number, it must be named err.
* If go func name needs to be different from it's winapi dll name,
the winapi name could be specified at the end, after "=" sign, like
//sys LoadLibrary(libname string) (handle uint32, err error) = LoadLibraryA
* Each function that returns err needs to supply a condition, that
return value of winapi will be tested against to detect failure.
This would set err to windows "last-error", otherwise it will be nil.
The value can be provided at end of //sys declaration, like
//sys LoadLibrary(libname string) (handle uint32, err error) [failretval==-1] = LoadLibraryA
and is [failretval==0] by default.
Usage:
mksyscall_windows [flags] [path ...]
The flags are:
-output
Specify output file name (outputs to console if blank).
-trace
Generate print statement after every syscall.
*/
package main
import (
"bufio"
"bytes"
"errors"
"flag"
"fmt"
"go/format"
"go/parser"
"go/token"
"io"
"io/ioutil"
"log"
"os"
"path/filepath"
"runtime"
"sort"
"strconv"
"strings"
"text/template"
)
var (
filename = flag.String("output", "", "output file name (standard output if omitted)")
printTraceFlag = flag.Bool("trace", false, "generate print statement after every syscall")
systemDLL = flag.Bool("systemdll", true, "whether all DLLs should be loaded from the Windows system directory")
winio = flag.Bool("winio", false, "import go-winio")
)
func trim(s string) string {
return strings.Trim(s, " \t")
}
var packageName string
func packagename() string {
return packageName
}
func syscalldot() string {
if packageName == "syscall" {
return ""
}
return "syscall."
}
// Param is function parameter
type Param struct {
Name string
Type string
fn *Fn
tmpVarIdx int
}
// tmpVar returns temp variable name that will be used to represent p during syscall.
func (p *Param) tmpVar() string {
if p.tmpVarIdx < 0 {
p.tmpVarIdx = p.fn.curTmpVarIdx
p.fn.curTmpVarIdx++
}
return fmt.Sprintf("_p%d", p.tmpVarIdx)
}
// BoolTmpVarCode returns source code for bool temp variable.
func (p *Param) BoolTmpVarCode() string {
const code = `var %s uint32
if %s {
%s = 1
} else {
%s = 0
}`
tmp := p.tmpVar()
return fmt.Sprintf(code, tmp, p.Name, tmp, tmp)
}
// SliceTmpVarCode returns source code for slice temp variable.
func (p *Param) SliceTmpVarCode() string {
const code = `var %s *%s
if len(%s) > 0 {
%s = &%s[0]
}`
tmp := p.tmpVar()
return fmt.Sprintf(code, tmp, p.Type[2:], p.Name, tmp, p.Name)
}
// StringTmpVarCode returns source code for string temp variable.
func (p *Param) StringTmpVarCode() string {
errvar := p.fn.Rets.ErrorVarName()
if errvar == "" {
errvar = "_"
}
tmp := p.tmpVar()
const code = `var %s %s
%s, %s = %s(%s)`
s := fmt.Sprintf(code, tmp, p.fn.StrconvType(), tmp, errvar, p.fn.StrconvFunc(), p.Name)
if errvar == "-" {
return s
}
const morecode = `
if %s != nil {
return
}`
return s + fmt.Sprintf(morecode, errvar)
}
// TmpVarCode returns source code for temp variable.
func (p *Param) TmpVarCode() string {
switch {
case p.Type == "bool":
return p.BoolTmpVarCode()
case strings.HasPrefix(p.Type, "[]"):
return p.SliceTmpVarCode()
default:
return ""
}
}
// TmpVarHelperCode returns source code for helper's temp variable.
func (p *Param) TmpVarHelperCode() string {
if p.Type != "string" {
return ""
}
return p.StringTmpVarCode()
}
// SyscallArgList returns source code fragments representing p parameter
// in syscall. Slices are translated into 2 syscall parameters: pointer to
// the first element and length.
func (p *Param) SyscallArgList() []string {
t := p.HelperType()
var s string
switch {
case t[0] == '*':
s = fmt.Sprintf("unsafe.Pointer(%s)", p.Name)
case t == "bool":
s = p.tmpVar()
case strings.HasPrefix(t, "[]"):
return []string{
fmt.Sprintf("uintptr(unsafe.Pointer(%s))", p.tmpVar()),
fmt.Sprintf("uintptr(len(%s))", p.Name),
}
default:
s = p.Name
}
return []string{fmt.Sprintf("uintptr(%s)", s)}
}
// IsError determines if p parameter is used to return error.
func (p *Param) IsError() bool {
return p.Name == "err" && p.Type == "error"
}
// HelperType returns type of parameter p used in helper function.
func (p *Param) HelperType() string {
if p.Type == "string" {
return p.fn.StrconvType()
}
return p.Type
}
// join concatenates parameters ps into a string with sep separator.
// Each parameter is converted into string by applying fn to it
// before conversion.
func join(ps []*Param, fn func(*Param) string, sep string) string {
if len(ps) == 0 {
return ""
}
a := make([]string, 0)
for _, p := range ps {
a = append(a, fn(p))
}
return strings.Join(a, sep)
}
// Rets describes function return parameters.
type Rets struct {
Name string
Type string
ReturnsError bool
FailCond string
}
// ErrorVarName returns error variable name for r.
func (r *Rets) ErrorVarName() string {
if r.ReturnsError {
return "err"
}
if r.Type == "error" {
return r.Name
}
return ""
}
// ToParams converts r into slice of *Param.
func (r *Rets) ToParams() []*Param {
ps := make([]*Param, 0)
if len(r.Name) > 0 {
ps = append(ps, &Param{Name: r.Name, Type: r.Type})
}
if r.ReturnsError {
ps = append(ps, &Param{Name: "err", Type: "error"})
}
return ps
}
// List returns source code of syscall return parameters.
func (r *Rets) List() string {
s := join(r.ToParams(), func(p *Param) string { return p.Name + " " + p.Type }, ", ")
if len(s) > 0 {
s = "(" + s + ")"
}
return s
}
// PrintList returns source code of trace printing part correspondent
// to syscall return values.
func (r *Rets) PrintList() string {
return join(r.ToParams(), func(p *Param) string { return fmt.Sprintf(`"%s=", %s, `, p.Name, p.Name) }, `", ", `)
}
// SetReturnValuesCode returns source code that accepts syscall return values.
func (r *Rets) SetReturnValuesCode() string {
if r.Name == "" && !r.ReturnsError {
return ""
}
retvar := "r0"
if r.Name == "" {
retvar = "r1"
}
errvar := "_"
if r.ReturnsError {
errvar = "e1"
}
return fmt.Sprintf("%s, _, %s := ", retvar, errvar)
}
func (r *Rets) useLongHandleErrorCode(retvar string) string {
const code = `if %s {
if e1 != 0 {
err = errnoErr(e1)
} else {
err = %sEINVAL
}
}`
cond := retvar + " == 0"
if r.FailCond != "" {
cond = strings.Replace(r.FailCond, "failretval", retvar, 1)
}
return fmt.Sprintf(code, cond, syscalldot())
}
// SetErrorCode returns source code that sets return parameters.
func (r *Rets) SetErrorCode() string {
const code = `if r0 != 0 {
%s = %sErrno(r0)
}`
const hrCode = `if int32(r0) < 0 {
%s = interop.Win32FromHresult(r0)
}`
if r.Name == "" && !r.ReturnsError {
return ""
}
if r.Name == "" {
return r.useLongHandleErrorCode("r1")
}
if r.Type == "error" {
if r.Name == "hr" {
return fmt.Sprintf(hrCode, r.Name)
} else {
return fmt.Sprintf(code, r.Name, syscalldot())
}
}
s := ""
switch {
case r.Type[0] == '*':
s = fmt.Sprintf("%s = (%s)(unsafe.Pointer(r0))", r.Name, r.Type)
case r.Type == "bool":
s = fmt.Sprintf("%s = r0 != 0", r.Name)
default:
s = fmt.Sprintf("%s = %s(r0)", r.Name, r.Type)
}
if !r.ReturnsError {
return s
}
return s + "\n\t" + r.useLongHandleErrorCode(r.Name)
}
// Fn describes syscall function.
type Fn struct {
Name string
Params []*Param
Rets *Rets
PrintTrace bool
confirmproc bool
dllname string
dllfuncname string
src string
// TODO: get rid of this field and just use parameter index instead
curTmpVarIdx int // insure tmp variables have uniq names
}
// extractParams parses s to extract function parameters.
func extractParams(s string, f *Fn) ([]*Param, error) {
s = trim(s)
if s == "" {
return nil, nil
}
a := strings.Split(s, ",")
ps := make([]*Param, len(a))
for i := range ps {
s2 := trim(a[i])
b := strings.Split(s2, " ")
if len(b) != 2 {
b = strings.Split(s2, "\t")
if len(b) != 2 {
return nil, errors.New("Could not extract function parameter from \"" + s2 + "\"")
}
}
ps[i] = &Param{
Name: trim(b[0]),
Type: trim(b[1]),
fn: f,
tmpVarIdx: -1,
}
}
return ps, nil
}
// extractSection extracts text out of string s starting after start
// and ending just before end. found return value will indicate success,
// and prefix, body and suffix will contain correspondent parts of string s.
func extractSection(s string, start, end rune) (prefix, body, suffix string, found bool) {
s = trim(s)
if strings.HasPrefix(s, string(start)) {
// no prefix
body = s[1:]
} else {
a := strings.SplitN(s, string(start), 2)
if len(a) != 2 {
return "", "", s, false
}
prefix = a[0]
body = a[1]
}
a := strings.SplitN(body, string(end), 2)
if len(a) != 2 {
return "", "", "", false
}
return prefix, a[0], a[1], true
}
// newFn parses string s and return created function Fn.
func newFn(s string) (*Fn, error) {
s = trim(s)
f := &Fn{
Rets: &Rets{},
src: s,
PrintTrace: *printTraceFlag,
}
// function name and args
prefix, body, s, found := extractSection(s, '(', ')')
if !found || prefix == "" {
return nil, errors.New("Could not extract function name and parameters from \"" + f.src + "\"")
}
f.Name = prefix
var err error
f.Params, err = extractParams(body, f)
if err != nil {
return nil, err
}
// return values
_, body, s, found = extractSection(s, '(', ')')
if found {
r, err := extractParams(body, f)
if err != nil {
return nil, err
}
switch len(r) {
case 0:
case 1:
if r[0].IsError() {
f.Rets.ReturnsError = true
} else {
f.Rets.Name = r[0].Name
f.Rets.Type = r[0].Type
}
case 2:
if !r[1].IsError() {
return nil, errors.New("Only last windows error is allowed as second return value in \"" + f.src + "\"")
}
f.Rets.ReturnsError = true
f.Rets.Name = r[0].Name
f.Rets.Type = r[0].Type
default:
return nil, errors.New("Too many return values in \"" + f.src + "\"")
}
}
// fail condition
_, body, s, found = extractSection(s, '[', ']')
if found {
f.Rets.FailCond = body
}
// dll and dll function names
s = trim(s)
if s == "" {
return f, nil
}
if !strings.HasPrefix(s, "=") {
return nil, errors.New("Could not extract dll name from \"" + f.src + "\"")
}
s = trim(s[1:])
a := strings.Split(s, ".")
switch len(a) {
case 1:
f.dllfuncname = a[0]
case 2:
f.dllname = a[0]
f.dllfuncname = a[1]
default:
return nil, errors.New("Could not extract dll name from \"" + f.src + "\"")
}
if f.dllfuncname[len(f.dllfuncname)-1] == '?' {
f.confirmproc = true
f.dllfuncname = f.dllfuncname[0 : len(f.dllfuncname)-1]
}
return f, nil
}
// DLLName returns DLL name for function f.
func (f *Fn) DLLName() string {
if f.dllname == "" {
return "kernel32"
}
return f.dllname
}
// DLLName returns DLL function name for function f.
func (f *Fn) DLLFuncName() string {
if f.dllfuncname == "" {
return f.Name
}
return f.dllfuncname
}
func (f *Fn) ConfirmProc() bool {
return f.confirmproc
}
// ParamList returns source code for function f parameters.
func (f *Fn) ParamList() string {
return join(f.Params, func(p *Param) string { return p.Name + " " + p.Type }, ", ")
}
// HelperParamList returns source code for helper function f parameters.
func (f *Fn) HelperParamList() string {
return join(f.Params, func(p *Param) string { return p.Name + " " + p.HelperType() }, ", ")
}
// ParamPrintList returns source code of trace printing part correspondent
// to syscall input parameters.
func (f *Fn) ParamPrintList() string {
return join(f.Params, func(p *Param) string { return fmt.Sprintf(`"%s=", %s, `, p.Name, p.Name) }, `", ", `)
}
// ParamCount return number of syscall parameters for function f.
func (f *Fn) ParamCount() int {
n := 0
for _, p := range f.Params {
n += len(p.SyscallArgList())
}
return n
}
// SyscallParamCount determines which version of Syscall/Syscall6/Syscall9/...
// to use. It returns parameter count for correspondent SyscallX function.
func (f *Fn) SyscallParamCount() int {
n := f.ParamCount()
switch {
case n <= 3:
return 3
case n <= 6:
return 6
case n <= 9:
return 9
case n <= 12:
return 12
case n <= 15:
return 15
default:
panic("too many arguments to system call")
}
}
// Syscall determines which SyscallX function to use for function f.
func (f *Fn) Syscall() string {
c := f.SyscallParamCount()
if c == 3 {
return syscalldot() + "Syscall"
}
return syscalldot() + "Syscall" + strconv.Itoa(c)
}
// SyscallParamList returns source code for SyscallX parameters for function f.
func (f *Fn) SyscallParamList() string {
a := make([]string, 0)
for _, p := range f.Params {
a = append(a, p.SyscallArgList()...)
}
for len(a) < f.SyscallParamCount() {
a = append(a, "0")
}
return strings.Join(a, ", ")
}
// HelperCallParamList returns source code of call into function f helper.
func (f *Fn) HelperCallParamList() string {
a := make([]string, 0, len(f.Params))
for _, p := range f.Params {
s := p.Name
if p.Type == "string" {
s = p.tmpVar()
}
a = append(a, s)
}
return strings.Join(a, ", ")
}
// IsUTF16 is true, if f is W (utf16) function. It is false
// for all A (ascii) functions.
func (_ *Fn) IsUTF16() bool {
return true
}
// StrconvFunc returns name of Go string to OS string function for f.
func (f *Fn) StrconvFunc() string {
if f.IsUTF16() {
return syscalldot() + "UTF16PtrFromString"
}
return syscalldot() + "BytePtrFromString"
}
// StrconvType returns Go type name used for OS string for f.
func (f *Fn) StrconvType() string {
if f.IsUTF16() {
return "*uint16"
}
return "*byte"
}
// HasStringParam is true, if f has at least one string parameter.
// Otherwise it is false.
func (f *Fn) HasStringParam() bool {
for _, p := range f.Params {
if p.Type == "string" {
return true
}
}
return false
}
var uniqDllFuncName = make(map[string]bool)
// IsNotDuplicate is true if f is not a duplicated function
func (f *Fn) IsNotDuplicate() bool {
funcName := f.DLLFuncName()
if uniqDllFuncName[funcName] == false {
uniqDllFuncName[funcName] = true
return true
}
return false
}
// HelperName returns name of function f helper.
func (f *Fn) HelperName() string {
if !f.HasStringParam() {
return f.Name
}
return "_" + f.Name
}
// Source files and functions.
type Source struct {
Funcs []*Fn
Files []string
StdLibImports []string
ExternalImports []string
}
func (src *Source) Import(pkg string) {
src.StdLibImports = append(src.StdLibImports, pkg)
sort.Strings(src.StdLibImports)
}
func (src *Source) ExternalImport(pkg string) {
src.ExternalImports = append(src.ExternalImports, pkg)
sort.Strings(src.ExternalImports)
}
// ParseFiles parses files listed in fs and extracts all syscall
// functions listed in sys comments. It returns source files
// and functions collection *Source if successful.
func ParseFiles(fs []string) (*Source, error) {
src := &Source{
Funcs: make([]*Fn, 0),
Files: make([]string, 0),
StdLibImports: []string{
"unsafe",
},
ExternalImports: make([]string, 0),
}
for _, file := range fs {
if err := src.ParseFile(file); err != nil {
return nil, err
}
}
return src, nil
}
// DLLs return dll names for a source set src.
func (src *Source) DLLs() []string {
uniq := make(map[string]bool)
r := make([]string, 0)
for _, f := range src.Funcs {
name := f.DLLName()
if _, found := uniq[name]; !found {
uniq[name] = true
r = append(r, name)
}
}
return r
}
// ParseFile adds additional file path to a source set src.
func (src *Source) ParseFile(path string) error {
file, err := os.Open(path)
if err != nil {
return err
}
defer file.Close()
s := bufio.NewScanner(file)
for s.Scan() {
t := trim(s.Text())
if len(t) < 7 {
continue
}
if !strings.HasPrefix(t, "//sys") {
continue
}
t = t[5:]
if !(t[0] == ' ' || t[0] == '\t') {
continue
}
f, err := newFn(t[1:])
if err != nil {
return err
}
src.Funcs = append(src.Funcs, f)
}
if err := s.Err(); err != nil {
return err
}
src.Files = append(src.Files, path)
// get package name
fset := token.NewFileSet()
_, err = file.Seek(0, 0)
if err != nil {
return err
}
pkg, err := parser.ParseFile(fset, "", file, parser.PackageClauseOnly)
if err != nil {
return err
}
packageName = pkg.Name.Name
return nil
}
// IsStdRepo returns true if src is part of standard library.
func (src *Source) IsStdRepo() (bool, error) {
if len(src.Files) == 0 {
return false, errors.New("no input files provided")
}
abspath, err := filepath.Abs(src.Files[0])
if err != nil {
return false, err
}
goroot := runtime.GOROOT()
if runtime.GOOS == "windows" {
abspath = strings.ToLower(abspath)
goroot = strings.ToLower(goroot)
}
sep := string(os.PathSeparator)
if !strings.HasSuffix(goroot, sep) {
goroot += sep
}
return strings.HasPrefix(abspath, goroot), nil
}
// Generate output source file from a source set src.
func (src *Source) Generate(w io.Writer) error {
const (
pkgStd = iota // any package in std library
pkgXSysWindows // x/sys/windows package
pkgOther
)
isStdRepo, err := src.IsStdRepo()
if err != nil {
return err
}
var pkgtype int
switch {
case isStdRepo:
pkgtype = pkgStd
case packageName == "windows":
// TODO: this needs better logic than just using package name
pkgtype = pkgXSysWindows
default:
pkgtype = pkgOther
}
if *systemDLL {
switch pkgtype {
case pkgStd:
src.Import("internal/syscall/windows/sysdll")
case pkgXSysWindows:
default:
src.ExternalImport("golang.org/x/sys/windows")
}
}
src.ExternalImport("github.com/Microsoft/hcsshim/internal/interop")
if *winio {
src.ExternalImport("github.com/Microsoft/go-winio")
}
if packageName != "syscall" {
src.Import("syscall")
}
funcMap := template.FuncMap{
"packagename": packagename,
"syscalldot": syscalldot,
"newlazydll": func(dll string) string {
arg := "\"" + dll + ".dll\""
if !*systemDLL {
return syscalldot() + "NewLazyDLL(" + arg + ")"
}
switch pkgtype {
case pkgStd:
return syscalldot() + "NewLazyDLL(sysdll.Add(" + arg + "))"
case pkgXSysWindows:
return "NewLazySystemDLL(" + arg + ")"
default:
return "windows.NewLazySystemDLL(" + arg + ")"
}
},
}
t := template.Must(template.New("main").Funcs(funcMap).Parse(srcTemplate))
err = t.Execute(w, src)
if err != nil {
return errors.New("Failed to execute template: " + err.Error())
}
return nil
}
func usage() {
fmt.Fprintf(os.Stderr, "usage: mksyscall_windows [flags] [path ...]\n")
flag.PrintDefaults()
os.Exit(1)
}
func main() {
flag.Usage = usage
flag.Parse()
if len(flag.Args()) <= 0 {
fmt.Fprintf(os.Stderr, "no files to parse provided\n")
usage()
}
src, err := ParseFiles(flag.Args())
if err != nil {
log.Fatal(err)
}
var buf bytes.Buffer
if err := src.Generate(&buf); err != nil {
log.Fatal(err)
}
data, err := format.Source(buf.Bytes())
if err != nil {
log.Fatal(err)
}
if *filename == "" {
_, err = os.Stdout.Write(data)
} else {
err = ioutil.WriteFile(*filename, data, 0644)
}
if err != nil {
log.Fatal(err)
}
}
// TODO: use println instead to print in the following template
const srcTemplate = `
{{define "main"}}// MACHINE GENERATED BY 'go generate' COMMAND; DO NOT EDIT
package {{packagename}}
import (
{{range .StdLibImports}}"{{.}}"
{{end}}
{{range .ExternalImports}}"{{.}}"
{{end}}
)
var _ unsafe.Pointer
// Do the interface allocations only once for common
// Errno values.
const (
errnoERROR_IO_PENDING = 997
)
var (
errERROR_IO_PENDING error = {{syscalldot}}Errno(errnoERROR_IO_PENDING)
)
// errnoErr returns common boxed Errno values, to prevent
// allocations at runtime.
func errnoErr(e {{syscalldot}}Errno) error {
switch e {
case 0:
return nil
case errnoERROR_IO_PENDING:
return errERROR_IO_PENDING
}
// TODO: add more here, after collecting data on the common
// error values see on Windows. (perhaps when running
// all.bat?)
return e
}
var (
{{template "dlls" .}}
{{template "funcnames" .}})
{{range .Funcs}}{{if .HasStringParam}}{{template "helperbody" .}}{{end}}{{template "funcbody" .}}{{end}}
{{end}}
{{/* help functions */}}
{{define "dlls"}}{{range .DLLs}} mod{{.}} = {{newlazydll .}}
{{end}}{{end}}
{{define "funcnames"}}{{range .Funcs}}{{if .IsNotDuplicate}} proc{{.DLLFuncName}} = mod{{.DLLName}}.NewProc("{{.DLLFuncName}}"){{end}}
{{end}}{{end}}
{{define "helperbody"}}
func {{.Name}}({{.ParamList}}) {{template "results" .}}{
{{template "helpertmpvars" .}} return {{.HelperName}}({{.HelperCallParamList}})
}
{{end}}
{{define "funcbody"}}
func {{.HelperName}}({{.HelperParamList}}) {{template "results" .}}{
{{template "tmpvars" .}} {{template "syscallcheck" .}}{{template "syscall" .}}
{{template "seterror" .}}{{template "printtrace" .}} return
}
{{end}}
{{define "helpertmpvars"}}{{range .Params}}{{if .TmpVarHelperCode}} {{.TmpVarHelperCode}}
{{end}}{{end}}{{end}}
{{define "tmpvars"}}{{range .Params}}{{if .TmpVarCode}} {{.TmpVarCode}}
{{end}}{{end}}{{end}}
{{define "results"}}{{if .Rets.List}}{{.Rets.List}} {{end}}{{end}}
{{define "syscall"}}{{.Rets.SetReturnValuesCode}}{{.Syscall}}(proc{{.DLLFuncName}}.Addr(), {{.ParamCount}}, {{.SyscallParamList}}){{end}}
{{define "syscallcheck"}}{{if .ConfirmProc}}if {{.Rets.ErrorVarName}} = proc{{.DLLFuncName}}.Find(); {{.Rets.ErrorVarName}} != nil {
return
}
{{end}}{{end}}
{{define "seterror"}}{{if .Rets.SetErrorCode}} {{.Rets.SetErrorCode}}
{{end}}{{end}}
{{define "printtrace"}}{{if .PrintTrace}} print("SYSCALL: {{.Name}}(", {{.ParamPrintList}}") (", {{.Rets.PrintList}}")\n")
{{end}}{{end}}
`

72
vendor/github.com/Microsoft/hcsshim/process.go generated vendored Normal file
View File

@@ -0,0 +1,72 @@
package hcsshim
import (
"io"
"time"
"github.com/Microsoft/hcsshim/internal/hcs"
)
// ContainerError is an error encountered in HCS
type process struct {
p *hcs.Process
}
// Pid returns the process ID of the process within the container.
func (process *process) Pid() int {
return process.p.Pid()
}
// Kill signals the process to terminate but does not wait for it to finish terminating.
func (process *process) Kill() error {
return convertProcessError(process.p.Kill(), process)
}
// Wait waits for the process to exit.
func (process *process) Wait() error {
return convertProcessError(process.p.Wait(), process)
}
// WaitTimeout waits for the process to exit or the duration to elapse. It returns
// false if timeout occurs.
func (process *process) WaitTimeout(timeout time.Duration) error {
return convertProcessError(process.p.WaitTimeout(timeout), process)
}
// ExitCode returns the exit code of the process. The process must have
// already terminated.
func (process *process) ExitCode() (int, error) {
code, err := process.p.ExitCode()
if err != nil {
err = convertProcessError(err, process)
}
return code, err
}
// ResizeConsole resizes the console of the process.
func (process *process) ResizeConsole(width, height uint16) error {
return convertProcessError(process.p.ResizeConsole(width, height), process)
}
// Stdio returns the stdin, stdout, and stderr pipes, respectively. Closing
// these pipes does not close the underlying pipes; it should be possible to
// call this multiple times to get multiple interfaces.
func (process *process) Stdio() (io.WriteCloser, io.ReadCloser, io.ReadCloser, error) {
stdin, stdout, stderr, err := process.p.Stdio()
if err != nil {
err = convertProcessError(err, process)
}
return stdin, stdout, stderr, err
}
// CloseStdin closes the write side of the stdin pipe so that the process is
// notified on the read side that there is no more data in stdin.
func (process *process) CloseStdin() error {
return convertProcessError(process.p.CloseStdin(), process)
}
// Close cleans up any state associated with the process but does not kill
// or wait on it.
func (process *process) Close() error {
return convertProcessError(process.p.Close(), process)
}

6
vendor/github.com/Microsoft/hcsshim/version.go generated vendored Normal file
View File

@@ -0,0 +1,6 @@
package hcsshim
// IsTP4 returns whether the currently running Windows build is at least TP4.
func IsTP4() bool {
return false
}

View File

@@ -0,0 +1,52 @@
// MACHINE GENERATED BY 'go generate' COMMAND; DO NOT EDIT
package hcsshim
import (
"syscall"
"unsafe"
"github.com/Microsoft/hcsshim/internal/interop"
"golang.org/x/sys/windows"
)
var _ unsafe.Pointer
// Do the interface allocations only once for common
// Errno values.
const (
errnoERROR_IO_PENDING = 997
)
var (
errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING)
)
// errnoErr returns common boxed Errno values, to prevent
// allocations at runtime.
func errnoErr(e syscall.Errno) error {
switch e {
case 0:
return nil
case errnoERROR_IO_PENDING:
return errERROR_IO_PENDING
}
// TODO: add more here, after collecting data on the common
// error values see on Windows. (perhaps when running
// all.bat?)
return e
}
var (
modiphlpapi = windows.NewLazySystemDLL("iphlpapi.dll")
procSetCurrentThreadCompartmentId = modiphlpapi.NewProc("SetCurrentThreadCompartmentId")
)
func SetCurrentThreadCompartmentId(compartmentId uint32) (hr error) {
r0, _, _ := syscall.Syscall(procSetCurrentThreadCompartmentId.Addr(), 1, uintptr(compartmentId), 0, 0)
if int32(r0) < 0 {
hr = interop.Win32FromHresult(r0)
}
return
}

10
vendor/github.com/buger/jsonparser/.gitignore generated vendored Normal file
View File

@@ -0,0 +1,10 @@
*.test
*.out
*.mprof
vendor/github.com/buger/goterm/
prof.cpu
prof.mem

3
vendor/github.com/buger/jsonparser/.travis.yml generated vendored Normal file
View File

@@ -0,0 +1,3 @@
language: go
go: 1.7
script: go test -v ./.

12
vendor/github.com/buger/jsonparser/Dockerfile generated vendored Normal file
View File

@@ -0,0 +1,12 @@
FROM golang:1.6
RUN go get github.com/Jeffail/gabs
RUN go get github.com/bitly/go-simplejson
RUN go get github.com/pquerna/ffjson
RUN go get github.com/antonholmquist/jason
RUN go get github.com/mreiferson/go-ujson
RUN go get -tags=unsafe -u github.com/ugorji/go/codec
RUN go get github.com/mailru/easyjson
WORKDIR /go/src/github.com/buger/jsonparser
ADD . /go/src/github.com/buger/jsonparser

21
vendor/github.com/buger/jsonparser/LICENSE generated vendored Normal file
View File

@@ -0,0 +1,21 @@
MIT License
Copyright (c) 2016 Leonid Bugaev
Permission is hereby granted, free of charge, to any person obtaining a copy
of this software and associated documentation files (the "Software"), to deal
in the Software without restriction, including without limitation the rights
to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
copies of the Software, and to permit persons to whom the Software is
furnished to do so, subject to the following conditions:
The above copyright notice and this permission notice shall be included in all
copies or substantial portions of the Software.
THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
SOFTWARE.

36
vendor/github.com/buger/jsonparser/Makefile generated vendored Normal file
View File

@@ -0,0 +1,36 @@
SOURCE = parser.go
CONTAINER = jsonparser
SOURCE_PATH = /go/src/github.com/buger/jsonparser
BENCHMARK = JsonParser
BENCHTIME = 5s
TEST = .
DRUN = docker run -v `pwd`:$(SOURCE_PATH) -i -t $(CONTAINER)
build:
docker build -t $(CONTAINER) .
race:
$(DRUN) --env GORACE="halt_on_error=1" go test ./. $(ARGS) -v -race -timeout 15s
bench:
$(DRUN) go test $(LDFLAGS) -test.benchmem -bench $(BENCHMARK) ./benchmark/ $(ARGS) -benchtime $(BENCHTIME) -v
bench_local:
$(DRUN) go test $(LDFLAGS) -test.benchmem -bench . $(ARGS) -benchtime $(BENCHTIME) -v
profile:
$(DRUN) go test $(LDFLAGS) -test.benchmem -bench $(BENCHMARK) ./benchmark/ $(ARGS) -memprofile mem.mprof -v
$(DRUN) go test $(LDFLAGS) -test.benchmem -bench $(BENCHMARK) ./benchmark/ $(ARGS) -cpuprofile cpu.out -v
$(DRUN) go test $(LDFLAGS) -test.benchmem -bench $(BENCHMARK) ./benchmark/ $(ARGS) -c
test:
$(DRUN) go test $(LDFLAGS) ./ -run $(TEST) -timeout 10s $(ARGS) -v
fmt:
$(DRUN) go fmt ./...
vet:
$(DRUN) go vet ./.
bash:
$(DRUN) /bin/bash

365
vendor/github.com/buger/jsonparser/README.md generated vendored Normal file
View File

@@ -0,0 +1,365 @@
[![Go Report Card](https://goreportcard.com/badge/github.com/buger/jsonparser)](https://goreportcard.com/report/github.com/buger/jsonparser) ![License](https://img.shields.io/dub/l/vibe-d.svg)
# Alternative JSON parser for Go (so far fastest)
It does not require you to know the structure of the payload (eg. create structs), and allows accessing fields by providing the path to them. It is up to **10 times faster** than standard `encoding/json` package (depending on payload size and usage), **allocates no memory**. See benchmarks below.
## Rationale
Originally I made this for a project that relies on a lot of 3rd party APIs that can be unpredictable and complex.
I love simplicity and prefer to avoid external dependecies. `encoding/json` requires you to know exactly your data structures, or if you prefer to use `map[string]interface{}` instead, it will be very slow and hard to manage.
I investigated what's on the market and found that most libraries are just wrappers around `encoding/json`, there is few options with own parsers (`ffjson`, `easyjson`), but they still requires you to create data structures.
Goal of this project is to push JSON parser to the performance limits and not sacrifice with compliance and developer user experience.
## Example
For the given JSON our goal is to extract the user's full name, number of github followers and avatar.
```go
import "github.com/buger/jsonparser"
...
data := []byte(`{
"person": {
"name": {
"first": "Leonid",
"last": "Bugaev",
"fullName": "Leonid Bugaev"
},
"github": {
"handle": "buger",
"followers": 109
},
"avatars": [
{ "url": "https://avatars1.githubusercontent.com/u/14009?v=3&s=460", "type": "thumbnail" }
]
},
"company": {
"name": "Acme"
}
}`)
// You can specify key path by providing arguments to Get function
jsonparser.Get(data, "person", "name", "fullName")
// There is `GetInt` and `GetBoolean` helpers if you exactly know key data type
jsonparser.GetInt(data, "person", "github", "followers")
// When you try to get object, it will return you []byte slice pointer to data containing it
// In `company` it will be `{"name": "Acme"}`
jsonparser.Get(data, "company")
// If the key doesn't exist it will throw an error
var size int64
if value, err := jsonparser.GetInt(data, "company", "size"); err == nil {
size = value
}
// You can use `ArrayEach` helper to iterate items [item1, item2 .... itemN]
jsonparser.ArrayEach(data, func(value []byte, dataType jsonparser.ValueType, offset int, err error) {
fmt.Println(jsonparser.Get(value, "url"))
}, "person", "avatars")
// Or use can access fields by index!
jsonparser.GetInt("person", "avatars", "[0]", "url")
// You can use `ObjectEach` helper to iterate objects { "key1":object1, "key2":object2, .... "keyN":objectN }
jsonparser.ObjectEach(data, func(key []byte, value []byte, dataType jsonparser.ValueType, offset int) error {
fmt.Printf("Key: '%s'\n Value: '%s'\n Type: %s\n", string(key), string(value), dataType)
return nil
}, "person", "name")
// The most efficient way to extract multiple keys is `EachKey`
paths := [][]string{
[]string{"person", "name", "fullName"},
[]string{"person", "avatars", "[0]", "url"},
[]string{"company", "url"},
}
jsonparser.EachKey(data, func(idx int, value []byte, vt jsonparser.ValueType, err error){
switch idx {
case 0: // []string{"person", "name", "fullName"}
...
case 1: // []string{"person", "avatars", "[0]", "url"}
...
case 2: // []string{"company", "url"},
...
}
}, paths...)
// For more information see docs below
```
## Need to speedup your app?
I'm available for consulting and can help you push your app performance to the limits. Ping me at: leonsbox@gmail.com.
## Reference
Library API is really simple. You just need the `Get` method to perform any operation. The rest is just helpers around it.
You also can view API at [godoc.org](https://godoc.org/github.com/buger/jsonparser)
### **`Get`**
```go
func Get(data []byte, keys ...string) (value []byte, dataType jsonparser.ValueType, offset int, err error)
```
Receives data structure, and key path to extract value from.
Returns:
* `value` - Pointer to original data structure containing key value, or just empty slice if nothing found or error
* `dataType` - Can be: `NotExist`, `String`, `Number`, `Object`, `Array`, `Boolean` or `Null`
* `offset` - Offset from provided data structure where key value ends. Used mostly internally, for example for `ArrayEach` helper.
* `err` - If the key is not found or any other parsing issue, it should return error. If key not found it also sets `dataType` to `NotExist`
Accepts multiple keys to specify path to JSON value (in case of quering nested structures).
If no keys are provided it will try to extract the closest JSON value (simple ones or object/array), useful for reading streams or arrays, see `ArrayEach` implementation.
Note that keys can be an array indexes: `jsonparser.GetInt("person", "avatars", "[0]", "url")`, pretty cool, yeah?
### **`GetString`**
```go
func GetString(data []byte, keys ...string) (val string, err error)
```
Returns strings properly handing escaped and unicode characters. Note that this will cause additional memory allocations.
### **`GetUnsafeString`**
If you need string in your app, and ready to sacrifice with support of escaped symbols in favor of speed. It returns string mapped to existing byte slice memory, without any allocations:
```go
s, _, := jsonparser.GetUnsafeString(data, "person", "name", "title")
switch s {
case 'CEO':
...
case 'Engineer'
...
...
}
```
Note that `unsafe` here means that your string will exist until GC will free underlying byte slice, for most of cases it means that you can use this string only in current context, and should not pass it anywhere externally: through channels or any other way.
### **`GetBoolean`**, **`GetInt`** and **`GetFloat`**
```go
func GetBoolean(data []byte, keys ...string) (val bool, err error)
func GetFloat(data []byte, keys ...string) (val float64, err error)
func GetInt(data []byte, keys ...string) (val int64, err error)
```
If you know the key type, you can use the helpers above.
If key data type do not match, it will return error.
### **`ArrayEach`**
```go
func ArrayEach(data []byte, cb func(value []byte, dataType jsonparser.ValueType, offset int, err error), keys ...string)
```
Needed for iterating arrays, accepts a callback function with the same return arguments as `Get`.
### **`ObjectEach`**
```go
func ObjectEach(data []byte, callback func(key []byte, value []byte, dataType ValueType, offset int) error, keys ...string) (err error)
```
Needed for iterating object, accepts a callback function. Example:
```go
var handler func([]byte, []byte, jsonparser.ValueType, int) error
handler = func(key []byte, value []byte, dataType jsonparser.ValueType, offset int) error {
//do stuff here
}
jsonparser.ObjectEach(myJson, handler)
```
### **`EachKey`**
```go
func EachKey(data []byte, cb func(idx int, value []byte, dataType jsonparser.ValueType, err error), paths ...[]string)
```
When you need to read multiple keys, and you do not afraid of low-level API `EachKey` is your friend. It read payload only single time, and calls callback function once path is found. For example when you call multiple times `Get`, it has to process payload multiple times, each time you call it. Depending on payload `EachKey` can be multiple times faster than `Get`. Path can use nested keys as well!
```go
paths := [][]string{
[]string{"uuid"},
[]string{"tz"},
[]string{"ua"},
[]string{"st"},
}
var data SmallPayload
jsonparser.EachKey(smallFixture, func(idx int, value []byte, vt jsonparser.ValueType, err error){
switch idx {
case 0:
data.Uuid, _ = value
case 1:
v, _ := jsonparser.ParseInt(value)
data.Tz = int(v)
case 2:
data.Ua, _ = value
case 3:
v, _ := jsonparser.ParseInt(value)
data.St = int(v)
}
}, paths...)
```
### **`Set`**
```go
func Set(data []byte, setValue []byte, keys ...string) (value []byte, err error)
```
Receives existing data structure, key path to set, and value to set at that key. *This functionality is experimental.*
Returns:
* `value` - Pointer to original data structure with updated or added key value.
* `err` - If any parsing issue, it should return error.
Accepts multiple keys to specify path to JSON value (in case of updating or creating nested structures).
Note that keys can be an array indexes: `jsonparser.Set(data, []byte("http://github.com"), "person", "avatars", "[0]", "url")`
### **`Delete`**
```go
func Delete(data []byte, keys ...string) value []byte
```
Receives existing data structure, and key path to delete. *This functionality is experimental.*
Returns:
* `value` - Pointer to original data structure with key path deleted if it can be found. If there is no key path, then the whole data structure is deleted.
Accepts multiple keys to specify path to JSON value (in case of updating or creating nested structures).
Note that keys can be an array indexes: `jsonparser.Delete(data, "person", "avatars", "[0]", "url")`
## What makes it so fast?
* It does not rely on `encoding/json`, `reflection` or `interface{}`, the only real package dependency is `bytes`.
* Operates with JSON payload on byte level, providing you pointers to the original data structure: no memory allocation.
* No automatic type conversions, by default everything is a []byte, but it provides you value type, so you can convert by yourself (there is few helpers included).
* Does not parse full record, only keys you specified
## Benchmarks
There are 3 benchmark types, trying to simulate real-life usage for small, medium and large JSON payloads.
For each metric, the lower value is better. Time/op is in nanoseconds. Values better than standard encoding/json marked as bold text.
Benchmarks run on standard Linode 1024 box.
Compared libraries:
* https://golang.org/pkg/encoding/json
* https://github.com/Jeffail/gabs
* https://github.com/a8m/djson
* https://github.com/bitly/go-simplejson
* https://github.com/antonholmquist/jason
* https://github.com/mreiferson/go-ujson
* https://github.com/ugorji/go/codec
* https://github.com/pquerna/ffjson
* https://github.com/mailru/easyjson
* https://github.com/buger/jsonparser
#### TLDR
If you want to skip next sections we have 2 winner: `jsonparser` and `easyjson`.
`jsonparser` is up to 10 times faster than standard `encoding/json` package (depending on payload size and usage), and almost infinitely (literally) better in memory consumption because it operates with data on byte level, and provide direct slice pointers.
`easyjson` wins in CPU in medium tests and frankly i'm impressed with this package: it is remarkable results considering that it is almost drop-in replacement for `encoding/json` (require some code generation).
It's hard to fully compare `jsonparser` and `easyjson` (or `ffson`), they a true parsers and fully process record, unlike `jsonparser` which parse only keys you specified.
If you searching for replacement of `encoding/json` while keeping structs, `easyjson` is an amazing choice. If you want to process dynamic JSON, have memory constrains, or more control over your data you should try `jsonparser`.
`jsonparser` performance heavily depends on usage, and it works best when you do not need to process full record, only some keys. The more calls you need to make, the slower it will be, in contrast `easyjson` (or `ffjson`, `encoding/json`) parser record only 1 time, and then you can make as many calls as you want.
With great power comes great responsibility! :)
#### Small payload
Each test processes 190 bytes of http log as a JSON record.
It should read multiple fields.
https://github.com/buger/jsonparser/blob/master/benchmark/benchmark_small_payload_test.go
Library | time/op | bytes/op | allocs/op
------ | ------- | -------- | -------
encoding/json struct | 7879 | 880 | 18
encoding/json interface{} | 8946 | 1521 | 38
Jeffail/gabs | 10053 | 1649 | 46
bitly/go-simplejson | 10128 | 2241 | 36
antonholmquist/jason | 27152 | 7237 | 101
github.com/ugorji/go/codec | 8806 | 2176 | 31
mreiferson/go-ujson | **7008** | **1409** | 37
a8m/djson | 3862 | 1249 | 30
pquerna/ffjson | **3769** | **624** | **15**
mailru/easyjson | **2002** | **192** | **9**
buger/jsonparser | **1367** | **0** | **0**
buger/jsonparser (EachKey API) | **809** | **0** | **0**
Winners are ffjson, easyjson and jsonparser, where jsonparser is up to 9.8x faster than encoding/json and 4.6x faster than ffjson, and slightly faster than easyjson.
If you look at memory allocation, jsonparser has no rivals, as it makes no data copy and operates with raw []byte structures and pointers to it.
#### Medium payload
Each test processes a 2.4kb JSON record (based on Clearbit API).
It should read multiple nested fields and 1 array.
https://github.com/buger/jsonparser/blob/master/benchmark/benchmark_medium_payload_test.go
| Library | time/op | bytes/op | allocs/op |
| ------- | ------- | -------- | --------- |
| encoding/json struct | 57749 | 1336 | 29 |
| encoding/json interface{} | 79297 | 10627 | 215 |
| Jeffail/gabs | 83807 | 11202 | 235 |
| bitly/go-simplejson | 88187 | 17187 | 220 |
| antonholmquist/jason | 94099 | 19013 | 247 |
| github.com/ugorji/go/codec | 114719 | 6712 | 152 |
| mreiferson/go-ujson | **56972** | 11547 | 270 |
| a8m/djson | 28525 | 10196 | 198 |
| pquerna/ffjson | **20298** | **856** | **20** |
| mailru/easyjson | **10512** | **336** | **12** |
| buger/jsonparser | **15955** | **0** | **0** |
| buger/jsonparser (EachKey API) | **8916** | **0** | **0** |
The difference between ffjson and jsonparser in CPU usage is smaller, while the memory consumption difference is growing. On the other hand `easyjson` shows remarkable performance for medium payload.
`gabs`, `go-simplejson` and `jason` are based on encoding/json and map[string]interface{} and actually only helpers for unstructured JSON, their performance correlate with `encoding/json interface{}`, and they will skip next round.
`go-ujson` while have its own parser, shows same performance as `encoding/json`, also skips next round. Same situation with `ugorji/go/codec`, but it showed unexpectedly bad performance for complex payloads.
#### Large payload
Each test processes a 24kb JSON record (based on Discourse API)
It should read 2 arrays, and for each item in array get a few fields.
Basically it means processing a full JSON file.
https://github.com/buger/jsonparser/blob/master/benchmark/benchmark_large_payload_test.go
| Library | time/op | bytes/op | allocs/op |
| --- | --- | --- | --- |
| encoding/json struct | 748336 | 8272 | 307 |
| encoding/json interface{} | 1224271 | 215425 | 3395 |
| a8m/djson | 510082 | 213682 | 2845 |
| pquerna/ffjson | **312271** | **7792** | **298** |
| mailru/easyjson | **154186** | **6992** | **288** |
| buger/jsonparser | **85308** | **0** | **0** |
`jsonparser` now is a winner, but do not forget that it is way more lightweight parser than `ffson` or `easyjson`, and they have to parser all the data, while `jsonparser` parse only what you need. All `ffjson`, `easysjon` and `jsonparser` have their own parsing code, and does not depend on `encoding/json` or `interface{}`, thats one of the reasons why they are so fast. `easyjson` also use a bit of `unsafe` package to reduce memory consuption (in theory it can lead to some unexpected GC issue, but i did not tested enough)
Also last benchmark did not included `EachKey` test, because in this particular case we need to read lot of Array values, and using `ArrayEach` is more efficient.
## Questions and support
All bug-reports and suggestions should go though Github Issues.
## Contributing
1. Fork it
2. Create your feature branch (git checkout -b my-new-feature)
3. Commit your changes (git commit -am 'Added some feature')
4. Push to the branch (git push origin my-new-feature)
5. Create new Pull Request
## Development
All my development happens using Docker, and repo include some Make tasks to simplify development.
* `make build` - builds docker image, usually can be called only once
* `make test` - run tests
* `make fmt` - run go fmt
* `make bench` - run benchmarks (if you need to run only single benchmark modify `BENCHMARK` variable in make file)
* `make profile` - runs benchmark and generate 3 files- `cpu.out`, `mem.mprof` and `benchmark.test` binary, which can be used for `go tool pprof`
* `make bash` - enter container (i use it for running `go tool pprof` above)

28
vendor/github.com/buger/jsonparser/bytes.go generated vendored Normal file
View File

@@ -0,0 +1,28 @@
package jsonparser
// About 3x faster then strconv.ParseInt because does not check for range error and support only base 10, which is enough for JSON
func parseInt(bytes []byte) (v int64, ok bool) {
if len(bytes) == 0 {
return 0, false
}
var neg bool = false
if bytes[0] == '-' {
neg = true
bytes = bytes[1:]
}
for _, c := range bytes {
if c >= '0' && c <= '9' {
v = (10 * v) + int64(c-'0')
} else {
return 0, false
}
}
if neg {
return -v, true
} else {
return v, true
}
}

25
vendor/github.com/buger/jsonparser/bytes_safe.go generated vendored Normal file
View File

@@ -0,0 +1,25 @@
// +build appengine appenginevm
package jsonparser
import (
"strconv"
)
// See fastbytes_unsafe.go for explanation on why *[]byte is used (signatures must be consistent with those in that file)
func equalStr(b *[]byte, s string) bool {
return string(*b) == s
}
func parseFloat(b *[]byte) (float64, error) {
return strconv.ParseFloat(string(*b), 64)
}
func bytesToString(b *[]byte) string {
return string(*b)
}
func StringToBytes(s string) []byte {
return []byte(s)
}

42
vendor/github.com/buger/jsonparser/bytes_unsafe.go generated vendored Normal file
View File

@@ -0,0 +1,42 @@
// +build !appengine,!appenginevm
package jsonparser
import (
"reflect"
"strconv"
"unsafe"
)
//
// The reason for using *[]byte rather than []byte in parameters is an optimization. As of Go 1.6,
// the compiler cannot perfectly inline the function when using a non-pointer slice. That is,
// the non-pointer []byte parameter version is slower than if its function body is manually
// inlined, whereas the pointer []byte version is equally fast to the manually inlined
// version. Instruction count in assembly taken from "go tool compile" confirms this difference.
//
// TODO: Remove hack after Go 1.7 release
//
func equalStr(b *[]byte, s string) bool {
return *(*string)(unsafe.Pointer(b)) == s
}
func parseFloat(b *[]byte) (float64, error) {
return strconv.ParseFloat(*(*string)(unsafe.Pointer(b)), 64)
}
// A hack until issue golang/go#2632 is fixed.
// See: https://github.com/golang/go/issues/2632
func bytesToString(b *[]byte) string {
return *(*string)(unsafe.Pointer(b))
}
func StringToBytes(s string) []byte {
sh := (*reflect.StringHeader)(unsafe.Pointer(&s))
bh := reflect.SliceHeader{
Data: sh.Data,
Len: sh.Len,
Cap: sh.Len,
}
return *(*[]byte)(unsafe.Pointer(&bh))
}

173
vendor/github.com/buger/jsonparser/escape.go generated vendored Normal file
View File

@@ -0,0 +1,173 @@
package jsonparser
import (
"bytes"
"unicode/utf8"
)
// JSON Unicode stuff: see https://tools.ietf.org/html/rfc7159#section-7
const supplementalPlanesOffset = 0x10000
const highSurrogateOffset = 0xD800
const lowSurrogateOffset = 0xDC00
const basicMultilingualPlaneReservedOffset = 0xDFFF
const basicMultilingualPlaneOffset = 0xFFFF
func combineUTF16Surrogates(high, low rune) rune {
return supplementalPlanesOffset + (high-highSurrogateOffset)<<10 + (low - lowSurrogateOffset)
}
const badHex = -1
func h2I(c byte) int {
switch {
case c >= '0' && c <= '9':
return int(c - '0')
case c >= 'A' && c <= 'F':
return int(c - 'A' + 10)
case c >= 'a' && c <= 'f':
return int(c - 'a' + 10)
}
return badHex
}
// decodeSingleUnicodeEscape decodes a single \uXXXX escape sequence. The prefix \u is assumed to be present and
// is not checked.
// In JSON, these escapes can either come alone or as part of "UTF16 surrogate pairs" that must be handled together.
// This function only handles one; decodeUnicodeEscape handles this more complex case.
func decodeSingleUnicodeEscape(in []byte) (rune, bool) {
// We need at least 6 characters total
if len(in) < 6 {
return utf8.RuneError, false
}
// Convert hex to decimal
h1, h2, h3, h4 := h2I(in[2]), h2I(in[3]), h2I(in[4]), h2I(in[5])
if h1 == badHex || h2 == badHex || h3 == badHex || h4 == badHex {
return utf8.RuneError, false
}
// Compose the hex digits
return rune(h1<<12 + h2<<8 + h3<<4 + h4), true
}
// isUTF16EncodedRune checks if a rune is in the range for non-BMP characters,
// which is used to describe UTF16 chars.
// Source: https://en.wikipedia.org/wiki/Plane_(Unicode)#Basic_Multilingual_Plane
func isUTF16EncodedRune(r rune) bool {
return highSurrogateOffset <= r && r <= basicMultilingualPlaneReservedOffset
}
func decodeUnicodeEscape(in []byte) (rune, int) {
if r, ok := decodeSingleUnicodeEscape(in); !ok {
// Invalid Unicode escape
return utf8.RuneError, -1
} else if r <= basicMultilingualPlaneOffset && !isUTF16EncodedRune(r) {
// Valid Unicode escape in Basic Multilingual Plane
return r, 6
} else if r2, ok := decodeSingleUnicodeEscape(in[6:]); !ok { // Note: previous decodeSingleUnicodeEscape success guarantees at least 6 bytes remain
// UTF16 "high surrogate" without manditory valid following Unicode escape for the "low surrogate"
return utf8.RuneError, -1
} else if r2 < lowSurrogateOffset {
// Invalid UTF16 "low surrogate"
return utf8.RuneError, -1
} else {
// Valid UTF16 surrogate pair
return combineUTF16Surrogates(r, r2), 12
}
}
// backslashCharEscapeTable: when '\X' is found for some byte X, it is to be replaced with backslashCharEscapeTable[X]
var backslashCharEscapeTable = [...]byte{
'"': '"',
'\\': '\\',
'/': '/',
'b': '\b',
'f': '\f',
'n': '\n',
'r': '\r',
't': '\t',
}
// unescapeToUTF8 unescapes the single escape sequence starting at 'in' into 'out' and returns
// how many characters were consumed from 'in' and emitted into 'out'.
// If a valid escape sequence does not appear as a prefix of 'in', (-1, -1) to signal the error.
func unescapeToUTF8(in, out []byte) (inLen int, outLen int) {
if len(in) < 2 || in[0] != '\\' {
// Invalid escape due to insufficient characters for any escape or no initial backslash
return -1, -1
}
// https://tools.ietf.org/html/rfc7159#section-7
switch e := in[1]; e {
case '"', '\\', '/', 'b', 'f', 'n', 'r', 't':
// Valid basic 2-character escapes (use lookup table)
out[0] = backslashCharEscapeTable[e]
return 2, 1
case 'u':
// Unicode escape
if r, inLen := decodeUnicodeEscape(in); inLen == -1 {
// Invalid Unicode escape
return -1, -1
} else {
// Valid Unicode escape; re-encode as UTF8
outLen := utf8.EncodeRune(out, r)
return inLen, outLen
}
}
return -1, -1
}
// unescape unescapes the string contained in 'in' and returns it as a slice.
// If 'in' contains no escaped characters:
// Returns 'in'.
// Else, if 'out' is of sufficient capacity (guaranteed if cap(out) >= len(in)):
// 'out' is used to build the unescaped string and is returned with no extra allocation
// Else:
// A new slice is allocated and returned.
func Unescape(in, out []byte) ([]byte, error) {
firstBackslash := bytes.IndexByte(in, '\\')
if firstBackslash == -1 {
return in, nil
}
// Get a buffer of sufficient size (allocate if needed)
if cap(out) < len(in) {
out = make([]byte, len(in))
} else {
out = out[0:len(in)]
}
// Copy the first sequence of unescaped bytes to the output and obtain a buffer pointer (subslice)
copy(out, in[:firstBackslash])
in = in[firstBackslash:]
buf := out[firstBackslash:]
for len(in) > 0 {
// Unescape the next escaped character
inLen, bufLen := unescapeToUTF8(in, buf)
if inLen == -1 {
return nil, MalformedStringEscapeError
}
in = in[inLen:]
buf = buf[bufLen:]
// Copy everything up until the next backslash
nextBackslash := bytes.IndexByte(in, '\\')
if nextBackslash == -1 {
copy(buf, in)
buf = buf[len(in):]
break
} else {
copy(buf, in[:nextBackslash])
buf = buf[nextBackslash:]
in = in[nextBackslash:]
}
}
// Trim the out buffer to the amount that was actually emitted
return out[:len(out)-len(buf)], nil
}

1191
vendor/github.com/buger/jsonparser/parser.go generated vendored Normal file

File diff suppressed because it is too large Load Diff

View File

@@ -1,51 +0,0 @@
package leasepool
import (
"encoding/json"
"net"
"testing"
"time"
)
/*
* The Leases are Marshalled and Unmarshalled for storage.
* I JSON Marshal these for gvklite
*/
func TestMarshaling(test *testing.T) {
var err error
startLease := Lease{}
startLease.IP = net.IPv4(192, 168, 0, 1)
startLease.Hostname = "ExampleHostname"
startLease.Status = Active
startLease.Expiry = time.Now()
startLease.MACAddress, err = net.ParseMAC("01:23:45:67:89:ab")
if err != nil {
test.Error("Error Parsing Mac Address:" + err.Error())
}
byteStartLease, err := json.Marshal(startLease)
if err != nil {
test.Error("Error Marshaling to JSON:" + err.Error())
}
test.Log("StartLease As JSON:" + string(byteStartLease))
endLease := Lease{}
err = json.Unmarshal(byteStartLease, &endLease)
if err != nil {
test.Error("Error Unmarshaling to JSON:" + err.Error())
}
test.Logf("End Lease Object:%v\n", endLease)
if !startLease.Equal(endLease) {
byteEndLease, err := json.Marshal(endLease)
if err != nil {
test.Error("Can't Marshal End Lease For Debuging:" + err.Error())
}
test.Log("End Lease as JSON:" + string(byteEndLease))
test.Error("Starting Lease Doesn't Match End Lease")
}
}

View File

@@ -104,7 +104,7 @@ func (t *MemoryPool) GetNextFreeLease() (bool, leasepool.Lease, error) {
defer t.poolLock.Unlock()
//Loop Through the elements backwards.
for i := (len(t.pool) - 1); i >= 0; i-- {
for i := (len(t.pool) - 1); i > 0; i-- {
//If the Lease Is Free
if t.pool[i].Status == leasepool.Free {
//Take the Element

Some files were not shown because too many files have changed in this diff Show More